{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a09346be-6f45-4e61-87cc-af3554b36b6e", "code": "69929-17-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=69929-17-5", "code_system": "CAS", "references": [ "d3e731d3-0adb-40e2-b7b7-181d5f1aeec6", "8ee21ddd-e4fc-45b0-ac8a-f12c2177ee81" ] }, { "uuid": "de9d4fdc-5aa8-4100-8abd-e66e6c24892e", "code": "274-223-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.067.454", "code_system": "ECHA (EC/EINECS)", "references": [ "d3e731d3-0adb-40e2-b7b7-181d5f1aeec6" ] }, { "uuid": "5cd01dca-04e8-4290-bdae-856da42e0923", "code": "112185", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/112185", "code_system": "PUBCHEM", "references": [ "d3e731d3-0adb-40e2-b7b7-181d5f1aeec6" ] }, { "uuid": "91de3172-b1a8-43b4-a3d2-fcbd34f3c489", "code": "15047ZP82F", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7b3fa4f7-9329-6a69-4ba9-53896fe1f898", "code": "DTXSID30867860", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30867860", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "543869da-27e7-4302-90a2-10fe7cf0148e", "name": "1-(2,4-DIMETHYL-3-CYCLOHEXEN-1-YL)-2,2-DIMETHYL-1-PROPANONE", "stdName": "1-(2,4-DIMETHYL-3-CYCLOHEXEN-1-YL)-2,2-DIMETHYL-1-PROPANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cca2ce0f-13a9-480a-83a3-6f95af9d176d" ], "display_name": true }, { "uuid": "7aeff7f7-9650-4c04-9dcb-8ec337e3cc3d", "name": "1-PROPANONE, 1-(2,4-DIMETHYL-3-CYCLOHEXEN-1-YL)-2,2-DIMETHYL-", "stdName": "1-PROPANONE, 1-(2,4-DIMETHYL-3-CYCLOHEXEN-1-YL)-2,2-DIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6c42bebf-c729-4de1-9530-98d0a2569e35" ], "display_name": false } ], "references": [ { "uuid": "6c42bebf-c729-4de1-9530-98d0a2569e35", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "cca2ce0f-13a9-480a-83a3-6f95af9d176d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d3e731d3-0adb-40e2-b7b7-181d5f1aeec6", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392628000, "tags": [ "NOMEN" ] }, { "uuid": "c7598c7d-329f-477a-9992-4589382b4ca4", "citation": "SRS import [15047ZP82F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=15047ZP82F", "doc_type": "SRS", "public_domain": true, "document_date": 1493392628000, "tags": [ "NOMEN" ] }, { "uuid": "8ee21ddd-e4fc-45b0-ac8a-f12c2177ee81", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b43ba261-2257-4781-ada8-c19f554865c3", "id": "b43ba261-2257-4781-ada8-c19f554865c3", "molfile": "\n Marvin 01132109202D \n\n 14 14 0 0 0 0 999 V2000\n 8.6569 -4.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6569 -5.2105 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.9424 -5.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9424 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2280 -6.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6569 -6.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3713 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3713 -5.6230 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.0858 -5.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0858 -4.3855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8003 -5.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8003 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5147 -6.0355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5147 -5.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 8 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\nM END", "smiles": "CC1=CC(C)C(CC1)C(=O)C(C)(C)C", "formula": "C13H22O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1ae648bb-7c9e-49c1-b378-3270f5cdad60" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "194.3137", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "dc956867-3bd8-4a7c-ab45-0b4603a3b33b", "version": "3", "structure": { "id": "ad1fadf3-870f-4215-b19d-45cf59ce26e9", "molfile": "\n Marvin 01132108592D \n\n 14 14 0 0 0 0 999 V2000\n 7.9424 -5.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6569 -5.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6569 -4.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3713 -5.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0858 -5.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8003 -5.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8003 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5147 -6.0355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5147 -5.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0858 -4.3855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3713 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6569 -6.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9424 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2280 -6.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 5 10 2 0 0 0 0\n 11 4 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 1 13 2 0 0 0 0\n 13 14 1 0 0 0 0\nM END", "smiles": "CC1=CC(C)C(CC1)C(=O)C(C)(C)C", "formula": "C13H22O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "194.3137", "optical_activity": "UNSPECIFIED", "references": [ "c7598c7d-329f-477a-9992-4589382b4ca4", "6c42bebf-c729-4de1-9530-98d0a2569e35" ], "stereo_centers": 2 }, "unii": "15047ZP82F" } ] }