{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "060f56b4-30dc-4d05-bc1c-8103edd40960", "code": "1533-45-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1533-45-5", "code_system": "CAS", "references": [ "57c2df27-2883-4c2c-8da3-820a67af1fba", "d1af36b9-beb7-4df4-a315-8d2eceec98c0" ] }, { "uuid": "c6c98de8-a207-4053-b164-d131b71c4362", "code": "21 CFR 178.3297", "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297", "code_system": "CFR", "references": [ "57c2df27-2883-4c2c-8da3-820a67af1fba" ] }, { "uuid": "de00e539-7f58-43d4-8da0-32804a02f20d", "code": "21 CFR 176.170", "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=176.170", "code_system": "CFR", "references": [ "57c2df27-2883-4c2c-8da3-820a67af1fba" ] }, { "uuid": "e085ab3a-a3bc-4eec-81a5-39f07de602ea", "code": "36422-63-6", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=36422-63-6", "code_system": "CAS", "references": [ "57c2df27-2883-4c2c-8da3-820a67af1fba", "ac0fb3db-cddb-481d-8923-1558638715ee" ] }, { "uuid": "2a2282d8-5f61-4b63-bd0a-1437661de95d", "code": "216-245-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.014.769", "code_system": "ECHA (EC/EINECS)", "references": [ "57c2df27-2883-4c2c-8da3-820a67af1fba" ] }, { "uuid": "e4121bc0-3966-4f50-8189-870057fbc368", "code": "5702717", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5702717", "code_system": "PUBCHEM", "references": [ "57c2df27-2883-4c2c-8da3-820a67af1fba" ] }, { "uuid": "3da5aaeb-7464-8098-9281-81afe8f2e219", "code": "DTXSID4051744", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4051744", "code_system": "EPA CompTox", "references": [ "f705bb98-69fe-9603-c2bb-b3bafefe7934" ] }, { "uuid": "9803d471-495c-4221-99e3-1468cac19505", "code": "128BY3ERD5", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "20d9be1c-b80c-85b7-cf92-73ef5fdff70d", "code": "252132", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=252132", "code_system": "NSC", "references": [ "dc86fd4c-876c-398d-3f03-c2f53d00e843" ] } ], "substance_class": "chemical", "names": [ { "uuid": "a23b7f72-1092-45ed-adc2-f71481f15d58", "name": "2,2'-(1,2-ETHENEDIYLDI-4,1-PHENYLENE)BISBENZOXAZOLE", "stdName": "2,2'-(1,2-ETHENEDIYLDI-4,1-PHENYLENE)BISBENZOXAZOLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "154966f7-6c14-4148-bde3-5e73c8e739da" ], "display_name": false }, { "uuid": "79ac69f9-c964-4264-a052-109e28108c76", "name": "2,2'-(VINYLENEDI-P-PHENYLENE)BISBENZOXAZOLE", "stdName": "2,2'-(VINYLENEDI-P-PHENYLENE)BISBENZOXAZOLE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false }, { "uuid": "2c4729ea-9026-4689-8aee-1811104a7638", "name": "4,4'-BIS(2-BENZOXAZOLYL)STILBENE", "stdName": "4,4'-BIS(2-BENZOXAZOLYL)STILBENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false }, { "uuid": "7828a706-0847-422e-8e27-9ad50b4a31c3", "name": "4,4'-BIS(2-BENZOXAZOLYL)STILBENE, TRANS-", "stdName": "4,4'-BIS(2-BENZOXAZOLYL)STILBENE, TRANS-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea010b54-8a2a-4ca2-a43c-7a21a2dcc74b" ], "display_name": false }, { "uuid": "dc236f83-bb2d-4942-9c18-d1f5879f1291", "name": "BENZOXAZOLE, 2,2'-(1,2-ETHENEDIYLDI-4,1-PHENYLENE)BIS-", "stdName": "BENZOXAZOLE, 2,2'-(1,2-ETHENEDIYLDI-4,1-PHENYLENE)BIS-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false }, { "uuid": "6ddb1a74-5c5d-47e4-9892-845f21fb8f4a", "name": "BENZOXAZOLE, 2,2'-(1,2-ETHENEDIYLDI-4,1-PHENYLENE)BIS-, (E)-", "stdName": "BENZOXAZOLE, 2,2'-(1,2-ETHENEDIYLDI-4,1-PHENYLENE)BIS-, (E)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false }, { "uuid": "d6630e6f-abe6-4785-8a24-09fa5f83b1e3", "name": "C.I. FLUORESCENT BRIGHTENER 393", "stdName": "C.I. FLUORESCENT BRIGHTENER 393", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false }, { "uuid": "6590afbb-e510-40b0-b2f6-b8c5309e6051", "name": "CI 40674", "stdName": "CI 40674", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false }, { "uuid": "7002f0ca-67d4-4915-bbd2-f54f68f970a8", "name": "EASTOBRITE OB 1", "stdName": "EASTOBRITE OB 1", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false }, { "uuid": "ac1ac17e-20e6-4806-bd96-279e24009b0f", "name": "FLUORESCENT BRIGHTENER 393", "stdName": "FLUORESCENT BRIGHTENER 393", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "0928e555-0cf8-46e9-b8d6-57d22a51ac85", "3879e8b8-92b1-47b2-b367-5e18688619ef", "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "55ac44ee-55e6-43dd-8186-308ad5bfc5a1", "name_org": "INCI" } ] }, { "uuid": "7a4e8c5c-a94b-4dfd-ac51-4ef2160668f0", "name": "NSC-252132", "stdName": "NSC-252132", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "dc86fd4c-876c-398d-3f03-c2f53d00e843" ], "display_name": false }, { "uuid": "58af4506-ad8d-4fef-85df-337a74df9507", "name": "OPTICAL BRIGHTENER 1", "stdName": "OPTICAL BRIGHTENER 1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false }, { "uuid": "c89a740b-55af-4058-a86c-489056dc61c8", "name": "P,P'-BIS(2-BENZOXAZOLYL)STILBENE", "stdName": "P,P'-BIS(2-BENZOXAZOLYL)STILBENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "display_name": false } ], "references": [ { "uuid": "ea010b54-8a2a-4ca2-a43c-7a21a2dcc74b", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "154966f7-6c14-4148-bde3-5e73c8e739da", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aa7e36e2-d753-4e82-ac65-af5164d7b72a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0928e555-0cf8-46e9-b8d6-57d22a51ac85", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "57c2df27-2883-4c2c-8da3-820a67af1fba", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393013000, "tags": [ "NOMEN" ] }, { "uuid": "36d38f0c-dbeb-4ca3-b173-9e703c1467ec", "citation": "SRS import [128BY3ERD5]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=128BY3ERD5", "doc_type": "SRS", "public_domain": true, "document_date": 1493393013000, "tags": [ "NOMEN" ] }, { "uuid": "3879e8b8-92b1-47b2-b367-5e18688619ef", "citation": "FLUORESCENT BRIGHTENER 393 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f705bb98-69fe-9603-c2bb-b3bafefe7934", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1533-45-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "dc86fd4c-876c-398d-3f03-c2f53d00e843", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "ac0fb3db-cddb-481d-8923-1558638715ee", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "d1af36b9-beb7-4df4-a315-8d2eceec98c0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f9770855-5032-44c1-b05f-0239fadf0053", "id": "f9770855-5032-44c1-b05f-0239fadf0053", "molfile": "\n Marvin 01132112562D \n\n 32 37 0 0 0 0 999 V2000\n -6.2047 -0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2047 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4903 0.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7758 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9912 0.3102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5062 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9912 -1.0247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7758 -0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4903 -1.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6812 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2687 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4437 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0312 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2062 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2063 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0313 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4438 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2688 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6813 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2688 1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4438 1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5063 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9912 -0.3102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7758 -0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4903 -0.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2047 -0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2047 0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4903 1.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7758 0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9912 1.0247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4437 -1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2688 -1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 9 1 2 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 8 4 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 10 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 32 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 31 2 0 0 0 0\n 15 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 21 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 22 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 2 0 0 0 0\n 30 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 29 2 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 32 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)nc(-c3ccc(/C=C/c4ccc(cc4)-c5nc6ccccc6o5)cc3)o2", "formula": "C28H18N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d2013972-79be-434f-bd13-cf114e8290f7" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "414.4558", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "5e62ffcf-843e-4679-b0f8-d8cb515f6548", "version": "6", "structure": { "id": "b3bb3e9c-ce3c-44d6-ba75-56ef546d9f45", "molfile": "\n Marvin 01132109182D \n\n 32 37 0 0 0 0 999 V2000\n 0.2063 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2062 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6812 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2687 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4437 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0312 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4437 -1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2688 -1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6813 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2688 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4438 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0313 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4438 1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2688 1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9912 0.3102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5062 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9912 -1.0247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7758 -0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.7758 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4903 -1.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2047 -0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2047 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4903 0.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9912 1.0247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5063 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9912 -0.3102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7758 -0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7758 0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4903 -0.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2047 -0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2047 0.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4903 1.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 3 8 2 0 0 0 0\n 2 6 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 9 14 2 0 0 0 0\n 1 12 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 15 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 19 2 0 0 0 0\n 20 18 2 0 0 0 0\n 3 16 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 24 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 28 2 0 0 0 0\n 29 27 2 0 0 0 0\n 9 25 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)nc(-c3ccc(/C=C/c4ccc(cc4)-c5nc6ccccc6o5)cc3)o2", "formula": "C28H18N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "414.4558", "optical_activity": "NONE", "references": [ "36d38f0c-dbeb-4ca3-b173-9e703c1467ec", "aa7e36e2-d753-4e82-ac65-af5164d7b72a" ], "stereo_centers": 0 }, "unii": "128BY3ERD5" } ] }