{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "40ddbeef-45fa-4b23-ae3c-9c2acf52fdda",
          "code": "60207-90-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60207-90-1",
          "code_system": "CAS",
          "references": [
            "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b",
            "77c9a114-0250-4d7d-b4b9-4d94f5f2c8a9"
          ]
        },
        {
          "uuid": "2b3b0081-87e1-4a28-97c9-5e65677f79f4",
          "code": "C97997",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C97997",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b"
          ]
        },
        {
          "uuid": "038a7aa8-eba9-47ce-9035-e57462b79b8e",
          "code": "C045950",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67045950",
          "code_system": "MESH",
          "references": [
            "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b"
          ]
        },
        {
          "uuid": "18019971-ff52-4875-8db9-176f1d26af07",
          "code": "PROPICONAZOLE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Propiconazole",
          "code_system": "WIKIPEDIA",
          "references": [
            "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b"
          ]
        },
        {
          "uuid": "3ba82205-515e-4ad3-81f5-da457e5e083f",
          "code": "122101",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3606",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b"
          ]
        },
        {
          "uuid": "c4d43d54-b8da-4f8b-ada9-22ff2f3818fa",
          "code": "262-104-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.441",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b"
          ]
        },
        {
          "uuid": "d1fdee8e-4f13-4953-9dc6-489f6c2bd436",
          "code": "m9202",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9202?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b"
          ]
        },
        {
          "uuid": "000153f9-d46f-4b8c-bfab-e6c7fbccfd61",
          "code": "43234",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/43234",
          "code_system": "PUBCHEM",
          "references": [
            "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b"
          ]
        },
        {
          "uuid": "b3594a09-9684-fe54-fdd7-3e48bd0b0075",
          "code": "6731",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6731",
          "code_system": "HSDB",
          "references": [
            "4f06e4c3-ea88-32f0-61c5-3fc14dcbfd63"
          ]
        },
        {
          "uuid": "6bd7836c-9927-cc3c-9c2e-9b1c64bf82f0",
          "code": "DTXSID8024280",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024280",
          "code_system": "EPA CompTox",
          "references": [
            "bb4b3b06-3fdc-ca75-e3b2-2491c70ba43a"
          ]
        },
        {
          "uuid": "406df35d-7d0b-fb4c-4125-74ed810f9201",
          "code": "C514",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antifungal Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C514",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fc457319-2939-dfa1-fc93-9412c8b7e5ae"
          ]
        },
        {
          "uuid": "2024c346-017c-461a-a3bb-421b816aefa6",
          "code": "142KW8TBSR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8187db29-ee10-b7e0-c0f8-bda1ab31336f",
          "code": "8489",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8489",
          "code_system": "CHEBI",
          "references": [
            "fc457319-2939-dfa1-fc93-9412c8b7e5ae"
          ]
        },
        {
          "uuid": "0532a2b2-ea3b-d3a5-952f-006d26bf7ebe",
          "code": "propiconazole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/propiconazole.html",
          "code_system": "ALANWOOD",
          "references": [
            "e51a3d87-034f-1c19-7d47-85953b759e0e"
          ]
        },
        {
          "uuid": "bd9256cf-b6a4-2b11-95f2-c48c1b301575",
          "code": "300000053552",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a2c5686f-bcaa-d3ce-845f-6574d5052b0e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0c456c3a-5666-456e-9bda-5f17896b46ca",
          "amount": {
            "uuid": "76628ebf-fab1-4f53-ac94-7cc859c8199a"
          },
          "type": "IMPURITY->PARENT",
          "related_substance": {
            "uuid": "71a71f17-ffa5-4332-95f1-01f7aa075fbd",
            "refuuid": "83d4f320-dbf6-4c65-9ac8-a97e0f1c3370",
            "name": "Propiconazole-4H-1,2,4-triazole",
            "unii": "C7G6MR7ALK",
            "linking_id": "C7G6MR7ALK",
            "ref_pname": "Propiconazole-4H-1,2,4-triazole",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fc2bf8b8-d7f3-447c-873d-504c2db3dd76",
          "name": "(±)-1H-1,2,4-TRIAZOLE, 1-((2-(2,4-DICHLOROPHENYL)-4-PROPYL-1,3-DIOXOLAN-2-YL)METHYL)-",
          "stdName": "(+/-)-1H-1,2,4-TRIAZOLE, 1-((2-(2,4-DICHLOROPHENYL)-4-PROPYL-1,3-DIOXOLAN-2-YL)METHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566977dd-e1a7-4677-b916-280e495cb1dc",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "9bb9f371-f34b-4c94-8f09-5a05dc27319e",
          "name": "1-((2-(2,4-DICHLOROPHENYL)-4-PROPYL-1,3-DIOXOLAN-2-YL)METHYL)-1H-1,2,4-TRIAZOLE",
          "stdName": "1-((2-(2,4-DICHLOROPHENYL)-4-PROPYL-1,3-DIOXOLAN-2-YL)METHYL)-1H-1,2,4-TRIAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "ee8d765e-60a3-42d5-9b32-bcc08a0af7cf",
          "name": "1H-1,2,4-TRIAZOLE, 1-((2-(2,4-DICHLOROPHENYL)-4-PROPYL-1,3-DIOXOLAN-2-YL)METHYL)-",
          "stdName": "1H-1,2,4-TRIAZOLE, 1-((2-(2,4-DICHLOROPHENYL)-4-PROPYL-1,3-DIOXOLAN-2-YL)METHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566977dd-e1a7-4677-b916-280e495cb1dc",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "18e98bd6-90b2-440d-bafe-15b456f78e84",
          "name": "BAMPER",
          "stdName": "BAMPER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566977dd-e1a7-4677-b916-280e495cb1dc",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "95343caf-aa48-4b12-b982-249d1ff4e69a",
          "name": "BANNER",
          "stdName": "BANNER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "309d7336-7a30-42a1-8383-92f5b5699e16",
          "name": "CGA-64250",
          "stdName": "CGA-64250",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "433fa9c5-0a6c-4b67-b607-ebb51615f9bd",
          "name": "ORBIT",
          "stdName": "ORBIT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "b086d9e7-9a46-45d4-9389-a8f912ad92ee",
          "name": "PROPICONAZOLE",
          "stdName": "PROPICONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d17f8a3-9176-4248-ab7e-9f4e720fc347",
            "85386c74-0219-4447-86e9-9838186e5eeb",
            "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
            "e3f15c9a-ad38-45e5-841a-6c56991610b2",
            "c329849e-c13a-4a2f-8944-37d633ba20a2",
            "82fbf5c9-5262-4993-8977-e3103840e034",
            "2b2a327c-0d4b-4d38-a927-edabb3ed7b8b",
            "4a7c660e-6cfa-45c7-a036-344497843c1e"
          ],
          "display_name": true
        },
        {
          "uuid": "ce1c88b5-93cf-4fc6-b7d2-49356e0f8f7f",
          "name": "PROPICONAZOLE [HSDB]",
          "stdName": "PROPICONAZOLE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85386c74-0219-4447-86e9-9838186e5eeb",
            "4a7c660e-6cfa-45c7-a036-344497843c1e"
          ],
          "display_name": false
        },
        {
          "uuid": "7b6fd573-0520-4090-965f-82d4e7fc2c65",
          "name": "PROPICONAZOLE [ISO]",
          "stdName": "PROPICONAZOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85386c74-0219-4447-86e9-9838186e5eeb",
            "82fbf5c9-5262-4993-8977-e3103840e034"
          ],
          "display_name": false
        },
        {
          "uuid": "ecd928b0-7cc7-4ef9-88dd-45d9a49ce463",
          "name": "PROPICONAZOLE [MI]",
          "stdName": "PROPICONAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "ddf23eee-c26d-420f-8a64-a23a8f03d8bc",
          "name": "PROPIMAX",
          "stdName": "PROPIMAX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "3a28ae1a-7429-4ee6-96ba-1ca1d7cd9e79",
          "name": "S 2140",
          "stdName": "S 2140",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566977dd-e1a7-4677-b916-280e495cb1dc",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "3377c4cf-a20c-4cfd-8c5a-2258f7b73ec6",
          "name": "S-2140",
          "stdName": "S-2140",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566977dd-e1a7-4677-b916-280e495cb1dc",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "dda9128d-7a1a-44dc-a908-4ffa91686d48",
          "name": "TILT",
          "stdName": "TILT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        },
        {
          "uuid": "f8900498-385f-4173-aac9-807469b63773",
          "name": "WOCOSIN",
          "stdName": "WOCOSIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566977dd-e1a7-4677-b916-280e495cb1dc",
            "85386c74-0219-4447-86e9-9838186e5eeb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2b2a327c-0d4b-4d38-a927-edabb3ed7b8b",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "85386c74-0219-4447-86e9-9838186e5eeb",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "566977dd-e1a7-4677-b916-280e495cb1dc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6b46ed6-1ba1-4606-b1f8-7460a9895f7d",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a7c660e-6cfa-45c7-a036-344497843c1e",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82fbf5c9-5262-4993-8977-e3103840e034",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5b4b38a-5ec6-4dc0-80ad-d7e01f46bd9b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391227000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6556e5cb-eefb-4550-ab68-5582a96a46e2",
          "citation": "SRS import [142KW8TBSR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=142KW8TBSR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391227000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92097b2d-f7c2-457e-a2ff-594e0e1b259d",
          "citation": "http://www.commonchemistry.org/ChemicalDetail.aspx?ref=60207-90-1",
          "url": "http://www.commonchemistry.org/ChemicalDetail.aspx?ref=60207-90-1",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d17f8a3-9176-4248-ab7e-9f4e720fc347",
          "citation": "PROPICONAZOLE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3f15c9a-ad38-45e5-841a-6c56991610b2",
          "citation": "PROPICONAZOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c329849e-c13a-4a2f-8944-37d633ba20a2",
          "citation": "PROPICONAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4f06e4c3-ea88-32f0-61c5-3fc14dcbfd63",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+60207-90-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bb4b3b06-3fdc-ca75-e3b2-2491c70ba43a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=60207-90-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fc457319-2939-dfa1-fc93-9412c8b7e5ae",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e51a3d87-034f-1c19-7d47-85953b759e0e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "77c9a114-0250-4d7d-b4b9-4d94f5f2c8a9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a2c5686f-bcaa-d3ce-845f-6574d5052b0e",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "92600924-9c84-4b59-8992-63aa1fb2d8e2",
          "id": "92600924-9c84-4b59-8992-63aa1fb2d8e2",
          "molfile": "\n  Marvin  01132107352D          \n\n 22 24  0  0  0  0            999 V2000\n    3.9840   -1.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2315   -2.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1449   -2.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3927   -3.2800    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.2246   -4.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4042   -4.1707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0672   -3.4176    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.3573   -3.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3573   -4.6510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3096   -5.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0546   -5.9211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7690   -5.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0266   -5.1392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6811   -2.8627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5794   -2.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2335   -2.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7244   -2.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3886   -1.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8753   -0.7537    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.4332   -1.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9151   -1.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7372   -1.9080    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n 14  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 14  1  0  0  0  0\n 15  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 13  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "CCCC1COC(Cn2cncn2)(c3ccc(cc3Cl)Cl)O1",
          "formula": "C15H17Cl2N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7681fa9e-3ab3-4a0c-b9fd-2a0a9062ace9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.2208",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ffc96902-55d5-4d22-8830-ac59f31b183b",
      "version": "11",
      "structure": {
        "id": "1a28e352-a26e-4e1a-a24c-9c73b9762c72",
        "molfile": "\n  Marvin  01132101322D          \n\n 22 24  0  0  0  0            999 V2000\n   -0.0546   -5.9211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3096   -5.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3573   -4.6510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0266   -5.1392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7690   -5.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3573   -3.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0672   -3.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4042   -4.1707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2246   -4.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3927   -3.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1449   -2.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2315   -2.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9840   -1.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6811   -2.8627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5794   -2.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9151   -1.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7372   -1.9080    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.4332   -1.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3886   -1.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8753   -0.7537    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7244   -2.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2335   -2.8369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 10  1  0  0  0  0\n  7 14  1  0  0  0  0\n 15  7  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 15 22  1  0  0  0  0\nM  END",
        "smiles": "CCCC1COC(Cn2cncn2)(c3ccc(cc3Cl)Cl)O1",
        "formula": "C15H17Cl2N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.2208",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "92097b2d-f7c2-457e-a2ff-594e0e1b259d",
          "6556e5cb-eefb-4550-ab68-5582a96a46e2"
        ],
        "stereo_centers": 2
      },
      "unii": "142KW8TBSR"
    }
  ]
}