{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a03d1c81-42b6-4da7-aeb9-ef07f2ded4a5",
          "code": "6223-36-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6223-36-5",
          "code_system": "CAS",
          "references": [
            "390d610c-4674-40bd-8fb9-8c02eb7ba926",
            "8c031d1c-8bd4-4d78-8247-572545a56061"
          ]
        },
        {
          "uuid": "b781824e-a1ac-4fea-9195-ada0e72e3b46",
          "code": "71388501",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71388501",
          "code_system": "PUBCHEM",
          "references": [
            "390d610c-4674-40bd-8fb9-8c02eb7ba926"
          ]
        },
        {
          "uuid": "33edbb64-45a4-5169-d7f9-23b538b11f30",
          "code": "DTXSID50211280",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50211280",
          "code_system": "EPA CompTox",
          "references": [
            "1c067c94-44c3-637c-ae09-647a0bcfec1a"
          ]
        },
        {
          "uuid": "e6ebc8ae-edc2-41d4-9c2f-d90ac296e02e",
          "code": "14E9ARC8U7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "301d4116-8c5e-4360-94ee-0a90726ed767",
          "name": "1-AZULENESULFONIC ACID, 3,8-DIMETHYL-5-(1-METHYLETHYL)-, ETHYL ESTER",
          "stdName": "1-AZULENESULFONIC ACID, 3,8-DIMETHYL-5-(1-METHYLETHYL)-, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "016d8335-3690-44d0-bf5c-b342cccbd144",
            "fcff7658-c7cd-4d93-960b-88aa251b0e5a"
          ],
          "display_name": false
        },
        {
          "uuid": "61a0c73a-6758-417b-b0e9-3fb8a7d9083c",
          "name": "1-AZULENESULFONIC ACID, 5-ISOPROPYL-3,8-DIMETHYL-, ETHYL ESTER",
          "stdName": "1-AZULENESULFONIC ACID, 5-ISOPROPYL-3,8-DIMETHYL-, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "016d8335-3690-44d0-bf5c-b342cccbd144",
            "fcff7658-c7cd-4d93-960b-88aa251b0e5a"
          ],
          "display_name": false
        },
        {
          "uuid": "3abac1b1-7169-4d5c-9bf0-c8e7f5ef5983",
          "name": "ETHYL GUAIAZULENE SULFONATE",
          "stdName": "ETHYL GUAIAZULENE SULFONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "016d8335-3690-44d0-bf5c-b342cccbd144",
            "310535a8-ec62-40c4-b84c-dd46904a61f1",
            "8f474bdf-b645-4238-8992-b4630d58d984"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a15eca7d-1709-4912-9603-5695ada39cf8",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "8f474bdf-b645-4238-8992-b4630d58d984",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "016d8335-3690-44d0-bf5c-b342cccbd144",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcff7658-c7cd-4d93-960b-88aa251b0e5a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "390d610c-4674-40bd-8fb9-8c02eb7ba926",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391524000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae3ec3f0-5225-40f4-98fa-3094c521142c",
          "citation": "SRS import [14E9ARC8U7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=14E9ARC8U7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391524000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "310535a8-ec62-40c4-b84c-dd46904a61f1",
          "citation": "ETHYL GUAIAZULENE SULFONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c067c94-44c3-637c-ae09-647a0bcfec1a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6223-36-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8c031d1c-8bd4-4d78-8247-572545a56061",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "03a8a6c1-131d-45a6-b0e2-e77b0e595e42",
          "id": "03a8a6c1-131d-45a6-b0e2-e77b0e595e42",
          "molfile": "\n  Marvin  01132100302D          \n\n 21 22  0  0  0  0            999 V2000\n    4.7138   -2.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5388   -2.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9513   -2.8995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7763   -2.8995    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6013   -2.8995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7763   -2.0745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7763   -3.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1088   -4.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3638   -4.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8788   -5.6614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1888   -4.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6433   -5.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4649   -5.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0351   -5.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9243   -4.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2161   -3.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2900   -3.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4437   -4.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7548   -6.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5687   -6.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2309   -7.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  2  0  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n 18  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 18 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 13 19  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\nM  END",
          "smiles": "CCOS(=O)(=O)c1cc(C)c-2cc(ccc(C)c21)C(C)C",
          "formula": "C17H22O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3a78f35-05bf-4226-861c-57cbe0ae572e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "306.4215",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4399cba1-609e-4937-8299-ac14fabf9b21",
      "version": "4",
      "structure": {
        "id": "5df6d5a8-6e5c-4c1f-8653-41828f6e5676",
        "molfile": "\n  Marvin  01132104522D          \n\n 21 22  0  0  0  0            999 V2000\n    7.4437   -4.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1888   -4.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6433   -5.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4649   -5.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0351   -5.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9243   -4.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2161   -3.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3638   -4.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7763   -3.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1088   -4.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2900   -3.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8788   -5.6614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7548   -6.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5687   -6.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2309   -7.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7763   -2.8995    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9513   -2.8995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5388   -2.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7138   -2.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6013   -2.8995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7763   -2.0745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  7  6  2  0  0  0  0\n  1  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  8  2  0  0  0  0\n  2  8  1  0  0  0  0\n  1  9  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  4 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n  9 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 16 20  2  0  0  0  0\n 16 21  2  0  0  0  0\n  5  6  1  0  0  0  0\nM  END",
        "smiles": "CCOS(=O)(=O)c1cc(C)c-2cc(ccc(C)c21)C(C)C",
        "formula": "C17H22O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "306.4215",
        "optical_activity": "NONE",
        "references": [
          "ae3ec3f0-5225-40f4-98fa-3094c521142c",
          "fcff7658-c7cd-4d93-960b-88aa251b0e5a"
        ],
        "stereo_centers": 0
      },
      "unii": "14E9ARC8U7"
    }
  ]
}