{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0079d6fb-72d6-4c05-b7a1-ba29d68f8f09", "code": "25126-38-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=25126-38-9", "code_system": "CAS", "references": [ "79de3563-f8b1-44c9-90b7-3f13f88c4544", "e006b138-04b6-4274-9037-d647ec4ac8af" ] }, { "uuid": "62850534-0a4a-49b0-8098-19c93e4a7d51", "code": "SUB13866MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "79de3563-f8b1-44c9-90b7-3f13f88c4544" ] }, { "uuid": "0fe3383b-06c3-4fcd-b382-f3029844e752", "code": "71587066", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587066", "code_system": "PUBCHEM", "references": [ "79de3563-f8b1-44c9-90b7-3f13f88c4544" ] }, { "uuid": "656f9de2-8e6f-8829-ada6-7187b216ae9c", "code": "DTXSID0051362", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0051362", "code_system": "EPA CompTox", "references": [ "fd95926e-5f0b-9f73-1f4c-98d1f968a6f3" ] }, { "uuid": "4402933d-0d4a-4d88-86d2-86bd01119499", "code": "13809H6DVG", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5215e1c3-e839-da55-b5e9-0f35e22f676e", "code": "100000078469", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "179f7d8f-6f09-b93f-d28c-243254d01680" ] } ], "relationships": [ { "uuid": "8a2321be-b934-4cea-813d-6629facb4b48", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "c04ef4ef-8952-4332-b810-00c2adbc0ea5", "refuuid": "3963b0fc-3b47-4ee5-8f3a-4a92b7438c3d", "name": "FERROUS CATION", "unii": "GW89581OWR", "linking_id": "GW89581OWR", "ref_pname": "FERROUS CATION", "substance_class": "reference" } }, { "uuid": "df65f2bf-b33b-48f7-9062-26b12c1df32e", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "3642c756-8711-4097-b679-5875ce01ea93", "refuuid": "3963b0fc-3b47-4ee5-8f3a-4a92b7438c3d", "name": "FERROUS CATION", "unii": "GW89581OWR", "linking_id": "GW89581OWR", "ref_pname": "FERROUS CATION", "substance_class": "reference" } }, { "uuid": "b09c13b5-2fef-4b55-b40b-046263925ee0", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "487344da-0ae6-4c77-984d-074b9f44ab76", "refuuid": "dd7d8b09-3b98-435a-a944-79908cc4fd86", "name": "GLUCOHEPTONIC ACID", "unii": "B1F50160Z2", "linking_id": "B1F50160Z2", "ref_pname": "GLUCOHEPTONIC ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "74d74fc3-3a7b-4875-be96-65d5b8edcd1f", "name": "FERROUS GLUCEPTATE", "stdName": "FERROUS GLUCEPTATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "205c6e78-b9ac-4350-b4e2-d2b55ca839cc", "1e3be0f2-fa23-47bd-ab82-035e7c5b5062", "31e54ba9-bc6a-4306-85d4-7b8ca088e95c", "cb165f06-7765-4760-a372-65f985538f3d", "5239ca86-d77b-42d0-9d3d-5c4af9c8bb41", "56bbe48a-211c-40fc-a871-037d1d4dd4c3" ], "display_name": true }, { "uuid": "b68996cc-f992-44ea-ac0f-e4e39defaae7", "name": "FERROUS GLUCEPTATE [MART.]", "stdName": "FERROUS GLUCEPTATE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "205c6e78-b9ac-4350-b4e2-d2b55ca839cc" ], "display_name": false }, { "uuid": "90b7f365-bd9a-4e3d-8136-53d849cd1241", "name": "FERROUS GLUCOHEPTONATE", "stdName": "FERROUS GLUCOHEPTONATE", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "79d4855b-9e6c-4a36-82fb-1fab0459f632", "1e3be0f2-fa23-47bd-ab82-035e7c5b5062", "66b3d259-526d-4388-bed2-23692175c285", "56bbe48a-211c-40fc-a871-037d1d4dd4c3" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "b1249744-54b1-412a-b9d5-8c1be334f77e", "name_org": "INCI" } ] }, { "uuid": "f0d2cf09-eae0-a2f4-6745-5a4b2692bfb5", "name": "Ferrous gluceptate [WHO-DD]", "stdName": "FERROUS GLUCEPTATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2f8d230a-8057-94ce-cd1c-6383b8637cea" ], "display_name": false } ], "references": [ { "uuid": "1e3be0f2-fa23-47bd-ab82-035e7c5b5062", "citation": "MARTINDALE", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "56bbe48a-211c-40fc-a871-037d1d4dd4c3", "citation": "MARTINDALE", "doc_type": "MARTINDALE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "205c6e78-b9ac-4350-b4e2-d2b55ca839cc", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "66b3d259-526d-4388-bed2-23692175c285", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cb165f06-7765-4760-a372-65f985538f3d", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "79de3563-f8b1-44c9-90b7-3f13f88c4544", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389703000, "tags": [ "NOMEN" ] }, { "uuid": "5d5706ec-1d87-407f-a8b8-8d9e3315c875", "citation": "SRS import [13809H6DVG]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=13809H6DVG", "doc_type": "SRS", "public_domain": true, "document_date": 1493389703000, "tags": [ "NOMEN" ] }, { "uuid": "31e54ba9-bc6a-4306-85d4-7b8ca088e95c", "citation": "FERROUS GLUCEPTATE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "79d4855b-9e6c-4a36-82fb-1fab0459f632", "citation": "FERROUS GLUCOHEPTONATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5239ca86-d77b-42d0-9d3d-5c4af9c8bb41", "citation": "FERROUS GLUCEPTATE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "fd95926e-5f0b-9f73-1f4c-98d1f968a6f3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=25126-38-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "179f7d8f-6f09-b93f-d28c-243254d01680", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "2f8d230a-8057-94ce-cd1c-6383b8637cea", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "e006b138-04b6-4274-9037-d647ec4ac8af", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2b3f6a41-c41f-46d2-80ea-29440bb46bd0", "id": "2b3f6a41-c41f-46d2-80ea-29440bb46bd0", "molfile": "\n Marvin 01132102212D \n\n 1 0 0 0 1 0 999 V2000\n 3.5038 -10.7365 0.0000 Fe 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Fe+2]", "formula": "Fe", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7740c55f-536f-43f3-8ded-0af79294c170" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "55.8451", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "9d82effd-5496-425c-aafd-3cdd03177f6e", "id": "9d82effd-5496-425c-aafd-3cdd03177f6e", "molfile": "\n Marvin 01132108112D \n\n 15 14 0 0 1 0 999 V2000\n -1.9412 -10.7519 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -1.9441 -11.5793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6542 -10.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3706 -10.7577 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -1.2278 -10.3398 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -1.2307 -9.5124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5114 -10.7489 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -0.5172 -11.5764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2016 -10.3340 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 0.1987 -9.5066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9180 -10.7460 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 0.9122 -11.5734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6310 -10.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3445 -10.7401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6281 -9.5036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 5 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 6 1 1 0 0 0\n 7 5 1 0 0 0 0\n 7 8 1 1 0 0 0\n 9 7 1 0 0 0 0\n 9 10 1 1 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 6 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\nM CHG 1 4 -1\nM END", "smiles": "C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)O)O)O)O)O)O)[O-]", "formula": "C7H13O8", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "74d84602-4ad3-4649-aed8-10ffc19d6200" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "225.1736", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "af1a7559-f692-442c-9a04-e8564d061118", "version": "8", "structure": { "id": "38626c15-656f-4bbe-bd24-5c1636063e2e", "molfile": "\n Marvin 01132103002D \n\n 31 28 0 0 1 0 999 V2000\n 3.5050 -10.7401 0.0000 Fe 0 2 0 0 0 0 0 0 0 0 0 0\n -3.3706 -10.7577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6542 -10.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9412 -10.7519 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.2278 -10.3398 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.5114 -10.7489 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.2016 -10.3340 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.9180 -10.7460 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.6310 -10.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3445 -10.7401 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.6281 -9.5036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9122 -11.5734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1987 -9.5066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5172 -11.5764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2307 -9.5124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9441 -11.5793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3706 -10.7577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6542 -10.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9412 -10.7519 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.2278 -10.3398 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.5114 -10.7489 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.2016 -10.3340 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.9180 -10.7460 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.6310 -10.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3445 -10.7401 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.6281 -9.5036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9122 -11.5734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1987 -9.5066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5172 -11.5764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2307 -9.5124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9441 -11.5793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 5 1 0 0 0 0\n 9 11 2 0 0 0 0\n 8 12 1 6 0 0 0\n 5 6 1 0 0 0 0\n 7 13 1 1 0 0 0\n 2 3 1 0 0 0 0\n 6 14 1 1 0 0 0\n 6 7 1 0 0 0 0\n 5 15 1 1 0 0 0\n 4 16 1 6 0 0 0\n 7 8 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 31 1 6 0 0 0\n 20 21 1 0 0 0 0\n 20 30 1 1 0 0 0\n 21 29 1 1 0 0 0\n 21 22 1 0 0 0 0\n 22 28 1 1 0 0 0\n 22 23 1 0 0 0 0\n 23 27 1 6 0 0 0\n 23 24 1 0 0 0 0\n 24 26 2 0 0 0 0\n 24 25 1 0 0 0 0\nM CHG 3 1 2 10 -1 25 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SAL 1 15 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31\nM SPA 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SDI 1 4 -3.7906 -11.9993 -3.7906 -9.0836\nM SDI 1 4 2.7645 -9.0836 2.7645 -11.9993\nM SMT 1 2\nM END", "smiles": "C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.[Fe+2]", "formula": "2C7H13O8.Fe", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "506.1924", "optical_activity": "UNSPECIFIED", "references": [ "5d5706ec-1d87-407f-a8b8-8d9e3315c875", "1e3be0f2-fa23-47bd-ab82-035e7c5b5062" ], "stereo_centers": 10 }, "unii": "13809H6DVG" } ] }