{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c49b1c59-5d3e-4749-95b5-a82c26944929", "code": "16042343", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16042343", "code_system": "PUBCHEM", "references": [ "c59990c5-761e-4807-ae08-f624ae071002" ] }, { "uuid": "07940eec-17ed-4b24-8359-bd7b5de7ebfc", "code": "927685-43-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=927685-43-6", "code_system": "CAS", "references": [ "c59990c5-761e-4807-ae08-f624ae071002", "0b9f052b-e8f0-5584-d57b-c0bddd898b7e" ] }, { "uuid": "8d2c8c3b-e633-4023-b7ba-71bfc62db65d", "code": "10969", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=10969", "code_system": "INN", "references": [ "9cd1641f-f53a-6373-330f-61d4c1a7b4d3" ] }, { "uuid": "9671bb47-a1e5-a73f-c188-29e0393adbcc", "code": "C166448", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C166448", "code_system": "NCI_THESAURUS", "references": [ "d68bab9d-c824-1c30-3c60-45d57b95d86b" ] }, { "uuid": "832cf539-f394-4d55-ad01-c63eb4b8cf92", "code": "11VWK61J69", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "31d75796-be71-5732-dee1-6725f2e523de", "code": "907322", "comments": "ORPHAN DRUG|Designated|Treatment of Amyotrophic Lateral Sclerosis", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=907322", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "92b2f1cb-5f7e-037a-a5f2-779ec8db0094", "code": "300000005906", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "c7ad37d4-79f5-ef13-2881-b28ed55a2cfd" ] } ], "relationships": [ { "uuid": "f2f09d20-0275-4958-a84f-747576648f92", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "c368049c-e5cf-4817-b1ad-8583ac05e3c6", "refuuid": "faf6cd0d-adef-40de-80ec-a4e6c0841b17", "name": "CRISDESALAZINE", "unii": "11VWK61J69", "linking_id": "11VWK61J69", "ref_pname": "CRISDESALAZINE", "substance_class": "reference" } }, { "uuid": "4d4777b4-4116-46e3-8d48-bf2479d998e1", "amount": { "uuid": "9ebdc618-4c0f-4fbc-8de8-5fb4c0309308" }, "type": "TARGET->INHIBITOR", "references": [ "52870d33-e228-4f84-a750-0acfddfbca77" ], "related_substance": { "uuid": "7d757444-7c60-46fd-bd72-be9d6c0aaeec", "refuuid": "355f095b-4fa8-4f5c-bcbe-a5e785465479", "name": "DINOPROSTONE", "unii": "K7Q1JQR04M", "linking_id": "K7Q1JQR04M", "ref_pname": "DINOPROSTONE", "substance_class": "reference" } }, { "uuid": "a08e6cc3-3f4a-455a-812e-93d9c0a1680a", "type": "TARGET->INHIBITOR", "references": [ "609f6fc4-e131-7fdb-8cf3-3acc2972e352" ], "related_substance": { "uuid": "297b49ea-0e51-4d50-b849-fbe422ad1e87", "refuuid": "38425c15-7231-49d6-9b52-c261cff288e3", "name": "PROSTAGLANDIN E SYNTHASE", "unii": "B7M1HNT0MO", "linking_id": "B7M1HNT0MO", "ref_pname": "PROSTAGLANDIN E SYNTHASE", "substance_class": "reference" } }, { "uuid": "7dfcfbd6-0e3e-4585-a6fb-d7219fbf49ef", "type": "TARGET->INHIBITOR", "references": [ "609f6fc4-e131-7fdb-8cf3-3acc2972e352" ], "related_substance": { "uuid": "95db5db4-9bc6-4acd-a2a9-4ec7cfb03ed9", "refuuid": "a6e37011-3907-4702-b0b7-f732090c23df", "name": "HUMAN .BETA.-AMYLOID PEPTIDE (1-40)", "unii": "13539D6GO8", "linking_id": "13539D6GO8", "ref_pname": "HUMAN .BETA.-AMYLOID PEPTIDE (1-40)", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "f9385e37-fccc-c187-b510-560686af5bac", "name": "2-HYDROXY-5-((2-(4-(TRIFLUOROMETHYL)PHENYL)ETHYL)AMINO)BENZOIC ACID", "stdName": "2-HYDROXY-5-((2-(4-(TRIFLUOROMETHYL)PHENYL)ETHYL)AMINO)BENZOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9cd1641f-f53a-6373-330f-61d4c1a7b4d3" ], "display_name": false }, { "uuid": "fa5b5874-7b29-4dd6-af10-1cb09ba66c4c", "name": "AAD-2004", "stdName": "AAD-2004", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f9ad761e-cbf3-4a67-b5c8-55161d1dd51f", "0dc09b32-0a8d-45d1-9cf6-8fe6b21c829a" ], "display_name": false }, { "uuid": "eec30bf7-6e46-4dea-a011-65fd81ca8043", "name": "BENZOIC ACID, 2-HYDROXY-5-((2-(4-(TRIFLUOROMETHYL)PHENYL)ETHYL)AMINO)-", "stdName": "BENZOIC ACID, 2-HYDROXY-5-((2-(4-(TRIFLUOROMETHYL)PHENYL)ETHYL)AMINO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f9ad761e-cbf3-4a67-b5c8-55161d1dd51f", "0dc09b32-0a8d-45d1-9cf6-8fe6b21c829a" ], "display_name": false }, { "uuid": "d12d3ef4-e0e7-11c2-03c0-c8798d4b9117", "name": "CRISDESALAZINE", "stdName": "CRISDESALAZINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "9cd1641f-f53a-6373-330f-61d4c1a7b4d3" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "80a4ca40-cb15-4607-be5d-f59bf6bb6057", "name_org": "INN" } ] }, { "uuid": "b26fe805-50a7-50ac-1653-6a49764b0ca2", "name": "crisdesalazine [INN]", "stdName": "CRISDESALAZINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9cd1641f-f53a-6373-330f-61d4c1a7b4d3" ], "display_name": false } ], "references": [ { "uuid": "f9ad761e-cbf3-4a67-b5c8-55161d1dd51f", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0dc09b32-0a8d-45d1-9cf6-8fe6b21c829a", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c59990c5-761e-4807-ae08-f624ae071002", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392605000, "tags": [ "NOMEN" ] }, { "uuid": "8837b8c9-005b-4c32-a825-ad017791a0fc", "citation": "SRS import [11VWK61J69]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=11VWK61J69", "doc_type": "SRS", "public_domain": true, "document_date": 1493392605000, "tags": [ "NOMEN" ] }, { "uuid": "c7ad37d4-79f5-ef13-2881-b28ed55a2cfd", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "0b9f052b-e8f0-5584-d57b-c0bddd898b7e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "9cd1641f-f53a-6373-330f-61d4c1a7b4d3", "citation": "INN Proposed List 120", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL120.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "609f6fc4-e131-7fdb-8cf3-3acc2972e352", "citation": "adisinsight", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d68bab9d-c824-1c30-3c60-45d57b95d86b", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "52870d33-e228-4f84-a750-0acfddfbca77", "citation": "adisinsight", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fe13b4b2-d4db-484a-a0d3-9f1806dee27e", "id": "fe13b4b2-d4db-484a-a0d3-9f1806dee27e", "molfile": "\n Marvin 01132113092D \n\n 23 24 0 0 0 0 999 V2000\n 3.5724 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -1.6500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 -1.2375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 -0.4125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 22 2 0 0 0 0\n 6 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 20 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 16 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1CCNc2ccc(c(c2)C(=O)O)O)C(F)(F)F", "formula": "C16H14F3NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a492858e-2003-4cbe-a6ec-2ffbfa857895" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "325.2831", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "faf6cd0d-adef-40de-80ec-a4e6c0841b17", "version": "13", "structure": { "id": "123e9800-4a4d-4844-a5b4-f00f702f8acc", "molfile": "\n Marvin 01132101102D \n\n 23 24 0 0 0 0 999 V2000\n 3.5724 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -1.6500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 -1.2375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 -0.4125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 2 7 2 0 0 0 0\n 1 8 2 0 0 0 0\n 1 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 13 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 16 19 1 0 0 0 0\n 12 13 1 0 0 0 0\n 10 11 1 0 0 0 0\n 6 10 1 0 0 0 0\n 3 23 1 0 0 0 0\nM END", "smiles": "c1cc(ccc1CCNc2ccc(c(c2)C(=O)O)O)C(F)(F)F", "formula": "C16H14F3NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "325.2831", "optical_activity": "NONE", "references": [ "8837b8c9-005b-4c32-a825-ad017791a0fc", "f9ad761e-cbf3-4a67-b5c8-55161d1dd51f", "9cd1641f-f53a-6373-330f-61d4c1a7b4d3" ], "stereo_centers": 0 }, "unii": "11VWK61J69" } ] }