{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7fbe0755-e8bf-4efc-9dd9-cad0fb7fb1cd",
          "code": "C01DA05",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|VASODILATORS USED IN CARDIAC DISEASES|Organic nitrates|pentaerithrityl tetranitrate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01DA05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "3a3763d5-9a9e-4f87-970d-7b48877f7625",
          "code": "QC01DA05",
          "comments": "VATC|CARDIAC THERAPY|VASODILATATORS USED IN CARDIAC DISEASE|Organic nitrates|pentaerithrityl tetranitrate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01DA05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "60834bba-c4f5-4549-be5d-b949edcf1792",
          "code": "QC01DA55",
          "comments": "VATC|CARDIAC THERAPY|VASODILATATORS USED IN CARDIAC DISEASE|Organic nitrates|pentaerithrityl tetranitrate, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01DA55&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "91ab4569-e0d5-4573-9f79-e76279f958c8",
          "code": "78-11-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=78-11-5",
          "code_system": "CAS",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950",
            "f4c0379b-0c7d-456c-91cb-d7f2222538c5"
          ]
        },
        {
          "uuid": "162f5e49-2cbf-40db-bfa8-65a9e79c9f64",
          "code": "C47660",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47660",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "791e99ad-d006-4a17-98cd-9798aed6ea61",
          "code": "D010417",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010417",
          "code_system": "MESH",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "81b55203-88ae-429c-b092-7429261a6e39",
          "code": "PENTAERYTHRITOL TETRANITRATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pentaerythritol_tetranitrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "ab877310-d751-499e-bb83-f0da8e4bb550",
          "code": "21 CFR 250.102",
          "comments": "PART 250 -- SPECIAL REQUIREMENTS FOR SPECIFIC HUMAN DRUGS|Subpart B--New Drug or Prescription Status of Specific Drugs|Sec. 250.102 Drug preparations intended for human use containing certain \"coronary vasodilators\".",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=250.102",
          "code_system": "CFR",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "b5a9d640-0b8d-462d-8d82-a5f004734d6f",
          "code": "C01DA55",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|VASODILATORS USED IN CARDIAC DISEASES|Organic nitrates|pentaerithrityl tetranitrate, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01DA55&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "c8cff541-a240-45d1-b3f4-2481bfe9f9b3",
          "code": "SUB09676MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "dbc5bdc9-98fa-4d3b-99da-03eb48621a97",
          "code": "1455",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1455",
          "code_system": "INN",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "7e9a22cd-5fd8-4bf3-8c78-29547c761935",
          "code": "7992",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/7992/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "9f3a45e5-0441-404e-896b-3295d49c0ced",
          "code": "m8492",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8492?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "30b0980b-a4a4-4399-b11b-00bfbe8fe35e",
          "code": "CHEMBL466659",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL466659",
          "code_system": "ChEMBL",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "221872a7-4b55-45c7-b115-94e4eaeb9f79",
          "code": "201-084-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.987",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "a67e06b0-7ef2-4471-911e-b093c9e9ab76",
          "code": "6518",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6518",
          "code_system": "PUBCHEM",
          "references": [
            "c6c1b513-4478-478c-bc81-9649f6f17950"
          ]
        },
        {
          "uuid": "79de278c-0826-2a6c-e5a4-f22248b38228",
          "code": "6313",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6313",
          "code_system": "HSDB",
          "references": [
            "18044e29-b36c-610d-d261-53d87af19c4d"
          ]
        },
        {
          "uuid": "05ca9b32-83bb-bdf3-2eed-b0854857ef7d",
          "code": "DTXSID2023430",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023430",
          "code_system": "EPA CompTox",
          "references": [
            "54fc5806-6557-b451-70d4-113f701850a5"
          ]
        },
        {
          "uuid": "f890b08c-284f-dd44-4756-15fcc107e5ad",
          "code": "C01DA20",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|VASODILATORS USED IN CARDIAC DISEASES|Organic nitrates|organic nitrates in combination",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01DA20&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "76bed361-7bea-2860-720c-f2413671100c",
          "code": "C29707",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Vasodilating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4ebe6f65-326e-f0f8-9a80-1b2f94ccbee7"
          ]
        },
        {
          "uuid": "ca2c3812-2619-4448-8398-81b3b558efe6",
          "code": "10L39TRG1Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ca3a4834-f905-1140-d3e5-1571fa3a03fe",
          "code": "DB06154",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB06154",
          "code_system": "DRUG BANK",
          "references": [
            "4ebe6f65-326e-f0f8-9a80-1b2f94ccbee7"
          ]
        },
        {
          "uuid": "ea3196b7-c9ba-37cd-bc32-a266f2c805e4",
          "code": "2087",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2087",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4ebe6f65-326e-f0f8-9a80-1b2f94ccbee7"
          ]
        },
        {
          "uuid": "c4b12fcb-1b18-6b3b-9c83-0230b88e2f1b",
          "code": "25879",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:25879",
          "code_system": "CHEBI",
          "references": [
            "4ebe6f65-326e-f0f8-9a80-1b2f94ccbee7"
          ]
        },
        {
          "uuid": "125b7141-93db-1d5f-38de-0e7bc3e4988c",
          "code": "17553",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17553",
          "code_system": "CHEBI",
          "references": [
            "4ebe6f65-326e-f0f8-9a80-1b2f94ccbee7"
          ]
        },
        {
          "uuid": "163e34f8-dc93-0937-eb85-1c18ddd26fb8",
          "code": "100000087401",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "402c8c9c-b0df-ca20-9e1e-a34bcb29f118"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "85025321-4d4d-4ade-a2fd-995fdf824422",
          "amount": {
            "uuid": "1e719c2b-96a3-46a2-a7cf-b043023e098f"
          },
          "type": "METABOLITE ACTIVE->PRODRUG",
          "references": [
            "5c157453-27dd-473e-bf7a-6783d52cb510"
          ],
          "related_substance": {
            "uuid": "52510d42-93c0-4280-905c-684fc7f91ccd",
            "refuuid": "dce119a9-5a01-40f2-b23f-ed07ec63d125",
            "name": "NITRIC OXIDE",
            "unii": "31C4KY9ESH",
            "linking_id": "31C4KY9ESH",
            "ref_pname": "NITRIC OXIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6fc058f7-c6d1-4d98-9472-964a149b8800",
          "amount": {
            "uuid": "c43a575a-97db-4f25-aaa3-42edac6f4cbe"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "504aeb58-4fc4-4f44-a2e0-8f2510c2786c",
            "refuuid": "dce119a9-5a01-40f2-b23f-ed07ec63d125",
            "name": "NITRIC OXIDE",
            "unii": "31C4KY9ESH",
            "linking_id": "31C4KY9ESH",
            "ref_pname": "NITRIC OXIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "90290a3d-1389-45c1-a71e-d7c8b9d14382",
          "name": "1,3-PROPANEDIOL, 2,2-BIS((NITROOXY)METHYL)-, DINITRATE (ESTER)",
          "stdName": "1,3-PROPANEDIOL, 2,2-BIS((NITROOXY)METHYL)-, DINITRATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8817259-0c38-4179-a84c-6ac564a72ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "36c265a6-7f3a-4274-929e-4341c2473e6c",
          "name": "2,2-Bis(hydroxymethyl)-1,3-propanediol tetranitrate",
          "stdName": "2,2-BIS(HYDROXYMETHYL)-1,3-PROPANEDIOL TETRANITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8817259-0c38-4179-a84c-6ac564a72ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "f7ce950c-55e9-4b2b-909e-1d40d50e687e",
          "name": "PENTAERITHRITYL TETRANITRATE",
          "stdName": "PENTAERITHRITYL TETRANITRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "978e35a5-8c1c-4266-a077-cd705d02a84c",
            "e7f79e13-c244-4d64-b2e4-4f64fa7e41ab",
            "345c7b1d-81e2-497b-a0fc-f51082567885",
            "42b4e994-bb17-4d11-82a9-fd401067b6f9",
            "c09bf160-f7e5-46af-961c-cd0452b7f3c9",
            "bf1a27cf-b9da-4ffe-8a99-2f4d98724984",
            "061a8838-297e-424f-927f-ef1c3d3a4f91"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "115671e2-8070-4a68-b60b-80ff15bb8f6b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c2639cc9-ad2c-4b92-85be-ec57a7c582f1",
          "name": "PENTAERITHRITYL TETRANITRATE [MART.]",
          "stdName": "PENTAERITHRITYL TETRANITRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "345c7b1d-81e2-497b-a0fc-f51082567885"
          ],
          "display_name": false
        },
        {
          "uuid": "5fc6ee71-fb39-4b3b-a022-caf8cf7b8047",
          "name": "PENTAERYTHRITOL TETRANITRATE",
          "stdName": "PENTAERYTHRITOL TETRANITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b52fe991-328b-4654-8c30-839607eb1e9c",
            "0ad285b5-eb34-4d1e-b8c5-ce2a1bcb33ad",
            "968bdb62-f2ff-4fcf-894a-bef7a740762d",
            "8d0f1708-ec15-4e35-a22c-054550295f25",
            "4486ee7d-c727-4700-85e2-12d2cf30f83e",
            "e8534b6c-28bf-478a-bee8-8fc4f5191cc4",
            "00ef5647-04b6-40e4-a54f-ea21c6ef1809",
            "7ed0b8d6-da56-44b8-b784-bf6f1ebb9828",
            "b8817259-0c38-4179-a84c-6ac564a72ddc"
          ],
          "display_name": true
        },
        {
          "uuid": "510e9a6d-335e-4ec3-aef1-c82be2beeaae",
          "name": "PENTAERYTHRITOL TETRANITRATE [HSDB]",
          "stdName": "PENTAERYTHRITOL TETRANITRATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d0f1708-ec15-4e35-a22c-054550295f25"
          ],
          "display_name": false
        },
        {
          "uuid": "4b650765-8ad5-4ec1-ad29-6000c6495ab7",
          "name": "PENTAERYTHRITOL TETRANITRATE [JAN]",
          "stdName": "PENTAERYTHRITOL TETRANITRATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00ef5647-04b6-40e4-a54f-ea21c6ef1809"
          ],
          "display_name": false
        },
        {
          "uuid": "c3b7ed84-9991-4329-ada8-fa49eee6df68",
          "name": "PENTAERYTHRITOL TETRANITRATE [MI]",
          "stdName": "PENTAERYTHRITOL TETRANITRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4486ee7d-c727-4700-85e2-12d2cf30f83e"
          ],
          "display_name": false
        },
        {
          "uuid": "010c4045-6f6a-4d24-8cf3-0f738ba8f94b",
          "name": "PENTAERYTHRITOL TETRANITRATE [VANDF]",
          "stdName": "PENTAERYTHRITOL TETRANITRATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b52fe991-328b-4654-8c30-839607eb1e9c"
          ],
          "display_name": false
        },
        {
          "uuid": "5e22c9ec-b273-4ebd-9841-7340bca9bc94",
          "name": "PENTAERYTHRITYL TETRANITRATE",
          "stdName": "PENTAERYTHRITYL TETRANITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c801e1e7-cb3f-4cd9-9889-83c2e0cf5056"
          ],
          "display_name": false
        },
        {
          "uuid": "dac5a90f-5142-40ae-a9c6-a02080c0d8a9",
          "name": "PENTALONG",
          "stdName": "PENTALONG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca0314a8-d694-4ffe-a8f3-4f70b775c3bb"
          ],
          "display_name": false
        },
        {
          "uuid": "b19504b0-15b1-4418-b077-8dae9ea246c1",
          "name": "PENTRITOL TEMPULES",
          "stdName": "PENTRITOL TEMPULES",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8817259-0c38-4179-a84c-6ac564a72ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "e7aaa879-6959-425c-830c-6f0557d88a56",
          "name": "PERITRATE",
          "stdName": "PERITRATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8817259-0c38-4179-a84c-6ac564a72ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "889cf4b4-2b76-e5e9-5d56-1200052a335a",
          "name": "Pentaerithrityl tetranitrate [WHO-DD]",
          "stdName": "PENTAERITHRITYL TETRANITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d854ddfa-622f-b435-ef53-2ed2ac34a7ed"
          ],
          "display_name": false
        },
        {
          "uuid": "dc604de5-dce3-4125-9b30-cf5247e8c24f",
          "name": "pentaerithrityl tetranitrate [INN]",
          "stdName": "PENTAERITHRITYL TETRANITRATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "42b4e994-bb17-4d11-82a9-fd401067b6f9",
            "c09bf160-f7e5-46af-961c-cd0452b7f3c9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b8817259-0c38-4179-a84c-6ac564a72ddc",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c09bf160-f7e5-46af-961c-cd0452b7f3c9",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "42b4e994-bb17-4d11-82a9-fd401067b6f9",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00ef5647-04b6-40e4-a54f-ea21c6ef1809",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "345c7b1d-81e2-497b-a0fc-f51082567885",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4486ee7d-c727-4700-85e2-12d2cf30f83e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d0f1708-ec15-4e35-a22c-054550295f25",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "061a8838-297e-424f-927f-ef1c3d3a4f91",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c801e1e7-cb3f-4cd9-9889-83c2e0cf5056",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b52fe991-328b-4654-8c30-839607eb1e9c",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca0314a8-d694-4ffe-a8f3-4f70b775c3bb",
          "citation": "https://www.drugs.com/international/pentalong.html",
          "url": "https://www.drugs.com/international/pentalong.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6c1b513-4478-478c-bc81-9649f6f17950",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8202eb7-d62c-4b43-9955-94c88d40d193",
          "citation": "SRS import [10L39TRG1Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=10L39TRG1Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf1a27cf-b9da-4ffe-8a99-2f4d98724984",
          "citation": "PENTAERITHRITYL TETRANITRATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0ad285b5-eb34-4d1e-b8c5-ce2a1bcb33ad",
          "citation": "PENTAERYTHRITOL TETRANITRATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "978e35a5-8c1c-4266-a077-cd705d02a84c",
          "citation": "PENTAERITHRITYL TETRANITRATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7ed0b8d6-da56-44b8-b784-bf6f1ebb9828",
          "citation": "PENTAERYTHRITOL TETRANITRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "968bdb62-f2ff-4fcf-894a-bef7a740762d",
          "citation": "PENTAERYTHRITOL TETRANITRATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e7f79e13-c244-4d64-b2e4-4f64fa7e41ab",
          "citation": "PENTAERITHRITYL TETRANITRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8534b6c-28bf-478a-bee8-8fc4f5191cc4",
          "citation": "PENTAERYTHRITOL TETRANITRATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "18044e29-b36c-610d-d261-53d87af19c4d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+78-11-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "54fc5806-6557-b451-70d4-113f701850a5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=78-11-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "402c8c9c-b0df-ca20-9e1e-a34bcb29f118",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4ebe6f65-326e-f0f8-9a80-1b2f94ccbee7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5c157453-27dd-473e-bf7a-6783d52cb510",
          "citation": "VASCULAR PHARMACOLOGY\\\\nVOLUME 63, ISSUE 3, DECEMBER 2014, PAGES 105?113",
          "url": "http://www.sciencedirect.com/science/article/pii/S153718911400161X",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4c0379b-0c7d-456c-91cb-d7f2222538c5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d854ddfa-622f-b435-ef53-2ed2ac34a7ed",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "03186366-4947-42e7-a3b0-65c967e56b2b",
          "id": "03186366-4947-42e7-a3b0-65c967e56b2b",
          "molfile": "\n  Marvin  01132100282D          \n\n 21 20  0  0  0  0            999 V2000\n    5.4238   -4.0873    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.8223   -3.0467    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.7687   -3.0495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1582   -2.3439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3778   -2.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8631   -1.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4525   -1.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2246   -1.1816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8057   -0.6420    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.4072    0.3542    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7853   -0.6503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3456   -2.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5652   -2.3439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9011   -3.0467    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.3356   -3.9627    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.0073   -3.0495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2709   -1.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5016   -1.1816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9177   -0.6420    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.3162    0.3542    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.9326   -0.6503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 12  6  1  0  0  0  0\n 17  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  2  0  0  0  0\nM  CHG  8   1  -1   2   1   9   1  10  -1  14   1  15  -1  19   1  20  -1\nM  END",
          "smiles": "C(C(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-])O[N+](=O)[O-]",
          "formula": "C5H8N4O12",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ac7d3f57-0637-407d-bdb8-067757a3fe43"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "316.1369",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "960b4e30-b662-4c16-92fe-24c533da3406",
      "version": "18",
      "structure": {
        "id": "7fcdf197-a4b6-425e-bf00-ba7e2caeab50",
        "molfile": "\n  Marvin  01132106382D          \n\n 21 20  0  0  0  0            999 V2000\n    5.8057   -0.6420    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.8223   -3.0467    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    1.9177   -0.6420    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    1.9011   -3.0467    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.8631   -1.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4238   -4.0873    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.4072    0.3542    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3356   -3.9627    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.3162    0.3542    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7853   -0.6503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7687   -3.0495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9326   -0.6503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0073   -3.0495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2246   -1.1816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1582   -2.3439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5016   -1.1816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5652   -2.3439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4525   -1.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3778   -2.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2709   -1.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3456   -2.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 15  1  0  0  0  0\n  3 16  1  0  0  0  0\n  4 17  1  0  0  0  0\n  5 18  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  1  2  0  0  0  0\n 11  2  2  0  0  0  0\n 12  3  2  0  0  0  0\n 13  4  2  0  0  0  0\n 14  1  1  0  0  0  0\n 15 19  1  0  0  0  0\n 16 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19  5  1  0  0  0  0\n 20  5  1  0  0  0  0\n 21  5  1  0  0  0  0\nM  CHG  8   1   1   2   1   3   1   4   1   6  -1   7  -1   8  -1   9  -1\nM  END",
        "smiles": "C(C(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-])O[N+](=O)[O-]",
        "formula": "C5H8N4O12",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "316.1369",
        "optical_activity": "NONE",
        "references": [
          "d8202eb7-d62c-4b43-9955-94c88d40d193",
          "b8817259-0c38-4179-a84c-6ac564a72ddc",
          "c09bf160-f7e5-46af-961c-cd0452b7f3c9"
        ],
        "stereo_centers": 0
      },
      "unii": "10L39TRG1Z"
    }
  ]
}