{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9f1dd5b3-f9af-4ea4-a529-0624274ccab4",
          "code": "697-18-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=697-18-7",
          "code_system": "CAS",
          "references": [
            "a2b1aca1-9784-4254-8a34-2a249e2669f7",
            "123aba57-453d-42da-80c8-c53bfb6f41cf"
          ]
        },
        {
          "uuid": "99ba4b53-0828-4457-8e0e-acc034c4a1be",
          "code": "211-805-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.734",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a2b1aca1-9784-4254-8a34-2a249e2669f7"
          ]
        },
        {
          "uuid": "ee58a2fe-3d43-4b75-b907-b139398ca721",
          "code": "69678",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69678",
          "code_system": "PUBCHEM",
          "references": [
            "a2b1aca1-9784-4254-8a34-2a249e2669f7"
          ]
        },
        {
          "uuid": "44200734-b868-1c48-a83b-03da63e7d42a",
          "code": "DTXSID7061017",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7061017",
          "code_system": "EPA CompTox",
          "references": [
            "a6fe2aba-cfd4-d0e6-3703-a1d4622a7e24"
          ]
        },
        {
          "uuid": "40309238-98d3-4d43-9040-5d4aa95dbc7a",
          "code": "16IFL9Y3ZY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf7bbbf9-6872-425b-9e09-727924129ead",
          "name": "1,2-OXATHIETANE, 3,3,4,4-TETRAFLUORO-, 2,2-DIOXIDE",
          "stdName": "1,2-OXATHIETANE, 3,3,4,4-TETRAFLUORO-, 2,2-DIOXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beaa8976-434b-4990-9954-dae0cba2f47c",
            "27a3e76d-3f78-4b6a-be12-ffdf35f006a8"
          ],
          "display_name": false
        },
        {
          "uuid": "874c1b62-6f9b-4b7c-82d2-d25f59d34b61",
          "name": "2-HYDROXYTETRAFLUOROETHANESULFONIC ACID .BETA.-SULTONE",
          "stdName": "2-HYDROXYTETRAFLUOROETHANESULFONIC ACID .BETA.-SULTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beaa8976-434b-4990-9954-dae0cba2f47c",
            "27a3e76d-3f78-4b6a-be12-ffdf35f006a8"
          ],
          "display_name": true
        },
        {
          "uuid": "21e9d021-9175-4346-9e56-fd5a5d3b0d13",
          "name": "2-HYDROXYTETRAFLUOROETHANESULFONIC ACID SULTONE",
          "stdName": "2-HYDROXYTETRAFLUOROETHANESULFONIC ACID SULTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c835f3e-6576-4a83-a845-a023ca1f670d"
          ],
          "display_name": false
        },
        {
          "uuid": "335acb2a-0bba-4136-878b-98bdeb826c3c",
          "name": "ETHANESULFONIC ACID, 1,1,2,2-TETRAFLUORO-2-HYDROXY-, .BETA.-SULTONE",
          "stdName": "ETHANESULFONIC ACID, 1,1,2,2-TETRAFLUORO-2-HYDROXY-, .BETA.-SULTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beaa8976-434b-4990-9954-dae0cba2f47c",
            "27a3e76d-3f78-4b6a-be12-ffdf35f006a8"
          ],
          "display_name": false
        },
        {
          "uuid": "485b9cef-5677-4cae-8cb6-a02b1bf9979e",
          "name": "TETRAFLUOROETHANE SULTONE",
          "stdName": "TETRAFLUOROETHANE SULTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d14ecab-eeeb-441c-b0cb-48d3f092ecbb",
            "27a3e76d-3f78-4b6a-be12-ffdf35f006a8"
          ],
          "display_name": false
        },
        {
          "uuid": "2dfd2647-d2f1-4339-85a0-0a310c4fbd2b",
          "name": "TETRAFLUOROETHANE-.BETA.-SULTONE",
          "stdName": "TETRAFLUOROETHANE-.BETA.-SULTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "beaa8976-434b-4990-9954-dae0cba2f47c",
            "27a3e76d-3f78-4b6a-be12-ffdf35f006a8"
          ],
          "display_name": false
        },
        {
          "uuid": "edc3593c-7e1d-4554-932a-101b40894324",
          "name": "TETRAFLUOROOXATHIETANE-2,2-DIOXIDE",
          "stdName": "TETRAFLUOROOXATHIETANE-2,2-DIOXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d14ecab-eeeb-441c-b0cb-48d3f092ecbb",
            "27a3e76d-3f78-4b6a-be12-ffdf35f006a8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8c835f3e-6576-4a83-a845-a023ca1f670d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "beaa8976-434b-4990-9954-dae0cba2f47c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27a3e76d-3f78-4b6a-be12-ffdf35f006a8",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d14ecab-eeeb-441c-b0cb-48d3f092ecbb",
          "citation": "Bretherick's Handbook of Reactive Chemical Hazards, Volumes 1-2 (7th Edition)",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2b1aca1-9784-4254-8a34-2a249e2669f7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391014000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6dcd909-c1ed-4e71-aad1-e8f47a1591c6",
          "citation": "SRS import [16IFL9Y3ZY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=16IFL9Y3ZY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391014000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13b2efca-349f-485d-b0f9-68adee913a3b",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6fe2aba-cfd4-d0e6-3703-a1d4622a7e24",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=697-18-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "123aba57-453d-42da-80c8-c53bfb6f41cf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bde6b1e3-891f-4df8-af23-9a3aac1a444f",
          "id": "bde6b1e3-891f-4df8-af23-9a3aac1a444f",
          "molfile": "\n  Marvin  01132109492D          \n\n 10 10  0  0  0  0            999 V2000\n    5.5841   -4.6853    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4091   -4.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4091   -3.8604    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2341   -4.6853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2341   -5.5103    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0590   -5.5103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2341   -6.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4091   -5.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4091   -6.3353    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5841   -5.5103    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  8  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  2  0  0  0  0\n  8  5  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\nM  END",
          "smiles": "C1(C(F)(F)S(=O)(=O)O1)(F)F",
          "formula": "C2F4O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "21276277-9a56-4119-a546-51ba6ad2e488"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "180.0794",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7e81fa03-042c-4ed0-9e8a-ac57b0431163",
      "version": "3",
      "structure": {
        "id": "4671b31c-0d70-4bbf-b2e0-7212e3efd776",
        "molfile": "\n  Marvin  01132103422D          \n\n 10 10  0  0  0  0            999 V2000\n    8.0590   -5.5103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2341   -5.5103    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2341   -6.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2341   -4.6853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4091   -4.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5841   -4.6853    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4091   -3.8604    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4091   -5.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4091   -6.3353    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5841   -5.5103    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  2  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\nM  END",
        "smiles": "C1(C(F)(F)S(=O)(=O)O1)(F)F",
        "formula": "C2F4O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "180.0794",
        "optical_activity": "NONE",
        "references": [
          "13b2efca-349f-485d-b0f9-68adee913a3b",
          "b6dcd909-c1ed-4e71-aad1-e8f47a1591c6"
        ],
        "stereo_centers": 0
      },
      "unii": "16IFL9Y3ZY"
    }
  ]
}