{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cf9ab9a9-5ebd-46a5-9422-52264110ee7e",
          "code": "A12BA05",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|MINERAL SUPPLEMENTS|POTASSIUM|Potassium|potassium gluconate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A12BA05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "0cadd26c-9a7b-4527-9ee9-229fb32377cb",
          "code": "QA12BA05",
          "comments": "VATC|MINERAL SUPPLEMENTS|POTASSIUM|Potassium|potassium gluconate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA12BA05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "11e0c23a-2752-4320-b0dc-962e0be77162",
          "code": "299-27-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=299-27-4",
          "code_system": "CAS",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4",
            "a89214db-ce4d-42c7-80b3-7654e6b8223f"
          ]
        },
        {
          "uuid": "337b7046-0947-432e-9362-ea017183c4db",
          "code": "C81070",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81070",
          "code_system": "NCI_THESAURUS",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "1f280136-290f-4533-9714-89149de1a1f1",
          "code": "INS-577",
          "comments": "JECFA|Functional Classification|ACIDITY REGULATOR|NUTRIENT SUPPLEMENT|YEAST FOOD",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=577",
          "code_system": "JECFA EVALUATION",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "92d00ee2-5463-4d96-90c1-2de80e7a30f0",
          "code": "INS-577",
          "comments": "Codex Alimentarius|Functional Classification|Acidity regulator|Sequestrant",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=364",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "9e8129c8-9338-4b31-8451-1a6361bac7a9",
          "code": "206-074-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.523",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "5f7580ff-5196-46bb-949e-1b72f59295ca",
          "code": "89903",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/89903/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "de10cbad-908c-4e2a-8b4c-667f98f7a9c1",
          "code": "m5762",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5762?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "2b509e21-5805-4212-b57b-088ae1cf2e04",
          "code": "SUB14979MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "1a003c1d-8396-42f8-807f-49ad918cf302",
          "code": "CHEMBL2106978",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106978",
          "code_system": "ChEMBL",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "d4ab7358-e644-447d-88fd-fd8f9cf671c3",
          "code": "16760467",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16760467",
          "code_system": "PUBCHEM",
          "references": [
            "52644a33-2085-4250-910b-3fc7575761c4"
          ]
        },
        {
          "uuid": "d3be72fd-35ac-71e5-7edc-6673beca5fe3",
          "code": "3165",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3165",
          "code_system": "HSDB",
          "references": [
            "fe763049-f890-22e1-a81d-ad9dc9625add"
          ]
        },
        {
          "uuid": "8376ea3c-7f16-8d68-bca2-19531affe97b",
          "code": "DTXSID7029617",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7029617",
          "code_system": "EPA CompTox",
          "references": [
            "0d35ae5e-2068-f4ba-8c6a-e99bff7d4f31"
          ]
        },
        {
          "uuid": "84fbfba0-3731-0cb2-e4ce-234262fe2465",
          "code": "C29730",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Electrolyte Replacement Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29730",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5a6ff0a2-469b-8d74-3897-f9a3a1aa6216"
          ]
        },
        {
          "uuid": "6182fc7a-d231-6d34-cf58-824067d0b330",
          "code": "4524",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4524",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5a6ff0a2-469b-8d74-3897-f9a3a1aa6216"
          ]
        },
        {
          "uuid": "2a9c89ce-ee4d-4ad3-2703-c5a524563905",
          "code": "DB13620",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13620",
          "code_system": "DRUG BANK",
          "references": [
            "5a6ff0a2-469b-8d74-3897-f9a3a1aa6216"
          ]
        },
        {
          "uuid": "745b6fb1-40bb-4dce-8a39-eea917735c70",
          "code": "12H3K5QKN9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bfb55ddf-0e21-25b8-949c-6715bd1b5c34",
          "code": "1550001",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1550001",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "5a6ff0a2-469b-8d74-3897-f9a3a1aa6216"
          ]
        },
        {
          "uuid": "dfa23262-858e-928a-f9cb-8f2ba4aba8c2",
          "code": "Potassium gluconate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Potassium_gluconate",
          "code_system": "WIKIPEDIA",
          "references": [
            "151784ce-b7b0-275d-ba85-01c2ff518341"
          ]
        },
        {
          "uuid": "fa673b42-6bc7-06d2-5e0b-d2b0ccb6d7bc",
          "code": "12H3K5QKN9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=12H3K5QKN9",
          "code_system": "DAILYMED",
          "references": [
            "89613a58-16ea-bbd6-b61f-192ed0bdca6f"
          ]
        },
        {
          "uuid": "010362e7-08dd-933a-7fdf-7508f8d7c12a",
          "code": "100000079195",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "800f4aec-488d-cebb-fcbb-408214c5b07b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2a5b449d-582f-43cc-bef7-60201da26f7d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "853c67dc-f842-40c7-b78b-db3a60b520b1",
            "refuuid": "2a5095e0-5b0c-47f7-b8f3-3d3ac9967382",
            "name": "POTASSIUM CATION",
            "unii": "295O53K152",
            "linking_id": "295O53K152",
            "ref_pname": "POTASSIUM CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a6fb8060-1610-4677-bb6d-c5d23c9c7521",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "e68425c1-fe2b-40c1-8ae0-35df7acd7deb",
            "refuuid": "20ccd816-7e70-49cc-835e-aa74b6a05e8c",
            "name": "Gluconic Acid",
            "unii": "R4R8J0Q44B",
            "linking_id": "R4R8J0Q44B",
            "ref_pname": "Gluconic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cc452bec-76ea-4411-ad3f-186d81ccbdbb",
          "amount": {
            "uuid": "5c0a00df-a8ee-49f2-9a6b-9c96fc5657bf"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "4dc56d43-60f2-476c-bc13-a3d5e253d60e",
            "refuuid": "20ccd816-7e70-49cc-835e-aa74b6a05e8c",
            "name": "Gluconic Acid",
            "unii": "R4R8J0Q44B",
            "linking_id": "R4R8J0Q44B",
            "ref_pname": "Gluconic Acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "34e110e5-3840-4285-a704-42b9ec968079",
          "name": "D-GLUCONIC ACID POTASSIUM SALT",
          "stdName": "D-GLUCONIC ACID POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "badef170-98da-40e4-957d-de4fa454ec56"
          ],
          "display_name": false
        },
        {
          "uuid": "35ec49d1-e2e7-40df-9300-35ebcc265c6e",
          "name": "D-GLUCONIC ACID, MONOPOTASSIUM SALT",
          "stdName": "D-GLUCONIC ACID, MONOPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cbc5ea0-390e-4641-9c64-01aff7f050a9"
          ],
          "display_name": false
        },
        {
          "uuid": "36d0923a-bc3b-44e7-818c-8cd76ac9022d",
          "name": "E-577",
          "stdName": "E-577",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70345aab-b3be-4d1f-9b64-5857af175600"
          ],
          "display_name": false
        },
        {
          "uuid": "82afc655-aac3-4689-8164-aa6a33d13f1b",
          "name": "GLUCONIC ACID POTASSIUM SALT",
          "stdName": "GLUCONIC ACID POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dca098a5-849f-45ab-9d51-5547bbf75abe",
            "e05433d0-48d3-478c-99d8-2da452d7d4e2"
          ],
          "display_name": false
        },
        {
          "uuid": "946faa6f-230e-4a7e-92af-893da65e2656",
          "name": "GLUCONIC ACID POTASSIUM SALT [MI]",
          "stdName": "GLUCONIC ACID POTASSIUM SALT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e05433d0-48d3-478c-99d8-2da452d7d4e2"
          ],
          "display_name": false
        },
        {
          "uuid": "4509b44a-c039-4bd0-904e-f8e30418fe2a",
          "name": "INS NO.577",
          "stdName": "INS NO.577",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70345aab-b3be-4d1f-9b64-5857af175600"
          ],
          "display_name": false
        },
        {
          "uuid": "9c5c930e-4e74-4bd5-a7da-e61680d88bb3",
          "name": "INS-577",
          "stdName": "INS-577",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70345aab-b3be-4d1f-9b64-5857af175600"
          ],
          "display_name": false
        },
        {
          "uuid": "873ed0a4-286b-44f9-a255-cc398fe5124b",
          "name": "KALI GLUCONICUM",
          "stdName": "KALI GLUCONICUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25abe495-b9e2-4049-9df1-3c39883b5068"
          ],
          "display_name": false
        },
        {
          "uuid": "9b1bf0b5-f29b-46ba-a3db-8a388b39a656",
          "name": "MONOPOTASSIUM D-GLUCONATE",
          "stdName": "MONOPOTASSIUM D-GLUCONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cbc5ea0-390e-4641-9c64-01aff7f050a9"
          ],
          "display_name": false
        },
        {
          "uuid": "603dde84-dd79-4ce1-9f4e-1fdd0e58334c",
          "name": "POTASSIUM D-GLUCONATE",
          "stdName": "POTASSIUM D-GLUCONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b037d52e-5748-438f-8c4e-a53e5f173e83"
          ],
          "display_name": false
        },
        {
          "uuid": "3047846e-9800-4a38-acce-a1625a611bf9",
          "name": "POTASSIUM GLUCONATE",
          "stdName": "POTASSIUM GLUCONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55de08ec-e507-4cb8-bb68-df2f7ec4f4d1",
            "6e63add8-7d15-41c3-96a5-a0762f3e4482",
            "9c47a10d-7c0b-42b4-980b-2f879c52fc06",
            "96d9362f-887f-44cb-9c97-0c4138158f37",
            "5f96a437-8598-4a10-80c1-04a8fde9eca2",
            "7f93bcef-ff22-46c9-8d56-5ecbe0a2be32",
            "6e269eb1-8cb7-4f1e-b9db-425790c8db64",
            "ef570b0f-badc-436d-a739-43436c27d5c0",
            "4e96534d-5d4c-46dc-80d3-6bd20ada13df",
            "89df8c80-210f-4b63-adf4-177c6ece68da",
            "9552a2c1-a979-4274-8adc-d2d2ab8dd37c",
            "4dadfeb9-4900-44db-a1e4-6ece9d59dd4f",
            "1a5f27c9-c523-476c-8124-35733c584d45",
            "c4cf2eba-898b-48c0-98ed-02f5fef6b1b5",
            "1460681d-1d43-4e45-ab20-6c925da0bc85",
            "d75527d8-ae3f-4e55-ab0f-e045bcc89794",
            "71eaf8a8-e02e-49ce-8a1a-cd65e5a775f2",
            "f19b7412-5f2e-4a68-b6b3-98f00228f9ce",
            "88b2b770-d510-484a-97ad-2b40d9e4dd37"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ef8026b8-9906-4933-8e77-7289ef44d10a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0a94feb2-9f42-415e-a219-ab645b604d01",
          "name": "POTASSIUM GLUCONATE [FCC]",
          "stdName": "POTASSIUM GLUCONATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96d9362f-887f-44cb-9c97-0c4138158f37"
          ],
          "display_name": false
        },
        {
          "uuid": "fa96db7a-938e-4903-a6cb-0945798c064c",
          "name": "POTASSIUM GLUCONATE [HSDB]",
          "stdName": "POTASSIUM GLUCONATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88b2b770-d510-484a-97ad-2b40d9e4dd37"
          ],
          "display_name": false
        },
        {
          "uuid": "3f255d87-766f-4a94-9b2a-a3080cbd2e90",
          "name": "POTASSIUM GLUCONATE [JAN]",
          "stdName": "POTASSIUM GLUCONATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4cf2eba-898b-48c0-98ed-02f5fef6b1b5"
          ],
          "display_name": false
        },
        {
          "uuid": "a0a48c1e-82c6-487f-a4ab-b49d7a15b1c5",
          "name": "POTASSIUM GLUCONATE [MART.]",
          "stdName": "POTASSIUM GLUCONATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f96a437-8598-4a10-80c1-04a8fde9eca2"
          ],
          "display_name": false
        },
        {
          "uuid": "fd6117e5-0a31-f5f3-f91d-02285db04d88",
          "name": "POTASSIUM GLUCONATE [USP MONOGRAPH]",
          "stdName": "POTASSIUM GLUCONATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd785644-9ebd-08f0-eec3-fdbff1671c52"
          ],
          "display_name": false
        },
        {
          "uuid": "c5e13631-e8e9-4433-992c-8820b812bc34",
          "name": "POTASSIUM GLUCONATE [USP-RS]",
          "stdName": "POTASSIUM GLUCONATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55de08ec-e507-4cb8-bb68-df2f7ec4f4d1"
          ],
          "display_name": false
        },
        {
          "uuid": "c6385825-c4fa-4d5e-abfd-a790dbcc4f14",
          "name": "POTASSIUM GLUCONATE [VANDF]",
          "stdName": "POTASSIUM GLUCONATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d75527d8-ae3f-4e55-ab0f-e045bcc89794"
          ],
          "display_name": false
        },
        {
          "uuid": "9dd7ca9d-3963-26d4-b675-2b7f0296b975",
          "name": "Potassium gluconate [WHO-DD]",
          "stdName": "POTASSIUM GLUCONATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98b648c5-92f2-d509-98e3-880d1e3c86de"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6e63add8-7d15-41c3-96a5-a0762f3e4482",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3cbc5ea0-390e-4641-9c64-01aff7f050a9",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e269eb1-8cb7-4f1e-b9db-425790c8db64",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25abe495-b9e2-4049-9df1-3c39883b5068",
          "citation": "Energique",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4cf2eba-898b-48c0-98ed-02f5fef6b1b5",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f96a437-8598-4a10-80c1-04a8fde9eca2",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89df8c80-210f-4b63-adf4-177c6ece68da",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96d9362f-887f-44cb-9c97-0c4138158f37",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88b2b770-d510-484a-97ad-2b40d9e4dd37",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55de08ec-e507-4cb8-bb68-df2f7ec4f4d1",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f93bcef-ff22-46c9-8d56-5ecbe0a2be32",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d75527d8-ae3f-4e55-ab0f-e045bcc89794",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e05433d0-48d3-478c-99d8-2da452d7d4e2",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70345aab-b3be-4d1f-9b64-5857af175600",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=364",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=364",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b037d52e-5748-438f-8c4e-a53e5f173e83",
          "citation": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-337.pdf",
          "url": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-337.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "badef170-98da-40e4-957d-de4fa454ec56",
          "citation": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=577",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=577",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52644a33-2085-4250-910b-3fc7575761c4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d754d6b3-fff5-43ce-9474-79405c66cccb",
          "citation": "SRS import [12H3K5QKN9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=12H3K5QKN9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa808f40-89ca-4d80-9d53-ea99a6fc7ab6",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c47a10d-7c0b-42b4-980b-2f879c52fc06",
          "citation": "POTASSIUM GLUCONATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4dadfeb9-4900-44db-a1e4-6ece9d59dd4f",
          "citation": "POTASSIUM GLUCONATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9552a2c1-a979-4274-8adc-d2d2ab8dd37c",
          "citation": "POTASSIUM GLUCONATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef570b0f-badc-436d-a739-43436c27d5c0",
          "citation": "POTASSIUM GLUCONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71eaf8a8-e02e-49ce-8a1a-cd65e5a775f2",
          "citation": "POTASSIUM GLUCONATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1460681d-1d43-4e45-ab20-6c925da0bc85",
          "citation": "POTASSIUM GLUCONATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a5f27c9-c523-476c-8124-35733c584d45",
          "citation": "POTASSIUM GLUCONATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f19b7412-5f2e-4a68-b6b3-98f00228f9ce",
          "citation": "POTASSIUM GLUCONATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e96534d-5d4c-46dc-80d3-6bd20ada13df",
          "citation": "POTASSIUM GLUCONATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dca098a5-849f-45ab-9d51-5547bbf75abe",
          "citation": "GLUCONIC ACID POTASSIUM SALT [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe763049-f890-22e1-a81d-ad9dc9625add",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+299-27-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d35ae5e-2068-f4ba-8c6a-e99bff7d4f31",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=299-27-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "800f4aec-488d-cebb-fcbb-408214c5b07b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5a6ff0a2-469b-8d74-3897-f9a3a1aa6216",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "151784ce-b7b0-275d-ba85-01c2ff518341",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "4977aab9-f45b-3b09-7473-48c7ce522583",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "a89214db-ce4d-42c7-80b3-7654e6b8223f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bd785644-9ebd-08f0-eec3-fdbff1671c52",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "98b648c5-92f2-d509-98e3-880d1e3c86de",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "89613a58-16ea-bbd6-b61f-192ed0bdca6f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "da989731-ba6b-4327-a69f-8d66cd553052",
          "id": "da989731-ba6b-4327-a69f-8d66cd553052",
          "molfile": "\n  Marvin  01132111202D          \n\n  1  0  0  0  1  0            999 V2000\n    6.2922   -0.9645    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "18a7d47e-a37c-4ca4-b022-011ba72db456"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "83ea07bf-7c8d-4194-8feb-b095510c3fb8",
          "id": "83ea07bf-7c8d-4194-8feb-b095510c3fb8",
          "molfile": "\n  Marvin  01132106512D          \n\n 13 12  0  0  1  0            999 V2000\n    1.7787   -0.5637    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.7704    0.2630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0647   -0.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3507   -0.5679    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4927   -0.9687    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.4843   -1.7954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2066   -0.5553    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.1983    0.2714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9206   -0.9687    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.9123   -1.7954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6346   -0.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3486   -0.9645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6263    0.2714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)[O-]",
          "formula": "C6H11O7",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f60d8267-5ead-4150-b173-c3441562e8db"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "195.1476",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "410b39a2-78f8-4684-96a6-d14763735697",
      "version": "21",
      "structure": {
        "id": "9febceae-1e39-4da2-831a-b2044bb50600",
        "molfile": "\n  Marvin  01132108182D          \n\n 14 12  0  0  1  0            999 V2000\n    3.9206   -0.9687    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.2066   -0.5553    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.4927   -0.9687    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6346   -0.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7787   -0.5637    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3486   -0.9645    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.6263    0.2714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9123   -1.7954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1983    0.2714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4843   -1.7954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7704    0.2630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3507   -0.5679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0647   -0.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2922   -0.9645    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  4  2  0  0  0  0\n  1  8  1  6  0  0  0\n  2  9  1  6  0  0  0\n  3 10  1  6  0  0  0\n  5 11  1  1  0  0  0\n 12 13  1  0  0  0  0\n 13  5  1  0  0  0  0\nM  CHG  2   6  -1  14   1\nM  END",
        "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[K+]",
        "formula": "C6H11O7.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "234.2459",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d754d6b3-fff5-43ce-9474-79405c66cccb",
          "aa808f40-89ca-4d80-9d53-ea99a6fc7ab6"
        ],
        "stereo_centers": 4
      },
      "unii": "12H3K5QKN9"
    }
  ]
}