{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "50a361c4-2d6f-49fb-8ef1-9e2dd722b25f",
          "code": "1222-05-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1222-05-5",
          "code_system": "CAS",
          "references": [
            "8ebdba53-b7d0-4e7a-a269-89b6328929c1",
            "75b3b449-16af-4a6e-8351-2015fd3b9fb1"
          ]
        },
        {
          "uuid": "7e855ff2-2fe1-45b3-bf8d-8f65d2228947",
          "code": "C033119",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67033119",
          "code_system": "MESH",
          "references": [
            "8ebdba53-b7d0-4e7a-a269-89b6328929c1"
          ]
        },
        {
          "uuid": "2b570549-d25e-4e4f-936e-2a2dd1749ea4",
          "code": "SCCS/1459/11",
          "comments": "EC-SCCS|OPINION ON FRAGRANCE ALLERGENS IN COSMETIC PRODUCTS|FRAGRANCE|ESTABLISHED CONTACT ALLERGEN IN HUMANS|LEVEL OF IMPORTANCE ++ OUT OF ++++",
          "type": "PRIMARY",
          "url": "http://ec.europa.eu/health/scientific_committees/consumer_safety/docs/sccs_o_102.pdf",
          "code_system": "EC SCIENTIFIC COMMITTEE ON CONSUMER SAFETY OPINION",
          "references": [
            "8ebdba53-b7d0-4e7a-a269-89b6328929c1"
          ]
        },
        {
          "uuid": "441f6bfd-a20a-4e59-9613-e3e92a453400",
          "code": "1314281",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314281/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8ebdba53-b7d0-4e7a-a269-89b6328929c1"
          ]
        },
        {
          "uuid": "73de5261-75aa-45d0-8ab0-25eefcb5f71f",
          "code": "m6021",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6021?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8ebdba53-b7d0-4e7a-a269-89b6328929c1"
          ]
        },
        {
          "uuid": "1c25ebbe-df42-4575-ba6c-db4e16035daf",
          "code": "214-946-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.588",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8ebdba53-b7d0-4e7a-a269-89b6328929c1"
          ]
        },
        {
          "uuid": "d3cfaefc-b79e-4df5-b7d5-c82eb3aa8de4",
          "code": "91497",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91497",
          "code_system": "PUBCHEM",
          "references": [
            "8ebdba53-b7d0-4e7a-a269-89b6328929c1"
          ]
        },
        {
          "uuid": "a60120a4-e393-9091-a43b-09d266f77e74",
          "code": "7514",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7514",
          "code_system": "HSDB",
          "references": [
            "eb1470da-4929-6ccf-b10f-15a81ff54336"
          ]
        },
        {
          "uuid": "aa6b0492-5a6d-4ebc-ba09-642881d65786",
          "code": "Galaxolide",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Galaxolide",
          "code_system": "WIKIPEDIA",
          "references": [
            "c07ffb14-2576-ee04-a07a-8722e17489ad"
          ]
        },
        {
          "uuid": "77a9dda6-f621-3245-927d-f9c3e400679b",
          "code": "DTXSID8027373",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8027373",
          "code_system": "EPA CompTox",
          "references": [
            "6f55f5ab-bb69-df5a-6773-cc7f7cb43ab8"
          ]
        },
        {
          "uuid": "3df04342-593e-4a1a-89b9-d59e8413db0f",
          "code": "14170060AT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "853be92e-05d8-550c-6a9e-4d2a979b3786",
          "code": "300000035059",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ff2fbbc7-e488-bab6-adf1-551cf401d012"
          ]
        },
        {
          "uuid": "8f132bd4-b64c-3353-f2b2-5468296e9669",
          "code": "14170060AT",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=14170060AT",
          "code_system": "DAILYMED",
          "references": [
            "51875f1f-f5b7-a33d-398e-35aa377d158d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "46be48bd-0382-4c46-8c8d-629c906c6bbe",
          "name": "ABBALIDE",
          "stdName": "ABBALIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0cd1b82-4ff9-4f4e-a561-c84c2c51bba3",
            "ffa1072f-1c8b-401d-b230-a328df8f8787"
          ],
          "display_name": false
        },
        {
          "uuid": "9672f2b6-e7be-4da4-80f8-cb1e782b720c",
          "name": "CYCLOPENTA(G)-2-BENZOPYRAN, 1,3,4,6,7,8-HEXAHYDRO-4,6,6,7,8,8-HEXAMETHYL-",
          "stdName": "CYCLOPENTA(G)-2-BENZOPYRAN, 1,3,4,6,7,8-HEXAHYDRO-4,6,6,7,8,8-HEXAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0cd1b82-4ff9-4f4e-a561-c84c2c51bba3",
            "ffa1072f-1c8b-401d-b230-a328df8f8787"
          ],
          "display_name": false
        },
        {
          "uuid": "a82a2731-d1a0-4ad5-99f1-9c6dca9783b6",
          "name": "GALAXOLIDE",
          "stdName": "GALAXOLIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0cd1b82-4ff9-4f4e-a561-c84c2c51bba3",
            "ffa1072f-1c8b-401d-b230-a328df8f8787",
            "4c1f3e62-1c82-4825-8bf7-8e3ec343fc4a",
            "21bdfc31-9ac3-4e9b-b795-a9368b82ac23"
          ],
          "display_name": false
        },
        {
          "uuid": "efd36138-be67-4202-9383-6c964d2ae6b6",
          "name": "GALAXOLIDE [HSDB]",
          "stdName": "GALAXOLIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffa1072f-1c8b-401d-b230-a328df8f8787",
            "21bdfc31-9ac3-4e9b-b795-a9368b82ac23"
          ],
          "display_name": false
        },
        {
          "uuid": "b64cf129-575b-4832-b8a5-ce70414b3a51",
          "name": "HEXAHYDROHEXAMETHYL CYCLOPENTABENZOPYRAN",
          "stdName": "HEXAHYDROHEXAMETHYL CYCLOPENTABENZOPYRAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2175e36b-45ec-4c5d-a771-06587e0949cd",
            "ffa1072f-1c8b-401d-b230-a328df8f8787"
          ],
          "display_name": false
        },
        {
          "uuid": "c1f5eb6a-5695-4097-bdb1-7b5df6fc5f93",
          "name": "HEXAMETHYLINDANOPYRAN",
          "stdName": "HEXAMETHYLINDANOPYRAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "531a700a-90af-43fb-b929-57917da1ce0b",
            "ffa1072f-1c8b-401d-b230-a328df8f8787",
            "b6c17aad-46c0-436d-9a47-069d85b93f45"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3957b85f-bf2b-4d8f-8fec-c73ee46fb69f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2be11b1c-3ea6-4933-8dd7-58fedf824a14",
          "name": "HHCB",
          "stdName": "HHCB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "486f60ed-1b2a-45dc-bc24-0cc8f335667a",
            "748cb6e3-11be-42fb-bfef-ac49c4b03f6d",
            "b0cd1b82-4ff9-4f4e-a561-c84c2c51bba3",
            "ffa1072f-1c8b-401d-b230-a328df8f8787"
          ],
          "display_name": false
        },
        {
          "uuid": "12733309-d9ed-49b5-b056-f23008be4454",
          "name": "HHCB [MI]",
          "stdName": "HHCB [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "486f60ed-1b2a-45dc-bc24-0cc8f335667a",
            "ffa1072f-1c8b-401d-b230-a328df8f8787"
          ],
          "display_name": false
        },
        {
          "uuid": "5965793f-b9ac-4cbe-a24f-0d332a260025",
          "name": "PEARLIDE",
          "stdName": "PEARLIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0cd1b82-4ff9-4f4e-a561-c84c2c51bba3",
            "ffa1072f-1c8b-401d-b230-a328df8f8787"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "531a700a-90af-43fb-b929-57917da1ce0b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ffa1072f-1c8b-401d-b230-a328df8f8787",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0cd1b82-4ff9-4f4e-a561-c84c2c51bba3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "486f60ed-1b2a-45dc-bc24-0cc8f335667a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21bdfc31-9ac3-4e9b-b795-a9368b82ac23",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2175e36b-45ec-4c5d-a771-06587e0949cd",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ebdba53-b7d0-4e7a-a269-89b6328929c1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390881000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0252a5d-0913-4e93-96e6-fab65bde42dd",
          "citation": "SRS import [14170060AT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=14170060AT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390881000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "748cb6e3-11be-42fb-bfef-ac49c4b03f6d",
          "citation": "HHCB [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b6c17aad-46c0-436d-9a47-069d85b93f45",
          "citation": "HEXAMETHYLINDANOPYRAN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4c1f3e62-1c82-4825-8bf7-8e3ec343fc4a",
          "citation": "GALAXOLIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c07ffb14-2576-ee04-a07a-8722e17489ad",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Galaxolide",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eb1470da-4929-6ccf-b10f-15a81ff54336",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1222-05-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6f55f5ab-bb69-df5a-6773-cc7f7cb43ab8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1222-05-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ff2fbbc7-e488-bab6-adf1-551cf401d012",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "75b3b449-16af-4a6e-8351-2015fd3b9fb1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "51875f1f-f5b7-a33d-398e-35aa377d158d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "13bbf29f-33e6-49dc-a188-c3d1ecfb7d03",
          "id": "13bbf29f-33e6-49dc-a188-c3d1ecfb7d03",
          "molfile": "\n  Marvin  01132101142D          \n\n 19 21  0  0  0  0            999 V2000\n   14.9230   -7.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0980   -7.7585    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   13.6131   -8.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2262   -8.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4416   -9.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8285   -8.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1140   -8.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3996   -8.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6851   -8.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9706   -8.1710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9706   -7.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6851   -6.9335    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.6851   -6.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3996   -7.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1140   -6.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8285   -7.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6131   -7.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4416   -6.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2262   -6.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 17  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 16  2  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 14  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
          "smiles": "CC1COCc2cc3c(cc12)C(C)(C)C(C)C3(C)C",
          "formula": "C18H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c51153eb-0b42-4091-bb4f-05a8dd1036c2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "258.3991",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cda9fbc9-207a-4609-9f4c-20889ede2b4c",
      "version": "8",
      "structure": {
        "id": "7950b107-2830-467f-a41e-7a2e7d909bdd",
        "molfile": "\n  Marvin  01132106182D          \n\n 19 21  0  0  0  0            999 V2000\n    9.9706   -7.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6851   -6.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3996   -7.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3996   -8.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6851   -8.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9706   -8.1710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1140   -8.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8285   -8.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8285   -7.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1140   -6.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6131   -8.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0980   -7.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6131   -7.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2262   -8.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4416   -9.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9230   -7.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4416   -6.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2262   -6.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6851   -6.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  3 10  2  0  0  0  0\n  4  7  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  9 13  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n  2 19  1  0  0  0  0\nM  END",
        "smiles": "CC1COCc2cc3c(cc12)C(C)(C)C(C)C3(C)C",
        "formula": "C18H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "258.3991",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d0252a5d-0913-4e93-96e6-fab65bde42dd",
          "b0cd1b82-4ff9-4f4e-a561-c84c2c51bba3"
        ],
        "stereo_centers": 2
      },
      "unii": "14170060AT"
    }
  ]
}