{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a3badfc8-f6ae-4cc2-b130-9fa3e471a4c6",
          "code": "21626-89-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=21626-89-1",
          "code_system": "CAS",
          "references": [
            "7f46ad59-d1ce-4bc6-bad9-7f402fbbda79",
            "93654589-09e6-4c4b-b621-09a26ed46981"
          ]
        },
        {
          "uuid": "cceaf315-333b-4962-8a97-b32e5cfcdadb",
          "code": "C100108",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67100108",
          "code_system": "MESH",
          "references": [
            "7f46ad59-d1ce-4bc6-bad9-7f402fbbda79"
          ]
        },
        {
          "uuid": "51a8302a-d60c-42a6-9993-f844f17b2925",
          "code": "SUB07132MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7f46ad59-d1ce-4bc6-bad9-7f402fbbda79"
          ]
        },
        {
          "uuid": "c73758cb-e723-49c6-a3cf-077771aa26af",
          "code": "3446",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3446",
          "code_system": "INN",
          "references": [
            "7f46ad59-d1ce-4bc6-bad9-7f402fbbda79"
          ]
        },
        {
          "uuid": "070885e3-1b58-4d09-ab49-a411d02dfb4a",
          "code": "CHEMBL1536675",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1536675",
          "code_system": "ChEMBL",
          "references": [
            "7f46ad59-d1ce-4bc6-bad9-7f402fbbda79"
          ]
        },
        {
          "uuid": "2b51b8c3-e253-49e2-a6bf-3a82d8c1c320",
          "code": "244-484-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.040.426",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7f46ad59-d1ce-4bc6-bad9-7f402fbbda79"
          ]
        },
        {
          "uuid": "5bc4de80-2914-4af2-b3d4-e117a8eb382e",
          "code": "30717",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/30717",
          "code_system": "PUBCHEM",
          "references": [
            "7f46ad59-d1ce-4bc6-bad9-7f402fbbda79"
          ]
        },
        {
          "uuid": "867ca003-ff53-0d73-3a8f-fc26315bdacb",
          "code": "DTXSID3020469",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3020469",
          "code_system": "EPA CompTox",
          "references": [
            "5d04c3fe-4c6f-562e-d36b-86a27b086dea"
          ]
        },
        {
          "uuid": "c29564ba-77e0-b780-797b-4fe4ddcc1423",
          "code": "C166457",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C166457",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7c6b032e-2961-3aae-273f-e020de7c14da"
          ]
        },
        {
          "uuid": "2efdfc3f-4246-484a-bac2-9ebdd7f41d39",
          "code": "142FG4G74X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "27830bd7-1436-12d7-42e2-9191bfeadbcb",
          "code": "100000082604",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2c505f62-7316-5b63-97de-094dba879f5c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c6fa6707-2b3b-48f8-abde-ce26b21d5334",
          "amount": {
            "uuid": "8b70954b-be42-4cca-9839-0b4cedf2cf2e"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b7004e59-fc2e-44c5-96a8-7acff31425a5",
            "refuuid": "9d9aaa28-d5dc-4495-bd99-1808045991dc",
            "name": "DIFTALONE",
            "unii": "142FG4G74X",
            "linking_id": "142FG4G74X",
            "ref_pname": "DIFTALONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "07165058-ae99-4b0c-8921-cb45a86cdb11",
          "amount": {
            "uuid": "ac6bb8d7-f498-42a8-9f3e-5d0d4d37e0a4"
          },
          "comments": "Anti-convulsant effect with no relation to its anti-inflammatory properties.  Same mode of action as seen with diphenylhydratoin and carbamazepine. Target assumed from similarity with ",
          "type": "TARGET->INHIBITOR",
          "references": [
            "6dc2f57b-a419-4039-907a-3da7d9e6eb41"
          ],
          "related_substance": {
            "uuid": "d52cba03-8c96-4477-b755-02c16b93599a",
            "refuuid": "7ce8de6e-75b5-474a-ba0c-8e96fc932a03",
            "name": "SODIUM CHANNEL PROTEIN TYPE 1 SUBUNIT ALPHA",
            "unii": "PIV978KC1N",
            "linking_id": "PIV978KC1N",
            "ref_pname": "SODIUM CHANNEL PROTEIN TYPE 1 SUBUNIT ALPHA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ce208b7c-174b-4d25-ba67-2f0dbf0a3720",
          "amount": {
            "uuid": "08ce8830-3e54-4dc2-86ab-57b96c3ce8cb"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "d5d6d9b7-a613-4c19-89d2-08981fb1d821"
          ],
          "related_substance": {
            "uuid": "ef2292bf-8b55-442a-adc7-038e7cf6b6fc",
            "refuuid": "96aca590-4206-4721-bc4b-95d02aa3a057",
            "name": "COX-2",
            "unii": "D8T754TT2I",
            "linking_id": "D8T754TT2I",
            "ref_pname": "COX-2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bd720cce-5255-40a9-92b4-ae0e4dad75a5",
          "amount": {
            "uuid": "fadfbca2-fe81-4b3e-b636-96c2e0a9aebf"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "d5d6d9b7-a613-4c19-89d2-08981fb1d821"
          ],
          "related_substance": {
            "uuid": "8934ba37-c18c-4bf7-88ad-9763ca233a07",
            "refuuid": "9f6c5c85-58e1-4128-ae38-8cb7fedbaf99",
            "name": "COX-1",
            "unii": "E6HDG0QI46",
            "linking_id": "E6HDG0QI46",
            "ref_pname": "COX-1",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c5a3493-7a48-4ec6-97f5-62ca68aead20",
          "name": "DIFTALONE",
          "stdName": "DIFTALONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a95dd4ef-848f-4ea1-a911-0e955cc90787",
            "4bc7f296-031e-4345-a50e-c0623b625746",
            "4ce04d92-0103-431a-a42c-03a9af227dd2",
            "f21cb65f-168e-4335-b61f-c370c037f424",
            "4a568ec7-804b-48cd-abfe-7d78ea3d15e7"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "586425cb-23cd-4899-a9fc-0121a043ddf6",
              "name_org": "INN"
            },
            {
              "uuid": "45d0d116-7975-4638-b4b5-41381f031a35",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "f9a358b2-f637-4773-bce4-f7fc940847b8",
          "name": "DIFTALONE [USAN]",
          "stdName": "DIFTALONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a568ec7-804b-48cd-abfe-7d78ea3d15e7"
          ],
          "display_name": false
        },
        {
          "uuid": "e1e7889f-3cd5-4951-8293-2c180371121f",
          "name": "L-5418",
          "stdName": "L-5418",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "484415e0-1a5d-474a-b5b4-d777f315ae7e"
          ],
          "display_name": false
        },
        {
          "uuid": "fdad6855-6074-412d-b2e5-47c6329221df",
          "name": "L5418",
          "stdName": "L5418",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91cb73ee-df11-4928-9777-d4700c2223fe"
          ],
          "display_name": false
        },
        {
          "uuid": "5c964a79-af56-40e4-aa79-27e0b4a58683",
          "name": "PHTHALAZINO(2,3-B)PHTHALAZINE-5,12(7H,14H)-DIONE",
          "stdName": "PHTHALAZINO(2,3-B)PHTHALAZINE-5,12(7H,14H)-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "484415e0-1a5d-474a-b5b4-d777f315ae7e"
          ],
          "display_name": false
        },
        {
          "uuid": "053477f0-542d-4b99-bed0-2421878c7909",
          "name": "diftalone [INN]",
          "stdName": "DIFTALONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a95dd4ef-848f-4ea1-a911-0e955cc90787"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4bc7f296-031e-4345-a50e-c0623b625746",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "484415e0-1a5d-474a-b5b4-d777f315ae7e",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a95dd4ef-848f-4ea1-a911-0e955cc90787",
          "citation": "INN Proposed List 30",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL30.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4a568ec7-804b-48cd-abfe-7d78ea3d15e7",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f46ad59-d1ce-4bc6-bad9-7f402fbbda79",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389674000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3707731-f4e0-4364-996d-357f9b1aff54",
          "citation": "SRS import [142FG4G74X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=142FG4G74X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389674000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ce04d92-0103-431a-a42c-03a9af227dd2",
          "citation": "DIFTALONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f21cb65f-168e-4335-b61f-c370c037f424",
          "citation": "DIFTALONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d04c3fe-4c6f-562e-d36b-86a27b086dea",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=21626-89-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2c505f62-7316-5b63-97de-094dba879f5c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "7c6b032e-2961-3aae-273f-e020de7c14da",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "93654589-09e6-4c4b-b621-09a26ed46981",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6dc2f57b-a419-4039-907a-3da7d9e6eb41",
          "citation": "Fujimura, H., et al. \"Pharmacological study of phthalazino-(2, 3-b)-phthalazine-5 (14H), 12 (7H)-dione (L-5418).\" Nihon Yakurigaku zasshi. Folia Pharmacologica Japonica 70.3 (1974): 479-505.",
          "url": "https://www.jstage.jst.go.jp/article/jphs1951/28/1/28_1_1/_article/-char/ja/",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "d5d6d9b7-a613-4c19-89d2-08981fb1d821",
          "citation": "Fujimura, H., et al. \"Pharmacological study of phthalazino-(2, 3-b)-phthalazine-5 (14H), 12 (7H)-dione (L-5418).\" Nihon Yakurigaku zasshi. Folia Pharmacologica Japonica 70.3 (1974): 479-505.",
          "url": "https://www.jstage.jst.go.jp/article/fpj1944/70/3/70_3_479/_pdf",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "91cb73ee-df11-4928-9777-d4700c2223fe",
          "citation": "MHRA",
          "doc_type": "MHRSA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c3471aa0-e7af-4f6e-a72d-8f5866c85fc6",
          "id": "c3471aa0-e7af-4f6e-a72d-8f5866c85fc6",
          "molfile": "\n  Marvin  01132110062D          \n\n 20 23  0  0  0  0            999 V2000\n    2.1431   -3.2907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1431   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8497   -2.0580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5538   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2733   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9825   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6969   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6969   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9825   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2733   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5538   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5538    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8497   -1.2327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1431   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4236   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7144   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7144   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4236   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n 20  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 13  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 20  2  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)CN3C(=O)c4ccccc4CN3C2=O",
          "formula": "C16H12N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8e3779ad-3869-468f-af7f-55f36df5ef54"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "264.2793",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9d9aaa28-d5dc-4495-bd99-1808045991dc",
      "version": "10",
      "structure": {
        "id": "d8b94dfb-0bfd-42ae-a1a0-f6c922902a45",
        "molfile": "\n  Marvin  01132111142D          \n\n 20 23  0  0  0  0            999 V2000\n    2.8497   -2.0580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8497   -1.2327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5538   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1431   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5538   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1431   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2733   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4236   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2733   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4236   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1431   -3.2907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5538    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9825   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7144   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7144   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9825   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6969   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6969   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  4  2  0  0  0  0\n 12  3  2  0  0  0  0\n 13  7  2  0  0  0  0\n 14  8  2  0  0  0  0\n 15 10  2  0  0  0  0\n 16  9  2  0  0  0  0\n 17 14  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20 17  2  0  0  0  0\n  7  3  1  0  0  0  0\n 10  6  1  0  0  0  0\n 18 13  1  0  0  0  0\n 20 15  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)CN3C(=O)c4ccccc4CN3C2=O",
        "formula": "C16H12N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "264.2793",
        "optical_activity": "NONE",
        "references": [
          "f3707731-f4e0-4364-996d-357f9b1aff54",
          "4bc7f296-031e-4345-a50e-c0623b625746",
          "a95dd4ef-848f-4ea1-a911-0e955cc90787"
        ],
        "stereo_centers": 0
      },
      "unii": "142FG4G74X"
    }
  ]
}