{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "030bb2c4-ed9f-4caa-9754-ba591e0b1016",
          "code": "200-730-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.664",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f5ddf926-f151-408c-a092-8b3326671255"
          ]
        },
        {
          "uuid": "28b05a33-5f3f-422b-9785-2e20a4a46fc7",
          "code": "m7446",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7446?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f5ddf926-f151-408c-a092-8b3326671255"
          ]
        },
        {
          "uuid": "a1cd31cd-0391-43fb-9eda-88142fe06fff",
          "code": "70-25-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=70-25-7",
          "code_system": "CAS",
          "references": [
            "f5ddf926-f151-408c-a092-8b3326671255",
            "44932378-8e15-4342-8865-ff88f5487529"
          ]
        },
        {
          "uuid": "1a14b29d-1f71-4b3a-9a3a-7c172beeb760",
          "code": "D008769",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008769",
          "code_system": "MESH",
          "references": [
            "f5ddf926-f151-408c-a092-8b3326671255"
          ]
        },
        {
          "uuid": "d70acf15-802f-4245-ab5a-e5203c4ecf70",
          "code": "METHYLNITRONITROSOGUANIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methylnitronitrosoguanidine",
          "code_system": "WIKIPEDIA",
          "references": [
            "f5ddf926-f151-408c-a092-8b3326671255"
          ]
        },
        {
          "uuid": "14cfcb1c-a3cf-1d33-2108-7834bed1b3ea",
          "code": "5104",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5104",
          "code_system": "HSDB",
          "references": [
            "717571c4-92aa-12af-4d66-10a3236cd903"
          ]
        },
        {
          "uuid": "6a433633-cc91-72b8-9912-fd3491de8890",
          "code": "DTXSID2020846",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2020846",
          "code_system": "EPA CompTox",
          "references": [
            "8cdd5986-f757-65c9-d6c1-185b66cd0365"
          ]
        },
        {
          "uuid": "5eaf3953-e98e-8c71-43fc-378a847eb80b",
          "code": "6261",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6261",
          "code_system": "PUBCHEM",
          "references": [
            "58a47671-a135-b73e-8524-978d093355c4"
          ]
        },
        {
          "uuid": "0b732929-4fd2-fe7a-7fdb-f591bc380083",
          "code": "21759",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:21759",
          "code_system": "CHEBI",
          "references": [
            "52cc4271-712f-b9ab-060b-e24d3c49943c"
          ]
        },
        {
          "uuid": "cc687591-5318-4898-baea-0239dbea26d3",
          "code": "12H3O2UGSF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3ee25cf4-fc80-1516-62df-e8451865258b",
          "code": "9369",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9369",
          "code_system": "NSC",
          "references": [
            "53f108e1-72d5-b7d7-ad41-67c8daf7a0fb"
          ]
        },
        {
          "uuid": "1daa2a7d-05ea-05ec-7c93-f31bae109c03",
          "code": "300000053709",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "788366e4-12ad-39fa-b8af-b4771d070874"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "05890430-3642-4098-a6c8-82cd283f505d",
          "name": "1-METHYL-1-NITROSO-2-NITROGUANIDINE",
          "stdName": "1-METHYL-1-NITROSO-2-NITROGUANIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc",
            "cc4ac5ba-b4a6-4677-8d68-412da782708a"
          ],
          "display_name": false
        },
        {
          "uuid": "0a48d142-7e97-4ae9-a91b-4cb0cf1c0e50",
          "name": "1-METHYL-1-NITROSO-3-NITROGUANIDINE",
          "stdName": "1-METHYL-1-NITROSO-3-NITROGUANIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc",
            "cc4ac5ba-b4a6-4677-8d68-412da782708a"
          ],
          "display_name": false
        },
        {
          "uuid": "82a24411-60a5-4ae1-beda-edb838472566",
          "name": "GUANIDINE, N-METHYL-N'-NITRO-N-NITROSO-",
          "stdName": "GUANIDINE, N-METHYL-N'-NITRO-N-NITROSO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f20a3c62-ad72-4abe-8959-14daffd8c534",
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc"
          ],
          "display_name": false
        },
        {
          "uuid": "e3ca2ee5-dfa3-4436-bfcf-d16006ed838a",
          "name": "METHYLNITRONITROSOGUANIDINE",
          "stdName": "METHYLNITRONITROSOGUANIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc",
            "cc4ac5ba-b4a6-4677-8d68-412da782708a"
          ],
          "display_name": false
        },
        {
          "uuid": "920806a8-9973-4070-8d01-9009e3427857",
          "name": "MNNG",
          "stdName": "MNNG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f20a3c62-ad72-4abe-8959-14daffd8c534",
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc"
          ],
          "display_name": false
        },
        {
          "uuid": "d6ba895d-e7ed-4e35-b1e8-97f4f85d7034",
          "name": "N-METHYL-N'-NITRO-N-NITROSOGUANIDINE",
          "stdName": "N-METHYL-N'-NITRO-N-NITROSOGUANIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a530e68e-5f04-4f66-84b2-75e68ee81af5",
            "2402c2aa-9b54-4b51-bbb0-37f61595ae88",
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc"
          ],
          "display_name": true
        },
        {
          "uuid": "199c2c00-fffa-49b3-8036-137a3c4ab21b",
          "name": "N-METHYL-N'-NITRO-N-NITROSOGUANIDINE [MI]",
          "stdName": "N-METHYL-N'-NITRO-N-NITROSOGUANIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a530e68e-5f04-4f66-84b2-75e68ee81af5",
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc"
          ],
          "display_name": false
        },
        {
          "uuid": "51d64ca2-5957-455d-9e72-b2d973ace469",
          "name": "N-METHYL-N-NITROSO-N'-NITROGUANIDINE",
          "stdName": "N-METHYL-N-NITROSO-N'-NITROGUANIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a530e68e-5f04-4f66-84b2-75e68ee81af5",
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc"
          ],
          "display_name": false
        },
        {
          "uuid": "903c35d6-9421-4c35-86c7-1784ca13fe56",
          "name": "NA-0473",
          "stdName": "NA-0473",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "085624be-f0c6-4cdd-b1a9-580227dfec37",
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc"
          ],
          "display_name": false
        },
        {
          "uuid": "e8a349e8-7f36-4e9a-82db-ef57140d8383",
          "name": "NA0473",
          "stdName": "NA0473",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f20a3c62-ad72-4abe-8959-14daffd8c534",
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc"
          ],
          "display_name": false
        },
        {
          "uuid": "7e4a81c1-ddd5-4109-bf47-fd3619acac9d",
          "name": "NSC-9369",
          "stdName": "NSC-9369",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e75f530-ee42-43c7-9dff-05d1c7c147dc",
            "cc4ac5ba-b4a6-4677-8d68-412da782708a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a530e68e-5f04-4f66-84b2-75e68ee81af5",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4e75f530-ee42-43c7-9dff-05d1c7c147dc",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f20a3c62-ad72-4abe-8959-14daffd8c534",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "085624be-f0c6-4cdd-b1a9-580227dfec37",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc4ac5ba-b4a6-4677-8d68-412da782708a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5ddf926-f151-408c-a092-8b3326671255",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391668000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1d1727c-7609-459f-849f-787ff58ed6f1",
          "citation": "SRS import [12H3O2UGSF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=12H3O2UGSF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391668000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee46b23a-e434-48ed-9f98-f27d41c790a8",
          "citation": "CHEMID RECORD 70-25-7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2402c2aa-9b54-4b51-bbb0-37f61595ae88",
          "citation": "N-METHYL-N'-NITRO-N-NITROSOGUANIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "717571c4-92aa-12af-4d66-10a3236cd903",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+70-25-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8cdd5986-f757-65c9-d6c1-185b66cd0365",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=70-25-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "58a47671-a135-b73e-8524-978d093355c4",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "44932378-8e15-4342-8865-ff88f5487529",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "52cc4271-712f-b9ab-060b-e24d3c49943c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "53f108e1-72d5-b7d7-ad41-67c8daf7a0fb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "788366e4-12ad-39fa-b8af-b4771d070874",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "baa54fbb-2515-4b41-b199-942a1975c057",
          "id": "baa54fbb-2515-4b41-b199-942a1975c057",
          "molfile": "\n  Marvin  01132109392D          \n\n 10  9  0  0  0  0            999 V2000\n    0.7806   -1.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7806   -0.2839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5023    0.1111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2184   -0.2986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0775    0.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0775    0.9472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6386   -0.2783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3602    0.1277    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.0763   -0.2783    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.3602    0.9527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  CHG  2   8   1   9  -1\nM  END",
          "smiles": "CN(C(=N)N[N+](=O)[O-])N=O",
          "formula": "C2H5N5O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a8ad9af0-9450-413d-a171-1914c8061c1a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "147.0929",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9efd8de8-6615-4de3-b83a-556b9634f22a",
      "version": "8",
      "structure": {
        "id": "5d775d01-3aae-4ef8-81c5-d675f040aa59",
        "molfile": "\n  Marvin  01132104502D          \n\n 10  9  0  0  0  0            999 V2000\n    0.0775    0.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7806   -0.2839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6386   -0.2783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0775    0.9472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5023    0.1111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7806   -1.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3602    0.1277    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.2184   -0.2986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0763   -0.2783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3602    0.9527    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  1  0  0  0  0\nM  CHG  2   7   1  10  -1\nM  END",
        "smiles": "CN(C(=N)N[N+](=O)[O-])N=O",
        "formula": "C2H5N5O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "147.0929",
        "optical_activity": "NONE",
        "references": [
          "e1d1727c-7609-459f-849f-787ff58ed6f1",
          "ee46b23a-e434-48ed-9f98-f27d41c790a8"
        ],
        "stereo_centers": 0
      },
      "unii": "12H3O2UGSF"
    }
  ]
}