{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "50a78bb9-ca7a-48b6-8851-9290816813c0",
          "code": "A06AB02",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|LAXATIVES|LAXATIVES|Contact laxatives|bisacodyl",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A06AB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "433b5466-250b-4240-8a7a-a9e27854d1e3",
          "code": "A06AG02",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|LAXATIVES|LAXATIVES|Enemas|bisacodyl",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A06AG02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "f8312da7-db7f-44c3-8c96-0e81f367ec73",
          "code": "N0000175812",
          "comments": "Established Pharmacologic Class [EPC]|Stimulant Laxative [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175812",
          "code_system": "NDF-RT",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "c03bcf4d-8e4e-4815-9e93-9235ad02ffde",
          "code": "N0000009371",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Digestive/GI System Activity Alteration [PE]|GI Motility Alteration [PE]|Increased GI Motility [PE]|Increased Large Intestinal Motility [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000009371",
          "code_system": "NDF-RT",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "5975e604-88a9-4b1e-a91d-4511f537edb7",
          "code": "N0000009871",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Digestive/GI System Activity Alteration [PE]|Large Intestine Fluid/Electrolyte Alteration [PE]|Large Intestine Fluid/Electrolyte Secretion Alteration [PE]|Stimulation Large Intestine Fluid/Electrolyte Secretion [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000009871",
          "code_system": "NDF-RT",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "10b4ea61-d54e-456c-94f5-efb72fe415a6",
          "code": "QA06AG02",
          "comments": "VATC|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Enemas|bisacodyl",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA06AG02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "7a5435da-6eb7-4931-874a-e2ea8cb454ee",
          "code": "QA06AB02",
          "comments": "VATC|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Contact laxatives|bisacodyl",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA06AB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "771eb867-2c1c-4a2e-8112-fefcbbb4fb86",
          "code": "QA06AB52",
          "comments": "VATC|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Contact laxatives|bisacodyl, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA06AB52&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "31b2e22c-0a22-4641-945d-3528b1151040",
          "code": "603-50-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=603-50-9",
          "code_system": "CAS",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e",
            "56976438-6869-4657-9d26-fedda935f047"
          ]
        },
        {
          "uuid": "8dfe5b2d-d747-41cd-8ec3-4c5a72697d22",
          "code": "C28870",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28870",
          "code_system": "NCI_THESAURUS",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "72454d4b-3003-4204-be94-9277168f5893",
          "code": "D001726",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001726",
          "code_system": "MESH",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "aae8b4c0-6a0e-4045-a5d4-fa0a17f0947a",
          "code": "NBK548124",
          "comments": "LiverTox|Gastroinestinal|Laxative|Diphenylmethane derivative",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548124/",
          "code_system": "LIVERTOX",
          "references": [
            "2bbf29ed-e791-947a-cc41-8769e3d03fff"
          ]
        },
        {
          "uuid": "7595d027-cc0c-446a-bb6e-801bea7d6c8d",
          "code": "BISACODYL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bisacodyl",
          "code_system": "WIKIPEDIA",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "88aea0b3-9a7c-4a2e-abd8-e9519c6abb52",
          "code": "A06AB52",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Contact laxatives|bisacodyl, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A06AB52&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "823c1b58-44fe-4679-a779-962b8f93ec2b",
          "code": "SUB05846MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "307bfd6b-c8cf-442b-822d-740b10ab54b4",
          "code": "824",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=824",
          "code_system": "INN",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "733d394c-5c12-47d2-97ea-03a190def22b",
          "code": "1596",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1596/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "2190b3af-71ac-4fde-990f-3f30715fe3d5",
          "code": "m2516",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2516?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "d5f70037-435c-49c0-832a-16835f34c59b",
          "code": "DB09020",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09020",
          "code_system": "DRUG BANK",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "16b253e0-80f1-40bc-9bf2-0166ccf6cd0c",
          "code": "CHEMBL942",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL942",
          "code_system": "ChEMBL",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "3a12f1ed-d725-4f67-9be7-fe00d6345f81",
          "code": "210-044-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.132",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "68e5b152-5fd4-4e17-ab26-e590e4da9c41",
          "code": "2391",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2391",
          "code_system": "PUBCHEM",
          "references": [
            "aec4bf25-d5e3-4004-944e-7fd85cdac23e"
          ]
        },
        {
          "uuid": "cf41a96d-bd3f-a54b-e9f1-ca5952ea1aed",
          "code": "3016",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3016",
          "code_system": "HSDB",
          "references": [
            "7fb597be-8f0d-8fb0-da19-d0e015c8f577"
          ]
        },
        {
          "uuid": "e1cd9899-5640-870a-ce2d-ba91fe86f427",
          "code": "DTXSID1022681",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1022681",
          "code_system": "EPA CompTox",
          "references": [
            "07a0f10d-87e5-265f-de07-b65dd4854536"
          ]
        },
        {
          "uuid": "b9dc8bf5-8aeb-87f7-c748-f45c0fa8b6a6",
          "code": "A06AB20",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Contact laxatives|contact laxatives in combination",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A06AB20&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "a3507151-7270-a926-3b45-80fcec8c9108",
          "code": "C29697",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Laxative",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29697",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2bbf29ed-e791-947a-cc41-8769e3d03fff"
          ]
        },
        {
          "uuid": "b834b48d-1af4-40d2-ade0-01185ecc76f5",
          "code": "10X0709Y6I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f83939af-7e53-5ee3-1c25-4e8bcb450847",
          "code": "Bisacodyl",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM448/",
          "code_system": "LACTMED",
          "references": [
            "2bbf29ed-e791-947a-cc41-8769e3d03fff"
          ]
        },
        {
          "uuid": "85221b7d-f8df-a6fa-d9cd-22fcc0a6a3b3",
          "code": "375",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/375",
          "code_system": "DRUG CENTRAL",
          "references": [
            "2bbf29ed-e791-947a-cc41-8769e3d03fff"
          ]
        },
        {
          "uuid": "252ff81e-86c8-cd28-ff7b-e61c6fdcc1a3",
          "code": "1074007",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1074007",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "2bbf29ed-e791-947a-cc41-8769e3d03fff"
          ]
        },
        {
          "uuid": "c02b2764-a29e-49a0-4851-ac5d7a9fc4df",
          "code": "100000091949",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "fd341b0c-04d3-b8e8-b834-76a9cab61081"
          ]
        },
        {
          "uuid": "6d8bd1a2-9d19-8430-5546-d11645745d94",
          "code": "10X0709Y6I",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=10X0709Y6I",
          "code_system": "DAILYMED",
          "references": [
            "5360c92f-ef5d-29ab-12cb-3ca37eda59e7"
          ]
        },
        {
          "uuid": "abe5dce9-eb77-fdd0-378c-1992b9801be9",
          "code": "755914",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=755914",
          "code_system": "NSC",
          "references": [
            "e985d4f4-29d4-06a5-648a-7964e982b577"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "41de3715-1992-481e-892b-5919d41384fc",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c2e6b31b-39ce-45f0-93bd-1a27e8e62185",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8eeb4238-291f-429f-b050-d3d971efd2e1",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "80a7c88c-0e6c-43b5-b6a4-58738ffc6735",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24688177-e5bb-4566-9eea-206411453219",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca4d4da4-2d63-443c-8bb0-c55167b1c305",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "396f7cb4-4f24-4bd7-acc8-e8ddb893561f",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca17b80d-27a7-42d9-bc7d-f3cb9e5bd909",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b33eb84-3c6c-46fa-b7a8-f32df3a71690",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7cd5a1d-04fc-47da-b05d-8cdbbe0eee34",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2922d08f-c21c-46d8-b47c-05f5277402a0",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03584037-9617-4b83-aefe-b574945d7f70",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d9de5d2-c3f1-4a82-8285-84dd06f58384",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "002b2af5-5a2e-4ce1-bd04-ea680e48a652",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aec4bf25-d5e3-4004-944e-7fd85cdac23e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d6553ed-97bd-4bec-8b1a-145d04345cd5",
          "citation": "EP 7.7 BISACODYL MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68ff94d7-8c30-426c-b714-18dd34c68c7c",
          "citation": "USP 35 BISACODYL MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36d96453-00fd-40c9-8b5a-af659e5f140d",
          "citation": "SRS import [10X0709Y6I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=10X0709Y6I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f06c598-3488-4cb1-91a1-6451809d679a",
          "citation": "BISACODYL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db005282-f75e-4270-864d-01c71d3e532c",
          "citation": "BISACODYL [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2174de00-9fc2-4d09-aa48-7eb7681112b7",
          "citation": "BISACODYL [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "160e5500-f088-4ee6-997f-0d28948ec22c",
          "citation": "BISACODYL [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "712e8c19-e689-4bcd-9862-4955f7700560",
          "citation": "BISACODYL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c684405f-8ab2-499d-b746-0e5e370d240a",
          "citation": "BISACODYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e24e7f8-63c3-43fc-b20f-4414e225c0fc",
          "citation": "BISACODYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1fd247e7-f950-4976-aed1-8d9a3355bbdd",
          "citation": "BISACODYL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "41c2190e-d93b-4363-876a-072d505a6359",
          "citation": "BISACODYL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15c61421-1cd5-4f20-8958-d5d8e5225346",
          "citation": "BISACODYL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "06ae1b52-e875-c392-e722-5f4dac611b5c",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549559#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "83a061ee-1f03-33e9-c531-94f755b23316",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7fb597be-8f0d-8fb0-da19-d0e015c8f577",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+603-50-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cd2497bb-8ac4-31ed-36b8-86f4aa52fb9b",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+603-50-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "07a0f10d-87e5-265f-de07-b65dd4854536",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=603-50-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fd341b0c-04d3-b8e8-b834-76a9cab61081",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "2bbf29ed-e791-947a-cc41-8769e3d03fff",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "56976438-6869-4657-9d26-fedda935f047",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9a0a37d7-ab68-fcc2-f2cf-3690c43e9e4e",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "1c56c3e9-f04d-0480-523b-497199e7d692",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "77a3606b-6b28-0d9f-4879-c933cafdd3b4",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "e985d4f4-29d4-06a5-648a-7964e982b577",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5360c92f-ef5d-29ab-12cb-3ca37eda59e7",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "017057cc-c58a-4f4b-9aca-1d12195efc9b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "011c41a3-b755-4031-98d2-d3d5f487d027",
          "id": "011c41a3-b755-4031-98d2-d3d5f487d027",
          "molfile": "\n  Marvin  01132100222D          \n\n 27 29  0  0  0  0            999 V2000\n   -1.3831  -13.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7045  -13.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7045  -12.7147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0026  -13.8310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7330  -13.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175  -12.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4375  -12.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1601  -12.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1472  -13.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323  -13.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8750  -12.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5925  -12.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2996  -12.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144  -12.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144  -13.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7344  -13.8259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4519  -13.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2885  -13.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364  -12.7536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3047  -13.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769  -13.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8776  -11.3445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5847  -10.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5976  -10.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8698   -9.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1627  -10.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1601  -10.9353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 22 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 21 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 20  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  2  0  0  0  0\n 20 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 27 22  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)Oc1ccc(cc1)C(c2ccc(cc2)OC(=O)C)c3ccccn3",
          "formula": "C22H19NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "28d801f2-441e-45b8-b390-ff0e5e09b631"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "361.3914",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6e8801fc-ce94-41a0-abb8-824e887070c5",
      "version": "31",
      "structure": {
        "id": "9beb04a2-c9df-4aa4-b9db-977f0c6af6a3",
        "molfile": "\n  Marvin  01132108062D          \n\n 27 29  0  0  0  0            999 V2000\n    2.8750  -12.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4519  -13.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7045  -13.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1601  -10.9353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5925  -12.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1601  -12.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8776  -11.3445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0026  -13.8310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7344  -13.8259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7045  -12.7147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364  -12.7536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2996  -12.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5769  -13.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4375  -12.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1472  -13.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7330  -13.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144  -13.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175  -12.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144  -12.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323  -13.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3047  -13.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1627  -10.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3831  -13.7248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2885  -13.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5847  -10.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8698   -9.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5976  -10.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  9  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8 16  1  0  0  0  0\n  9 17  1  0  0  0  0\n 10  3  2  0  0  0  0\n 11  2  2  0  0  0  0\n 12  5  1  0  0  0  0\n 13  5  2  0  0  0  0\n 14  6  2  0  0  0  0\n 15  6  1  0  0  0  0\n 16 20  1  0  0  0  0\n 17 21  2  0  0  0  0\n 18 14  1  0  0  0  0\n 19 12  2  0  0  0  0\n 20 15  2  0  0  0  0\n 21 13  1  0  0  0  0\n 22  4  2  0  0  0  0\n 23  3  1  0  0  0  0\n 24  2  1  0  0  0  0\n 25  7  2  0  0  0  0\n 26 27  2  0  0  0  0\n 27 25  1  0  0  0  0\n 18 16  2  0  0  0  0\n 17 19  1  0  0  0  0\n 22 26  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)Oc1ccc(cc1)C(c2ccc(cc2)OC(=O)C)c3ccccn3",
        "formula": "C22H19NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "361.3914",
        "optical_activity": "NONE",
        "references": [
          "36d96453-00fd-40c9-8b5a-af659e5f140d",
          "41de3715-1992-481e-892b-5919d41384fc",
          "8eeb4238-291f-429f-b050-d3d971efd2e1"
        ],
        "stereo_centers": 0
      },
      "unii": "10X0709Y6I",
      "relationships": [
        {
          "uuid": "02075caa-feb2-4f59-bcfa-b17567c9a076",
          "amount": {
            "uuid": "c914b9ad-1c56-43be-bf4a-07be27810451",
            "type": "RELATIONSHIP_AMOUNT",
            "high_limit": 101,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "68ff94d7-8c30-426c-b714-18dd34c68c7c"
          ],
          "related_substance": {
            "uuid": "9c6306c8-5bb9-4bdd-9cb4-c11afbedf45e",
            "refuuid": "6e8801fc-ce94-41a0-abb8-824e887070c5",
            "name": "BISACODYL",
            "unii": "10X0709Y6I",
            "linking_id": "10X0709Y6I",
            "ref_pname": "BISACODYL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f1204694-0f90-413a-84d7-20ca3480157c",
          "amount": {
            "uuid": "a5c243a8-2ec6-4dbf-a674-153f7f3b1ab7",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "0d6553ed-97bd-4bec-8b1a-145d04345cd5"
          ],
          "related_substance": {
            "uuid": "40302b4b-cb98-432c-9de5-93df2a145c9a",
            "refuuid": "8c23b0f3-332c-4aba-977a-f9cae7a038c9",
            "name": "DEACETYLBISACODYL",
            "unii": "R09078E41Y",
            "linking_id": "R09078E41Y",
            "ref_pname": "DEACETYLBISACODYL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d8a3c41f-8f8b-439c-8f7b-c95a86fb47fd",
          "amount": {
            "uuid": "06c8d751-65e7-4e16-bdf3-9c8c4d88fbea",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "68ff94d7-8c30-426c-b714-18dd34c68c7c"
          ],
          "related_substance": {
            "uuid": "5e4771ea-da81-4d69-b1a6-43f0796e5c23",
            "refuuid": "8c23b0f3-332c-4aba-977a-f9cae7a038c9",
            "name": "DEACETYLBISACODYL",
            "unii": "R09078E41Y",
            "linking_id": "R09078E41Y",
            "ref_pname": "DEACETYLBISACODYL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6db387cd-463b-4c2e-a43e-dbd7128fff78",
          "amount": {
            "uuid": "c273b33f-d06d-473f-a7b9-819f03cfe6da",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "0d6553ed-97bd-4bec-8b1a-145d04345cd5"
          ],
          "related_substance": {
            "uuid": "952d5b51-e140-4097-b1e3-d55c0aa8b916",
            "refuuid": "cc79be94-72f8-4124-844b-a094165325e7",
            "name": "2,4'-(2-PYRIDYLMETHYLENE)DIPHENOL",
            "unii": "2E2GA7AVTD",
            "linking_id": "2E2GA7AVTD",
            "ref_pname": "2,4'-(2-PYRIDYLMETHYLENE)DIPHENOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3ed536ce-3724-4a0c-aee4-7f5c303960ff",
          "amount": {
            "uuid": "34ac535d-b84c-48e8-9879-ee66e411c4d1",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "68ff94d7-8c30-426c-b714-18dd34c68c7c"
          ],
          "related_substance": {
            "uuid": "c2ef6510-30aa-4520-b0d1-f2b14cc972bc",
            "refuuid": "cc79be94-72f8-4124-844b-a094165325e7",
            "name": "2,4'-(2-PYRIDYLMETHYLENE)DIPHENOL",
            "unii": "2E2GA7AVTD",
            "linking_id": "2E2GA7AVTD",
            "ref_pname": "2,4'-(2-PYRIDYLMETHYLENE)DIPHENOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e14ff921-a3a4-43ae-bcc0-627828c2b36e",
          "amount": {
            "uuid": "1ed49a98-d708-4e47-992b-e0dd2b045263",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "0d6553ed-97bd-4bec-8b1a-145d04345cd5"
          ],
          "related_substance": {
            "uuid": "86248d57-26a7-4d44-a989-e4f7c8913e40",
            "refuuid": "22d6ebee-54c3-4068-91ce-738de595f5f3",
            "name": "MONOACETYL BISACODYL",
            "unii": "K64Y0Z4A16",
            "linking_id": "K64Y0Z4A16",
            "ref_pname": "MONOACETYL BISACODYL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b2c35ede-eb3f-40b1-8fef-dc0600c3098e",
          "amount": {
            "uuid": "b7f14668-397c-4211-9591-07d6d21345a4",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "68ff94d7-8c30-426c-b714-18dd34c68c7c"
          ],
          "related_substance": {
            "uuid": "8a85ba01-9290-4b6a-8f82-46d913fdc8d1",
            "refuuid": "22d6ebee-54c3-4068-91ce-738de595f5f3",
            "name": "MONOACETYL BISACODYL",
            "unii": "K64Y0Z4A16",
            "linking_id": "K64Y0Z4A16",
            "ref_pname": "MONOACETYL BISACODYL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b18bb820-ca40-44f1-a47e-0432126ea7de",
          "amount": {
            "uuid": "6a4fc6c6-a10c-4363-ad6d-19f051f45ffa",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "0d6553ed-97bd-4bec-8b1a-145d04345cd5"
          ],
          "related_substance": {
            "uuid": "a71e986a-2285-43b9-a24a-7010d0428219",
            "refuuid": "4728febb-be96-43c4-84d1-d01e19624e2b",
            "name": "2,4'-(PYRIDIN-2-YLMETHYLENE)DIPHENYL DIACETATE",
            "unii": "276EMM63AK",
            "linking_id": "276EMM63AK",
            "ref_pname": "2,4'-(PYRIDIN-2-YLMETHYLENE)DIPHENYL DIACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "27393572-dacb-430d-842e-96087beb22ad",
          "amount": {
            "uuid": "8e74476e-70bd-4c69-a929-c447acf50597",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "68ff94d7-8c30-426c-b714-18dd34c68c7c"
          ],
          "related_substance": {
            "uuid": "175bb3e6-3eb5-422c-8957-2eb59ada2504",
            "refuuid": "4728febb-be96-43c4-84d1-d01e19624e2b",
            "name": "2,4'-(PYRIDIN-2-YLMETHYLENE)DIPHENYL DIACETATE",
            "unii": "276EMM63AK",
            "linking_id": "276EMM63AK",
            "ref_pname": "2,4'-(PYRIDIN-2-YLMETHYLENE)DIPHENYL DIACETATE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "70218f23-6f4c-4b8b-8748-c71d5cf0f0bd",
          "name": "4,4'-(2-PYRIDYLMETHYLENE)DIPHENOL DIACETATE (ESTER)",
          "stdName": "4,4'-(2-PYRIDYLMETHYLENE)DIPHENOL DIACETATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "13b0c6dc-d5aa-41a6-aabd-fbd240cde673",
          "name": "BISACODYL",
          "stdName": "BISACODYL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f06c598-3488-4cb1-91a1-6451809d679a",
            "41de3715-1992-481e-892b-5919d41384fc",
            "002b2af5-5a2e-4ce1-bd04-ea680e48a652",
            "03584037-9617-4b83-aefe-b574945d7f70",
            "80a7c88c-0e6c-43b5-b6a4-58738ffc6735",
            "ca17b80d-27a7-42d9-bc7d-f3cb9e5bd909",
            "8eeb4238-291f-429f-b050-d3d971efd2e1",
            "1fd247e7-f950-4976-aed1-8d9a3355bbdd",
            "712e8c19-e689-4bcd-9862-4955f7700560",
            "0d9de5d2-c3f1-4a82-8285-84dd06f58384",
            "db005282-f75e-4270-864d-01c71d3e532c",
            "2174de00-9fc2-4d09-aa48-7eb7681112b7",
            "2922d08f-c21c-46d8-b47c-05f5277402a0",
            "c684405f-8ab2-499d-b746-0e5e370d240a",
            "f7cd5a1d-04fc-47da-b05d-8cdbbe0eee34",
            "160e5500-f088-4ee6-997f-0d28948ec22c",
            "41c2190e-d93b-4363-876a-072d505a6359",
            "24688177-e5bb-4566-9eea-206411453219",
            "6b33eb84-3c6c-46fa-b7a8-f32df3a71690",
            "15c61421-1cd5-4f20-8958-d5d8e5225346",
            "1e24e7f8-63c3-43fc-b20f-4414e225c0fc"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e17d6a18-613b-4f97-a6f5-1de88c8be33a",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3f2521da-f5d4-6545-338c-fc476bb3d255",
          "name": "BISACODYL [EP MONOGRAPH]",
          "stdName": "BISACODYL [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77a3606b-6b28-0d9f-4879-c933cafdd3b4"
          ],
          "display_name": false
        },
        {
          "uuid": "340dc0a1-7c51-433a-b8f2-0c04dfd98c5f",
          "name": "BISACODYL [HSDB]",
          "stdName": "BISACODYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2922d08f-c21c-46d8-b47c-05f5277402a0"
          ],
          "display_name": false
        },
        {
          "uuid": "5fb7b845-564b-4d8d-a979-80e7f1c5f78a",
          "name": "BISACODYL [JAN]",
          "stdName": "BISACODYL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83a061ee-1f03-33e9-c531-94f755b23316"
          ],
          "display_name": false
        },
        {
          "uuid": "20ee81b5-2332-4dac-a3f3-25d1df294802",
          "name": "BISACODYL [MART.]",
          "stdName": "BISACODYL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b33eb84-3c6c-46fa-b7a8-f32df3a71690"
          ],
          "display_name": false
        },
        {
          "uuid": "965b1251-24de-48cb-b43a-505a719cddc8",
          "name": "BISACODYL [MI]",
          "stdName": "BISACODYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7cd5a1d-04fc-47da-b05d-8cdbbe0eee34"
          ],
          "display_name": false
        },
        {
          "uuid": "03121a27-c824-4060-ac88-4f132e6f3d75",
          "name": "BISACODYL [ORANGE BOOK]",
          "stdName": "BISACODYL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca17b80d-27a7-42d9-bc7d-f3cb9e5bd909"
          ],
          "display_name": false
        },
        {
          "uuid": "3a3f86a4-6408-d602-9b34-1c418c7f3597",
          "name": "BISACODYL [USP MONOGRAPH]",
          "stdName": "BISACODYL [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c56c3e9-f04d-0480-523b-497199e7d692"
          ],
          "display_name": false
        },
        {
          "uuid": "6f74ce96-fee1-466b-9e5b-ec0e197ddeb0",
          "name": "BISACODYL [USP-RS]",
          "stdName": "BISACODYL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03584037-9617-4b83-aefe-b574945d7f70"
          ],
          "display_name": false
        },
        {
          "uuid": "ecabdc31-94d6-48c7-b3cf-999b076163cf",
          "name": "BISACODYL [VANDF]",
          "stdName": "BISACODYL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "002b2af5-5a2e-4ce1-bd04-ea680e48a652"
          ],
          "display_name": false
        },
        {
          "uuid": "1d675d6f-8475-c33a-8fb2-5fe5fbfe9140",
          "name": "Bisacodyl [WHO-DD]",
          "stdName": "BISACODYL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "017057cc-c58a-4f4b-9aca-1d12195efc9b"
          ],
          "display_name": false
        },
        {
          "uuid": "7fd8484d-4f4d-4076-a79f-8684d7f8f82f",
          "name": "CORRECTOL TABLETS, CAPLETS",
          "stdName": "CORRECTOL TABLETS, CAPLETS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "e67d5e6c-b507-46b7-b83c-7ef3c8ea0e25",
          "name": "DULCOLAX",
          "stdName": "DULCOLAX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "85e83801-c50a-44b5-acc4-12c249776ba0",
          "name": "EVAC-Q-TABS",
          "stdName": "EVAC-Q-TABS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "097ef43e-e60c-49a7-9de5-0fda44631b22",
          "name": "FEEN-A-MINT TABLETS",
          "stdName": "FEEN-A-MINT TABLETS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "be4c4a90-bd92-4764-931b-674c8d14903a",
          "name": "HALFLYTELY COMPONENT BISACODYL",
          "stdName": "HALFLYTELY COMPONENT BISACODYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca4d4da4-2d63-443c-8bb0-c55167b1c305",
            "396f7cb4-4f24-4bd7-acc8-e8ddb893561f"
          ],
          "display_name": false
        },
        {
          "uuid": "8cad351e-3569-409b-935d-40fd2ef8b6dd",
          "name": "MODANE",
          "stdName": "MODANE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "1f28ac18-a538-2a4f-454b-9516fd546932",
          "name": "NSC-755914",
          "stdName": "NSC-755914",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e985d4f4-29d4-06a5-648a-7964e982b577"
          ],
          "display_name": false
        },
        {
          "uuid": "0bbe2ad8-f057-4772-a8c6-4fc40e0d7c05",
          "name": "PHENOL, 4,4'-(2-PYRIDINYLMETHYLENE)BIS-, DIACETATE (ESTER)",
          "stdName": "PHENOL, 4,4'-(2-PYRIDINYLMETHYLENE)BIS-, DIACETATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "685699cc-7028-41b1-ab38-d51422420896",
          "name": "SK-BISACODYL",
          "stdName": "SK-BISACODYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "aa4cf438-28f3-4399-a389-87951738fd80",
          "name": "THERALAX",
          "stdName": "THERALAX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e6b31b-39ce-45f0-93bd-1a27e8e62185"
          ],
          "display_name": false
        },
        {
          "uuid": "6108dc2d-13be-4772-aa75-8c6476653e2b",
          "name": "bisacodyl [INN]",
          "stdName": "BISACODYL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eeb4238-291f-429f-b050-d3d971efd2e1"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "26c6b786-585d-4a4d-9ca2-e2bb3b197ec7",
          "name": "Biological Half-life",
          "value": {
            "uuid": "824570f0-7938-4825-9563-22a5bdd7c8e7",
            "average": 8,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "06ae1b52-e875-c392-e722-5f4dac611b5c"
          ]
        }
      ]
    }
  ]
}