{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "57e03d9f-3179-4337-a2fd-7413d26788dd",
          "code": "75166-31-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=75166-31-3",
          "code_system": "CAS",
          "references": [
            "c15f6d29-e88a-4d8f-b572-0782c52e8544",
            "04fd29ca-13d3-4b28-a2be-f57d5dc43ea1"
          ]
        },
        {
          "uuid": "be2ede0a-1f63-4b7c-9c32-3f008df2c493",
          "code": "1549660",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1549660",
          "code_system": "PUBCHEM",
          "references": [
            "c15f6d29-e88a-4d8f-b572-0782c52e8544"
          ]
        },
        {
          "uuid": "e3c86f16-4780-ffe5-cd64-263bda442818",
          "code": "DTXSID30226155",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30226155",
          "code_system": "EPA CompTox",
          "references": [
            "2a02d8d9-5d59-b40f-571b-0551bd1f71cd"
          ]
        },
        {
          "uuid": "b84cf660-800d-4211-8011-a01b206baeda",
          "code": "14X71K3AMT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fd8219f7-ab78-431e-8d5e-64c5c92cdcee",
          "name": "(-)-2-METHYL-3-(4-TERT-BUTYLPHENYL)PROPANAL",
          "stdName": "(-)-2-METHYL-3-(4-TERT-BUTYLPHENYL)PROPANAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19dfcf10-3832-4b00-8f00-e9b5062b85f6",
            "178890b5-6008-4452-a96c-3ed7e086af20"
          ],
          "display_name": false
        },
        {
          "uuid": "cf8badae-19c8-4bca-8f3a-50b4cbb143cd",
          "name": "(R)-2-METHYL-3-(4-TERT-BUTYLPHENYL)PROPANAL",
          "stdName": "(R)-2-METHYL-3-(4-TERT-BUTYLPHENYL)PROPANAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f766cba9-b3f7-421f-b253-121a7c782ce9",
            "178890b5-6008-4452-a96c-3ed7e086af20"
          ],
          "display_name": false
        },
        {
          "uuid": "2ad384cb-c713-4425-863d-5df921e2b728",
          "name": "BENZENEPROPANAL, 4-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYL-, (.ALPHA.R)-",
          "stdName": "BENZENEPROPANAL, 4-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYL-, (.ALPHA.R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f766cba9-b3f7-421f-b253-121a7c782ce9",
            "178890b5-6008-4452-a96c-3ed7e086af20"
          ],
          "display_name": false
        },
        {
          "uuid": "2cb58e52-fe6c-4147-878d-158acee96752",
          "name": "BENZENEPROPANAL, 4-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYL-, (R)-",
          "stdName": "BENZENEPROPANAL, 4-(1,1-DIMETHYLETHYL)-.ALPHA.-METHYL-, (R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f766cba9-b3f7-421f-b253-121a7c782ce9",
            "178890b5-6008-4452-a96c-3ed7e086af20"
          ],
          "display_name": false
        },
        {
          "uuid": "3b30c453-5a7c-46da-aecc-6f7762d9fd58",
          "name": "BUTYLPHENYL METHYLPROPIONAL, (-)-",
          "stdName": "BUTYLPHENYL METHYLPROPIONAL, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19dfcf10-3832-4b00-8f00-e9b5062b85f6",
            "178890b5-6008-4452-a96c-3ed7e086af20"
          ],
          "display_name": false
        },
        {
          "uuid": "3ad2d7ef-71a0-46d9-b2df-e6a6652d3285",
          "name": "BUTYLPHENYL METHYLPROPIONAL, (R)-",
          "stdName": "BUTYLPHENYL METHYLPROPIONAL, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19dfcf10-3832-4b00-8f00-e9b5062b85f6",
            "178890b5-6008-4452-a96c-3ed7e086af20"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "19dfcf10-3832-4b00-8f00-e9b5062b85f6",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "178890b5-6008-4452-a96c-3ed7e086af20",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f766cba9-b3f7-421f-b253-121a7c782ce9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c15f6d29-e88a-4d8f-b572-0782c52e8544",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391913000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5787794b-9aa2-4c7b-9eb3-4f72e72262d9",
          "citation": "SRS import [14X71K3AMT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=14X71K3AMT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391913000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a02d8d9-5d59-b40f-571b-0551bd1f71cd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=75166-31-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04fd29ca-13d3-4b28-a2be-f57d5dc43ea1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "767eea78-8498-4ec3-a5df-44a79c986af8",
          "id": "767eea78-8498-4ec3-a5df-44a79c986af8",
          "molfile": "\n  Marvin  01132106092D          \n\n 15 15  0  0  1  0            999 V2000\n   15.9564   -7.4694    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   15.9564   -8.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0485   -6.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3358   -7.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6207   -6.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9076   -7.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9076   -8.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6256   -8.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3358   -8.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1948   -8.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6098   -9.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4820   -8.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1948   -9.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6691   -7.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6691   -6.2305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 14  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
          "smiles": "C[C@H](Cc1ccc(cc1)C(C)(C)C)C=O",
          "formula": "C14H20O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6de0a315-ebd9-40b3-85c2-74f4a4e184a7"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "204.3085",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a77fdb64-6e79-4a3e-8e5d-41db1f44af62",
      "version": "3",
      "structure": {
        "id": "52ee524f-081d-45c0-adac-61a546c2293f",
        "molfile": "\n  Marvin  01132104192D          \n\n 15 15  0  0  1  0            999 V2000\n   11.6098   -9.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1948   -8.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9076   -8.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9076   -7.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6207   -6.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3358   -7.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0485   -6.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9564   -7.4694    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.9564   -8.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6691   -7.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6691   -6.2305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3358   -8.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6256   -8.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4820   -8.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1948   -9.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12  6  2  0  0  0  0\n 13 12  1  0  0  0  0\n  3 13  2  0  0  0  0\n  2 14  1  0  0  0  0\n  2 15  1  0  0  0  0\nM  END",
        "smiles": "C[C@H](Cc1ccc(cc1)C(C)(C)C)C=O",
        "formula": "C14H20O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "204.3085",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f766cba9-b3f7-421f-b253-121a7c782ce9",
          "5787794b-9aa2-4c7b-9eb3-4f72e72262d9"
        ],
        "stereo_centers": 1
      },
      "unii": "14X71K3AMT"
    }
  ]
}