{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b514ea92-6d87-41b8-8754-a6f024da2aa9",
          "code": "D06BB09",
          "comments": "ATC|DERMATOLOGICALS|ANTIBIOTICS AND CHEMOTHERAPEUTICS FOR DERMATOLOGICAL USE|CHEMOTHERAPEUTICS FOR TOPICAL USE|Antivirals|edoxudine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D06BB09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "960e9b0b-c15b-418a-8408-e435957da095",
          "code": "QD06BB09",
          "comments": "VATC|ANTIBIOTICS AND CHEMOTHERAPEUTICS FOR DERMATOLOGICAL  USE|CHEMOTHERAPEUTICS FOR TOPICAL USE|Antivirals|edoxudine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD06BB09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "0a03c49f-eff3-4484-a35a-4dfec6b0d3ca",
          "code": "15176-29-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15176-29-1",
          "code_system": "CAS",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd",
            "08877eb0-7756-4051-974f-867132d095f9"
          ]
        },
        {
          "uuid": "8138ddc9-c413-4f3d-946e-2ba4019f50ba",
          "code": "C87662",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87662",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "885e89c7-d80d-4205-a911-07e766521106",
          "code": "C022811",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67022811",
          "code_system": "MESH",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "cc9a225d-8543-4add-aaeb-4b030917b123",
          "code": "EDOXUDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Edoxudine",
          "code_system": "WIKIPEDIA",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "15f817ae-b976-4ff3-99f1-ecab40bf5180",
          "code": "SUB06460MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "b153cdd9-e369-401e-bb21-cd6ca2237417",
          "code": "5512",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5512",
          "code_system": "INN",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "91cff8b4-31a9-4bfc-967e-4cdf54118c42",
          "code": "239-226-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.645",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "7e432f9f-b815-4e81-9196-7cfe0d1da00e",
          "code": "49428",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/49428/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "2126ebba-bd58-40b3-9663-3a03040bfd64",
          "code": "m4833",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4833?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "12345854-a9e6-4a63-9ae4-b0cbe93404e4",
          "code": "CHEMBL318153",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL318153",
          "code_system": "ChEMBL",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "5b3b30bb-2cd9-4c69-aaa0-1df73ea278d6",
          "code": "66377",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66377",
          "code_system": "PUBCHEM",
          "references": [
            "b5007b95-4d08-4f8e-a06b-3ea8f63409bd"
          ]
        },
        {
          "uuid": "65b085a9-ede2-e3a0-2b0b-25662eaade8d",
          "code": "DTXSID4045890",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4045890",
          "code_system": "EPA CompTox",
          "references": [
            "1e0d56d6-d3f1-02b9-29cb-6fb6f80bb997"
          ]
        },
        {
          "uuid": "e3857589-4d54-57fe-5821-62abe37edbed",
          "code": "C281",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiviral Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C281",
          "code_system": "NCI_THESAURUS",
          "references": [
            "463ce0fb-1765-d330-4f2b-dfe6871cb6b7"
          ]
        },
        {
          "uuid": "dcd9b437-c4da-8bbc-253d-7b84a7313d5c",
          "code": "C29575",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|DNA Polymerase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29575",
          "code_system": "NCI_THESAURUS",
          "references": [
            "463ce0fb-1765-d330-4f2b-dfe6871cb6b7"
          ]
        },
        {
          "uuid": "8264da29-afa5-4aba-8dd8-d73c207173b5",
          "code": "15ZQM81Y3R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b328531f-62e5-3d1f-3c0d-80833a85d751",
          "code": "3173",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3173",
          "code_system": "DRUG CENTRAL",
          "references": [
            "463ce0fb-1765-d330-4f2b-dfe6871cb6b7"
          ]
        },
        {
          "uuid": "98ab0945-c666-6225-eae1-b0e2116a46f8",
          "code": "DB13421",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13421",
          "code_system": "DRUG BANK",
          "references": [
            "463ce0fb-1765-d330-4f2b-dfe6871cb6b7"
          ]
        },
        {
          "uuid": "ea087334-a0b8-d3c6-427f-2b69a3d2ca74",
          "code": "U-62",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/U-62/relevant/1/",
          "code_system": "USAN",
          "references": [
            "51fb5f94-d602-39db-e2c2-a40e8526fd4b"
          ]
        },
        {
          "uuid": "0e6ff938-8966-8fee-dbbd-32f23004acf1",
          "code": "100000080512",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8cfc6962-3d5a-b2d3-67aa-7fe898b5d8e6"
          ]
        },
        {
          "uuid": "63c1847a-4ed4-5309-f740-f3982742ef71",
          "code": "758405",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758405",
          "code_system": "NSC",
          "references": [
            "32f107d8-6afd-e064-34cd-d2d67605294b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "00b2465e-1b00-4398-b85f-d7d81d54a4e3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2ab145a7-a28d-4b5c-b43c-b73194f249c5",
            "refuuid": "659d7deb-b616-447d-a378-9ebd6e6a172c",
            "name": "EDOXUDINE",
            "unii": "15ZQM81Y3R",
            "linking_id": "15ZQM81Y3R",
            "ref_pname": "EDOXUDINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "46f3c217-917c-4eee-9e0b-8d77af460262",
          "name": "2'-DEOXY-5-ETHYLURIDINE",
          "stdName": "2'-DEOXY-5-ETHYLURIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09cca991-4de1-4920-92e7-436bd2353490"
          ],
          "display_name": false
        },
        {
          "uuid": "b4f57dc8-3663-45bf-ae69-4f7bd7274109",
          "name": "5-ETHYL-2'-DEOXYURIDINE",
          "stdName": "5-ETHYL-2'-DEOXYURIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2b962a7-6363-458d-85bc-2b55e3edb0cb"
          ],
          "display_name": false
        },
        {
          "uuid": "77c1971e-4b7c-4877-b91c-19d18005926c",
          "name": "5-ETHYL-3-(2'-DEOXYRIBOSYL)URACIL",
          "stdName": "5-ETHYL-3-(2'-DEOXYRIBOSYL)URACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c7e60c-3955-4671-a1d9-a674bf9c8224"
          ],
          "display_name": false
        },
        {
          "uuid": "c73304f0-e570-471f-96fb-3cf64c341916",
          "name": "EDOXUDINE",
          "stdName": "EDOXUDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09cca991-4de1-4920-92e7-436bd2353490",
            "a50ae7bf-bff1-4c3e-ad7d-52bd8142962b",
            "13efa316-916c-4bd9-a715-68a69a836ec0",
            "631bc53f-ecc5-42a6-8f1e-e6eb259fc898",
            "04e9feea-18a0-46fd-9773-ba5d7e95615d",
            "a57e02c2-6ce4-47a7-aa7d-be453d1be02a",
            "b9273d54-5c4a-4c6c-8328-1c3187774f00",
            "aee62880-51f0-4b2c-bb1e-64cb74ba8863",
            "671dc881-4731-4ada-a11e-c5a437aa0efd",
            "411ac1d7-c83f-445a-9c80-14991a18a9aa",
            "a44cec1a-c1d1-424d-94cd-8c762451304f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "1ddcd517-471f-4291-b5cf-8ba4a485e37c",
              "name_org": "INN"
            },
            {
              "uuid": "eac1ec9a-4406-44c7-b2f4-dc10b441e282",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "f6be45f4-a33f-4942-8c6c-17f36474485f",
          "name": "EDOXUDINE [MART.]",
          "stdName": "EDOXUDINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a57e02c2-6ce4-47a7-aa7d-be453d1be02a"
          ],
          "display_name": false
        },
        {
          "uuid": "7a50d67b-55ee-4d01-b7a1-c5ec3a00bfc1",
          "name": "EDOXUDINE [MI]",
          "stdName": "EDOXUDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "671dc881-4731-4ada-a11e-c5a437aa0efd"
          ],
          "display_name": false
        },
        {
          "uuid": "57a62a19-c841-48d0-b867-cb880fcedcae",
          "name": "EDOXUDINE [USAN]",
          "stdName": "EDOXUDINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04e9feea-18a0-46fd-9773-ba5d7e95615d"
          ],
          "display_name": false
        },
        {
          "uuid": "0623416e-c431-485a-b8e7-b92249f03c9b",
          "name": "EDU",
          "stdName": "EDU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09cca991-4de1-4920-92e7-436bd2353490"
          ],
          "display_name": false
        },
        {
          "uuid": "69e44110-f229-4b58-8bbc-1641ac6653c4",
          "name": "EUDR",
          "stdName": "EUDR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09cca991-4de1-4920-92e7-436bd2353490"
          ],
          "display_name": false
        },
        {
          "uuid": "70d609b6-99a7-890f-07eb-479632b5bba7",
          "name": "Edoxudine [WHO-DD]",
          "stdName": "EDOXUDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "090a0715-2dfd-1a78-6b24-2bf26ac68aab"
          ],
          "display_name": false
        },
        {
          "uuid": "d343ca86-fb59-6229-bbe8-7501484ff869",
          "name": "NSC-758405",
          "stdName": "NSC-758405",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32f107d8-6afd-e064-34cd-d2d67605294b"
          ],
          "display_name": false
        },
        {
          "uuid": "89434aef-b3a6-4590-abca-90f2e2715542",
          "name": "ORF 15817",
          "stdName": "ORF 15817",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09cca991-4de1-4920-92e7-436bd2353490"
          ],
          "display_name": false
        },
        {
          "uuid": "4dd9e835-293a-4dd2-8216-821daeed970a",
          "name": "ORF-15817",
          "stdName": "ORF-15817",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "702ebd42-987e-48b9-ab26-92adb326de2f"
          ],
          "display_name": false
        },
        {
          "uuid": "afe99afc-c77c-4bfa-8861-ad800548ddf5",
          "name": "RWJ 15817",
          "stdName": "RWJ 15817",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09cca991-4de1-4920-92e7-436bd2353490"
          ],
          "display_name": false
        },
        {
          "uuid": "95ea1c15-44cd-461c-9534-66b186f8d7fa",
          "name": "RWJ-15817",
          "stdName": "RWJ-15817",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "702ebd42-987e-48b9-ab26-92adb326de2f"
          ],
          "display_name": false
        },
        {
          "uuid": "188eb380-37ce-4918-a719-fa8fdf17104d",
          "name": "URIDINE, 2'-DEOXY-5-ETHYL-",
          "stdName": "URIDINE, 2'-DEOXY-5-ETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09cca991-4de1-4920-92e7-436bd2353490"
          ],
          "display_name": false
        },
        {
          "uuid": "f4bfec07-d4fe-4d09-9574-fbe83401aed1",
          "name": "edoxudine [INN]",
          "stdName": "EDOXUDINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aee62880-51f0-4b2c-bb1e-64cb74ba8863"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "13efa316-916c-4bd9-a715-68a69a836ec0",
          "citation": "EDOXUDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b9273d54-5c4a-4c6c-8328-1c3187774f00",
          "citation": "EDOXUDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b2b962a7-6363-458d-85bc-2b55e3edb0cb",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "702ebd42-987e-48b9-ab26-92adb326de2f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09cca991-4de1-4920-92e7-436bd2353490",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35c7e60c-3955-4671-a1d9-a674bf9c8224",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aee62880-51f0-4b2c-bb1e-64cb74ba8863",
          "citation": "INN Proposed List 52",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL52.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04e9feea-18a0-46fd-9773-ba5d7e95615d",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a57e02c2-6ce4-47a7-aa7d-be453d1be02a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "671dc881-4731-4ada-a11e-c5a437aa0efd",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a44cec1a-c1d1-424d-94cd-8c762451304f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5007b95-4d08-4f8e-a06b-3ea8f63409bd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389723000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d62f34a6-fa5c-48bf-9263-887ef858c26a",
          "citation": "SRS import [15ZQM81Y3R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=15ZQM81Y3R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389723000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a50ae7bf-bff1-4c3e-ad7d-52bd8142962b",
          "citation": "EDOXUDINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "411ac1d7-c83f-445a-9c80-14991a18a9aa",
          "citation": "EDOXUDINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "631bc53f-ecc5-42a6-8f1e-e6eb259fc898",
          "citation": "EDOXUDINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e0d56d6-d3f1-02b9-29cb-6fb6f80bb997",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15176-29-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8cfc6962-3d5a-b2d3-67aa-7fe898b5d8e6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "463ce0fb-1765-d330-4f2b-dfe6871cb6b7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "51fb5f94-d602-39db-e2c2-a40e8526fd4b",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "08877eb0-7756-4051-974f-867132d095f9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "32f107d8-6afd-e064-34cd-d2d67605294b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "090a0715-2dfd-1a78-6b24-2bf26ac68aab",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "048a443f-eaf4-4012-80ce-27f6b90e5760",
          "id": "048a443f-eaf4-4012-80ce-27f6b90e5760",
          "molfile": "\n  Marvin  01132100322D          \n\n 18 19  0  0  1  0            999 V2000\n    7.2972   -5.6117    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.9715   -6.3716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2744   -5.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5811   -5.0076    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.7928   -4.5686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9999   -5.0122    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.3720   -4.4741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5414   -4.4741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5811   -3.8370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8731   -3.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8731   -2.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1603   -2.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4429   -2.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5859   -2.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5859   -1.3636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2986   -2.6003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2986   -3.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0066   -3.8370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  1  0  0  0\n  5  4  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 17  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 14  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\nM  END",
          "smiles": "CCc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O",
          "formula": "C11H16N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b4b567f4-a529-41b2-96ca-30924bb61a7a"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "256.2556",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "659d7deb-b616-447d-a378-9ebd6e6a172c",
      "version": "19",
      "structure": {
        "id": "a93fd125-ae82-4625-9c0d-6f3bb2ad24ac",
        "molfile": "\n  Marvin  01132108472D          \n\n 18 19  0  0  1  0            999 V2000\n    8.5811   -3.8370    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2986   -3.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2986   -2.6003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5859   -2.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5859   -1.3636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8731   -2.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8731   -3.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1603   -2.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4429   -2.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0066   -3.8370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5811   -5.0076    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.7928   -4.5686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9999   -5.0122    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3720   -4.4741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5414   -4.4741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2972   -5.6117    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2744   -5.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9715   -6.3716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  2  2  0  0  0  0\n 11  1  1  1  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 15 14  1  0  0  0  0\n 16 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 11  1  0  0  0  0\n 16 18  1  6  0  0  0\nM  END",
        "smiles": "CCc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O",
        "formula": "C11H16N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "256.2556",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d62f34a6-fa5c-48bf-9263-887ef858c26a",
          "09cca991-4de1-4920-92e7-436bd2353490",
          "aee62880-51f0-4b2c-bb1e-64cb74ba8863"
        ],
        "stereo_centers": 3
      },
      "unii": "15ZQM81Y3R"
    }
  ]
}