{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d21fcf4f-8fe5-4576-8543-9acdb5fd83a0",
          "code": "35354-74-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=35354-74-6",
          "code_system": "CAS",
          "references": [
            "85b83f48-6053-4ec2-bcf5-2e96a3dbb5d7",
            "d288f135-be12-41ff-bc10-c1919d9154bc"
          ]
        },
        {
          "uuid": "ffe45f69-2371-4795-9562-43a1446dfae7",
          "code": "C005499",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005499",
          "code_system": "MESH",
          "references": [
            "85b83f48-6053-4ec2-bcf5-2e96a3dbb5d7"
          ]
        },
        {
          "uuid": "05ffb008-dd90-4967-8777-9c00a9ab041c",
          "code": "HONOKIOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Honokiol",
          "code_system": "WIKIPEDIA",
          "references": [
            "85b83f48-6053-4ec2-bcf5-2e96a3dbb5d7"
          ]
        },
        {
          "uuid": "f54d8e7e-075c-4633-98fd-ec2ee243eb1a",
          "code": "m6051",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6051?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "85b83f48-6053-4ec2-bcf5-2e96a3dbb5d7"
          ]
        },
        {
          "uuid": "1b946305-8a8e-4d33-87c3-5a8c396b21c1",
          "code": "SUB33674",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "85b83f48-6053-4ec2-bcf5-2e96a3dbb5d7"
          ]
        },
        {
          "uuid": "31070a7d-22bf-45e3-8c8c-5dfbf3db6e4a",
          "code": "72303",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72303",
          "code_system": "PUBCHEM",
          "references": [
            "85b83f48-6053-4ec2-bcf5-2e96a3dbb5d7"
          ]
        },
        {
          "uuid": "d0be0b4e-34fb-f385-307b-f476f0ca84c2",
          "code": "DTXSID30188845",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30188845",
          "code_system": "EPA CompTox",
          "references": [
            "a24ab0a5-1b67-c4a3-7cc6-e58cb6cae6f2"
          ]
        },
        {
          "uuid": "3922f212-90e1-a260-2dc5-beb96ac556d5",
          "code": "2680 (Number of products:8)",
          "comments": "Dietary Supplement Label Database|chemical|Honokiol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2680&item=Honokiol",
          "code_system": "DSLD",
          "references": [
            "04e995cc-95b1-1731-1524-dbb2f99d54b1"
          ]
        },
        {
          "uuid": "aeec1df0-7d33-49a8-901a-aca626c3fffc",
          "code": "11513CCO0N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ee3225c4-1caa-18c7-27e5-1279bff1a56a",
          "code": "2562546",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2562546/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d190c604-1313-febe-c407-fc5db37dcdc6"
          ]
        },
        {
          "uuid": "a57cff02-3922-4280-9b3f-e05096c0d95e",
          "code": "100000127617",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0ce649de-4c85-0f25-fefe-86af43821f21"
          ]
        },
        {
          "uuid": "429a1aed-10a5-49ce-9824-9931bfc17ae7",
          "code": "11513CCO0N",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=11513CCO0N",
          "code_system": "DAILYMED",
          "references": [
            "e08c6920-0cf3-9e11-e715-f77d9dcecb13"
          ]
        },
        {
          "uuid": "4495c81a-8a7d-c916-7136-0ca2655e07e4",
          "code": "293100",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=293100",
          "code_system": "NSC",
          "references": [
            "e1477d38-8289-2412-61d2-ecb60f0b0383"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1d64a359-b738-45b8-823d-d9896ed949c1",
          "amount": {
            "uuid": "633173f9-185a-4e5b-a1c9-d46b89b53a7f"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ccbbd929-65a3-4ca4-9bb5-f8d4f76b58d4",
            "refuuid": "5762b32c-4724-4fb1-9d03-311e2f0d4051",
            "name": "HONOKIOL",
            "unii": "11513CCO0N",
            "linking_id": "11513CCO0N",
            "ref_pname": "HONOKIOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b4d2cb54-a91e-45ff-b1c4-1a4c6a5c6f40",
          "amount": {
            "uuid": "6ca49845-55a3-49cb-a09b-064248f9976f"
          },
          "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "4a9472f6-cb62-4c60-851f-35b94626469d",
            "refuuid": "c0e10260-f30e-4cb4-824f-b433d668fa95",
            "name": "MAGNOLIA OFFICINALIS BARK",
            "unii": "5M609NV974",
            "linking_id": "5M609NV974",
            "ref_pname": "MAGNOLIA OFFICINALIS BARK",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "32ed0de2-d437-4285-ad6d-b136511e02a9",
          "name": "(1,1'-BIPHENYL)-2,4'-DIOL, 3',5-DI-2-PROPEN-1-YL-",
          "stdName": "(1,1'-BIPHENYL)-2,4'-DIOL, 3',5-DI-2-PROPEN-1-YL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
            "271a5e43-7b52-4dd8-8d47-2fd1ba6657a3"
          ],
          "display_name": false
        },
        {
          "uuid": "eb4dfa3a-7b16-46a7-b34d-704faa316139",
          "name": "(1,1'-BIPHENYL)-2,4'-DIOL, 3',5-DI-2-PROPENYL-",
          "stdName": "(1,1'-BIPHENYL)-2,4'-DIOL, 3',5-DI-2-PROPENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
            "271a5e43-7b52-4dd8-8d47-2fd1ba6657a3"
          ],
          "display_name": false
        },
        {
          "uuid": "39fdba6b-f3dc-44e0-bb89-d42340524a4c",
          "name": "3',5-DIALLYL-2,4'-BIPHENYLDIOL",
          "stdName": "3',5-DIALLYL-2,4'-BIPHENYLDIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
            "271a5e43-7b52-4dd8-8d47-2fd1ba6657a3"
          ],
          "display_name": false
        },
        {
          "uuid": "d86f935d-5238-47be-908c-bdcbe4ea8a4d",
          "name": "FMLT BSASM H",
          "stdName": "FMLT BSASM H",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
            "e041f316-a8a2-4ad9-b141-720d679d444b"
          ],
          "display_name": false
        },
        {
          "uuid": "8c0861fd-e163-45e4-96ba-b65aad3ebaf6",
          "name": "HONOKIOL",
          "stdName": "HONOKIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
            "3940f583-b39b-43aa-a8c9-72fb16233798",
            "cb4d1fbd-9c92-469b-8a90-0a485028ce88",
            "9a552b44-efc8-4330-a485-e5b137e97204",
            "78a332ba-5427-4287-9e5e-37c709916eb8",
            "e041f316-a8a2-4ad9-b141-720d679d444b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a00d3040-f403-46e0-b3b6-3fce5a34f2b4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2844dd86-a214-46f5-b6be-48a80d18ffb1",
          "name": "HONOKIOL [MI]",
          "stdName": "HONOKIOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
            "cb4d1fbd-9c92-469b-8a90-0a485028ce88"
          ],
          "display_name": false
        },
        {
          "uuid": "f549777e-f3e9-40e5-c8af-4ff7e74bc5e7",
          "name": "Honokiol [WHO-DD]",
          "stdName": "HONOKIOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21a82cb6-496f-786c-08bb-873440568885"
          ],
          "display_name": false
        },
        {
          "uuid": "a2d998c4-9782-4c47-bf48-707a2d40026c",
          "name": "NSC-293100",
          "stdName": "NSC-293100",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
            "271a5e43-7b52-4dd8-8d47-2fd1ba6657a3"
          ],
          "display_name": false
        },
        {
          "uuid": "d866a041-3d4f-496c-8b8b-a113796e4431",
          "name": "PURINOL",
          "stdName": "PURINOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
            "e041f316-a8a2-4ad9-b141-720d679d444b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3940f583-b39b-43aa-a8c9-72fb16233798",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f569146d-07ff-47dc-bc13-bf0d5aa5a79e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e041f316-a8a2-4ad9-b141-720d679d444b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "271a5e43-7b52-4dd8-8d47-2fd1ba6657a3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb4d1fbd-9c92-469b-8a90-0a485028ce88",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85b83f48-6053-4ec2-bcf5-2e96a3dbb5d7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391529000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92b1fd44-e9f7-48fe-aa9e-73aca8d529de",
          "citation": "SRS import [11513CCO0N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=11513CCO0N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391529000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78a332ba-5427-4287-9e5e-37c709916eb8",
          "citation": "HONOKIOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a552b44-efc8-4330-a485-e5b137e97204",
          "citation": "HONOKIOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a24ab0a5-1b67-c4a3-7cc6-e58cb6cae6f2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=35354-74-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0ce649de-4c85-0f25-fefe-86af43821f21",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "dd10aa19-2b47-8477-020e-19a42840b526",
          "citation": "WHO DRUG DICTIONARY 2019",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "04e995cc-95b1-1731-1524-dbb2f99d54b1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d288f135-be12-41ff-bc10-c1919d9154bc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d190c604-1313-febe-c407-fc5db37dcdc6",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "e1477d38-8289-2412-61d2-ecb60f0b0383",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e08c6920-0cf3-9e11-e715-f77d9dcecb13",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "21a82cb6-496f-786c-08bb-873440568885",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a6235b47-e8ed-4e97-8144-2512ca6afff2",
          "id": "a6235b47-e8ed-4e97-8144-2512ca6afff2",
          "molfile": "\n  Marvin  01132108382D          \n\n 20 21  0  0  0  0            999 V2000\n    8.4052   -5.8891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2280   -5.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6385   -5.1825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4635   -5.1825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8739   -5.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4635   -6.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6385   -6.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2280   -7.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6574   -8.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2640   -8.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6968   -5.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1093   -6.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9323   -6.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3426   -7.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9153   -8.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3088   -8.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3426   -5.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9323   -5.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1093   -5.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6883   -4.4675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n 11  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 17  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "C=CCc1ccc(c(c1)-c2ccc(c(CC=C)c2)O)O",
          "formula": "C18H18O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "643e9891-024e-47e7-a4c4-cdfc2cd2e128"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "266.335",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5762b32c-4724-4fb1-9d03-311e2f0d4051",
      "version": "27",
      "structure": {
        "id": "508f2776-fea0-4b2c-9a7f-50ab43fadfc9",
        "molfile": "\n  Marvin  01132104122D          \n\n 20 21  0  0  0  0            999 V2000\n    9.2640   -8.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3088   -8.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6574   -8.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4052   -5.8891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9153   -8.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2280   -7.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2280   -5.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3426   -7.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3426   -5.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6385   -5.1825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6385   -6.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6883   -4.4675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9323   -5.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9323   -6.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4635   -5.1825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4635   -6.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1093   -5.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1093   -6.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8739   -5.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6968   -5.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 10  7  1  0  0  0  0\n 13  9  1  0  0  0  0\n  3  1  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n 11  7  2  0  0  0  0\n 14  8  1  0  0  0  0\n 14  9  2  0  0  0  0\n 15 10  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 12  1  0  0  0  0\n 17 13  2  0  0  0  0\n 18 14  1  0  0  0  0\n 19 15  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 17  1  0  0  0  0\n 20 18  2  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
        "smiles": "C=CCc1ccc(c(c1)-c2ccc(c(CC=C)c2)O)O",
        "formula": "C18H18O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "266.335",
        "optical_activity": "NONE",
        "references": [
          "92b1fd44-e9f7-48fe-aa9e-73aca8d529de",
          "271a5e43-7b52-4dd8-8d47-2fd1ba6657a3"
        ],
        "stereo_centers": 0
      },
      "unii": "11513CCO0N"
    }
  ]
}