{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d3c62a78-8474-4a3e-a8aa-1cadf0a70d9e", "code": "1182-68-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1182-68-9", "code_system": "CAS", "references": [ "3f3292cd-6e1b-42d2-8632-b1a97359b844", "19458fbe-f4b9-4dee-ab2d-5501435ea2b9" ] }, { "uuid": "d52cad0f-3dcc-4ee9-8b6d-520270252403", "code": "SUB14505MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "3f3292cd-6e1b-42d2-8632-b1a97359b844" ] }, { "uuid": "fae4e1f3-563f-4218-9775-21a837b100af", "code": "14009404", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14009404", "code_system": "PUBCHEM", "references": [ "3f3292cd-6e1b-42d2-8632-b1a97359b844" ] }, { "uuid": "f707552c-e3bf-e70d-05bf-ca7ec028ce6d", "code": "357311", "comments": "ORPHAN DRUG|Designated|Treatment of calciphylaxis", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=357311", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "96333273-3f66-70a2-65f7-6f65e874ab7f", "code": "C943", "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Vitamin[C944]|Fat-Soluble Vitamin[C1550]|Vitamin K", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C943", "code_system": "NCI_THESAURUS", "references": [ "17210518-c9d5-7894-18aa-d80b9cec15d3" ] }, { "uuid": "e74c5e95-cd88-6de0-dff6-8c70927c0e13", "code": "DB15381", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB15381", "code_system": "DRUG BANK", "references": [ "17210518-c9d5-7894-18aa-d80b9cec15d3" ] }, { "uuid": "fa139836-ce42-48e4-b7fd-8af01c8246bd", "code": "12V8PA4WCH", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9ef67db4-44e9-d5ba-68dd-71faac637ea3", "code": "2463 (Number of products:750)", "comments": "Dietary Supplement Label Database|vitamin|Vitamin K (menaquinone)", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2463&item=Vitamin K (menaquinone)", "code_system": "DSLD", "references": [ "17210518-c9d5-7894-18aa-d80b9cec15d3" ] }, { "uuid": "51b9a41b-ac6a-4d22-b8ff-86249eaf3807", "code": "C68319", "comments": "NCIT", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68319", "code_system": "NCI_THESAURUS", "references": [ "442060fe-d857-9d41-ab9e-32a02dd45c9a" ] }, { "uuid": "c937e049-c782-5623-a8bc-33e5933e4ec7", "code": "28869", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28869", "code_system": "CHEBI", "references": [ "17210518-c9d5-7894-18aa-d80b9cec15d3" ] }, { "uuid": "2c5a5c51-9abe-7188-d88a-08b43b0377a7", "code": "16374", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16374", "code_system": "CHEBI", "references": [ "17210518-c9d5-7894-18aa-d80b9cec15d3" ] }, { "uuid": "3702f9cd-cc8f-d7b9-d63b-60c17a006e60", "code": "12V8PA4WCH", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=12V8PA4WCH", "code_system": "DAILYMED", "references": [ "2c8f4a74-14d7-df22-9081-63d1901bd9bd" ] }, { "uuid": "a2dce516-2280-8105-711f-e32a14d79b56", "code": "100000076538", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "3b5da5c6-6a5e-1046-8ff4-bba0ec902241" ] } ], "substance_class": "chemical", "names": [ { "uuid": "a407a6cb-ab22-44c8-88bc-68961aca74f5", "name": "1,4-NAPHTHALENEDIONE, 2-METHYL-3-((2E,6E,10E,14E)-3,7,11,15,19-PENTAMETHYL-2,6,10,14,18-EICOSAPENTAEN-1-YL)-", "stdName": "1,4-NAPHTHALENEDIONE, 2-METHYL-3-((2E,6E,10E,14E)-3,7,11,15,19-PENTAMETHYL-2,6,10,14,18-EICOSAPENTAEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4411d893-22ff-4426-8897-c6c3cb17eaf0", "58457ce8-836f-4679-998d-d00a2377f8f7" ], "display_name": false }, { "uuid": "d307695f-87e4-4292-9c04-676d293c8ff6", "name": "J39.473D", "stdName": "J39.473D", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "58457ce8-836f-4679-998d-d00a2377f8f7", "b80877a4-f4cb-410b-9f0c-e7160ffad6dd" ], "display_name": false }, { "uuid": "9b387e71-bde6-49e6-9126-d52883b6fc2d", "name": "MENAQUINONE", "stdName": "MENAQUINONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4411d893-22ff-4426-8897-c6c3cb17eaf0", "368b6aaf-c4a6-405b-83c1-fff37fd0d3af", "58457ce8-836f-4679-998d-d00a2377f8f7", "d2e8240c-61d9-43d9-b2b2-0d613a39b1f2" ], "display_name": true }, { "uuid": "34e79a27-0e50-4e87-96e7-80ce3e82db82", "name": "MENAQUINONE 5", "stdName": "MENAQUINONE 5", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4411d893-22ff-4426-8897-c6c3cb17eaf0", "58457ce8-836f-4679-998d-d00a2377f8f7" ], "display_name": false }, { "uuid": "5a7a6024-9845-a251-35e7-05c48456b617", "name": "Menaquinone [WHO-DD]", "stdName": "MENAQUINONE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "77cb30ec-055e-fc72-4251-c7c76c9f6c8f" ], "display_name": false }, { "uuid": "604ecc45-1d3e-46a1-a9ed-4103622e2da7", "name": "VITAMIN K2(25)", "stdName": "VITAMIN K2(25)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4411d893-22ff-4426-8897-c6c3cb17eaf0", "58457ce8-836f-4679-998d-d00a2377f8f7" ], "display_name": false }, { "uuid": "854f96cc-2b8d-41c4-a576-eb6b7192886e", "name": "VITAMIN MK 5", "stdName": "VITAMIN MK 5", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4411d893-22ff-4426-8897-c6c3cb17eaf0", "58457ce8-836f-4679-998d-d00a2377f8f7" ], "display_name": false } ], "references": [ { "uuid": "b80877a4-f4cb-410b-9f0c-e7160ffad6dd", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J39.473D", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J39.473D", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "58457ce8-836f-4679-998d-d00a2377f8f7", "citation": "JAPAN CHEMICAL SUBSTANCE DICTIONARY", "doc_type": "JAPAN CHEMICAL SUBSTANCE DICTIONARY", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d2e8240c-61d9-43d9-b2b2-0d613a39b1f2", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4411d893-22ff-4426-8897-c6c3cb17eaf0", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3f3292cd-6e1b-42d2-8632-b1a97359b844", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393376000, "tags": [ "NOMEN" ] }, { "uuid": "11c06d3a-bfa5-4e00-b002-aff427e87b91", "citation": "SRS import [12V8PA4WCH]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=12V8PA4WCH", "doc_type": "SRS", "public_domain": true, "document_date": 1493393376000, "tags": [ "NOMEN" ] }, { "uuid": "368b6aaf-c4a6-405b-83c1-fff37fd0d3af", "citation": "MENAQUINONE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3b5da5c6-6a5e-1046-8ff4-bba0ec902241", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "17210518-c9d5-7894-18aa-d80b9cec15d3", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "19458fbe-f4b9-4dee-ab2d-5501435ea2b9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "442060fe-d857-9d41-ab9e-32a02dd45c9a", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "77cb30ec-055e-fc72-4251-c7c76c9f6c8f", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "2c8f4a74-14d7-df22-9081-63d1901bd9bd", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b2a0b469-a2b1-4814-a69b-eb7a2df96550", "id": "b2a0b469-a2b1-4814-a69b-eb7a2df96550", "molfile": "\n Marvin 01132109152D \n\n 38 39 0 0 0 0 999 V2000\n -7.8592 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8592 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5737 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1447 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4302 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7158 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1447 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8592 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5737 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5737 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8592 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1447 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 17 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 22 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 2 0 0 0 0\n 26 37 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 27 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 32 31 1 0 0 0 0\n 36 31 2 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 2 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC1=C(C)C(=O)c2ccccc2C1=O)/C)/C)/C)/C)C", "formula": "C36H48O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c78e9366-c0c5-46c5-935c-8d2c5f082022" }, "defined_stereo": 0, "ez_centers": 4, "molecular_weight": "512.7665", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f6a96e5e-3e82-4b09-81f7-bd0426cd3ca6", "version": "16", "structure": { "id": "100525ef-2502-40c7-b078-08cc36291c85", "molfile": "\n Marvin 01132101042D \n\n 38 39 0 0 0 0 999 V2000\n 6.4302 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1447 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8592 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5737 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5737 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8592 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1447 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7158 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4302 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.1447 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8592 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -7.8592 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -8.5737 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 1 10 1 0 0 0 0\n 5 10 2 0 0 0 0\n 1 11 2 0 0 0 0\n 4 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 27 34 1 0 0 0 0\n 23 35 1 0 0 0 0\n 19 36 1 0 0 0 0\n 15 37 1 0 0 0 0\n 3 13 1 0 0 0 0\n 2 38 1 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC1=C(C)C(=O)c2ccccc2C1=O)/C)/C)/C)/C)C", "formula": "C36H48O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 4, "molecular_weight": "512.7665", "optical_activity": "NONE", "references": [ "11c06d3a-bfa5-4e00-b002-aff427e87b91", "4411d893-22ff-4426-8897-c6c3cb17eaf0" ], "stereo_centers": 0 }, "unii": "12V8PA4WCH" } ] }