{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6ae195a-3b2f-4377-8cac-fea365b3c002",
          "code": "131-73-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131-73-7",
          "code_system": "CAS",
          "references": [
            "3691e38e-c859-43a9-801c-654d591f64a0",
            "8c13a2b7-73a7-40f8-9fa5-49defeab4d7c"
          ]
        },
        {
          "uuid": "71d8bfb0-fa88-4a97-a4e6-a184379f3522",
          "code": "C011454",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67011454",
          "code_system": "MESH",
          "references": [
            "3691e38e-c859-43a9-801c-654d591f64a0"
          ]
        },
        {
          "uuid": "8bbccdc3-3ed4-4b16-817a-4844b4f74fc7",
          "code": "HEXANITRODIPHENYLAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hexanitrodiphenylamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "3691e38e-c859-43a9-801c-654d591f64a0"
          ]
        },
        {
          "uuid": "f065b0d0-4487-4331-894b-8f887b149790",
          "code": "m4645",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4645?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3691e38e-c859-43a9-801c-654d591f64a0"
          ]
        },
        {
          "uuid": "f32c0750-1ac2-4eb1-9f01-464c76ebb187",
          "code": "205-037-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.581",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3691e38e-c859-43a9-801c-654d591f64a0"
          ]
        },
        {
          "uuid": "0f78e65e-e209-4b2f-95f9-91e1398a752c",
          "code": "8576",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8576",
          "code_system": "PUBCHEM",
          "references": [
            "3691e38e-c859-43a9-801c-654d591f64a0"
          ]
        },
        {
          "uuid": "62afb956-689a-7d02-8e07-9bd18588c67f",
          "code": "2873",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2873",
          "code_system": "HSDB",
          "references": [
            "089b5e84-40d8-c53d-9e33-418ea9133837"
          ]
        },
        {
          "uuid": "32cf54b2-a3a9-fe83-49e9-87f8c40437f6",
          "code": "DTXSID4059621",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4059621",
          "code_system": "EPA CompTox",
          "references": [
            "2247bec6-aea7-b83a-22dd-756c2f949652"
          ]
        },
        {
          "uuid": "44a028aa-06fb-42ea-bbf4-062d8103d00e",
          "code": "14STR4KG8T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "460d53d2-869e-d575-fff1-af2f6cd88f42",
          "code": "1786",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1786",
          "code_system": "NSC",
          "references": [
            "1cdbfad8-ede4-e1d9-9712-31672d0409de"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6e38d28e-da73-4c45-864c-fac0248de396",
          "name": "DIPICRYLAMINE",
          "stdName": "DIPICRYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d42da29b-c32e-4e94-aff8-7051cf6cb660",
            "5ddc9bde-31c8-4aea-bab3-08e794b2a78d",
            "e314ba29-5d84-447b-8af4-a49f417b97f1",
            "ee15ec11-6200-48c1-970f-47d928bc5362"
          ],
          "display_name": true
        },
        {
          "uuid": "7ae11486-a1f3-4d10-ae38-45028ecd4269",
          "name": "DIPICRYLAMINE [MI]",
          "stdName": "DIPICRYLAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d42da29b-c32e-4e94-aff8-7051cf6cb660",
            "e314ba29-5d84-447b-8af4-a49f417b97f1"
          ],
          "display_name": false
        },
        {
          "uuid": "739df984-4319-4067-b04f-1f8748f60021",
          "name": "HEXANITRODIPHENYLAMINE",
          "stdName": "HEXANITRODIPHENYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d42da29b-c32e-4e94-aff8-7051cf6cb660",
            "d98cded5-1f9b-475d-9f43-5611e97c1ad9"
          ],
          "display_name": false
        },
        {
          "uuid": "38274a31-8e01-4162-9301-77d6df195358",
          "name": "NSC-1786",
          "stdName": "NSC-1786",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d42da29b-c32e-4e94-aff8-7051cf6cb660",
            "82f49260-3b28-455a-94b0-860bf3af4e1f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5ddc9bde-31c8-4aea-bab3-08e794b2a78d",
          "citation": "NCI CADD 2012;WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d42da29b-c32e-4e94-aff8-7051cf6cb660",
          "citation": "NCI DRUG DICTIONARY",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d98cded5-1f9b-475d-9f43-5611e97c1ad9",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e314ba29-5d84-447b-8af4-a49f417b97f1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82f49260-3b28-455a-94b0-860bf3af4e1f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3691e38e-c859-43a9-801c-654d591f64a0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391616000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7676d02-02b5-476d-832d-704ce8564c64",
          "citation": "SRS import [14STR4KG8T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=14STR4KG8T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391616000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f820dcbb-1753-45ca-ac36-59cde4d1495a",
          "citation": "CHEMID  2012",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee15ec11-6200-48c1-970f-47d928bc5362",
          "citation": "DIPICRYLAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "089b5e84-40d8-c53d-9e33-418ea9133837",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+131-73-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2247bec6-aea7-b83a-22dd-756c2f949652",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=131-73-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8c13a2b7-73a7-40f8-9fa5-49defeab4d7c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1cdbfad8-ede4-e1d9-9712-31672d0409de",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "aa18c294-4c21-40ac-bb9b-c22061380bdd",
          "id": "aa18c294-4c21-40ac-bb9b-c22061380bdd",
          "molfile": "\n  Marvin  01132108502D          \n\n 31 32  0  0  0  0            999 V2000\n   -4.2032    0.0174    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -3.4695    0.0209    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -3.4765   -0.8274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6386    0.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2250   -0.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3906   -0.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9942    0.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0550    0.0557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9908    0.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4045    0.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2319    0.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6421    0.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2111   -0.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3942   -0.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3942   -1.4566    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.6884   -1.8738    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1102   -1.8599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4590    0.0591    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.2622    0.0452    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.4730   -0.7092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4150    1.6097    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.6988    2.0337    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3084    1.9364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4080    0.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2354    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4185    1.5853    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.1345    1.9955    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.7127    1.9955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4045   -1.4949    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.1241   -1.8983    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.6918   -1.9121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 25  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6 29  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 24  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 10 21  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 18  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  2  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  2  0  0  0  0\nM  CHG  8   1  -1   2   1  15   1  16  -1  18   1  19  -1  21   1  22  -1\nM  CHG  4  26   1  27  -1  29   1  30  -1\nM  END",
          "smiles": "c1c(cc(c(c1[N+](=O)[O-])Nc2c(cc(cc2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]",
          "formula": "C12H5N7O12",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "267fcb2d-4feb-4454-9ce8-0e611bc101c4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "439.2083",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2ea4ba92-17d1-48a5-95bc-7cdfabce4cfa",
      "version": "5",
      "structure": {
        "id": "01f6cebc-88a2-4c8a-98dc-bb847923f17c",
        "molfile": "\n  Marvin  01132100252D          \n\n 31 32  0  0  0  0            999 V2000\n   -0.9942    0.0452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3906   -0.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4080    0.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0550    0.0557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2250   -0.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4045   -1.4949    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.2354    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4185    1.5853    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.9908    0.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6386    0.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1241   -1.8983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6918   -1.9121    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.1345    1.9955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7127    1.9955    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.4045    0.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3942   -0.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4695    0.0209    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.2319    0.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4150    1.6097    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.2111   -0.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3942   -1.4566    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -4.2032    0.0174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4765   -0.8274    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.6421    0.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6988    2.0337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3084    1.9364    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.6884   -1.8738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1102   -1.8599    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.4590    0.0591    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.2622    0.0452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4730   -0.7092    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n  8 13  2  0  0  0  0\n  8 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n  9 16  2  0  0  0  0\n 10 17  1  0  0  0  0\n 15 18  2  0  0  0  0\n 15 19  1  0  0  0  0\n 16 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 22  2  0  0  0  0\n 17 23  1  0  0  0  0\n 18 24  1  0  0  0  0\n 19 25  2  0  0  0  0\n 19 26  1  0  0  0  0\n 21 27  2  0  0  0  0\n 21 28  1  0  0  0  0\n 24 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n  7 10  1  0  0  0  0\n 20 24  2  0  0  0  0\nM  CHG  8   6   1   8   1  12  -1  14  -1  17   1  19   1  21   1  23  -1\nM  CHG  4  26  -1  28  -1  29   1  31  -1\nM  END",
        "smiles": "c1c(cc(c(c1[N+](=O)[O-])Nc2c(cc(cc2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]",
        "formula": "C12H5N7O12",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "439.2083",
        "optical_activity": "NONE",
        "references": [
          "f820dcbb-1753-45ca-ac36-59cde4d1495a",
          "e7676d02-02b5-476d-832d-704ce8564c64"
        ],
        "stereo_centers": 0
      },
      "unii": "14STR4KG8T"
    }
  ]
}