{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "aba636d5-ca93-4276-a119-29d2ccb013fb", "code": "7784-98-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=7784-98-7", "code_system": "CAS", "references": [ "88796431-1736-48f7-bd97-c9e050678215", "8bfa6fdc-9572-4f0a-91a5-9fe3301d4648" ] }, { "uuid": "55fdbccf-1e5b-4bcb-b319-26634f9e7ad4", "code": "232-074-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.029.158", "code_system": "ECHA (EC/EINECS)", "references": [ "88796431-1736-48f7-bd97-c9e050678215" ] }, { "uuid": "500784d0-3c27-4a13-8e2e-872b9219d52a", "code": "5463913", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5463913", "code_system": "PUBCHEM", "references": [ "88796431-1736-48f7-bd97-c9e050678215" ] }, { "uuid": "ae35c8c4-d438-2842-8fac-3dc9cba2495b", "code": "DTXSID20864126", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20864126", "code_system": "EPA CompTox", "references": [ "0ff89ec4-24f8-3258-fedb-cc91969f364f" ] }, { "uuid": "1cd7ffa0-be6b-41cf-9cf6-af4932a949f7", "code": "11E70LY0Z5", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "63ddea6b-f47c-6345-6661-3bcd38a1d09a", "code": "88", "type": "PRIMARY", "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/88/", "code_system": "JECFA MONOGRAPH", "references": [ "c45b8615-5481-ad63-71bf-9bfc8eedebfd" ] } ], "substance_class": "chemical", "names": [ { "uuid": "8c716f68-1b2a-4efe-bcd8-e150f6589305", "name": "1-(2,6,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-1-PENTEN-3-ONE", "stdName": "1-(2,6,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-1-PENTEN-3-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "029ef037-e6c4-48e7-9d1f-81db32dd0017" ], "display_name": false }, { "uuid": "cae1b6f3-0cdd-4f11-a55f-cb64103a459e", "name": "1-PENTEN-3-ONE, 1-(2,6,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-", "stdName": "1-PENTEN-3-ONE, 1-(2,6,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "029ef037-e6c4-48e7-9d1f-81db32dd0017" ], "display_name": false }, { "uuid": "5e749915-b4a9-45cb-a627-e7ae7bfbbbc8", "name": "5-(2,6,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-4-PENTEN-3-ONE", "stdName": "5-(2,6,6-TRIMETHYL-3-CYCLOHEXEN-1-YL)-4-PENTEN-3-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "029ef037-e6c4-48e7-9d1f-81db32dd0017" ], "display_name": false }, { "uuid": "a866df15-fe43-4646-93ae-af95038a41b8", "name": "METHYL .DELTA.-IONONE", "stdName": "METHYL .DELTA.-IONONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "029ef037-e6c4-48e7-9d1f-81db32dd0017" ], "display_name": true }, { "uuid": "293f0107-be91-44ff-bb16-0213233b4fa1", "name": "METHYL-.DELTA.-IONONE", "stdName": "METHYL-.DELTA.-IONONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "929b34aa-3a70-45a2-9d60-124b3656d6c9" ], "display_name": false } ], "references": [ { "uuid": "029ef037-e6c4-48e7-9d1f-81db32dd0017", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "929b34aa-3a70-45a2-9d60-124b3656d6c9", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "88796431-1736-48f7-bd97-c9e050678215", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390478000, "tags": [ "NOMEN" ] }, { "uuid": "f6231350-15c5-4e23-857a-fe73a006d1a1", "citation": "SRS import [11E70LY0Z5]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=11E70LY0Z5", "doc_type": "SRS", "public_domain": true, "document_date": 1493390478000, "tags": [ "NOMEN" ] }, { "uuid": "8bfa6fdc-9572-4f0a-91a5-9fe3301d4648", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0ff89ec4-24f8-3258-fedb-cc91969f364f", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "c45b8615-5481-ad63-71bf-9bfc8eedebfd", "citation": "JECFA", "doc_type": "JECFA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0716410e-1877-40d6-bed5-73aeb4209931", "id": "0716410e-1877-40d6-bed5-73aeb4209931", "molfile": "\n Marvin 01132100392D \n\n 15 15 0 0 0 0 999 V2000\n 4.5870 -0.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5919 -1.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8935 -0.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9092 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1688 -1.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1504 -2.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4205 -2.4445 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.6879 -2.0323 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.6879 -1.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6879 -3.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4021 -3.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1137 -3.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4021 -4.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 13 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 8 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 13 1 0 0 0 0\nM END", "smiles": "CCC(=O)/C=C/C1C(C)C=CCC1(C)C", "formula": "C14H22O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ab3e51b9-f6b2-4fc9-bf6f-8802b678327f" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "206.3244", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "763a34fb-5fcb-43e6-aaaf-8453832150c0", "version": "6", "structure": { "id": "497b8fc0-8ed1-4ed9-9124-635ddf3c2781", "molfile": "\n Marvin 01132103512D \n\n 15 15 0 0 0 0 999 V2000\n 2.1504 -2.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4205 -2.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1688 -1.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4021 -3.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6879 -2.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8935 -0.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9092 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6879 -3.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1137 -3.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4021 -4.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5919 -1.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6879 -1.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5870 -0.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 2 1 0 0 0 0\n 8 3 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 4 1 0 0 0 0\n 11 4 1 0 0 0 0\n 12 4 1 0 0 0 0\n 13 8 1 0 0 0 0\n 14 7 1 0 0 0 0\n 15 13 1 0 0 0 0\n 10 5 1 0 0 0 0\nM END", "smiles": "CCC(=O)/C=C/C1C(C)C=CCC1(C)C", "formula": "C14H22O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "UNKNOWN", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "206.3244", "optical_activity": "UNSPECIFIED", "references": [ "029ef037-e6c4-48e7-9d1f-81db32dd0017", "f6231350-15c5-4e23-857a-fe73a006d1a1" ], "stereo_centers": 2 }, "unii": "11E70LY0Z5" } ] }