{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f772d267-0dc1-4e6b-8e33-c70d16e8812f",
          "code": "522-48-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=522-48-5",
          "code_system": "CAS",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb",
            "caa2699b-785d-48f7-b7f3-e021d9d9bd6d"
          ]
        },
        {
          "uuid": "9d09c945-e793-4469-b2dc-a1df86227636",
          "code": "C47749",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47749",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb"
          ]
        },
        {
          "uuid": "a92dbade-35c1-48c1-b802-272fbb309307",
          "code": "C005810",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005810",
          "code_system": "MESH",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb"
          ]
        },
        {
          "uuid": "107d1b5a-9e9b-4dea-b1eb-b49ad7040d3b",
          "code": "21 CFR 349.18",
          "comments": "PART 349 -- OPHTHALMIC DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart B--Active Ingredients|Sec. 349.18 Ophthalmic vasoconstrictors.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=349.18",
          "code_system": "CFR",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb"
          ]
        },
        {
          "uuid": "431f2d62-4252-476c-9141-53d2d6b1471a",
          "code": "57983",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/57983/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb"
          ]
        },
        {
          "uuid": "5678001a-01d7-4400-a0e0-59e1bb7d0e7b",
          "code": "m10634",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10634?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb"
          ]
        },
        {
          "uuid": "443166d7-6a39-4e14-861c-f6b27028caec",
          "code": "CHEMBL1266",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1266",
          "code_system": "ChEMBL",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb"
          ]
        },
        {
          "uuid": "1fd03060-107a-4dca-a063-54b1b4a49b69",
          "code": "SUB04765MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb"
          ]
        },
        {
          "uuid": "58ee01b0-bb0d-4a70-9091-81de2ddef7cb",
          "code": "208-329-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.574",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a9444c8d-599b-4bd3-8efd-0a50c48338fb"
          ]
        },
        {
          "uuid": "99ed64c5-2688-c583-0a46-9653d287f482",
          "code": "10648",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10648",
          "code_system": "PUBCHEM",
          "references": [
            "d54531fd-8ad6-ff0d-ae47-6c81eef13d74"
          ]
        },
        {
          "uuid": "be4a8fe2-63f2-87dc-64a9-e6c380a6454c",
          "code": "DTXSID7045316",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7045316",
          "code_system": "EPA CompTox",
          "references": [
            "49760858-aa7e-5da7-90f3-8215959ec007"
          ]
        },
        {
          "uuid": "e54a358d-2bc1-7a45-2758-10a6e4591de2",
          "code": "C29709",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Agonist[C87053]|Alpha-Adrenergic Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29709",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a9df97aa-8394-8410-f04c-5724726dc7c1"
          ]
        },
        {
          "uuid": "997d4476-2b04-e78c-350e-3fd1631792c2",
          "code": "DBSALT001254",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001254",
          "code_system": "DRUG BANK",
          "references": [
            "a9df97aa-8394-8410-f04c-5724726dc7c1"
          ]
        },
        {
          "uuid": "89e4d4a3-3b1e-42f6-ba6f-1d313e5f10a7",
          "code": "0YZT43HS7D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7f6d81ca-3582-950d-a412-ac41fec6b877",
          "code": "1652001",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1652001",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "a9df97aa-8394-8410-f04c-5724726dc7c1"
          ]
        },
        {
          "uuid": "425d7e2a-dec6-2cdd-c9fd-16c025a31241",
          "code": "9492",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9492",
          "code_system": "CHEBI",
          "references": [
            "a9df97aa-8394-8410-f04c-5724726dc7c1"
          ]
        },
        {
          "uuid": "1845ad19-ed8f-8ede-1f09-54f91d15b872",
          "code": "0YZT43HS7D",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0YZT43HS7D",
          "code_system": "DAILYMED",
          "references": [
            "727065a3-002e-2f24-6cb8-4beaebe5db43"
          ]
        },
        {
          "uuid": "3dd43c76-baef-c53e-72cd-4ad455477518",
          "code": "100000092231",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4b0721ee-bdfe-830e-213d-594c3a63bedd"
          ]
        },
        {
          "uuid": "e766b23f-0a83-5170-a9b9-3546df67a8b5",
          "code": "757339",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757339",
          "code_system": "NSC",
          "references": [
            "b3236381-f361-8ce8-677c-aba42fa61418"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4dc2533a-1f99-4bbe-a643-0648a5deb496",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c3aa2077-75e2-41e1-bba3-3e839caa7702",
            "refuuid": "38ff183a-db8e-4a74-8d40-9d85e8159a88",
            "name": "TETRAHYDROZOLINE",
            "unii": "S9U025Y077",
            "linking_id": "S9U025Y077",
            "ref_pname": "TETRAHYDROZOLINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7c86ee1b-e12e-4f00-997f-0e27cc3aedc0",
          "amount": {
            "uuid": "b0d9fea8-74de-4b09-b02c-af8acc921b93",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101,
            "low_limit": 98
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "b4391f36-241e-4adb-9771-1db6c0ad8fe9"
          ],
          "related_substance": {
            "uuid": "e7814e59-eb95-420f-a57d-55d3903815a1",
            "refuuid": "3c9a65a4-9739-46fe-92fd-c92dd901e3f7",
            "name": "TETRAHYDROZOLINE HYDROCHLORIDE",
            "unii": "0YZT43HS7D",
            "linking_id": "0YZT43HS7D",
            "ref_pname": "TETRAHYDROZOLINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7b885fff-f97d-4fe1-bd04-272144e64a04",
          "amount": {
            "uuid": "eb88de82-0220-432e-a2c4-1da357ca60a6",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 100.5,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "4f8b0bdd-d94f-439a-8e96-3fb6bc4983c5"
          ],
          "related_substance": {
            "uuid": "7684654a-809a-41b7-b1e9-3e7730dcdb81",
            "refuuid": "3c9a65a4-9739-46fe-92fd-c92dd901e3f7",
            "name": "TETRAHYDROZOLINE HYDROCHLORIDE",
            "unii": "0YZT43HS7D",
            "linking_id": "0YZT43HS7D",
            "ref_pname": "TETRAHYDROZOLINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f51498c5-4bb3-4591-8f49-384e98b3fa97",
          "amount": {
            "uuid": "0847f442-7967-4d55-8ac0-bf5818cf79c1",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "ENANTIOMER->RACEMATE",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b4391f36-241e-4adb-9771-1db6c0ad8fe9"
          ],
          "related_substance": {
            "uuid": "0773a71f-b797-480f-9861-0447a1e6e1f3",
            "refuuid": "7dd447dc-fc1b-4426-b460-4f14b5891d61",
            "name": "1-CYANOTETRALIN",
            "unii": "27327TPP91",
            "linking_id": "27327TPP91",
            "ref_pname": "1-CYANOTETRALIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7bffc2a9-edd1-4ceb-a402-fd880d9ea4b4",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "dc26ada1-49e2-441f-ab34-cf155b2c1816",
            "refuuid": "38ff183a-db8e-4a74-8d40-9d85e8159a88",
            "name": "TETRAHYDROZOLINE",
            "unii": "S9U025Y077",
            "linking_id": "S9U025Y077",
            "ref_pname": "TETRAHYDROZOLINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2655df1f-095e-453e-b1a4-ed21cf50b99c",
          "amount": {
            "uuid": "43ed7503-26ad-4a53-9945-06f4e5d72417",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "Ph.Eur.; USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "8c319b93-6cc0-4de1-af3e-80fbca7ae324",
            "367aa747-7dc5-dca8-f009-d2d7d737969a"
          ],
          "related_substance": {
            "uuid": "001532e8-5f8f-486e-9101-4bd1a452f5a1",
            "refuuid": "7dd447dc-fc1b-4426-b460-4f14b5891d61",
            "name": "1-CYANOTETRALIN",
            "unii": "27327TPP91",
            "linking_id": "27327TPP91",
            "ref_pname": "1-CYANOTETRALIN"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "671090f3-c29d-1b3e-ecba-b3a23284e3fb",
          "name": "NSC-757339",
          "stdName": "NSC-757339",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3236381-f361-8ce8-677c-aba42fa61418"
          ],
          "display_name": false
        },
        {
          "uuid": "fe0ca357-ef0f-4963-9f91-1484478d935a",
          "name": "RHINOPRONT",
          "stdName": "RHINOPRONT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
            "dad863a8-c615-450b-815d-8ecf9a6cf780"
          ],
          "display_name": false
        },
        {
          "uuid": "43145ca8-1d83-4b6b-b9fe-f91457b93fef",
          "name": "TETRAHYDROZOLINE HCL",
          "stdName": "TETRAHYDROZOLINE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4220e1c-c8e1-437d-9a14-a895ff5981a9"
          ],
          "display_name": false
        },
        {
          "uuid": "f2a64ed7-fcae-4c30-91d1-bce36623c5fa",
          "name": "TETRAHYDROZOLINE HYDROCHLORIDE",
          "stdName": "TETRAHYDROZOLINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d03ab40f-d1d5-49a9-820c-1204024aff66",
            "f6318590-3b2e-4543-a1b3-2ced24e6cad6",
            "4734a2c7-7b0c-466d-bf05-a2f9b606a1ee",
            "fdd18a6c-9c53-4c1a-84c4-d505808dfd2c",
            "a48cdf77-e4ce-4775-8806-8b7d38ec6d94",
            "84efdf1a-550b-4f29-85ec-90e3e8d5bcdf",
            "0f986707-d353-46a2-940b-0c9f3613b1c4",
            "8c338ce6-ff74-43be-bba3-511ba7ff1d76",
            "a00709a8-cd34-4f1a-b49c-c7f82bd50e48",
            "6a33c268-dd47-4d73-a527-12c5d0631098",
            "dace68e7-4b2e-4d61-b777-9174b7feb503",
            "6232efa7-b410-4486-a023-96828c98247c",
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
            "dad863a8-c615-450b-815d-8ecf9a6cf780"
          ],
          "display_name": true
        },
        {
          "uuid": "06f1d31d-7bce-4a3f-afc7-908709d7c1fb",
          "name": "TETRAHYDROZOLINE HYDROCHLORIDE [JAN]",
          "stdName": "TETRAHYDROZOLINE HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d03ab40f-d1d5-49a9-820c-1204024aff66",
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b"
          ],
          "display_name": false
        },
        {
          "uuid": "a6514f5a-96a4-4166-aa4e-cd98c245cbb7",
          "name": "TETRAHYDROZOLINE HYDROCHLORIDE [MI]",
          "stdName": "TETRAHYDROZOLINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
            "dad863a8-c615-450b-815d-8ecf9a6cf780"
          ],
          "display_name": false
        },
        {
          "uuid": "d232828b-0bdd-42b4-a9d8-9028545631c9",
          "name": "TETRAHYDROZOLINE HYDROCHLORIDE [ORANGE BOOK]",
          "stdName": "TETRAHYDROZOLINE HYDROCHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f986707-d353-46a2-940b-0c9f3613b1c4"
          ],
          "display_name": false
        },
        {
          "uuid": "917c2769-bea6-4bfd-415f-e04a2ea3390a",
          "name": "TETRAHYDROZOLINE HYDROCHLORIDE [USP MONOGRAPH]",
          "stdName": "TETRAHYDROZOLINE HYDROCHLORIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4db5ab85-1379-0d7f-1ee9-61c6a1562889"
          ],
          "display_name": false
        },
        {
          "uuid": "a78fde25-0582-4842-bc60-517b01929dd0",
          "name": "TETRAHYDROZOLINE HYDROCHLORIDE [USP-RS]",
          "stdName": "TETRAHYDROZOLINE HYDROCHLORIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
            "84efdf1a-550b-4f29-85ec-90e3e8d5bcdf"
          ],
          "display_name": false
        },
        {
          "uuid": "8f52e6f8-50f5-489e-905f-3263c5680122",
          "name": "TETRAHYDROZOLINE HYDROCHLORIDE [VANDF]",
          "stdName": "TETRAHYDROZOLINE HYDROCHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdd18a6c-9c53-4c1a-84c4-d505808dfd2c",
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b"
          ],
          "display_name": false
        },
        {
          "uuid": "71c83b08-b650-4a36-9fd7-18eb2ebda5f2",
          "name": "TETRYZOLINE HYDROCHLORIDE",
          "stdName": "TETRYZOLINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "512df47e-6c76-4bb4-bbc9-d0c4507adbac",
            "eb21ac55-6f8c-445e-8fdb-fe84a1f78e26",
            "ea51e117-9084-45ee-9066-c1e5a25ff000",
            "4ad69023-fe0b-454f-bf36-4f4614b7282f",
            "1fcd9fbe-fcf8-4594-af97-7a5435916647",
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
            "ce16fe11-2e34-4699-be51-e9df331fa224",
            "5b1886de-f9a4-4fcd-abf5-1b1f212e0bca"
          ],
          "display_name": false
        },
        {
          "uuid": "db3995f1-9d91-d6b9-8a07-e04ef785d10a",
          "name": "TETRYZOLINE HYDROCHLORIDE [EP MONOGRAPH]",
          "stdName": "TETRYZOLINE HYDROCHLORIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4449251-ce58-5499-d1a2-e6683276309d"
          ],
          "display_name": false
        },
        {
          "uuid": "1e5f926d-6ebd-47e8-86f3-02d9838b962d",
          "name": "TETRYZOLINE HYDROCHLORIDE [MART.]",
          "stdName": "TETRYZOLINE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea51e117-9084-45ee-9066-c1e5a25ff000"
          ],
          "display_name": false
        },
        {
          "uuid": "22fa9828-5308-4286-a643-d295d242a05b",
          "name": "TYZINE",
          "stdName": "TYZINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
            "dad863a8-c615-450b-815d-8ecf9a6cf780"
          ],
          "display_name": false
        },
        {
          "uuid": "4a4fddb2-60de-ab31-6453-ce293ca40816",
          "name": "Tetryzoline hydrochloride [WHO-DD]",
          "stdName": "TETRYZOLINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0a10f31-8524-03ee-c085-f06c67685dd1"
          ],
          "display_name": false
        },
        {
          "uuid": "c00ba704-616d-41cc-9378-1e670345db35",
          "name": "VISINE",
          "stdName": "VISINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
            "dad863a8-c615-450b-815d-8ecf9a6cf780"
          ],
          "display_name": false
        },
        {
          "uuid": "7bb4d7a7-490d-41b8-aaab-769b6c317e36",
          "name": "YXIN",
          "stdName": "YXIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
            "dad863a8-c615-450b-815d-8ecf9a6cf780"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a4220e1c-c8e1-437d-9a14-a895ff5981a9",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fcd9fbe-fcf8-4594-af97-7a5435916647",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38f6a6d3-affb-43c2-bd52-b5c7a6f4b80b",
          "citation": "EMA LIST",
          "doc_type": "EMA LIST",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb21ac55-6f8c-445e-8fdb-fe84a1f78e26",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4734a2c7-7b0c-466d-bf05-a2f9b606a1ee",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d03ab40f-d1d5-49a9-820c-1204024aff66",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f986707-d353-46a2-940b-0c9f3613b1c4",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea51e117-9084-45ee-9066-c1e5a25ff000",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84efdf1a-550b-4f29-85ec-90e3e8d5bcdf",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce16fe11-2e34-4699-be51-e9df331fa224",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdd18a6c-9c53-4c1a-84c4-d505808dfd2c",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dad863a8-c615-450b-815d-8ecf9a6cf780",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9444c8d-599b-4bd3-8efd-0a50c48338fb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389646000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4391f36-241e-4adb-9771-1db6c0ad8fe9",
          "citation": "EP 7.8 TETRYZOLINE HYDROCHLORIDE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f8b0bdd-d94f-439a-8e96-3fb6bc4983c5",
          "citation": "USP 36 TETRAHYDROZOLINE HYDROCHLORIDE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45860049-ae3c-42d4-93dc-35628d6daf8d",
          "citation": "SRS import [0YZT43HS7D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0YZT43HS7D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389646000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ad69023-fe0b-454f-bf36-4f4614b7282f",
          "citation": "TETRYZOLINE HYDROCHLORIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a33c268-dd47-4d73-a527-12c5d0631098",
          "citation": "TETRAHYDROZOLINE HYDROCHLORIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a00709a8-cd34-4f1a-b49c-c7f82bd50e48",
          "citation": "TETRAHYDROZOLINE HYDROCHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dace68e7-4b2e-4d61-b777-9174b7feb503",
          "citation": "TETRAHYDROZOLINE HYDROCHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "512df47e-6c76-4bb4-bbc9-d0c4507adbac",
          "citation": "TETRYZOLINE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f6318590-3b2e-4543-a1b3-2ced24e6cad6",
          "citation": "TETRAHYDROZOLINE HYDROCHLORIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5b1886de-f9a4-4fcd-abf5-1b1f212e0bca",
          "citation": "TETRYZOLINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a48cdf77-e4ce-4775-8806-8b7d38ec6d94",
          "citation": "TETRAHYDROZOLINE HYDROCHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6232efa7-b410-4486-a023-96828c98247c",
          "citation": "TETRAHYDROZOLINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c338ce6-ff74-43be-bba3-511ba7ff1d76",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "49760858-aa7e-5da7-90f3-8215959ec007",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=522-48-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4b0721ee-bdfe-830e-213d-594c3a63bedd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a9df97aa-8394-8410-f04c-5724726dc7c1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "caa2699b-785d-48f7-b7f3-e021d9d9bd6d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8c319b93-6cc0-4de1-af3e-80fbca7ae324",
          "citation": "European Pharmacopoeia Online 9.8, Tetryzoline Hydrochloride Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "367aa747-7dc5-dca8-f009-d2d7d737969a",
          "citation": "USP42-NF37 - 4278, Tetrahydrozoline Hydrochloride Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d54531fd-8ad6-ff0d-ae47-6c81eef13d74",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "c7a41b61-ea6e-57a3-df19-48c668691ab2",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "4db5ab85-1379-0d7f-1ee9-61c6a1562889",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "b3236381-f361-8ce8-677c-aba42fa61418",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d4449251-ce58-5499-d1a2-e6683276309d",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "727065a3-002e-2f24-6cb8-4beaebe5db43",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f0a10f31-8524-03ee-c085-f06c67685dd1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "332aa985-aa18-4131-9332-5d5326a4c266",
          "id": "332aa985-aa18-4131-9332-5d5326a4c266",
          "molfile": "\n  Marvin  01132102442D          \n\n  1  0  0  0  0  0            999 V2000\n    1.2064   -0.2011    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "94b8b21e-29ee-4ea2-a8bb-ec12c5d3a9c6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9b58e5e9-5778-48ea-8508-a43cddbe1d75",
          "id": "9b58e5e9-5778-48ea-8508-a43cddbe1d75",
          "molfile": "\n  Marvin  01132108042D          \n\n 15 17  0  0  0  0            999 V2000\n    0.2165   -1.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6109   -0.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0387   -0.2011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6960   -0.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5981   -1.3662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4384   -0.1469    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -1.4384    0.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1498    1.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8536    0.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8536   -0.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5341   -0.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5341   -1.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8226   -1.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0906   -1.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1060   -0.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  3  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n 15  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 15  2  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)CCCC2C3=NCCN3",
          "formula": "C13H16N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "75c6ef8f-28df-4222-b344-bf85f43d542d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "200.28",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3c9a65a4-9739-46fe-92fd-c92dd901e3f7",
      "version": "24",
      "structure": {
        "id": "0fbb1955-f644-4452-ad2e-dc1f8f36a568",
        "molfile": "\n  Marvin  01132101032D          \n\n 16 17  0  0  0  0            999 V2000\n   -0.6960   -0.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4384   -0.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1060   -0.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5981   -1.3662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0387   -0.2011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8536   -0.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4384    0.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2165   -1.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0906   -1.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6109   -0.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1498    1.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8536    0.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5341   -0.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8226   -1.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5341   -1.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2064   -0.2011    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  9  2  0  0  0  0\n 15 14  1  0  0  0  0\n 10  8  1  0  0  0  0\n 12  6  1  0  0  0  0\n 15 13  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)CCCC2C3=NCCN3.Cl",
        "formula": "C13H16N2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "236.7409",
        "optical_activity": "( + / - )",
        "references": [
          "8c338ce6-ff74-43be-bba3-511ba7ff1d76",
          "45860049-ae3c-42d4-93dc-35628d6daf8d"
        ],
        "stereo_centers": 1
      },
      "unii": "0YZT43HS7D"
    }
  ]
}