{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9bc70fc6-cf4c-4e0f-8d16-3a00f91f7003",
          "code": "337513-72-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=337513-72-1",
          "code_system": "CAS",
          "references": [
            "8a58e0fc-ea68-4642-9cb6-516ac5e485f7",
            "11a3c704-4a20-4040-b7d6-617c243cc666"
          ]
        },
        {
          "uuid": "e1bc25c9-b117-4ec2-89bc-65e2e3ad5ab9",
          "code": "36160",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36160",
          "code_system": "PUBCHEM",
          "references": [
            "8a58e0fc-ea68-4642-9cb6-516ac5e485f7"
          ]
        },
        {
          "uuid": "2cbc20ac-d6f4-82eb-3a8c-c2247a7d2ffb",
          "code": "DTXSID7074749",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7074749",
          "code_system": "EPA CompTox",
          "references": [
            "ddd33524-f5cf-f7d5-b240-18771f52a825"
          ]
        },
        {
          "uuid": "df9a3f54-8a15-4269-8574-dcbf6d77951b",
          "code": "13NAJ7N8H3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "af655c5c-e0ef-17d8-4057-e395c18c71c2",
          "code": "300000053710",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "73e67179-058a-fdfb-626a-ab79ce510cfb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "31213c86-d424-46ef-a1f5-00fc25c946fa",
          "name": "2,2',3,4,4',5,5',6-OCTABROMODIPHENYL ETHER",
          "stdName": "2,2',3,4,4',5,5',6-OCTABROMODIPHENYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee948163-f2e8-4a8a-bb65-19f69c8ee916",
            "7b64ce6b-bfe1-4a5b-bb9a-a632a939ca95"
          ],
          "display_name": true
        },
        {
          "uuid": "f7bd41e8-70b0-4947-89bf-a846ffc9b18c",
          "name": "BENZENE, 1,2,3,4,5-PENTABROMO-6-(2,4,5-TRIBROMOPHENOXY)-",
          "stdName": "BENZENE, 1,2,3,4,5-PENTABROMO-6-(2,4,5-TRIBROMOPHENOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee948163-f2e8-4a8a-bb65-19f69c8ee916",
            "7b64ce6b-bfe1-4a5b-bb9a-a632a939ca95"
          ],
          "display_name": false
        },
        {
          "uuid": "309bf08b-e8cd-4ea9-b8b8-cd9c7e0c8e79",
          "name": "BENZENE, PENTABROMO(2,4,5-TRIBROMOPHENOXY)-",
          "stdName": "BENZENE, PENTABROMO(2,4,5-TRIBROMOPHENOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee948163-f2e8-4a8a-bb65-19f69c8ee916",
            "7b64ce6b-bfe1-4a5b-bb9a-a632a939ca95"
          ],
          "display_name": false
        },
        {
          "uuid": "07993ca2-f425-49cb-a9e1-d5d2a6baa279",
          "name": "PBDE 203",
          "stdName": "PBDE 203",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee948163-f2e8-4a8a-bb65-19f69c8ee916",
            "7b64ce6b-bfe1-4a5b-bb9a-a632a939ca95"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7b64ce6b-bfe1-4a5b-bb9a-a632a939ca95",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ee948163-f2e8-4a8a-bb65-19f69c8ee916",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a58e0fc-ea68-4642-9cb6-516ac5e485f7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392455000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee29b9a9-1237-4e4c-a527-bc3439b0c0eb",
          "citation": "SRS import [13NAJ7N8H3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=13NAJ7N8H3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392455000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddd33524-f5cf-f7d5-b240-18771f52a825",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=337513-72-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "11a3c704-4a20-4040-b7d6-617c243cc666",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "73e67179-058a-fdfb-626a-ab79ce510cfb",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "58df9d9c-7314-46f9-a0b8-5e88a2227b14",
          "id": "58df9d9c-7314-46f9-a0b8-5e88a2227b14",
          "molfile": "\n  Marvin  01132104372D          \n\n 21 22  0  0  0  0            999 V2000\n    1.1504   -2.4399    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.8552   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8363   -3.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5411   -4.1224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5221   -4.9472    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.2648   -3.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9696   -4.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6934   -3.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7123   -2.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0075   -2.5056    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4360   -2.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4550   -1.7137    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1409   -2.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8647   -2.5713    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1219   -3.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8267   -4.2209    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.3982   -4.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3792   -5.0128    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.2838   -2.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5790   -2.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5979   -1.6480    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 20  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 19  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 17  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "c1c(c(cc(c1Br)Oc2c(c(c(c(c2Br)Br)Br)Br)Br)Br)Br",
          "formula": "C12H2Br8O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "67a65af4-234d-4897-a122-662a76270ce7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "801.3723",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2669354e-6f1e-484e-bf34-756d39ef443c",
      "version": "4",
      "structure": {
        "id": "7ef90577-dc45-4dbc-9d14-f003d8c4ea94",
        "molfile": "\n  Marvin  01132106362D          \n\n 21 22  0  0  0  0            999 V2000\n    6.1219   -3.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3982   -4.1880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6934   -3.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9696   -4.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2648   -3.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5411   -4.1224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8363   -3.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8552   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5790   -2.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2838   -2.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5979   -1.6480    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.1504   -2.4399    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.5221   -4.9472    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7123   -2.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0075   -2.5056    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4360   -2.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1409   -2.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8647   -2.5713    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4550   -1.7137    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.3792   -5.0128    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.8267   -4.2209    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n  6 13  1  0  0  0  0\n 14  3  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n  1 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n  2 20  1  0  0  0  0\n  1 21  1  0  0  0  0\nM  END",
        "smiles": "c1c(c(cc(c1Br)Oc2c(c(c(c(c2Br)Br)Br)Br)Br)Br)Br",
        "formula": "C12H2Br8O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "801.3723",
        "optical_activity": "NONE",
        "references": [
          "ee29b9a9-1237-4e4c-a527-bc3439b0c0eb",
          "7b64ce6b-bfe1-4a5b-bb9a-a632a939ca95"
        ],
        "stereo_centers": 0
      },
      "unii": "13NAJ7N8H3"
    }
  ]
}