{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "28f7f199-5f20-4e4d-98a1-c06a7dace936",
          "code": "82558-50-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=82558-50-7",
          "code_system": "CAS",
          "references": [
            "9abf613e-4e96-44ca-b8fa-035db680799f",
            "db7d69b1-0272-49cc-b6ac-1e6a06985f3c"
          ]
        },
        {
          "uuid": "4ba501cd-c344-4c5b-9f0f-46796296b024",
          "code": "125851",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2644",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "9abf613e-4e96-44ca-b8fa-035db680799f"
          ]
        },
        {
          "uuid": "b7106ae9-21aa-45cb-af98-9f156a9f4bdf",
          "code": "m6551",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6551?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9abf613e-4e96-44ca-b8fa-035db680799f"
          ]
        },
        {
          "uuid": "cb95ba6e-966b-4b7e-82ac-cca24ce020af",
          "code": "73672",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73672",
          "code_system": "PUBCHEM",
          "references": [
            "9abf613e-4e96-44ca-b8fa-035db680799f"
          ]
        },
        {
          "uuid": "d61d319c-40ba-12e3-c1be-bbb79b352aea",
          "code": "6691",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6691",
          "code_system": "HSDB",
          "references": [
            "9eb9b069-2f4a-335d-f35c-86a36543d466"
          ]
        },
        {
          "uuid": "2b9bce35-8206-8f4e-fbcf-c3ed54812b18",
          "code": "DTXSID8024159",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024159",
          "code_system": "EPA CompTox",
          "references": [
            "494f29a2-a173-ee1d-ffbc-642cb15b2b86"
          ]
        },
        {
          "uuid": "30c88013-dbfe-4028-a739-16e7e05f0b73",
          "code": "101V41EEA4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "90115568-01fb-5322-2341-5bb0ff4324e9",
          "code": "63956",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:63956",
          "code_system": "CHEBI",
          "references": [
            "5fa597be-e060-9890-a72c-f544ba535419"
          ]
        },
        {
          "uuid": "9840787c-70ef-60b2-8a4f-d6a3c841e5d6",
          "code": "Isoxaben",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Isoxaben",
          "code_system": "WIKIPEDIA",
          "references": [
            "53473b6b-0368-898e-5465-1a61c51164ae"
          ]
        },
        {
          "uuid": "0f54a994-4ff6-2e49-e37a-bb8ccbac6aa9",
          "code": "isoxaben",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/isoxaben.html",
          "code_system": "ALANWOOD",
          "references": [
            "7832cc65-527f-83bc-9652-7d2dfc91f9bc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f6897f24-d634-489e-b9ec-04b9685966c4",
          "name": "BENZAMIZOLE",
          "stdName": "BENZAMIZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c6c0e67-fade-43ff-985d-cb99196d5302",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        },
        {
          "uuid": "d4c9e428-2fb7-4738-b3e1-a4fe96817994",
          "name": "EL-107",
          "stdName": "EL-107",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c6c0e67-fade-43ff-985d-cb99196d5302",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        },
        {
          "uuid": "bbcd6432-2391-4ccc-be26-4da2c9a4beaf",
          "name": "FLEXIDOR",
          "stdName": "FLEXIDOR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4d7d283-2a98-4356-843a-7787cc3718a5",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        },
        {
          "uuid": "5846268a-df2b-485b-b5a4-6ea20bf0fdf1",
          "name": "GALLERY",
          "stdName": "GALLERY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4d7d283-2a98-4356-843a-7787cc3718a5",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        },
        {
          "uuid": "d4d5199f-0ad4-4046-a33e-0b85c33c700f",
          "name": "ISOXABEN",
          "stdName": "ISOXABEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "671a21fa-5098-4576-8da6-ee2f6e225531",
            "21ac2ecf-04d9-4f4c-869c-ec4d56b45df4",
            "7594a5f1-10e1-430c-a528-38f4fbc64ef6",
            "50f83dea-0c03-4cc3-a84d-1fdef87f6233",
            "82adbb9a-a9e1-4cce-b211-3fcc6909a43e",
            "99b953ff-06ba-4304-a3c5-64a8e5f9c3ea",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b",
            "8b9924e7-9d55-4b44-b42f-19a1781c69dd"
          ],
          "display_name": true
        },
        {
          "uuid": "7ed1f197-34c0-4c96-a96e-b6507174bd9b",
          "name": "ISOXABEN [HSDB]",
          "stdName": "ISOXABEN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99b953ff-06ba-4304-a3c5-64a8e5f9c3ea",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        },
        {
          "uuid": "a413a66a-9d60-47a8-8f45-39fb364f81da",
          "name": "ISOXABEN [ISO]",
          "stdName": "ISOXABEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7594a5f1-10e1-430c-a528-38f4fbc64ef6",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        },
        {
          "uuid": "88bf1326-2304-45df-ac35-f232fc529eff",
          "name": "ISOXABEN [MI]",
          "stdName": "ISOXABEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82adbb9a-a9e1-4cce-b211-3fcc6909a43e",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        },
        {
          "uuid": "b6967f61-82a4-4316-abca-7751ce7f6a1f",
          "name": "N-(3-(1-ETHYL-1-METHYLPROPYL)-1,2-OXAZOL-5-YL)-2,6-DIMETHOXYBENZAMIDE",
          "stdName": "N-(3-(1-ETHYL-1-METHYLPROPYL)-1,2-OXAZOL-5-YL)-2,6-DIMETHOXYBENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76466fd9-cc61-4a4d-ac79-29344f613a47",
            "90be9106-2d09-4a9c-af99-7ad70983b745"
          ],
          "display_name": false
        },
        {
          "uuid": "24b5fd28-9fd1-445a-9a14-422df702a7c5",
          "name": "N-(3-(1-ETHYL-1-METHYLPROPYL)-5-ISOXAZOLYL)-2,6-DIMETHOXYBENZAMIDE",
          "stdName": "N-(3-(1-ETHYL-1-METHYLPROPYL)-5-ISOXAZOLYL)-2,6-DIMETHOXYBENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64663100-4fe7-4164-8931-bed35587a143",
            "76466fd9-cc61-4a4d-ac79-29344f613a47"
          ],
          "display_name": false
        },
        {
          "uuid": "b812bc4a-3e6b-4505-bc7b-9e6bf51ef112",
          "name": "NA-8318",
          "stdName": "NA-8318",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c6c0e67-fade-43ff-985d-cb99196d5302",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        },
        {
          "uuid": "30cc1e2c-cdfe-4350-8d42-0081f361d35e",
          "name": "SNAPSHOT",
          "stdName": "SNAPSHOT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac370f76-9f80-4aac-98e3-c967273b0181",
            "ba692c6d-3862-4684-8b8f-67fe84ed086b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "671a21fa-5098-4576-8da6-ee2f6e225531",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "76466fd9-cc61-4a4d-ac79-29344f613a47",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64663100-4fe7-4164-8931-bed35587a143",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90be9106-2d09-4a9c-af99-7ad70983b745",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82adbb9a-a9e1-4cce-b211-3fcc6909a43e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba692c6d-3862-4684-8b8f-67fe84ed086b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c6c0e67-fade-43ff-985d-cb99196d5302",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4d7d283-2a98-4356-843a-7787cc3718a5",
          "citation": "M ERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac370f76-9f80-4aac-98e3-c967273b0181",
          "citation": "SITTIG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99b953ff-06ba-4304-a3c5-64a8e5f9c3ea",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7594a5f1-10e1-430c-a528-38f4fbc64ef6",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9abf613e-4e96-44ca-b8fa-035db680799f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ac4c419-9ae4-42d8-a626-eb0e5b9c0cc3",
          "citation": "SRS import [101V41EEA4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=101V41EEA4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f1d40c1-9238-4105-9a97-2fa9a2e443b2",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21ac2ecf-04d9-4f4c-869c-ec4d56b45df4",
          "citation": "ISOXABEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8b9924e7-9d55-4b44-b42f-19a1781c69dd",
          "citation": "ISOXABEN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "50f83dea-0c03-4cc3-a84d-1fdef87f6233",
          "citation": "ISOXABEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9eb9b069-2f4a-335d-f35c-86a36543d466",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+82558-50-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "494f29a2-a173-ee1d-ffbc-642cb15b2b86",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82558-50-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "53473b6b-0368-898e-5465-1a61c51164ae",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "7832cc65-527f-83bc-9652-7d2dfc91f9bc",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "5fa597be-e060-9890-a72c-f544ba535419",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "db7d69b1-0272-49cc-b6ac-1e6a06985f3c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0f0ee7e8-728e-4006-84f3-fa481a6c3165",
          "id": "0f0ee7e8-728e-4006-84f3-fa481a6c3165",
          "molfile": "\n  Marvin  01132101012D          \n\n 24 25  0  0  0  0            999 V2000\n    5.4406   -3.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7763   -3.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2932   -4.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8055   -5.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6561   -4.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8721   -4.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9604   -5.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7439   -4.8475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2269   -5.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0553   -5.5148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4671   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0553   -4.0850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2909   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7027   -5.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2909   -6.2297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7027   -6.9445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5265   -5.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9383   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5265   -4.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7027   -4.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2909   -3.3703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7027   -2.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7439   -6.1820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9604   -5.9267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  7  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 24  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 23  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 20  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCC(C)(CC)c1cc(NC(=O)c2c(cccc2OC)OC)on1",
          "formula": "C18H24N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aa90da4f-a7cd-408c-bce3-685a91f13399"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "332.3949",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "06d8457a-ed4f-4e6b-a254-72f06a101ed9",
      "version": "7",
      "structure": {
        "id": "aa2f884a-43c2-4baf-8229-a1c115d23b3b",
        "molfile": "\n  Marvin  01132108502D          \n\n 24 25  0  0  0  0            999 V2000\n    6.7439   -6.1820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9604   -5.9267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9604   -5.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2932   -4.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7763   -3.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4406   -3.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6561   -4.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8721   -4.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8055   -5.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7439   -4.8475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2269   -5.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0553   -5.5148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4671   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2909   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7027   -4.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5265   -4.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9383   -4.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5265   -5.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7027   -5.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2909   -6.2297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7027   -6.9445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2909   -3.3703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7027   -2.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0553   -4.0850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  1  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 14  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 15 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 13 24  2  0  0  0  0\nM  END",
        "smiles": "CCC(C)(CC)c1cc(NC(=O)c2c(cccc2OC)OC)on1",
        "formula": "C18H24N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "332.3949",
        "optical_activity": "NONE",
        "references": [
          "1ac4c419-9ae4-42d8-a626-eb0e5b9c0cc3",
          "6f1d40c1-9238-4105-9a97-2fa9a2e443b2"
        ],
        "stereo_centers": 0
      },
      "unii": "101V41EEA4"
    }
  ]
}