{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d6fc2c00-8dc7-43bf-97f1-265930bff08f",
          "code": "G03XA02",
          "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|OTHER SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|Antigonadotropins and similar agents|gestrinone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=G03XA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "d6aff9fd-926b-4597-9a83-900dd956f4d7",
          "code": "QG03XA02",
          "comments": "VATC|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|OTHER SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|Antigonadotropins and similar agents|gestrinone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QG03XA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "c90fb756-9e6f-4a34-895f-a61b89e9bd0c",
          "code": "16320-04-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16320-04-0",
          "code_system": "CAS",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f",
            "0c2e569c-a51d-49f6-ab5f-3fc977b6efba"
          ]
        },
        {
          "uuid": "38144c03-a05b-4bb4-9574-e28f9ddb0539",
          "code": "C87241",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87241",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "c6221d2f-3930-48a7-a9b7-3f133531bf2f",
          "code": "D005867",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005867",
          "code_system": "MESH",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "6ad70e4b-2b81-4371-a73c-7bbd9b87a2a1",
          "code": "SUB13963MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "a46847cd-cec3-44f2-9990-b2ea55e21018",
          "code": "4285",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4285",
          "code_system": "INN",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "64510446-c0a7-4e59-b866-9b18a9f78169",
          "code": "4792",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4792/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "2cd4a4d6-145e-4454-94ec-4f59d2e616a6",
          "code": "m5719",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5719?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "5be58147-8c80-4322-85ba-85ae4c2983e7",
          "code": "CHEMBL1868702",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1868702",
          "code_system": "ChEMBL",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "d87bbf71-0a6f-4442-9501-cc913fbe4692",
          "code": "27812",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27812",
          "code_system": "PUBCHEM",
          "references": [
            "7538596c-e34e-407c-b803-7bd1a3acd85f"
          ]
        },
        {
          "uuid": "3d673280-473b-6795-3e3a-918f337dc2ce",
          "code": "Gestrinone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Gestrinone",
          "code_system": "WIKIPEDIA",
          "references": [
            "f00999d1-2738-651b-3897-c37d5d8f3d90"
          ]
        },
        {
          "uuid": "52c0e07e-88a3-18fa-ae69-81fc8d8d343a",
          "code": "DTXSID4023094",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023094",
          "code_system": "EPA CompTox",
          "references": [
            "52e4b0a0-2a5e-5eb3-4c4e-aca1c0c9f866"
          ]
        },
        {
          "uuid": "1f6bf98d-885b-6019-868f-87ccd2d37171",
          "code": "C776",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Progestin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C776",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f076f45b-433a-f0f6-75df-f08f3d4fff35"
          ]
        },
        {
          "uuid": "95f3ae12-5114-4da5-b0ef-4f393bd12827",
          "code": "1421533RCM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c9fc18c1-b410-0003-abf0-d2c8352c5be1",
          "code": "1292",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1292",
          "code_system": "DRUG CENTRAL",
          "references": [
            "f076f45b-433a-f0f6-75df-f08f3d4fff35"
          ]
        },
        {
          "uuid": "b8946ac1-d6fb-ca98-4a81-4159fda1d68f",
          "code": "DB11619",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11619",
          "code_system": "DRUG BANK",
          "references": [
            "f076f45b-433a-f0f6-75df-f08f3d4fff35"
          ]
        },
        {
          "uuid": "c0b8b469-518d-51fe-3138-35f5b4723146",
          "code": "100000078182",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e58539b9-352c-a193-6406-287087894c5b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "58ee00b4-0720-4f9c-84b0-26ee7185351f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "fe097a8d-6309-4b38-bf7f-62d0dce140fc",
            "refuuid": "47edf1f2-8298-46d8-9fb1-e6c805bcba7e",
            "name": "GESTRINONE",
            "unii": "1421533RCM",
            "linking_id": "1421533RCM",
            "ref_pname": "GESTRINONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2654fdf0-f72d-4d66-80d0-c53d185b7f92",
          "name": "13-Ethyl-17-hydroxy-18,19-dinor-17α-pregna-4,9,11-trien-20-yn-3-one",
          "stdName": "13-ETHYL-17-HYDROXY-18,19-DINOR-17.ALPHA.-PREGNA-4,9,11-TRIEN-20-YN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c692475b-9e15-429d-9639-9c65d454042d"
          ],
          "display_name": false
        },
        {
          "uuid": "b84febe7-ba52-45e5-9129-0c8de7c4a143",
          "name": "18,19-DINORPREGNA-4,9,11-TRIEN-20-YN-3-ONE, 13-ETHYL-17-HYDROXY-, (17.ALPHA.)-",
          "stdName": "18,19-DINORPREGNA-4,9,11-TRIEN-20-YN-3-ONE, 13-ETHYL-17-HYDROXY-, (17.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3bcc0fb-472c-4c47-9e95-626a54264833"
          ],
          "display_name": false
        },
        {
          "uuid": "4486df96-fd76-4868-8254-9b4a2a50b9e6",
          "name": "A 46 745",
          "stdName": "A 46 745",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c692475b-9e15-429d-9639-9c65d454042d"
          ],
          "display_name": false
        },
        {
          "uuid": "d56075ea-9e6b-43a3-bff6-f0e3bdb76510",
          "name": "A-46-745",
          "stdName": "A-46-745",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0672c013-83c9-4731-9019-730b4b8c0663"
          ],
          "display_name": false
        },
        {
          "uuid": "7fd23fb5-b01d-4fef-9a84-a69000ce75c5",
          "name": "A-46745",
          "stdName": "A-46745",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90c4acc9-e6f5-4440-a338-636423a287f7"
          ],
          "display_name": false
        },
        {
          "uuid": "78b4a54d-c8ba-4e4b-af26-fb4979c97cbf",
          "name": "GESTRINONE",
          "stdName": "GESTRINONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ac425f7-9ad2-412b-8f80-c6d5338a41b7",
            "c2ed341c-b537-4097-bcee-def0769479db",
            "5a2a1d15-773d-465c-b0bf-a8d0d100139a",
            "7732f8b8-67e6-4c84-a2dd-58377da2b61c",
            "d21f2550-f7e3-4662-980d-62a18a37d3a3",
            "713980ff-9406-48e9-a81b-f2ff347d99c2",
            "450cedf0-2920-4311-a590-e61d73ed5232",
            "f3165e6b-497f-4054-bfd8-c7f0a774c1c5",
            "c692475b-9e15-429d-9639-9c65d454042d",
            "1428794f-dba1-4e35-ac1c-75f29d8af3f9",
            "e3985296-31ae-424a-8359-72b1050466cf"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "50e0d41f-532f-4b0e-9288-5152c8606f8c",
              "name_org": "INN"
            },
            {
              "uuid": "5acc9c54-97a3-4291-b5b8-766789e399b4",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "e1c1713d-fa24-cbd8-e4f3-cdf090d4adf3",
          "name": "GESTRINONE [JAN]",
          "stdName": "GESTRINONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa166a64-f7d8-8092-ce27-954397106a56"
          ],
          "display_name": false
        },
        {
          "uuid": "3a7e406e-7f61-4df7-8ca3-a29fb537fa47",
          "name": "GESTRINONE [MART.]",
          "stdName": "GESTRINONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3165e6b-497f-4054-bfd8-c7f0a774c1c5"
          ],
          "display_name": false
        },
        {
          "uuid": "212ff505-f17b-4087-b764-99789613e9a5",
          "name": "GESTRINONE [MI]",
          "stdName": "GESTRINONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ac425f7-9ad2-412b-8f80-c6d5338a41b7"
          ],
          "display_name": false
        },
        {
          "uuid": "d2f73dfd-3906-4f71-8c98-7fdee161195d",
          "name": "GESTRINONE [USAN]",
          "stdName": "GESTRINONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "713980ff-9406-48e9-a81b-f2ff347d99c2"
          ],
          "display_name": false
        },
        {
          "uuid": "545e2470-81c1-b231-4344-d5662e455728",
          "name": "Gestrinone [WHO-DD]",
          "stdName": "GESTRINONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96a17c76-f9fd-e1cf-8792-dc0424804f18"
          ],
          "display_name": false
        },
        {
          "uuid": "6af826d6-7c89-4e1e-b17e-f999ddcd0dfc",
          "name": "PREGNA-4,9,11-TRIEN-20-YN-3-ONE, 13-ETHYL-17-HYDROXY-18,19-DINOR-, (17.ALPHA.)-",
          "stdName": "PREGNA-4,9,11-TRIEN-20-YN-3-ONE, 13-ETHYL-17-HYDROXY-18,19-DINOR-, (17.ALPHA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c692475b-9e15-429d-9639-9c65d454042d"
          ],
          "display_name": false
        },
        {
          "uuid": "9cf72fad-b40e-4ce6-902a-b5a00581522c",
          "name": "R 2323",
          "stdName": "R 2323",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0672c013-83c9-4731-9019-730b4b8c0663"
          ],
          "display_name": false
        },
        {
          "uuid": "4f66d7d8-3b39-471d-8fed-5ce0b17d6cec",
          "name": "R-2323",
          "stdName": "R-2323",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90c4acc9-e6f5-4440-a338-636423a287f7"
          ],
          "display_name": false
        },
        {
          "uuid": "0bb36b66-22ae-42ae-9620-00d5dc0ccb61",
          "name": "RU 2323",
          "stdName": "RU 2323",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0672c013-83c9-4731-9019-730b4b8c0663"
          ],
          "display_name": false
        },
        {
          "uuid": "2f709774-5f71-449f-8339-3c65537f289a",
          "name": "RU-2323",
          "stdName": "RU-2323",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0672c013-83c9-4731-9019-730b4b8c0663"
          ],
          "display_name": false
        },
        {
          "uuid": "544752f6-3cff-4589-b9c7-ef8872bd94d2",
          "name": "gestrinone [INN]",
          "stdName": "GESTRINONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1428794f-dba1-4e35-ac1c-75f29d8af3f9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c692475b-9e15-429d-9639-9c65d454042d",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0672c013-83c9-4731-9019-730b4b8c0663",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90c4acc9-e6f5-4440-a338-636423a287f7",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1428794f-dba1-4e35-ac1c-75f29d8af3f9",
          "citation": "INN Proposed List 39",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL39.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "713980ff-9406-48e9-a81b-f2ff347d99c2",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3165e6b-497f-4054-bfd8-c7f0a774c1c5",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ac425f7-9ad2-412b-8f80-c6d5338a41b7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3985296-31ae-424a-8359-72b1050466cf",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3bcc0fb-472c-4c47-9e95-626a54264833",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7538596c-e34e-407c-b803-7bd1a3acd85f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e97aa483-b4b5-42e0-90da-b88929a98d14",
          "citation": "SRS import [1421533RCM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1421533RCM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389706000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a2a1d15-773d-465c-b0bf-a8d0d100139a",
          "citation": "GESTRINONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2ed341c-b537-4097-bcee-def0769479db",
          "citation": "GESTRINONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7732f8b8-67e6-4c84-a2dd-58377da2b61c",
          "citation": "GESTRINONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "450cedf0-2920-4311-a590-e61d73ed5232",
          "citation": "GESTRINONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d21f2550-f7e3-4662-980d-62a18a37d3a3",
          "citation": "GESTRINONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f00999d1-2738-651b-3897-c37d5d8f3d90",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Dimetrose",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "52e4b0a0-2a5e-5eb3-4c4e-aca1c0c9f866",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16320-04-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e58539b9-352c-a193-6406-287087894c5b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "f076f45b-433a-f0f6-75df-f08f3d4fff35",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0c2e569c-a51d-49f6-ab5f-3fc977b6efba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fa166a64-f7d8-8092-ce27-954397106a56",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "96a17c76-f9fd-e1cf-8792-dc0424804f18",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4f1d04ae-7345-49a0-812c-0d41854cdca7",
          "id": "4f1d04ae-7345-49a0-812c-0d41854cdca7",
          "molfile": "\n  Marvin  01132104072D          \n\n 23 26  0  0  1  0            999 V2000\n    0.2817   -2.5271    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.0689   -2.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5628   -2.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0689   -1.4553    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.0806   -0.6304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7835   -1.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4923   -0.6274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2817   -1.7080    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.2817   -0.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4357   -0.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4241   -1.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1329   -1.7080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1329   -2.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8474   -2.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5707   -2.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2881   -2.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2881   -3.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0027   -4.1684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5707   -4.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8474   -3.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1329   -4.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4241   -3.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4241   -2.9367    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n  1  2  1  1  0  0  0\n  1  8  1  0  0  0  0\n 23  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  8  4  1  0  0  0  0\n  6  7  3  0  0  0  0\n  8  9  1  1  0  0  0\n  8 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 23 13  1  6  0  0  0\n 15 14  1  0  0  0  0\n 20 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "CC[C@@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]2CC[C@]1(C#C)O",
          "formula": "C21H24O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7da68df7-073b-480d-921a-ed89cbe8e0a0"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "308.4148",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "47edf1f2-8298-46d8-9fb1-e6c805bcba7e",
      "version": "15",
      "structure": {
        "id": "f9ea84c5-24ea-4334-b83e-343f3b5f7c79",
        "molfile": "\n  Marvin  01132112572D          \n\n 25 28  0  0  1  0            999 V2000\n   -1.1329   -2.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8474   -2.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2817   -1.7080    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.8474   -3.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4241   -2.9367    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.2817   -2.5271    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.1329   -1.7080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4241   -1.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5707   -4.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0689   -1.4553    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.5707   -2.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4241   -3.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0689   -2.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1329   -4.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2881   -3.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5628   -2.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0027   -4.1684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2881   -2.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0806   -0.6304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2817   -0.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7835   -1.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2817   -3.3521    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4299   -2.1147    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4357   -0.4735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4923   -0.6274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  6  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  4  2  0  0  0  0\n 10  3  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15  9  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 11  1  0  0  0  0\n 10 19  1  1  0  0  0\n  3 20  1  1  0  0  0\n 10 21  1  6  0  0  0\n  6 22  1  6  0  0  0\n  5 23  1  1  0  0  0\n  3  8  1  0  0  0  0\n 14  4  1  0  0  0  0\n 18 15  1  0  0  0  0\n 10 16  1  0  0  0  0\n 20 24  1  0  0  0  0\n  2  1  2  0  0  0  0\n 21 25  3  0  0  0  0\nM  END",
        "smiles": "CC[C@@]12C=CC3=C4CCC(=O)C=C4CC[C@@]3([H])[C@]2([H])CC[C@]1(C#C)O",
        "formula": "C21H24O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "308.4148",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c692475b-9e15-429d-9639-9c65d454042d",
          "e97aa483-b4b5-42e0-90da-b88929a98d14",
          "1428794f-dba1-4e35-ac1c-75f29d8af3f9"
        ],
        "stereo_centers": 4
      },
      "unii": "1421533RCM"
    }
  ]
}