{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fe547b4d-c587-4183-9c73-64163b5bc72b",
          "code": "C533",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C533",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5a42b728-fef5-4115-ba77-31dc2b85b697"
          ]
        },
        {
          "uuid": "9510652c-141a-4c82-b3dd-9bbacbdd5117",
          "code": "D006151",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68006151",
          "code_system": "MESH",
          "references": [
            "5a42b728-fef5-4115-ba77-31dc2b85b697"
          ]
        },
        {
          "uuid": "fc537ad6-7272-4279-bb48-d6675a5b77ed",
          "code": "118-00-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=118-00-3",
          "code_system": "CAS",
          "references": [
            "5a42b728-fef5-4115-ba77-31dc2b85b697",
            "a9bccb4a-c3db-483d-844a-3dc9d3fbd105"
          ]
        },
        {
          "uuid": "4fdac34d-3ba1-44f5-bae4-aa6a7536e26f",
          "code": "204-227-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.844",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5a42b728-fef5-4115-ba77-31dc2b85b697"
          ]
        },
        {
          "uuid": "17ae2440-b267-41b9-99cd-b0dd1a9ad16a",
          "code": "1591890",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1591890/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5a42b728-fef5-4115-ba77-31dc2b85b697"
          ]
        },
        {
          "uuid": "b6881dd3-e7b4-40a1-9f8b-17624284df19",
          "code": "m5871",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5871?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5a42b728-fef5-4115-ba77-31dc2b85b697"
          ]
        },
        {
          "uuid": "77263c5d-8088-4f23-92ea-1d2161cbbb2b",
          "code": "SUB14037MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5a42b728-fef5-4115-ba77-31dc2b85b697"
          ]
        },
        {
          "uuid": "1b428ead-a8d1-b51b-60ad-211137e5ccac",
          "code": "135398635",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135398635",
          "code_system": "PUBCHEM",
          "references": [
            "4ca18f8b-9d17-0270-b214-e8b6828028e2"
          ]
        },
        {
          "uuid": "ab909ad6-918f-b407-843b-996c6a8766ce",
          "code": "Guanosine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Guanosine",
          "code_system": "WIKIPEDIA",
          "references": [
            "d442c5fe-5bec-3b37-dc5a-6e7ef6f26327"
          ]
        },
        {
          "uuid": "1deba8cc-657c-32e1-f6b5-cd1fbe93c606",
          "code": "C707",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Nucleic Acids, Nucleosides, and Nucleotides[C708]|Nucleoside",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e3c7656d-e790-26b6-b15d-4d61ed74c96b"
          ]
        },
        {
          "uuid": "b851e4f1-fbb1-4068-00f6-bf4f1d2077ca",
          "code": "79670-6",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Guanosine [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/79670-6/",
          "code_system": "LOINC",
          "references": [
            "e3c7656d-e790-26b6-b15d-4d61ed74c96b"
          ]
        },
        {
          "uuid": "9a8cf98c-e7b9-5347-9a7e-9944eabf2007",
          "code": "78691-3",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Guanosine/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/78691-3/",
          "code_system": "LOINC",
          "references": [
            "e3c7656d-e790-26b6-b15d-4d61ed74c96b"
          ]
        },
        {
          "uuid": "841282b0-1e27-2c24-0dcd-cad9dfe07663",
          "code": "79660-7",
          "comments": "LOINC|ACTIVE|CHEM|CSF|Guanosine [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/79660-7/",
          "code_system": "LOINC",
          "references": [
            "e3c7656d-e790-26b6-b15d-4d61ed74c96b"
          ]
        },
        {
          "uuid": "5c9f7b28-1acf-66c7-2912-0e51ae6c7521",
          "code": "1436 (Number of products:3)",
          "comments": "Dietary Supplement Label Database|Chemical|Guanosine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1436&item=Guanosine",
          "code_system": "DSLD",
          "references": [
            "e3c7656d-e790-26b6-b15d-4d61ed74c96b"
          ]
        },
        {
          "uuid": "ef132f93-70e5-4706-5dc6-7704447dfcf9",
          "code": "DB02857",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02857",
          "code_system": "DRUG BANK",
          "references": [
            "e3c7656d-e790-26b6-b15d-4d61ed74c96b"
          ]
        },
        {
          "uuid": "86d5d4af-d4f9-496d-9a3c-e82aaea2d367",
          "code": "12133JR80S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7bf7cbfa-1bef-473a-7e18-6d724107e41c",
          "code": "16750",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16750",
          "code_system": "CHEBI",
          "references": [
            "e3c7656d-e790-26b6-b15d-4d61ed74c96b"
          ]
        },
        {
          "uuid": "f893a74e-3073-1d2d-bf71-d25db0829773",
          "code": "100000077898",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "08f1032e-a74e-5f0c-38e1-9ce7c66d664e"
          ]
        },
        {
          "uuid": "8626639e-e3f3-3b0d-a82e-777f044816d8",
          "code": "DTXSID00893055",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00893055",
          "code_system": "EPA CompTox",
          "references": [
            "e3c7656d-e790-26b6-b15d-4d61ed74c96b"
          ]
        },
        {
          "uuid": "e8fd2d13-ffbe-8699-0601-9f4cc2459849",
          "code": "19994",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=19994",
          "code_system": "NSC",
          "references": [
            "a36171ab-c642-0bf0-fa80-083ea21cfa2e"
          ]
        },
        {
          "uuid": "9e894897-1e32-98c6-6e8b-cb1ea247abcd",
          "code": "12133JR80S",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=12133JR80S",
          "code_system": "DAILYMED",
          "references": [
            "ca5bb837-69c0-82ae-7cc2-00be7a3bf688"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "38e309f4-26ae-4906-a137-fcbe132ad379",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d72c1026-cf7e-41ab-a422-902fed89594d",
            "refuuid": "d7deb216-be02-42ae-934c-55bccdf95e50",
            "name": "GUANOSINE",
            "unii": "12133JR80S",
            "linking_id": "12133JR80S",
            "ref_pname": "GUANOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7888d5da-fd8c-49a2-a38a-79932858ddd8",
          "amount": {
            "uuid": "66bc6900-ef94-4039-81b5-d73da1467458",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "60e8c2bf-4749-4d58-a7c8-d8ae56ca69a7"
          ],
          "related_substance": {
            "uuid": "3307aa23-d18f-4f07-9c58-e0621d4eb4a1",
            "refuuid": "dc70f2f3-5a14-4f5f-bf00-2fb0ad0100e2",
            "name": "ADENOSINE",
            "unii": "K72T3FS567",
            "linking_id": "K72T3FS567",
            "ref_pname": "ADENOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d0fadfa1-a882-4449-85b6-478892fde3cf",
          "amount": {
            "uuid": "c3e9688a-1cf7-42a5-93f6-a3b6aec12f5a",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "c92b3887-9632-4f59-91bc-e931c6f2ea33"
          ],
          "related_substance": {
            "uuid": "529df25e-aa98-4d81-8046-e3709755f268",
            "refuuid": "dc70f2f3-5a14-4f5f-bf00-2fb0ad0100e2",
            "name": "ADENOSINE",
            "unii": "K72T3FS567",
            "linking_id": "K72T3FS567",
            "ref_pname": "ADENOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "491e2dca-9d3a-4fcd-e8f2-dce987748e6a",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "a9bccb4a-c3db-483d-844a-3dc9d3fbd105"
          ],
          "related_substance": {
            "uuid": "d0392a7f-8244-4fc4-822b-7851abfe1f62",
            "refuuid": "a15e38c2-b0e4-41f7-b305-7b73930caa26",
            "name": "GUANOSINE DIHYDRATE",
            "unii": "E62RXW39EW",
            "linking_id": "E62RXW39EW",
            "ref_pname": "GUANOSINE DIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9efa9607-2655-45b5-883a-cb62051f721f",
          "name": "2-AMINO-9-.BETA.-D-RIBOFURANOSYL-1,9-DIHYDRO-6H-PURIN-6-ONE",
          "stdName": "2-AMINO-9-.BETA.-D-RIBOFURANOSYL-1,9-DIHYDRO-6H-PURIN-6-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60e8c2bf-4749-4d58-a7c8-d8ae56ca69a7"
          ],
          "display_name": false
        },
        {
          "uuid": "966fb888-c47f-4be2-a6f5-d1f7a70b05c8",
          "name": "2-AMINO-9-.BETA.-D-RIBOFURANOSYL-9H-PURINE-6(1H)-ONE",
          "stdName": "2-AMINO-9-.BETA.-D-RIBOFURANOSYL-9H-PURINE-6(1H)-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "151fc180-4197-459e-8361-b4056879aaf0",
            "a927954a-f12a-477d-bbc9-f863f97716b3"
          ],
          "display_name": false
        },
        {
          "uuid": "cf413ffd-21d1-f6ff-72d8-2667f10b1485",
          "name": "ADENOSINE IMPURITY H [EP IMPURITY]",
          "stdName": "ADENOSINE IMPURITY H [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b52fc43-05f7-4aa1-998f-8c5dde774ea7",
            "a927954a-f12a-477d-bbc9-f863f97716b3"
          ],
          "display_name": false
        },
        {
          "uuid": "915943ee-0dbd-495a-a18b-14f72e3ba284",
          "name": "DL-GUANOSINE",
          "stdName": "DL-GUANOSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f440821c-9459-48eb-90d2-e32577b5868c",
            "a927954a-f12a-477d-bbc9-f863f97716b3"
          ],
          "display_name": false
        },
        {
          "uuid": "f7e9beb1-b7e8-433b-afba-4c75ae2eb4e2",
          "name": "GUANOSINE",
          "stdName": "GUANOSINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7291aae-d4a1-4c17-a2e6-3e18f5c693dc",
            "04447513-5230-4c77-b5d2-cb841f9602da",
            "38ed5947-aca9-4e6d-b494-705de1ce7a52",
            "a927954a-f12a-477d-bbc9-f863f97716b3",
            "1d04c0ba-3da4-4746-b041-1dca63fa5b0f",
            "5aedd406-8b70-4b9b-89a3-f48831726d24",
            "ad1d7b1f-6f4a-43a6-8be6-c03d7dd3a310",
            "0f2be29c-94d9-40c7-b642-43524e5348f9",
            "00a4f6f4-7775-4b3e-b4c5-f02d3446f8a5",
            "1edc45dc-0dee-4ef2-bfa2-8d513344e749"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5615a335-828e-4975-be8d-a6d7029e273b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3fadefea-73a0-43e9-9c82-c0f1f1cb9960",
          "name": "GUANOSINE [MART.]",
          "stdName": "GUANOSINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7291aae-d4a1-4c17-a2e6-3e18f5c693dc"
          ],
          "display_name": false
        },
        {
          "uuid": "34ddd5ce-bb6e-4311-9b85-71d91a80604a",
          "name": "GUANOSINE [MI]",
          "stdName": "GUANOSINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38ed5947-aca9-4e6d-b494-705de1ce7a52",
            "a927954a-f12a-477d-bbc9-f863f97716b3"
          ],
          "display_name": false
        },
        {
          "uuid": "f26a9782-1f7d-5d32-50a7-1433aa2652b0",
          "name": "GUANOSINE [USP IMPURITY]",
          "stdName": "GUANOSINE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c92b3887-9632-4f59-91bc-e931c6f2ea33"
          ],
          "display_name": false
        },
        {
          "uuid": "ca9d0081-acc8-3dd6-0faf-97c077fbf417",
          "name": "Guanosine [WHO-DD]",
          "stdName": "GUANOSINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "071a0777-5813-60bd-80bb-8575386768a7"
          ],
          "display_name": false
        },
        {
          "uuid": "fc5f11ca-2adf-4e03-b337-0b834e113dba",
          "name": "NSC-19994",
          "stdName": "NSC-19994",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a4e6a5b-94bb-4ed1-a864-83d55f2d1a36",
            "a927954a-f12a-477d-bbc9-f863f97716b3"
          ],
          "display_name": false
        },
        {
          "uuid": "e96a7a3b-67ec-49e1-bd78-26ae2fe32999",
          "name": "VERNINE",
          "stdName": "VERNINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "151fc180-4197-459e-8361-b4056879aaf0",
            "a927954a-f12a-477d-bbc9-f863f97716b3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "04447513-5230-4c77-b5d2-cb841f9602da",
          "citation": "GUANOSINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1edc45dc-0dee-4ef2-bfa2-8d513344e749",
          "citation": "GUANOSINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad1d7b1f-6f4a-43a6-8be6-c03d7dd3a310",
          "citation": "GUANOSINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0f2be29c-94d9-40c7-b642-43524e5348f9",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a927954a-f12a-477d-bbc9-f863f97716b3",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "151fc180-4197-459e-8361-b4056879aaf0",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7291aae-d4a1-4c17-a2e6-3e18f5c693dc",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00a4f6f4-7775-4b3e-b4c5-f02d3446f8a5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b52fc43-05f7-4aa1-998f-8c5dde774ea7",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5aedd406-8b70-4b9b-89a3-f48831726d24",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f440821c-9459-48eb-90d2-e32577b5868c",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38ed5947-aca9-4e6d-b494-705de1ce7a52",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a4e6a5b-94bb-4ed1-a864-83d55f2d1a36",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a42b728-fef5-4115-ba77-31dc2b85b697",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390939000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "785bca8a-6b30-4049-9def-8934dd215afa",
          "citation": "SRS import [12133JR80S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=12133JR80S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390939000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d04c0ba-3da4-4746-b041-1dca63fa5b0f",
          "citation": "GUANOSINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d442c5fe-5bec-3b37-dc5a-6e7ef6f26327",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Luzindole",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "08f1032e-a74e-5f0c-38e1-9ce7c66d664e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e3c7656d-e790-26b6-b15d-4d61ed74c96b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a9bccb4a-c3db-483d-844a-3dc9d3fbd105",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4ca18f8b-9d17-0270-b214-e8b6828028e2",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "60e8c2bf-4749-4d58-a7c8-d8ae56ca69a7",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c92b3887-9632-4f59-91bc-e931c6f2ea33",
          "citation": "USP",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "071a0777-5813-60bd-80bb-8575386768a7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a36171ab-c642-0bf0-fa80-083ea21cfa2e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ca5bb837-69c0-82ae-7cc2-00be7a3bf688",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "459bccb5-23ce-4eba-bc27-4ecea86273f7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e58db766-836c-4dcf-ac67-68f217268c12",
          "id": "e58db766-836c-4dcf-ac67-68f217268c12",
          "molfile": "\n  Marvin  01132111532D          \n\n 20 22  0  0  1  0            999 V2000\n    4.4047   -6.1155    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.7721   -5.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9460   -5.5821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1929   -5.6717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9813   -6.1155    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.9813   -4.9400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4998   -4.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9813   -3.6137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7648   -3.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7648   -4.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4776   -5.0958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1904   -4.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9032   -5.0958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1904   -3.8544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4776   -3.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4776   -2.6223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6745   -6.7150    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.0002   -7.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6973   -6.7150    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.3763   -7.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 19  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 17  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 15  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 18  1  6  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  6  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c2[nH]c(N)nc3=O)O1)O)O)O",
          "formula": "C10H13N5O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "abec6a2a-fb98-4b9a-8dc1-40a62bd01196"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "283.2411",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d7deb216-be02-42ae-934c-55bccdf95e50",
      "version": "28",
      "structure": {
        "id": "03be8be2-7b8a-42b1-80d4-6547e6eea963",
        "molfile": "\n  Marvin  01132100302D          \n\n 20 22  0  0  1  0            999 V2000\n    6.7648   -4.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9813   -4.9400    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9813   -6.1155    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.6745   -6.7150    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6973   -6.7150    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3763   -7.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4047   -6.1155    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.1929   -5.6717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7721   -5.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9460   -5.5821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0002   -7.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4998   -4.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9813   -3.6137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7648   -3.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4776   -3.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4776   -2.6223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1904   -3.8544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1904   -4.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4776   -5.0958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9032   -5.0958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  1  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  3  1  0  0  0  0\n  7  9  1  1  0  0  0\n 10  9  1  0  0  0  0\n  4 11  1  6  0  0  0\n 12  2  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  1  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19  1  1  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c2nc(N)[nH]c3=O)O1)O)O)O",
        "formula": "C10H13N5O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "283.2411",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "785bca8a-6b30-4049-9def-8934dd215afa",
          "151fc180-4197-459e-8361-b4056879aaf0"
        ],
        "stereo_centers": 4
      },
      "unii": "12133JR80S"
    }
  ]
}