{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "864a25b1-5f19-4db9-9aee-ae52b1cb7e56",
          "code": "534-52-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=534-52-1",
          "code_system": "CAS",
          "references": [
            "8564d77a-dd44-4f49-9896-9f124f705114",
            "d63933d7-3b40-449b-ad4e-6f97395224cb"
          ]
        },
        {
          "uuid": "631e5084-4b06-4a3b-9be9-c89043633955",
          "code": "C024132",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67024132",
          "code_system": "MESH",
          "references": [
            "8564d77a-dd44-4f49-9896-9f124f705114"
          ]
        },
        {
          "uuid": "3b032b62-48ee-4706-8447-db576b7ad010",
          "code": "600023",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:776",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "8564d77a-dd44-4f49-9896-9f124f705114"
          ]
        },
        {
          "uuid": "f908e844-76a7-4fd1-bb8b-8ae472c468e5",
          "code": "m4575",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4575?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8564d77a-dd44-4f49-9896-9f124f705114"
          ]
        },
        {
          "uuid": "cab904bf-abb1-4e75-b279-af9a7c8860dd",
          "code": "208-601-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.821",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8564d77a-dd44-4f49-9896-9f124f705114"
          ]
        },
        {
          "uuid": "bd7027f7-5240-4439-94d7-64e837543761",
          "code": "10800",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10800",
          "code_system": "PUBCHEM",
          "references": [
            "8564d77a-dd44-4f49-9896-9f124f705114"
          ]
        },
        {
          "uuid": "fb2e5a15-9b94-86b2-b137-d79d7920a29f",
          "code": "DTXSID1022053",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1022053",
          "code_system": "EPA CompTox",
          "references": [
            "0170fd70-9901-efe7-068f-9630c70ade0b"
          ]
        },
        {
          "uuid": "23657f46-a4fb-9906-9952-dd71901c40dc",
          "code": "1596",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1596",
          "code_system": "HSDB",
          "references": [
            "3c2e1f24-0ea6-c409-c18b-e216433e5bfe"
          ]
        },
        {
          "uuid": "254ac009-c247-9bd7-cd35-7c244777803d",
          "code": "39349",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39349",
          "code_system": "CHEBI",
          "references": [
            "0a1505ab-9bb4-e79e-326c-11fc2ef6b6f3"
          ]
        },
        {
          "uuid": "cf1167a9-23d5-4847-9719-0bf0989dd192",
          "code": "1604ZJR09T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b3847366-6f50-ccad-fb65-bc97a7895eab",
          "code": "2082",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2082",
          "code_system": "NSC",
          "references": [
            "7e8851b2-7bbd-d1b1-03f4-4cd4ad59fdda"
          ]
        },
        {
          "uuid": "7a5c3813-6676-8086-23eb-b7cf2238e72e",
          "code": "1604ZJR09T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1604ZJR09T",
          "code_system": "DAILYMED",
          "references": [
            "7673c7b8-c0ee-a55e-458e-115f8691b801"
          ]
        },
        {
          "uuid": "42a3e45c-58f6-320b-47cc-7df1fc7f7937",
          "code": "DNOC",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/DNOC.html",
          "code_system": "ALANWOOD",
          "references": [
            "57bfc8b2-f21b-ed50-a761-e8f71232ae2c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bae86859-cfa5-4f61-a368-bf0c5efc568f",
          "name": "2-METHYL-4,6-DINITROPHENOL",
          "stdName": "2-METHYL-4,6-DINITROPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2635eb02-aea1-4379-9a69-cfaa21e7bc97",
            "d7d44b17-aae5-469e-a910-74e4d13db797"
          ],
          "display_name": false
        },
        {
          "uuid": "06012b87-83f0-4968-939c-909b2ce20df0",
          "name": "4,6 DINITRO-O-CRESOL",
          "stdName": "4,6 DINITRO-O-CRESOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95f28503-f03e-4244-adc9-e7ff624b8d50",
            "3acbe6a8-c4b7-47c8-a01d-8953b2557fa7"
          ],
          "display_name": false
        },
        {
          "uuid": "81a8bd40-63c1-46e8-ada8-51488d57d898",
          "name": "4,6-DINITRO-O-CRESOL",
          "stdName": "4,6-DINITRO-O-CRESOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7d44b17-aae5-469e-a910-74e4d13db797",
            "5a622f32-ee28-4761-93e5-6868770e9a8b"
          ],
          "display_name": false
        },
        {
          "uuid": "a8649aee-97aa-41ae-a339-c5f1570f2bc7",
          "name": "DINITRO-O-CRESOL",
          "stdName": "DINITRO-O-CRESOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ff3ddb2-ce28-44ce-9d65-40648e075252",
            "95f28503-f03e-4244-adc9-e7ff624b8d50",
            "35c889c9-5745-4a9f-82bc-f02f700c4e03",
            "76ce76a7-5d78-49ac-b741-5ccaf93d58bc"
          ],
          "display_name": false
        },
        {
          "uuid": "bffc44b7-6b2d-4628-b76b-8e2e9f929ad0",
          "name": "DINITRO-O-CRESOL [MART.]",
          "stdName": "DINITRO-O-CRESOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c889c9-5745-4a9f-82bc-f02f700c4e03"
          ],
          "display_name": false
        },
        {
          "uuid": "bfded286-a586-473e-864f-b43c0dface7a",
          "name": "DINITROCRESOL [MI]",
          "stdName": "DINITROCRESOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95f28503-f03e-4244-adc9-e7ff624b8d50",
            "5238cc74-bddd-4e9c-a54d-314622c963a9"
          ],
          "display_name": false
        },
        {
          "uuid": "58d4ab11-0bd0-4873-814c-55e2a7763532",
          "name": "DNOC",
          "stdName": "DNOC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95f28503-f03e-4244-adc9-e7ff624b8d50",
            "38879e18-6023-450c-b57a-1eb0c5505e2b",
            "6d7d22b0-e987-4c86-b5b5-958f8740b0f4",
            "283855ee-5664-4d4d-9cd8-695280e196c5",
            "f5eb15ac-73ac-47ba-a65f-d76f0fba8357",
            "ee0aa7d5-0a11-4faf-a8e3-e5147852f4b7"
          ],
          "display_name": true
        },
        {
          "uuid": "15c61520-8de8-4746-83d6-d76edf52111e",
          "name": "DNOC [HSDB]",
          "stdName": "DNOC [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95f28503-f03e-4244-adc9-e7ff624b8d50",
            "ee0aa7d5-0a11-4faf-a8e3-e5147852f4b7"
          ],
          "display_name": false
        },
        {
          "uuid": "eba7e0bc-51ac-4a70-ab0b-170cb4f5a044",
          "name": "DNOC [ISO]",
          "stdName": "DNOC [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95f28503-f03e-4244-adc9-e7ff624b8d50",
            "f5eb15ac-73ac-47ba-a65f-d76f0fba8357"
          ],
          "display_name": false
        },
        {
          "uuid": "e31d53b3-b4e9-40a3-8b07-94ca7496ef1c",
          "name": "NSC-2082",
          "stdName": "NSC-2082",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdb48ac3-211d-4336-97a1-af906d4e2a6f",
            "95f28503-f03e-4244-adc9-e7ff624b8d50"
          ],
          "display_name": false
        },
        {
          "uuid": "5e273026-c6d6-4d82-8890-565244d465ee",
          "name": "PHENOL, 2-METHYL-4,6-DINITRO-",
          "stdName": "PHENOL, 2-METHYL-4,6-DINITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55c4919b-332d-4348-a8be-153842ce6d4e",
            "95f28503-f03e-4244-adc9-e7ff624b8d50"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "38879e18-6023-450c-b57a-1eb0c5505e2b",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d7d44b17-aae5-469e-a910-74e4d13db797",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a622f32-ee28-4761-93e5-6868770e9a8b",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2635eb02-aea1-4379-9a69-cfaa21e7bc97",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35c889c9-5745-4a9f-82bc-f02f700c4e03",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5238cc74-bddd-4e9c-a54d-314622c963a9",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95f28503-f03e-4244-adc9-e7ff624b8d50",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee0aa7d5-0a11-4faf-a8e3-e5147852f4b7",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76ce76a7-5d78-49ac-b741-5ccaf93d58bc",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55c4919b-332d-4348-a8be-153842ce6d4e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5eb15ac-73ac-47ba-a65f-d76f0fba8357",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3acbe6a8-c4b7-47c8-a01d-8953b2557fa7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdb48ac3-211d-4336-97a1-af906d4e2a6f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8564d77a-dd44-4f49-9896-9f124f705114",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390927000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8493b077-844a-4f6a-a0fe-28fe4bf3a4d9",
          "citation": "SRS import [1604ZJR09T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1604ZJR09T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390927000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6099ca11-5910-4589-9fb0-4aa1fda34d42",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ff3ddb2-ce28-44ce-9d65-40648e075252",
          "citation": "DINITRO-O-CRESOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "283855ee-5664-4d4d-9cd8-695280e196c5",
          "citation": "DNOC [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6d7d22b0-e987-4c86-b5b5-958f8740b0f4",
          "citation": "DNOC [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c2e1f24-0ea6-c409-c18b-e216433e5bfe",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+534-52-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0170fd70-9901-efe7-068f-9630c70ade0b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=534-52-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "57bfc8b2-f21b-ed50-a761-e8f71232ae2c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d63933d7-3b40-449b-ad4e-6f97395224cb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0a1505ab-9bb4-e79e-326c-11fc2ef6b6f3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7e8851b2-7bbd-d1b1-03f4-4cd4ad59fdda",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7673c7b8-c0ee-a55e-458e-115f8691b801",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "64d56ccd-ea98-4e40-8583-7aa768662add",
          "id": "64d56ccd-ea98-4e40-8583-7aa768662add",
          "molfile": "\n  Marvin  01132105152D          \n\n 14 14  0  0  0  0            999 V2000\n    5.3215   -4.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0401   -4.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0401   -5.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7604   -5.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4649   -5.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4649   -4.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7604   -4.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7604   -3.3466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1754   -4.1469    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.8798   -4.5466    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1754   -3.3202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7604   -6.6214    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.4649   -7.0286    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.0401   -7.0408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4 12  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  CHG  4   9   1  10  -1  12   1  13  -1\nM  END",
          "smiles": "Cc1cc(cc(c1O)[N+](=O)[O-])[N+](=O)[O-]",
          "formula": "C7H6N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0758796d-db5e-4b1a-ae6c-394dce1bd875"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "198.1332",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "739c4f5a-b5ef-4f45-9da0-f89d8377ceff",
      "version": "8",
      "structure": {
        "id": "1473c40c-321a-40db-9fb8-3525a992fa9f",
        "molfile": "\n  Marvin  01132101162D          \n\n 14 14  0  0  0  0            999 V2000\n    7.4649   -4.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4649   -5.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7604   -5.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0401   -5.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0401   -4.5765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7604   -4.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7604   -3.3466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3215   -4.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7604   -6.6214    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.4649   -7.0286    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.0401   -7.0408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1754   -4.1469    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.8798   -4.5466    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1754   -3.3202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  CHG  4   9   1  10  -1  12   1  13  -1\nM  END",
        "smiles": "Cc1cc(cc(c1O)[N+](=O)[O-])[N+](=O)[O-]",
        "formula": "C7H6N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "198.1332",
        "optical_activity": "NONE",
        "references": [
          "6099ca11-5910-4589-9fb0-4aa1fda34d42",
          "8493b077-844a-4f6a-a0fe-28fe4bf3a4d9"
        ],
        "stereo_centers": 0
      },
      "unii": "1604ZJR09T"
    }
  ]
}