{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6ce1004-4425-4bcd-8bbe-0cc52d91611d",
          "code": "99-18-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=99-18-3",
          "code_system": "CAS",
          "references": [
            "3dd5554e-4fbd-4b81-84a0-1c139d7a1bc4",
            "425f67d5-ec0e-4988-83b2-31a883eecafb"
          ]
        },
        {
          "uuid": "6077f2fb-cde7-4794-86b9-bf6ce83a9372",
          "code": "C019063",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67019063",
          "code_system": "MESH",
          "references": [
            "3dd5554e-4fbd-4b81-84a0-1c139d7a1bc4"
          ]
        },
        {
          "uuid": "be24f68b-d18f-49c2-9e1e-75db15688ab0",
          "code": "PRUNASIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Prunasin",
          "code_system": "WIKIPEDIA",
          "references": [
            "3dd5554e-4fbd-4b81-84a0-1c139d7a1bc4"
          ]
        },
        {
          "uuid": "8aa4c143-c10a-4143-8c94-4f07a041d52f",
          "code": "202-738-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.489",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3dd5554e-4fbd-4b81-84a0-1c139d7a1bc4"
          ]
        },
        {
          "uuid": "14fce9fe-009a-4fd0-91ed-37dd0b676f8f",
          "code": "m7054",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7054?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3dd5554e-4fbd-4b81-84a0-1c139d7a1bc4"
          ]
        },
        {
          "uuid": "76ca637e-ae2b-4266-b6be-376a6c5d3c9d",
          "code": "119033",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119033",
          "code_system": "PUBCHEM",
          "references": [
            "3dd5554e-4fbd-4b81-84a0-1c139d7a1bc4"
          ]
        },
        {
          "uuid": "cffb1c92-65ff-4dce-bf86-2829f808eeee",
          "code": "14W4BPM5FB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "44f749bd-5c01-2852-5f4f-f69dbd80531a",
          "code": "25150",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:25150",
          "code_system": "CHEBI",
          "references": [
            "17487586-9fd4-8620-9611-be8f96558e74"
          ]
        },
        {
          "uuid": "adaf1d8a-12ef-841d-9f44-9a42b69b10a5",
          "code": "17396",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17396",
          "code_system": "CHEBI",
          "references": [
            "17487586-9fd4-8620-9611-be8f96558e74"
          ]
        },
        {
          "uuid": "943322fb-a933-c26e-010f-6929fea279b8",
          "code": "DTXSID001018995",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001018995",
          "code_system": "EPA CompTox",
          "references": [
            "4b8e7d72-3d99-3be3-9862-add8eb6c41e2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "544d4b84-e432-43b3-b02e-76cd1e2bd69f",
          "name": "(2R)-PRUNASIN",
          "stdName": "(2R)-PRUNASIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27e058db-632c-47e4-893a-07b84a043682",
            "af0436fb-8cf3-41cb-bf84-bce361f6e6fa"
          ],
          "display_name": false
        },
        {
          "uuid": "8ef7f4d3-a090-440d-a3cc-fd98a9ade8b4",
          "name": "(R)-PRUNASIN",
          "stdName": "(R)-PRUNASIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27e058db-632c-47e4-893a-07b84a043682",
            "af0436fb-8cf3-41cb-bf84-bce361f6e6fa"
          ],
          "display_name": false
        },
        {
          "uuid": "4ec9924f-fd96-4218-889e-84261eb4a74d",
          "name": "BENZENEACETONITRILE, .ALPHA.-(.BETA.-D-GLUCOPYRANOSYLOXY)-, (.ALPHA.R)-",
          "stdName": "BENZENEACETONITRILE, .ALPHA.-(.BETA.-D-GLUCOPYRANOSYLOXY)-, (.ALPHA.R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27e058db-632c-47e4-893a-07b84a043682",
            "af0436fb-8cf3-41cb-bf84-bce361f6e6fa"
          ],
          "display_name": false
        },
        {
          "uuid": "2ca5aa38-bfdf-48ee-bd96-ea83e7347962",
          "name": "BENZENEACETONITRILE, .ALPHA.-(.BETA.-D-GLUCOPYRANOSYLOXY)-, (R)-",
          "stdName": "BENZENEACETONITRILE, .ALPHA.-(.BETA.-D-GLUCOPYRANOSYLOXY)-, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27e058db-632c-47e4-893a-07b84a043682",
            "af0436fb-8cf3-41cb-bf84-bce361f6e6fa"
          ],
          "display_name": false
        },
        {
          "uuid": "bcd183df-a169-48ac-b1a5-0e3075ee4faa",
          "name": "D-PRUNASIN",
          "stdName": "D-PRUNASIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27e058db-632c-47e4-893a-07b84a043682",
            "af0436fb-8cf3-41cb-bf84-bce361f6e6fa"
          ],
          "display_name": false
        },
        {
          "uuid": "fbcb8fa1-c138-4750-91a4-2bb9b07a8438",
          "name": "MANDELONITRILE GLUCOSIDE D-FORM",
          "stdName": "MANDELONITRILE GLUCOSIDE D-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0da4e8b-a549-485c-875e-2882949dfb2e",
            "ad79d36d-b17b-47a3-b0eb-e04d68f0d5fb",
            "af0436fb-8cf3-41cb-bf84-bce361f6e6fa"
          ],
          "display_name": false
        },
        {
          "uuid": "2754de84-f954-4a0c-8fb4-c3c93300e030",
          "name": "MANDELONITRILE GLUCOSIDE D-FORM [MI]",
          "stdName": "MANDELONITRILE GLUCOSIDE D-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0da4e8b-a549-485c-875e-2882949dfb2e",
            "af0436fb-8cf3-41cb-bf84-bce361f6e6fa"
          ],
          "display_name": false
        },
        {
          "uuid": "107b79b1-9689-4f72-b51f-70e00f7b1358",
          "name": "PRUNASIN",
          "stdName": "PRUNASIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21302878-7a70-4e1a-89fe-408061ddbba3",
            "ad746633-d4d3-420d-b0e3-b61e66fc18c7",
            "af0436fb-8cf3-41cb-bf84-bce361f6e6fa",
            "bb284613-3c4e-4e8c-9d27-a911020d407e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bf7b41cb-0287-458f-bb66-7b656b34d6e3",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "21302878-7a70-4e1a-89fe-408061ddbba3",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bb284613-3c4e-4e8c-9d27-a911020d407e",
          "citation": "PCPCP-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af0436fb-8cf3-41cb-bf84-bce361f6e6fa",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27e058db-632c-47e4-893a-07b84a043682",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0da4e8b-a549-485c-875e-2882949dfb2e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dd5554e-4fbd-4b81-84a0-1c139d7a1bc4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391100000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54165994-ec42-4733-9b23-0eb0c1f5cd0c",
          "citation": "SRS import [14W4BPM5FB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=14W4BPM5FB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391100000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba45b1f1-3b26-4ce8-a652-70cb071fda6a",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad746633-d4d3-420d-b0e3-b61e66fc18c7",
          "citation": "PRUNASIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad79d36d-b17b-47a3-b0eb-e04d68f0d5fb",
          "citation": "MANDELONITRILE GLUCOSIDE D-FORM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "425f67d5-ec0e-4988-83b2-31a883eecafb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "17487586-9fd4-8620-9611-be8f96558e74",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4b8e7d72-3d99-3be3-9862-add8eb6c41e2",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f26ec3c2-21b0-491b-b853-7be66811474f",
          "id": "f26ec3c2-21b0-491b-b853-7be66811474f",
          "molfile": "\n  Marvin  01132112342D          \n\n 21 22  0  0  1  0            999 V2000\n   11.3730   -5.7197    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   12.0646   -6.1462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0646   -6.9666    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.7668   -7.3873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7668   -8.2125    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.4781   -8.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1230   -8.2287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0455   -8.6171    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.0455   -9.4422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3498   -8.1922    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.6181   -8.5983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3498   -7.3761    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.6418   -6.9496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6507   -6.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9282   -6.5259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3730   -4.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6711   -4.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6711   -3.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4067   -3.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1149   -3.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1149   -4.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 14  1  0  0  0  0\n  1 16  1  0  0  0  0\n  3  2  1  6  0  0  0\n  3  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 15  3  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)[C@H](C#N)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
          "formula": "C14H17NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f17b7051-6e81-4edd-8808-ecaebad76cc9"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "295.2884",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b87f2f19-c43d-418d-9869-623e32809d18",
      "version": "10",
      "structure": {
        "id": "6452266a-c0c9-4327-b65c-c3ac04f5c913",
        "molfile": "\n  Marvin  01132105132D          \n\n 21 22  0  0  1  0            999 V2000\n   12.7668   -7.3873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0646   -6.9666    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.0646   -6.1462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3730   -5.7197    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.3730   -4.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6711   -4.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6711   -3.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4067   -3.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1149   -3.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1149   -4.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6507   -6.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9282   -6.5259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3498   -7.3761    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.6418   -6.9496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3498   -8.1922    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.6181   -8.5983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0455   -8.6171    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.0455   -9.4422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7668   -8.2125    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.4781   -8.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1230   -8.2287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  6  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10  5  2  0  0  0  0\n  4 11  1  0  0  0  0\n 11 12  3  0  0  0  0\n  2 13  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 19  1  0  0  0  0\n 19  1  1  0  0  0  0\n 19 20  1  6  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)[C@H](C#N)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
        "formula": "C14H17NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "295.2884",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ba45b1f1-3b26-4ce8-a652-70cb071fda6a",
          "54165994-ec42-4733-9b23-0eb0c1f5cd0c"
        ],
        "stereo_centers": 6
      },
      "unii": "14W4BPM5FB"
    }
  ]
}