{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "19435e52-e2a7-4a7b-9ef0-0d72bd4c42a2",
          "code": "1296149-08-0",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1296149-08-0",
          "code_system": "CAS",
          "references": [
            "db53e6b6-1e9d-4185-a476-6d1e1cc61d82",
            "6995ecc8-5966-47cb-81a6-3cd016cc16b8"
          ]
        },
        {
          "uuid": "a5564424-7b89-4574-9363-6e58ef417942",
          "code": "1789517",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1789517/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "db53e6b6-1e9d-4185-a476-6d1e1cc61d82"
          ]
        },
        {
          "uuid": "69270aad-dd70-4d1f-9d6a-9097141f44d9",
          "code": "SUB26636",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "db53e6b6-1e9d-4185-a476-6d1e1cc61d82"
          ]
        },
        {
          "uuid": "921f6550-7dd5-4790-b8e2-1dd30fbb27e9",
          "code": "CHEMBL2110916",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110916",
          "code_system": "ChEMBL",
          "references": [
            "db53e6b6-1e9d-4185-a476-6d1e1cc61d82"
          ]
        },
        {
          "uuid": "26a0b507-a1e5-4894-b8a4-dd71039aabd3",
          "code": "76965765",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76965765",
          "code_system": "PUBCHEM",
          "references": [
            "db53e6b6-1e9d-4185-a476-6d1e1cc61d82"
          ]
        },
        {
          "uuid": "31cff68a-eb32-4f69-867a-16b8595c9afe",
          "code": "15VQ11I66N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7ed04d05-e65f-d0fe-dc36-1c2aa792e185",
          "code": "100000091426",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3c97d6a4-0bd9-193f-b00f-3c1c53d7567d"
          ]
        },
        {
          "uuid": "3181ccf6-7807-d57f-d3d2-0b67cfc0674a",
          "code": "15VQ11I66N",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=15VQ11I66N",
          "code_system": "DAILYMED",
          "references": [
            "dea0c12b-583c-da49-43ee-cd777cd959d6"
          ]
        },
        {
          "uuid": "a6f63586-5b48-450c-8dda-930207154113",
          "code": "216699-44-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=216699-44-4",
          "code_system": "CAS",
          "references": [
            "e89043b3-4526-424a-aab3-5aa22aa9f482"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4fa27742-34ed-4dde-88fc-48b2a760a56d",
          "amount": {
            "uuid": "7030d9f5-e575-4078-8f00-858a86fd1d96"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "60b567ca-33f9-4b13-9cce-09aabaa54fab",
            "refuuid": "2cec419b-f063-4993-a7a6-3b252fe501c6",
            "name": "GLUCOSAMINE",
            "unii": "N08U5BOQ1K",
            "linking_id": "N08U5BOQ1K",
            "ref_pname": "GLUCOSAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6f68d23c-d22f-49ca-9821-faf750abd110",
          "amount": {
            "uuid": "82aed2c8-8245-4d28-a610-c682cd942ee8"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "74185308-f227-4f23-a432-f6f731bdaf19"
          ],
          "related_substance": {
            "uuid": "09e02160-79cb-445d-adbd-cc1d3e53c489",
            "refuuid": "9353b517-49e9-482c-ade6-4e0f82546d56",
            "name": "5-(HYDROXYMETHYL)-2-FURALDEHYDE",
            "unii": "70ETD81LF0",
            "linking_id": "70ETD81LF0",
            "ref_pname": "5-(HYDROXYMETHYL)-2-FURALDEHYDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c7db0e08-1c0b-45a0-9ac4-d6c76711445d",
          "amount": {
            "uuid": "ffaa475a-4e67-41bb-91e7-547ae937bd9f"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "4a864da7-a655-479f-99a1-c57400e99d17"
          ],
          "related_substance": {
            "uuid": "232f6c3f-c92f-49bc-bbd6-b982578fbb87",
            "refuuid": "62d7f0bf-c631-4c43-a03b-0db75a7c5087",
            "name": "2,5-Deoxyfructosazine",
            "unii": "X6DTV8Q73C",
            "linking_id": "X6DTV8Q73C",
            "ref_pname": "2,5-Deoxyfructosazine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f74620ae-0464-479d-91c9-b7b4ba09b47d",
          "amount": {
            "uuid": "edc40a47-75a0-4544-b860-ba17c406a8a4"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "680f925a-4ba9-4ca4-98fe-0f1c6ad3b1b4"
          ],
          "related_substance": {
            "uuid": "8b5b8fb8-a787-4a7b-8900-be5e19239b67",
            "refuuid": "743bfa4d-44e5-44c1-9f22-bf0ff9b05ce5",
            "name": "N-ACETYLGLUCOSAMINE",
            "unii": "V956696549",
            "linking_id": "V956696549",
            "ref_pname": "N-ACETYLGLUCOSAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f2f263cd-3500-492b-b679-4dc778d13258",
          "amount": {
            "uuid": "24169a21-c62b-4ad7-9c1b-0cfa6fdf2374"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "c71f6356-c7b9-4ce3-afc1-6892a50ba037"
          ],
          "related_substance": {
            "uuid": "c1cbb860-d26c-4f8d-9701-71a52ee44aaf",
            "refuuid": "021a1976-a834-4dff-b65f-8b97f544f203",
            "name": "Fructosazine",
            "unii": "U4PRP9J3ZX",
            "linking_id": "U4PRP9J3ZX",
            "ref_pname": "Fructosazine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "78c7e9ce-4777-4257-b345-9048c47dc88f",
          "name": "D-GLUCOSE, 2-AMINO-2-DEOXY-, SULFATE, COMPD. WITH POTASSIUM CHLORIDE",
          "stdName": "D-GLUCOSE, 2-AMINO-2-DEOXY-, SULFATE, COMPD. WITH POTASSIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45934dcd-13fe-432b-b314-5dc1b986db5d",
            "e89043b3-4526-424a-aab3-5aa22aa9f482"
          ],
          "display_name": false
        },
        {
          "uuid": "ad92badc-4873-4ec5-a3ba-a1b2e1dd4414",
          "name": "D-GLUCOSE, 2-AMINO-2-DEOXY-, SULFATE, COMPD. WITH POTASSIUM CHLORIDE (2:1:2)",
          "stdName": "D-GLUCOSE, 2-AMINO-2-DEOXY-, SULFATE, COMPD. WITH POTASSIUM CHLORIDE (2:1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e544859-8fcc-4907-bff3-1a9a1f642088",
            "45934dcd-13fe-432b-b314-5dc1b986db5d"
          ],
          "display_name": false
        },
        {
          "uuid": "c1bd34a1-7781-48ea-992c-ec3e6c6bf7ed",
          "name": "GLUCOSAMINE SULFATE (AS POTASSIUM CHLORIDE)",
          "stdName": "GLUCOSAMINE SULFATE (AS POTASSIUM CHLORIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acd65996-e28d-4147-9bf3-9e64427f4f6a",
            "45934dcd-13fe-432b-b314-5dc1b986db5d"
          ],
          "display_name": false
        },
        {
          "uuid": "2e8f1394-8b34-4328-8e66-24751bfa1cd6",
          "name": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE",
          "stdName": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d30ce3af-df27-4263-9673-a8a058660074",
            "ad21b1e2-13b7-4073-ae5f-3738bd8cd3f1",
            "45934dcd-13fe-432b-b314-5dc1b986db5d",
            "3def938d-9747-4606-8d1a-b0cf3122a16d",
            "078f18f7-e3a0-460d-ad9f-4002c2d01f85",
            "ac435a98-9ff5-4729-b24d-485b76972150"
          ],
          "display_name": true
        },
        {
          "uuid": "8c68f9c5-5558-8627-61c6-cddaffef2128",
          "name": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE [EP MONOGRAPH]",
          "stdName": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "208a3001-fa3e-5c55-84a9-7da7a5c0f349"
          ],
          "display_name": false
        },
        {
          "uuid": "a1bc5159-5568-3115-6b81-904346b390ab",
          "name": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE [USP IMPURITY]",
          "stdName": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45934dcd-13fe-432b-b314-5dc1b986db5d",
            "078f18f7-e3a0-460d-ad9f-4002c2d01f85"
          ],
          "display_name": false
        },
        {
          "uuid": "9a287a1f-f503-4a6f-8ce1-b43d95265b6d",
          "name": "GLUCOSAMINE SULFPHATE (AS POTASSIUM CHLORIDE)",
          "stdName": "GLUCOSAMINE SULFPHATE (AS POTASSIUM CHLORIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "250472a3-f8db-40ae-95df-2e84cc6e3d3e",
            "45934dcd-13fe-432b-b314-5dc1b986db5d"
          ],
          "display_name": false
        },
        {
          "uuid": "e5f715d1-4912-6cc1-d4c8-33cff74fe6f3",
          "name": "Glucosamine sulfate potassium chloride [WHO-DD]",
          "stdName": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5117256a-1fa2-1d47-7edb-734be12e5e6e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "078f18f7-e3a0-460d-ad9f-4002c2d01f85",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3def938d-9747-4606-8d1a-b0cf3122a16d",
          "citation": "DMF 19639",
          "doc_type": "DMF",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac435a98-9ff5-4729-b24d-485b76972150",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45934dcd-13fe-432b-b314-5dc1b986db5d",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e89043b3-4526-424a-aab3-5aa22aa9f482",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acd65996-e28d-4147-9bf3-9e64427f4f6a",
          "citation": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=119551",
          "url": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=119551",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "250472a3-f8db-40ae-95df-2e84cc6e3d3e",
          "citation": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=108983",
          "url": "http://www.drugoffice.gov.hk/eps/productDetailActionNew.do?lang=en&section=consumer&id=108983",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e544859-8fcc-4907-bff3-1a9a1f642088",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db53e6b6-1e9d-4185-a476-6d1e1cc61d82",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392283000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53c51507-adb1-4e39-a78e-4821454bd2cc",
          "citation": "SRS import [15VQ11I66N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=15VQ11I66N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392283000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d30ce3af-df27-4263-9673-a8a058660074",
          "citation": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad21b1e2-13b7-4073-ae5f-3738bd8cd3f1",
          "citation": "GLUCOSAMINE SULFATE POTASSIUM CHLORIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c97d6a4-0bd9-193f-b00f-3c1c53d7567d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2a883819-05be-c77f-38be-b1f8e1d8f433",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6995ecc8-5966-47cb-81a6-3cd016cc16b8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "208a3001-fa3e-5c55-84a9-7da7a5c0f349",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "dea0c12b-583c-da49-43ee-cd777cd959d6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5117256a-1fa2-1d47-7edb-734be12e5e6e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "74185308-f227-4f23-a432-f6f731bdaf19",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "680f925a-4ba9-4ca4-98fe-0f1c6ad3b1b4",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4a864da7-a655-479f-99a1-c57400e99d17",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c71f6356-c7b9-4ce3-afc1-6892a50ba037",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b82332ad-2527-7ec0-f9b3-e59add6f9648",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e5dd526f-6341-4427-a566-d8af6f1d1fd7",
          "id": "e5dd526f-6341-4427-a566-d8af6f1d1fd7",
          "molfile": "\n  CDK     01042418182D\n\n  1  0  0  0  0  0  0  0  0  0999 V2000\n   33.7299   -7.9119    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "41d06a5d-d904-42ae-9024-7b280d0d7992"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9b6324d5-6610-4d08-8849-cac6566fedf8",
          "id": "9b6324d5-6610-4d08-8849-cac6566fedf8",
          "molfile": "\n  CDK     01042418182D\n\n 12 11  0  0  1  0  0  0  0  0999 V2000\n   21.3971   -5.8432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3971   -7.4015    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   22.7460   -8.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7460   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0481   -8.1854    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   20.0481   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6986   -7.4015    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   18.6986   -5.8432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3408   -8.1854    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   17.3408   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9920   -7.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6427   -8.1854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)N",
          "formula": "C6H13NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "375a045f-793d-42b3-a3f8-3e17b1e9dea7"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "179.1714",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        },
        {
          "uuid": "f1fe28d5-2c8c-4734-affb-471f38877daf",
          "id": "f1fe28d5-2c8c-4734-affb-471f38877daf",
          "molfile": "\n  CDK     01042418182D\n\n  5  4  0  0  0  0  0  0  0  0999 V2000\n   25.5171   -7.3098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0756   -7.3098    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6340   -7.3098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0756   -8.8766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0756   -5.7513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1a271b75-710a-49d4-a2f0-8f91c2d19636"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f9d51e43-75a8-4200-861e-c27c71cb5ad4",
          "id": "f9d51e43-75a8-4200-861e-c27c71cb5ad4",
          "molfile": "\n  CDK     01042418182D\n\n  1  0  0  0  0  0  0  0  0  0999 V2000\n   37.7863   -7.8733    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[Cl-]",
          "formula": "Cl",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "eb8c8f2d-2637-4f0a-a894-f48001bb9a3f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "35.4529",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ace8c952-6314-4c52-8dde-3b1306ecf59d",
      "version": "19",
      "structure": {
        "id": "94b0db66-b8da-48b7-b637-d9a93c21fe37",
        "molfile": "\n   JSDraw201042418182D\n\n 33 26  0  0  1  0              0 V2000\n   25.5171   -7.3098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0756   -7.3098    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6340   -7.3098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0756   -8.8766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0756   -5.7513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3971   -5.8432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3971   -7.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7460   -8.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7460   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0481   -8.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0481   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6986   -7.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6986   -5.8432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3408   -8.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3408   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9920   -7.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6427   -8.1854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   33.7299   -7.9119    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   37.7863   -7.8733    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n   21.3971   -5.8432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3971   -7.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7460   -8.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7460   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0481   -8.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0481   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6986   -7.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6986   -5.8432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3408   -8.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3408   -9.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9920   -7.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6427   -8.1854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   33.7299   -7.9119    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n   37.7863   -7.8733    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\n  2  1  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n  2  3  1  0  0  0  0\n 21 20  1  1  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 21  1  0  0  0  0\n 24 25  1  1  0  0  0\n 26 24  1  0  0  0  0\n 26 27  1  1  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  6  0  0  0\n 30 28  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  STY  1   1 MUL\nM  SAL   1  8   6   7   8   9  10  11  12  13\nM  SAL   1  8  14  15  16  17  20  21  22  23\nM  SAL   1  8  24  25  26  27  28  29  30  31\nM  SPA   1  8   6   7   8   9  10  11  12  13\nM  SPA   1  4  14  15  16  17\nM  SDI   1  4   12.7920  -11.1222   12.7920   -4.1022\nM  SDI   1  4   23.7640   -4.1022   23.7640  -11.1222\nM  SMT   1 2\nM  STY  1   2 MUL\nM  SAL   2  2  18  32\nM  SPA   2  1  18\nM  SDI   2  4   32.5000   -8.9902   32.5000   -6.6502\nM  SDI   2  4   34.8400   -6.6502   34.8400   -8.9902\nM  SMT   2 2\nM  STY  1   3 MUL\nM  SAL   3  2  19  33\nM  SPA   3  1  19\nM  SDI   3  4   36.7640   -9.3022   36.7640   -6.5982\nM  SDI   3  4   38.7920   -6.5982   38.7920   -9.3022\nM  SMT   3 2\nM  CHG  4  18   1  19  -1  32   1  33  -1\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)N.C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)N.[Cl-].[Cl-].[K+].[K+].OS(=O)(=O)O",
        "formula": "2C6H13NO5.2Cl.2K.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "605.5248",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "53c51507-adb1-4e39-a78e-4821454bd2cc",
          "078f18f7-e3a0-460d-ad9f-4002c2d01f85"
        ],
        "stereo_centers": 8
      },
      "unii": "15VQ11I66N"
    }
  ]
}