{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cdae79ed-8db4-414f-b338-0b644a768ad3",
          "code": "4554-00-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4554-00-1",
          "code_system": "CAS",
          "references": [
            "916a3036-0a71-4f20-95d1-b004888f14a7",
            "1a2647f2-cff8-4124-976e-37cb30ae933c"
          ]
        },
        {
          "uuid": "07d35576-ed1d-40da-bb58-b2fc2f40bf6e",
          "code": "C019282",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67019282",
          "code_system": "MESH",
          "references": [
            "916a3036-0a71-4f20-95d1-b004888f14a7"
          ]
        },
        {
          "uuid": "2b988e9c-1f0b-48dc-a30e-95ee236015dc",
          "code": "1427411",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427411/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "916a3036-0a71-4f20-95d1-b004888f14a7"
          ]
        },
        {
          "uuid": "39b3264d-9085-4dd1-9c30-2b948aa94166",
          "code": "107559",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/107559",
          "code_system": "PUBCHEM",
          "references": [
            "916a3036-0a71-4f20-95d1-b004888f14a7"
          ]
        },
        {
          "uuid": "3f7eaa6a-a07f-435e-aac2-d2b60b825a4c",
          "code": "13P836X9Q6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c87eff84-7201-4555-7467-1bb562d2cebb",
          "code": "DTXSID50963398",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50963398",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "b3bfc19c-9151-4830-2e17-4eeb35c0ebc0",
          "code": "13P836X9Q6",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=13P836X9Q6",
          "code_system": "DAILYMED",
          "references": [
            "9aaf23e3-8d2d-b63d-af32-6cf2813b4f58"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4899f3fb-0ce9-4c29-ae28-4ba468eee00c",
          "name": "1,3-BUTANEDIOL DIOCTYLATE",
          "stdName": "1,3-BUTANEDIOL DIOCTYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79426116-8dd3-474f-8c76-0063f4a69c0c",
            "5c0823fa-ad80-48b3-928f-002de37dc9c5"
          ],
          "display_name": false
        },
        {
          "uuid": "584d0a76-e79c-4877-b7bb-32b266791d77",
          "name": "1,3-BUTANEDIOL-1,3-DIOCTANOATE",
          "stdName": "1,3-BUTANEDIOL-1,3-DIOCTANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79426116-8dd3-474f-8c76-0063f4a69c0c",
            "75c11613-8a6e-4253-bdea-7476e29ecadb"
          ],
          "display_name": false
        },
        {
          "uuid": "d97a5cdc-f09f-4c04-a129-d20ebe26be86",
          "name": "BUTYLENE GLYCOL DICAPRYLATE",
          "stdName": "BUTYLENE GLYCOL DICAPRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79426116-8dd3-474f-8c76-0063f4a69c0c",
            "daf54ab2-e8ac-4b74-b26f-9c90628ad4f9"
          ],
          "display_name": true
        },
        {
          "uuid": "2d00ca1f-ff7b-4947-83b6-3b22430f7007",
          "name": "OCTANOIC ACID, 1,1'-(1-METHYL-1,3-PROPANEDIYL) ESTER",
          "stdName": "OCTANOIC ACID, 1,1'-(1-METHYL-1,3-PROPANEDIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79426116-8dd3-474f-8c76-0063f4a69c0c",
            "5c0823fa-ad80-48b3-928f-002de37dc9c5"
          ],
          "display_name": false
        },
        {
          "uuid": "d56215cd-30ca-4ee2-a246-5ef50f4a6c56",
          "name": "OCTANOIC ACID, 1-METHYL-1,3-PROPANEDIYL ESTER",
          "stdName": "OCTANOIC ACID, 1-METHYL-1,3-PROPANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79426116-8dd3-474f-8c76-0063f4a69c0c",
            "5c0823fa-ad80-48b3-928f-002de37dc9c5"
          ],
          "display_name": false
        },
        {
          "uuid": "12ee2cb3-d45f-4afe-a32f-dcff86149733",
          "name": "OCTANOIC ACID, 1-METHYLTRIMETHYLENE ESTER",
          "stdName": "OCTANOIC ACID, 1-METHYLTRIMETHYLENE ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79426116-8dd3-474f-8c76-0063f4a69c0c",
            "5c0823fa-ad80-48b3-928f-002de37dc9c5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "daf54ab2-e8ac-4b74-b26f-9c90628ad4f9",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "79426116-8dd3-474f-8c76-0063f4a69c0c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c0823fa-ad80-48b3-928f-002de37dc9c5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75c11613-8a6e-4253-bdea-7476e29ecadb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "916a3036-0a71-4f20-95d1-b004888f14a7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391403000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b6ffe27-8b2a-44f0-bdec-e5cc44b49789",
          "citation": "SRS import [13P836X9Q6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=13P836X9Q6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391403000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9aaf23e3-8d2d-b63d-af32-6cf2813b4f58",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1a2647f2-cff8-4124-976e-37cb30ae933c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d1995844-7f2a-4ff4-8439-4ff066b3ba2b",
          "id": "d1995844-7f2a-4ff4-8439-4ff066b3ba2b",
          "molfile": "\n  Marvin  01132110502D          \n\n 24 23  0  0  0  0            999 V2000\n   17.6178   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9034   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1889   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4745   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7600   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0456   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3312   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6167   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6167   -1.7477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9022   -2.9852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1878   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4733   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7589   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.7589   -1.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0445   -2.9852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3301   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3301   -1.7478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6156   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9011   -2.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1867   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4722   -2.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7579   -2.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0434   -2.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3289   -2.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC(=O)OCCC(C)OC(=O)CCCCCCC",
          "formula": "C20H38O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "df7365d1-f706-4a7f-bec3-addc544232f0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.5141",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "60a21a23-0dda-4c6a-8fea-4710829ecdae",
      "version": "4",
      "structure": {
        "id": "79fc326c-3c75-4f4b-a66f-117a306627dd",
        "molfile": "\n  Marvin  01132106202D          \n\n 24 23  0  0  0  0            999 V2000\n   12.6167   -1.7477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6167   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9022   -2.9852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1878   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4733   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7589   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3312   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0456   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7600   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4745   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1889   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9034   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6178   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0445   -2.9852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7589   -1.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3301   -2.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6156   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9011   -2.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1867   -2.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4722   -2.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7579   -2.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0434   -2.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3289   -2.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3301   -1.7478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n  6 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 16 24  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCC(=O)OCCC(C)OC(=O)CCCCCCC",
        "formula": "C20H38O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.5141",
        "optical_activity": "( + / - )",
        "references": [
          "8b6ffe27-8b2a-44f0-bdec-e5cc44b49789",
          "daf54ab2-e8ac-4b74-b26f-9c90628ad4f9"
        ],
        "stereo_centers": 1
      },
      "unii": "13P836X9Q6"
    }
  ]
}