{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c23e3020-5013-455d-9a43-1f7d97e57d22",
          "code": "CHEMBL1516469",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1516469",
          "code_system": "ChEMBL",
          "references": [
            "de34628b-9262-40cc-a01d-754474a44ec1"
          ]
        },
        {
          "uuid": "1f811b2c-0262-469f-b1a4-7a16d9094ae3",
          "code": "119793-66-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=119793-66-7",
          "code_system": "CAS",
          "references": [
            "de34628b-9262-40cc-a01d-754474a44ec1",
            "51962846-78fb-4066-960b-fbb85f2bbd69"
          ]
        },
        {
          "uuid": "884265b9-269f-4256-a970-fd05729b0ddb",
          "code": "SUB36026",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "de34628b-9262-40cc-a01d-754474a44ec1"
          ]
        },
        {
          "uuid": "b341e845-093c-783e-07fb-1494e529a481",
          "code": "DTXSID4057897",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4057897",
          "code_system": "EPA CompTox",
          "references": [
            "0afb4447-f9cf-970e-446a-82cabbb28ca7"
          ]
        },
        {
          "uuid": "20bb77fa-5f00-c48f-27d1-9cbc8f8f94f6",
          "code": "C166451",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C166451",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ee845dde-a667-2634-187f-8c00224ae6a6"
          ]
        },
        {
          "uuid": "dac9295b-3dd5-3690-04c6-c92a4bb9f845",
          "code": "157836",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/157836",
          "code_system": "PUBCHEM",
          "references": [
            "73623a2a-f71f-329d-caa9-211cbe43d540"
          ]
        },
        {
          "uuid": "e44e36e9-7cd2-4ec9-a08a-94e9a32aff84",
          "code": "12FW2YBF04",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bc560f3a-19e7-ae6a-275a-ed806096ae6e",
          "code": "100000128672",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7a6e1107-4d74-6211-3b8b-279b54058798"
          ]
        },
        {
          "uuid": "20d618f0-d234-5195-a603-31e2f59416a3",
          "code": "OO-26",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/OO-26/relevant/1/",
          "code_system": "USAN",
          "references": [
            "0208b0cb-1e17-9943-9e77-cfe5a55e70fd"
          ]
        },
        {
          "uuid": "7cea207e-22f0-1678-b375-f4650bc5a290",
          "code": "759826",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759826",
          "code_system": "NSC",
          "references": [
            "1231390d-7ab2-1da7-3089-1bea0cb63ccd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "34f09603-a794-44f5-bb82-bc9dded37529",
          "amount": {
            "uuid": "78a0b89a-aa07-4155-b326-1a008480324e"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7419c399-87c6-4a82-a456-2c2cc398e8e6",
            "refuuid": "523e21ff-f2d9-4fbb-9842-1e91ad778ba6",
            "name": "LEVOCARNITINE",
            "unii": "0G389FZZ9M",
            "linking_id": "0G389FZZ9M",
            "ref_pname": "LEVOCARNITINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2b7ba135-f0b4-44e8-8af3-cfaaadf079bd",
          "amount": {
            "uuid": "04799b65-f7f6-4a30-9f33-dd6852231959"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "7a7a229d-b751-4cbd-82a2-bad191aa8c36",
            "refuuid": "359e6f56-a47a-4bf2-939a-9e40bec02c5c",
            "name": "PROPIONYL-L-CARNITINE",
            "unii": "0HU2UI27HF",
            "linking_id": "0HU2UI27HF",
            "ref_pname": "PROPIONYL-L-CARNITINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "782cf7ec-24ac-4e59-86ff-c09fbbe2831f",
          "name": "(2R)-3-Carboxy-N,N,N-trimethyl-2-(propanoyloxy)propan-1-aminium chloride",
          "stdName": "(2R)-3-CARBOXY-N,N,N-TRIMETHYL-2-(PROPANOYLOXY)PROPAN-1-AMINIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89d79d50-6717-4d24-8503-44bfe1f7ae91"
          ],
          "display_name": false
        },
        {
          "uuid": "e6fd7450-448c-45f2-b041-904c72ea60c7",
          "name": "1-PROPANAMINIUM, 3-CARBOXY-N,N,N-TRIMETHYL-2-(1-OXOPROPOXY)-, CHLORIDE, (R)-",
          "stdName": "1-PROPANAMINIUM, 3-CARBOXY-N,N,N-TRIMETHYL-2-(1-OXOPROPOXY)-, CHLORIDE, (R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89d79d50-6717-4d24-8503-44bfe1f7ae91"
          ],
          "display_name": false
        },
        {
          "uuid": "809469ae-6418-49e3-84c3-e869a0438778",
          "name": "DROMOS",
          "stdName": "DROMOS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89d79d50-6717-4d24-8503-44bfe1f7ae91"
          ],
          "display_name": false
        },
        {
          "uuid": "dde2f6f2-0aab-42cb-9d32-5aa61cbc6b74",
          "name": "LEVOCARNITINE PROPIONATE HCL",
          "stdName": "LEVOCARNITINE PROPIONATE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d6ab216-a8ae-4a92-a76c-320866d01dd3"
          ],
          "display_name": false
        },
        {
          "uuid": "94a0a95f-b773-4434-8230-f45b9ec1d884",
          "name": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE",
          "stdName": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51cbe30e-0c0a-47c0-b768-3af40be10554",
            "89d79d50-6717-4d24-8503-44bfe1f7ae91",
            "1b61cd53-978f-4efd-bf98-c8598db45fa9",
            "9ddbab39-cf5d-4877-bc4f-e2cbff8d5adc",
            "ae45c528-d7d6-4857-bbdf-47469085aa1b",
            "94900648-4e1b-4945-9981-206608200393",
            "978bc927-fe73-4739-b9fc-534638dc83cb"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "847e46f8-818d-49d5-98f7-d2ff1b8d8566",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "f407ad2f-dc0e-4cde-ac99-04a76a9396c5",
          "name": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE [MART.]",
          "stdName": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94900648-4e1b-4945-9981-206608200393"
          ],
          "display_name": false
        },
        {
          "uuid": "c74f445e-17c8-48e9-9377-b60eea229ed1",
          "name": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE [USAN]",
          "stdName": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "978bc927-fe73-4739-b9fc-534638dc83cb"
          ],
          "display_name": false
        },
        {
          "uuid": "eeb41959-e949-0bec-035f-2e503b3ac63e",
          "name": "Levocarnitine propionate hydrochloride [WHO-DD]",
          "stdName": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78ad1109-7faa-93d7-00d5-2a2863f789f1"
          ],
          "display_name": false
        },
        {
          "uuid": "3e14587f-27cc-62ea-fa72-85c795f0eba0",
          "name": "NSC-759826",
          "stdName": "NSC-759826",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1231390d-7ab2-1da7-3089-1bea0cb63ccd"
          ],
          "display_name": false
        },
        {
          "uuid": "7e461b54-bccb-47f9-8b9b-cdd9b4f22231",
          "name": "PROPIONYL L-CARNITINE HYDROCHLORIDE",
          "stdName": "PROPIONYL L-CARNITINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "670be8db-ca82-43db-89cc-4d8c37695d3b"
          ],
          "display_name": false
        },
        {
          "uuid": "249df560-15a1-46ad-892d-32090226cf78",
          "name": "Propionyl-L-carnitine chloride",
          "stdName": "PROPIONYL-L-CARNITINE CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51962846-78fb-4066-960b-fbb85f2bbd69"
          ],
          "display_name": true
        },
        {
          "uuid": "431448a6-dfaf-44bb-811a-358268e98995",
          "name": "ST 261",
          "stdName": "ST 261",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6fd5c2a3-4465-476e-b9ea-99ed17cfad5c"
          ],
          "display_name": false
        },
        {
          "uuid": "41beb7dc-f150-4455-9e92-54de161908f8",
          "name": "ST-261",
          "stdName": "ST-261",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6fd5c2a3-4465-476e-b9ea-99ed17cfad5c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "89d79d50-6717-4d24-8503-44bfe1f7ae91",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "978bc927-fe73-4739-b9fc-534638dc83cb",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94900648-4e1b-4945-9981-206608200393",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d6ab216-a8ae-4a92-a76c-320866d01dd3",
          "citation": "http://www.ama-assn.org/ama/pub/physician-resources/medical-science/united-states-adopted-names-coun",
          "url": "http://www.ama-assn.org/ama/pub/physician-resources/medical-science/united-states-adopted-names-coun",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51cbe30e-0c0a-47c0-b768-3af40be10554",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fd5c2a3-4465-476e-b9ea-99ed17cfad5c",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "670be8db-ca82-43db-89cc-4d8c37695d3b",
          "citation": "clinical trials",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de34628b-9262-40cc-a01d-754474a44ec1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390975000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca6d764e-9418-4f23-86ef-3d03b25d5467",
          "citation": "SRS import [12FW2YBF04]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=12FW2YBF04",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390975000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b61cd53-978f-4efd-bf98-c8598db45fa9",
          "citation": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ddbab39-cf5d-4877-bc4f-e2cbff8d5adc",
          "citation": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae45c528-d7d6-4857-bbdf-47469085aa1b",
          "citation": "LEVOCARNITINE PROPIONATE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0afb4447-f9cf-970e-446a-82cabbb28ca7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119793-66-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7a6e1107-4d74-6211-3b8b-279b54058798",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "50e9ab6f-b534-8315-a13c-7e7853f5a6ad",
          "citation": "USAN COUN 2002",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "51962846-78fb-4066-960b-fbb85f2bbd69",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0208b0cb-1e17-9943-9e77-cfe5a55e70fd",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "73623a2a-f71f-329d-caa9-211cbe43d540",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "ee845dde-a667-2634-187f-8c00224ae6a6",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "1231390d-7ab2-1da7-3089-1bea0cb63ccd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "78ad1109-7faa-93d7-00d5-2a2863f789f1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8881986e-5819-434d-afb6-32aaf9023435",
          "id": "8881986e-5819-434d-afb6-32aaf9023435",
          "molfile": "\n  CDK     06252410082D\n\n  1  0  0  0  0  0  0  0  0  0999 V2000\n   31.6160   -7.4533    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7735fca3-cd1b-44e8-99e7-3f6b2941d182"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "107f937f-42e7-4f14-9392-80c21d433f7b",
          "id": "107f937f-42e7-4f14-9392-80c21d433f7b",
          "molfile": "\n  CDK     06252410082D\n\n 15 14  0  0  1  0  0  0  0  0999 V2000\n   26.1543   -6.5191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8532   -4.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3834   -4.4912    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   27.0301   -3.9694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8247   -7.3211    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   24.8247   -8.8844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3233   -9.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5002   -8.3624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6246  -10.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0942  -11.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4575   -6.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2893   -7.5927    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   20.9938   -6.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3097   -8.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8848   -9.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 12  1  0  0  0  0\nM  CHG  1   3  -1\nM  CHG  1  12   1\nM  END",
          "smiles": "CCC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C",
          "formula": "C10H19NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c8bd35a2-73ca-4242-8cc4-5ab52c4ae334"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "217.2626",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "24755225-1dd6-4a73-96ee-c02aeeb90aa1",
      "version": "18",
      "structure": {
        "id": "e0ee65c7-19a4-4453-8132-41a7803b5c3c",
        "molfile": "\n   JSDraw206252410082D\n\n 16 14  0  0  1  0              0 V2000\n   26.1543   -6.5191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8532   -4.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3834   -4.4912    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   27.0301   -3.9694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8247   -7.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8247   -8.8844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3233   -9.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5002   -8.3624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6246  -10.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0942  -11.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4575   -6.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2893   -7.5927    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   20.9938   -6.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3097   -8.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8848   -9.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.6160   -7.4533    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 12  1  0  0  0  0\nM  CHG  2   3  -1  12   1\nM  END",
        "smiles": "CCC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C.Cl",
        "formula": "C10H19NO4.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "253.7234",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ca6d764e-9418-4f23-86ef-3d03b25d5467",
          "89d79d50-6717-4d24-8503-44bfe1f7ae91"
        ],
        "stereo_centers": 1
      },
      "unii": "12FW2YBF04"
    }
  ]
}