{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bfa21370-d190-4f0d-bd4a-d5c5107acd3a",
          "code": "C03CA02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|HIGH-CEILING DIURETICS|Sulfonamides, plain|bumetanide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03CA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "21ec189f-aee0-4081-bd64-c738167aa020",
          "code": "N0000175590",
          "comments": "Established Pharmacologic Class [EPC]|Loop Diuretic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175590",
          "code_system": "NDF-RT",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "286c615a-9c5f-47d8-b939-01bd8aadd4c2",
          "code": "N0000175366",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Renal/Urological Activity Alteration [PE]|Diuresis Alteration [PE]|Increased Diuresis [PE]|Increased Diuresis at Loop of Henle [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175366",
          "code_system": "NDF-RT",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "e0362da0-d2f8-488b-927c-0263dbc3b076",
          "code": "QC03CB02",
          "comments": "VATC|DIURETICS|HIGH-CEILING DIURETICS|Sulfonamides and potassium in combination|bumetanide and potassium",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03CB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "35dbc8ea-4a39-4923-825e-368a09704c95",
          "code": "QC03EB02",
          "comments": "VATC|DIURETICS|DIURETICS AND POTASSIUM-SPARING AGENTS IN COMBINATION|High-ceiling diuretics and potassium-sparing agents|bumetanide and potassium-sparing agents",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03EB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "a4576714-0275-4fde-8033-8c03c2d289e5",
          "code": "QC03CA02",
          "comments": "VATC|DIURETICS|HIGH-CEILING DIURETICS|Sulfonamides, plain|bumetanide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03CA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "847243a7-9ca9-48b3-973d-b76a9ddd0eb5",
          "code": "28395-03-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28395-03-1",
          "code_system": "CAS",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050",
            "76bc6d8a-722b-4dd8-a78a-56edd56c90e2"
          ]
        },
        {
          "uuid": "707ca870-0397-498b-a4be-9f64a3b1507d",
          "code": "C28875",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28875",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "23df0da8-3a3c-45af-a1c8-8c03a3a2ccbd",
          "code": "D002034",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002034",
          "code_system": "MESH",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "5d8cced5-0302-4f76-b929-6c46bc053442",
          "code": "126",
          "comments": "LiverTox|Cardiac|Diuretic|Loop diuretic",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Bumetanide.htm",
          "code_system": "LIVERTOX",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "298b3f29-8587-4d9d-a39d-ee2723d89b8d",
          "code": "BUMETANIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bumetanide",
          "code_system": "WIKIPEDIA",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "7b5f3237-9c55-4391-aa4c-26dc23c2abd4",
          "code": "C03CB02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|HIGH-CEILING DIURETICS|Sulfonamides and potassium in combination|bumetanide and potassium",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03CB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "fb6b9dd7-50cf-4852-8a85-657787179f74",
          "code": "C03EB02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|DIURETICS AND POTASSIUM-SPARING AGENTS IN COMBINATION|High-ceiling diuretics and potassium-sparing agents|bumetanide and potassium-sparing agents",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03EB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "34dae005-0adc-46f8-9066-fa2fa4ba937d",
          "code": "SUB05971MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "bc88a907-3bac-4767-8746-3dbf094886af",
          "code": "2943",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2943",
          "code_system": "INN",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "54fc5a65-c532-4aa4-a0de-6a9deee3fe4c",
          "code": "4837",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4837",
          "code_system": "IUPHAR",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "4465c864-6631-4484-90c5-eb5476d69dfa",
          "code": "1808",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1808/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "0b00cecf-0174-4506-950a-36bb71f6be20",
          "code": "m2759",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2759?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "6c6e787a-ead0-46fd-a34e-014e8240b00f",
          "code": "DB00887",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00887",
          "code_system": "DRUG BANK",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "c89ff28d-6847-4f45-8a82-38481a60307c",
          "code": "CHEMBL1072",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1072",
          "code_system": "ChEMBL",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "0f7bfa15-5aa7-4e1a-9b29-871f5b3f0490",
          "code": "249-004-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.534",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "bfb0f003-eca3-4652-a94d-b716614b2638",
          "code": "2471",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2471",
          "code_system": "PUBCHEM",
          "references": [
            "2065c447-a00d-4712-a283-02caef732050"
          ]
        },
        {
          "uuid": "1f986c00-757f-720a-dd13-aaa4ada2bd12",
          "code": "DTXSID5022699",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5022699",
          "code_system": "EPA CompTox",
          "references": [
            "a6241806-8f32-0782-b054-b212a09120f2"
          ]
        },
        {
          "uuid": "53b67b91-af21-b589-7b2b-41db3485c93e",
          "code": "C49184",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic[C448]|Loop Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C49184",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6170c21c-26d7-4500-56b3-6d5d71ce6a90"
          ]
        },
        {
          "uuid": "d3acb748-c573-45de-8418-1c6d751c5da5",
          "code": "0Y2S3XUQ5H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6316388c-872d-0e31-b92a-529aab5baf20",
          "code": "Bumetanide",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM36/",
          "code_system": "LACTMED",
          "references": [
            "6170c21c-26d7-4500-56b3-6d5d71ce6a90"
          ]
        },
        {
          "uuid": "94a0a95d-5d7c-0744-dd74-d4900d7fa533",
          "code": "427",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/427",
          "code_system": "DRUG CENTRAL",
          "references": [
            "6170c21c-26d7-4500-56b3-6d5d71ce6a90"
          ]
        },
        {
          "uuid": "9ce0d1e8-565a-5a4a-7ce5-17b94f713240",
          "code": "3213",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3213",
          "code_system": "CHEBI",
          "references": [
            "6170c21c-26d7-4500-56b3-6d5d71ce6a90"
          ]
        },
        {
          "uuid": "79984f7b-0532-f930-d619-88720201085a",
          "code": "1078303",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1078303",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "6170c21c-26d7-4500-56b3-6d5d71ce6a90"
          ]
        },
        {
          "uuid": "ec276101-38dd-47b9-edf4-88eb7d2699ff",
          "code": "100000088443",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e64337e2-fdfe-7f12-b8fb-6543061b9cc3"
          ]
        },
        {
          "uuid": "dd7b397c-7549-0afa-f061-bbf6f8bd9012",
          "code": "0Y2S3XUQ5H",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0Y2S3XUQ5H",
          "code_system": "DAILYMED",
          "references": [
            "cf04df72-91df-4523-5584-1e03458f794c"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "56986866-67b8-4db5-87f1-065ada625324",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0a1c216-9caa-4035-b431-fefb09901cfd",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5944577d-3441-40e7-806b-eadab89faf38",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "869201df-16d0-44ed-a601-afed7abcfea8",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7188269-ccda-4200-a911-ded9181403cc",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cb9d4b1-d9e4-457b-b487-5422ba0d702f",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50bd1165-6cda-416d-bc10-38da911541f0",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2065c447-a00d-4712-a283-02caef732050",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389723000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e88088f2-2588-43f3-b53c-2cf0e50726b2",
          "citation": "SRS import [0Y2S3XUQ5H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0Y2S3XUQ5H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389723000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13c5f790-2f96-4524-8f6d-25725cdb1675",
          "citation": "BUMETANIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b5950563-976b-4e21-a2d6-808ec9a16c1e",
          "citation": "BUMETANIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f8ea6822-d2fe-4d3c-bd7d-e2a0c5a0d72b",
          "citation": "BUMETANIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "43ab6b9c-a9e7-46ed-ad1b-e42b35ebcbb3",
          "citation": "BUMETANIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46386260-31b9-46b6-8fde-dbcc64a46a6c",
          "citation": "BUMETANIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55081371-2afd-4b49-9b0e-68d9e5aeb7ec",
          "citation": "BUMETANIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2024d0a6-9704-4582-a163-04388f84b141",
          "citation": "BUMETANIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f729e444-06e5-4cd3-91cc-f9bf94096bc4",
          "citation": "BUMETANIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a6c0da73-b425-433d-9148-7e5207578dbf",
          "citation": "BUMETANIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5da72fc4-027e-449d-b3fd-40ca3d408ab0",
          "citation": "BUMETANIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3384628b-77b6-4dfd-ac83-0a5fc834bdcf",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a98ee26c-96d1-42ec-bbd6-3019c7373d37",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8ab34f2-260b-4df7-8dc4-139ab6450756",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8defa307-3534-4c0c-84f9-5074074ce82b",
          "citation": "INN Proposed List 24",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL24.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9d341e57-63d2-42d2-9541-afae59fa82f0",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c36de002-4fcb-4fd3-a5cd-c679a53f289f",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bddef3b-a585-4c44-8596-e83469b0674c",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25c6b903-9aeb-c98a-0787-0713533c0bf8",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/74?sec=monphar",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "e5895774-d259-ac58-cf99-1c2fded99065",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "71e16a25-48a0-020b-8ef1-3c9c344c66b9",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+28395-03-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a6241806-8f32-0782-b054-b212a09120f2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28395-03-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e64337e2-fdfe-7f12-b8fb-6543061b9cc3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6170c21c-26d7-4500-56b3-6d5d71ce6a90",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "db060293-cfdb-6f9c-acba-d172c568ce2c",
          "citation": "https://adisinsight.springer.com/drugs/800049117",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "76bc6d8a-722b-4dd8-a78a-56edd56c90e2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ba161095-150c-49f3-abe3-69af43030291",
          "citation": "Pérez-Escuredo, Jhudit, et al. \"Monocarboxylate transporters in the brain and in cancer.\" Biochimica et Biophysica Acta (BBA)-Molecular Cell Research 1863.10 (2016): 2481-2497.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0167488916300660",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "0431c2d8-cb8f-4eeb-a3ab-1fe869e638e2",
          "citation": "Downloaded from journals.physiology.org/journal/ajpgi at FDA Library (150.148.014.134) on July 7, 2020",
          "url": "https://journals.physiology.org/doi/pdf/10.1152/ajpgi.1993.265.5.G942",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "28a67bd9-71a6-421e-ae23-016e11a098b9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4a30172e-caf9-f78e-3ef9-1c8fdd4aa6f3",
          "citation": "USP42-NF37 - 593, Bumetanide Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d5504dd-9a34-4fcd-8cba-f2dd6d955c4b",
          "citation": "USP42-NF37 - 593, Bumetanide Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e21dbf46-24a4-43e0-b952-944e3ea59af4",
          "citation": "USP42-NF37 - 593, Bumetanide Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "207909e3-3c01-4a60-be7f-6f987ea6594e",
          "citation": "USP42-NF37 - 593, Bumetanide Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d1ffd40-1cab-4ff7-b67d-305314a17dfe",
          "citation": "USP42-NF37 - 593, Bumetanide Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ba720200-09fa-4a9d-a8b9-8c32f84db9d9",
          "citation": "PH. EUR 10.4 BUTEMIDE MONOGRAPH",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3b807429-1c1a-4806-95a9-4897ba1667fc",
          "citation": "PH. EUR 10.4 BUTEMIDE MONOGRAPH",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe0bf168-53aa-7774-59b5-0c9229196112",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "926300ae-5237-dca6-32f9-d226d42d20f6",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "408a22f0-e862-aa79-7f8c-72dfb7ffd4b6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "00dde09c-0516-d265-3bdc-19a8f2c2b862",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "826a3dad-e5b0-67bc-f8cc-464ae02630b3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cf04df72-91df-4523-5584-1e03458f794c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2fd3cb5d-532c-48dc-8021-adcac1ed1efd",
          "citation": "USP42-NF37 - 593, Bumetanide Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "68e34628-6bfe-427d-b26f-aa112e43ab85",
          "citation": "EP",
          "url": "http://online6.edqm.eu/ep906/mobile/#documentPage",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "da123f4c-f0de-454d-9cff-6b5ab57fe317",
          "citation": "USP42-NF37 - 593, Bumetanide Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "479098ad-e6a9-49b4-85dd-968809b9ec4d",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "81944a91-0833-42c3-a657-a26e0aab6194",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b2052265-5da8-4ed6-b6db-69dbc0503da3",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "05aab636-1f03-4c47-bac0-6c04d978fc0b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bdeac95b-5438-4d74-9efb-fc46bfda52d8",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d9e29ca8-f1ae-4d77-8fde-3b2b28ed354a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a08f8f4c-3188-4551-b7a5-8b17877075d1",
          "id": "a08f8f4c-3188-4551-b7a5-8b17877075d1",
          "molfile": "\n  Marvin  01132108202D          \n\n 25 26  0  0  0  0            999 V2000\n    0.0000   -3.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8228   -3.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2255   -2.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0539   -2.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4690   -2.2088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2768   -2.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6872   -2.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5126   -2.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9307   -2.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5048   -1.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6794   -1.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2691   -0.7769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4457   -0.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0359   -1.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2100   -1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8048   -0.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2100   -0.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0359   -0.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9152   -0.7769    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7199   -0.9828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1965    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1667   -0.4259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9307   -3.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7535   -3.6149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5229   -4.3267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 23  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 19  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  2  0  0  0  0\n 22 19  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  2  0  0  0  0\nM  END",
          "smiles": "CCCCNc1cc(cc(c1Oc2ccccc2)S(=O)(=O)N)C(=O)O",
          "formula": "C17H20N2O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d39f24a4-af42-4039-b2d1-50ceee9aa688"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "364.4178",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "94eea4cd-8bba-4811-91e8-67a49e2cd21f",
      "version": "81",
      "structure": {
        "id": "84e25452-43f8-4651-a94a-531bc69a1318",
        "molfile": "\n  Marvin  01132106542D          \n\n 25 26  0  0  0  0            999 V2000\n   17.3197   -2.6876    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9093   -3.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0834   -3.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3351   -4.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9169   -4.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6808   -4.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3351   -5.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0911   -4.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6730   -2.6876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6010   -1.9107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5712   -2.3366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1248   -2.8941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1585   -5.5266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8729   -4.1200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9274   -6.2390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8496   -2.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4574   -4.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4393   -1.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4393   -3.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6289   -4.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2263   -5.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4029   -5.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6134   -3.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6134   -1.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2082   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  1  2  0  0  0  0\n 11  1  2  0  0  0  0\n 12  1  1  0  0  0  0\n 13  7  2  0  0  0  0\n 14  6  1  0  0  0  0\n 15  7  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 16  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 19  2  0  0  0  0\n 24 18  1  0  0  0  0\n 25 23  1  0  0  0  0\n  6  8  2  0  0  0  0\n 24 25  2  0  0  0  0\nM  END",
        "smiles": "CCCCNc1cc(cc(c1Oc2ccccc2)S(=O)(=O)N)C(=O)O",
        "formula": "C17H20N2O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "364.4178",
        "optical_activity": "NONE",
        "references": [
          "3384628b-77b6-4dfd-ac83-0a5fc834bdcf",
          "e88088f2-2588-43f3-b53c-2cf0e50726b2",
          "8defa307-3534-4c0c-84f9-5074074ce82b"
        ],
        "stereo_centers": 0
      },
      "unii": "0Y2S3XUQ5H",
      "relationships": [
        {
          "uuid": "bd7049f1-3a2c-4709-b219-736bcb16025a",
          "amount": {
            "uuid": "ceb68f76-ab9e-49e1-a591-3a4a243418bc"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "20185ccb-558a-49af-894e-71f7cb90e97a",
            "refuuid": "94eea4cd-8bba-4811-91e8-67a49e2cd21f",
            "name": "Bumetanide",
            "unii": "0Y2S3XUQ5H",
            "linking_id": "0Y2S3XUQ5H",
            "ref_pname": "Bumetanide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fe29a481-1c8a-4839-a53a-d1328655c3f7",
          "amount": {
            "uuid": "daea0e04-6945-4d31-91e0-36432c14986e",
            "average": 96,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "25c6b903-9aeb-c98a-0787-0713533c0bf8"
          ],
          "related_substance": {
            "uuid": "0748daec-ccd0-4696-acff-422dc8b2853d",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b58d1b77-1421-4c1f-931e-2ef44318a816",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "ba161095-150c-49f3-abe3-69af43030291"
          ],
          "related_substance": {
            "uuid": "2f26a474-2b9e-4dc7-b16a-495ab25de686",
            "refuuid": "7e429dc7-8255-4143-a00f-0635730dff29",
            "name": "MONOCARBOXYLATE TRANSPORTER 6",
            "unii": "3FJ2FTH4UQ",
            "linking_id": "3FJ2FTH4UQ",
            "ref_pname": "MONOCARBOXYLATE TRANSPORTER 6"
          }
        },
        {
          "uuid": "1a964fe3-73c5-4522-87c0-b2da0b97edc2",
          "amount": {
            "uuid": "df26c919-2a3e-44a2-a53e-fa20de71815c",
            "units": "%",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "2fd3cb5d-532c-48dc-8021-adcac1ed1efd",
            "68e34628-6bfe-427d-b26f-aa112e43ab85"
          ],
          "related_substance": {
            "uuid": "a5821c9b-aaf1-40a7-99ed-c5df372f5836",
            "refuuid": "540f902b-0b28-41eb-88d0-61c044e467e0",
            "name": "3-(AMINOSULFONYL)-5-NITRO-4-PHENOXYBENZOIC ACID",
            "unii": "P531HR643J",
            "linking_id": "P531HR643J",
            "ref_pname": "3-(AMINOSULFONYL)-5-NITRO-4-PHENOXYBENZOIC ACID"
          }
        },
        {
          "uuid": "7dfae650-73f1-4475-837d-76fbf1837c88",
          "amount": {
            "uuid": "cf8bdad0-8381-4658-8c37-f26d7c5b517c",
            "units": "%",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "e21dbf46-24a4-43e0-b952-944e3ea59af4"
          ],
          "related_substance": {
            "uuid": "4854c0ea-1178-4582-90d6-487def186eda",
            "refuuid": "9eebe75a-e59d-4c52-8d2b-be5a8925ceae",
            "name": "PF-1760",
            "unii": "NBS61YGN42",
            "linking_id": "NBS61YGN42",
            "ref_pname": "PF-1760"
          }
        },
        {
          "uuid": "cceef250-66e0-42a5-b30d-897d4901f41e",
          "amount": {
            "uuid": "1de0bf9d-de19-4cf5-ae95-b2ff31665d7e",
            "units": "%",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "da123f4c-f0de-454d-9cff-6b5ab57fe317",
            "479098ad-e6a9-49b4-85dd-968809b9ec4d"
          ],
          "related_substance": {
            "uuid": "4604a911-a865-438e-9840-54d7e6cbc2ab",
            "refuuid": "9047ff5b-fbd2-4ef4-b185-e5a30ea67a2a",
            "name": "3-AMINO-4-PHENOXY-5-SULFAMOYLBENZOIC ACID",
            "unii": "9D69CZ7VGU",
            "linking_id": "9D69CZ7VGU",
            "ref_pname": "3-AMINO-4-PHENOXY-5-SULFAMOYLBENZOIC ACID"
          }
        },
        {
          "uuid": "0bae5600-bdc9-44ac-b753-87008a3bccec",
          "amount": {
            "uuid": "1a1ed431-f06d-424b-82f1-fe84d6567df4"
          },
          "type": "DERIVATIVE->PARENT",
          "references": [
            "0431c2d8-cb8f-4eeb-a3ab-1fe869e638e2"
          ],
          "related_substance": {
            "uuid": "bf2d2a0c-0b22-411c-94f6-a2498730fe33",
            "refuuid": "9eebe75a-e59d-4c52-8d2b-be5a8925ceae",
            "name": "PF-1760",
            "unii": "NBS61YGN42",
            "linking_id": "NBS61YGN42",
            "ref_pname": "PF-1760"
          }
        },
        {
          "uuid": "85c44c1c-3c66-4020-8919-075ba824aaf9",
          "amount": {
            "uuid": "3ef98714-f379-4859-b00f-51fbc74fb577"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "28a67bd9-71a6-421e-ae23-016e11a098b9"
          ],
          "related_substance": {
            "uuid": "c2ede299-71fa-40d3-be2a-15b17aa6911f",
            "refuuid": "306fa9bb-0989-4936-a0c0-227e98bfdda9",
            "name": "BUMETANIDE SODIUM",
            "unii": "1QC8KM52D1",
            "linking_id": "1QC8KM52D1",
            "ref_pname": "BUMETANIDE SODIUM"
          }
        },
        {
          "uuid": "db08e8b4-233a-4634-a5c0-ca212fa770b6",
          "amount": {
            "uuid": "e3b92b1d-7ae7-48db-b386-a9b70c9fbeba",
            "average": 1,
            "units": "mg",
            "non_numeric_value": "Relative to 40 mg of Furosemide"
          },
          "qualification": "POTENCY",
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "95c0433d-ce6a-4eb0-b9cf-c7d7fb5b3f81",
            "refuuid": "7a222f8d-da94-494e-a8de-9526848be425",
            "name": "SOLUTE CARRIER FAMILY 12 MEMBER 1",
            "unii": "0T7E9VPM81",
            "linking_id": "0T7E9VPM81",
            "ref_pname": "SOLUTE CARRIER FAMILY 12 MEMBER 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c6e0a9d-c364-4847-90e2-0e3a02a72d19",
          "amount": {
            "uuid": "b6111480-fba6-4a4b-995d-02211d496bb8",
            "type": "MOLE PERCENT",
            "units": "%",
            "high_limit": 0.1,
            "non_numeric_value": "PEAK AREA"
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "3b807429-1c1a-4806-95a9-4897ba1667fc"
          ],
          "related_substance": {
            "uuid": "ec220af1-5982-46a6-a0c9-90dd60a4ce38",
            "refuuid": "e9ee3ebf-c7d6-4013-8ddc-86ec84092f7c",
            "name": "3-((2-Ethylhexyl)amino)-4-phenoxy-5-sulfamoylbenzoic acid",
            "unii": "Q57DG6WQJ6",
            "linking_id": "Q57DG6WQJ6",
            "ref_pname": "3-((2-Ethylhexyl)amino)-4-phenoxy-5-sulfamoylbenzoic acid"
          }
        }
      ],
      "names": [
        {
          "uuid": "0362e9e3-e0c3-433e-b119-26cbb14ca394",
          "name": "3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid",
          "stdName": "3-(BUTYLAMINO)-4-PHENOXY-5-SULFAMOYLBENZOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a98ee26c-96d1-42ec-bbd6-3019c7373d37"
          ],
          "display_name": false
        },
        {
          "uuid": "68f1e8a2-6878-4028-8da4-c64d0ab0f0d6",
          "name": "Benzoic acid, 3-(aminosulfonyl)-5-(butylamino)-4-phenoxy-",
          "stdName": "BENZOIC ACID, 3-(AMINOSULFONYL)-5-(BUTYLAMINO)-4-PHENOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a98ee26c-96d1-42ec-bbd6-3019c7373d37"
          ],
          "display_name": false
        },
        {
          "uuid": "3de045b4-6807-4590-a298-7a8452190617",
          "name": "Bumetanide",
          "stdName": "BUMETANIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46386260-31b9-46b6-8fde-dbcc64a46a6c",
            "1cb9d4b1-d9e4-457b-b487-5422ba0d702f",
            "8defa307-3534-4c0c-84f9-5074074ce82b",
            "3384628b-77b6-4dfd-ac83-0a5fc834bdcf",
            "f729e444-06e5-4cd3-91cc-f9bf94096bc4",
            "b7188269-ccda-4200-a911-ded9181403cc",
            "2bddef3b-a585-4c44-8596-e83469b0674c",
            "b5950563-976b-4e21-a2d6-808ec9a16c1e",
            "13c5f790-2f96-4524-8f6d-25725cdb1675",
            "43ab6b9c-a9e7-46ed-ad1b-e42b35ebcbb3",
            "55081371-2afd-4b49-9b0e-68d9e5aeb7ec",
            "f8ea6822-d2fe-4d3c-bd7d-e2a0c5a0d72b",
            "2024d0a6-9704-4582-a163-04388f84b141",
            "c36de002-4fcb-4fd3-a5cd-c679a53f289f",
            "e0a1c216-9caa-4035-b431-fefb09901cfd",
            "5944577d-3441-40e7-806b-eadab89faf38",
            "5da72fc4-027e-449d-b3fd-40ca3d408ab0",
            "56986866-67b8-4db5-87f1-065ada625324",
            "a6c0da73-b425-433d-9148-7e5207578dbf",
            "9d341e57-63d2-42d2-9541-afae59fa82f0",
            "869201df-16d0-44ed-a601-afed7abcfea8"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "93a8756c-940a-4947-949b-fb2b549575f4",
              "name_org": "INN"
            },
            {
              "uuid": "a9891e26-b7ed-4ac6-83f0-da4cd41460d2",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "74189a30-956d-21f5-9e55-685aaa557263",
          "name": "Bumetanide [EP IMPURITY]",
          "stdName": "BUMETANIDE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2bddef3b-a585-4c44-8596-e83469b0674c"
          ],
          "display_name": false
        },
        {
          "uuid": "3276ec86-d92a-66ff-bff2-d4bbebd10d6c",
          "name": "Bumetanide [EP MONOGRAPH]",
          "stdName": "BUMETANIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00dde09c-0516-d265-3bdc-19a8f2c2b862"
          ],
          "display_name": false
        },
        {
          "uuid": "b3f7e43f-0d18-4dc3-a81e-d4eb4e5f9e2b",
          "name": "Bumetanide [INN]",
          "stdName": "BUMETANIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8defa307-3534-4c0c-84f9-5074074ce82b"
          ],
          "display_name": false
        },
        {
          "uuid": "fe3069f6-c012-4f14-92c0-270a7460c5cf",
          "name": "Bumetanide [JAN]",
          "stdName": "BUMETANIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5895774-d259-ac58-cf99-1c2fded99065"
          ],
          "display_name": false
        },
        {
          "uuid": "fa54b020-4115-426c-a764-aa2e78a126c9",
          "name": "Bumetanide [MART.]",
          "stdName": "BUMETANIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0a1c216-9caa-4035-b431-fefb09901cfd"
          ],
          "display_name": false
        },
        {
          "uuid": "134a6cc2-e9f4-4fc9-8281-4ec7e8e7b9ce",
          "name": "Bumetanide [MI]",
          "stdName": "BUMETANIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5944577d-3441-40e7-806b-eadab89faf38"
          ],
          "display_name": false
        },
        {
          "uuid": "61c61da7-51c5-4f11-8111-9e2e1c65360f",
          "name": "Bumetanide [ORANGE BOOK]",
          "stdName": "BUMETANIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56986866-67b8-4db5-87f1-065ada625324"
          ],
          "display_name": false
        },
        {
          "uuid": "735c9191-7cce-436a-81a9-e92ba8711a92",
          "name": "Bumetanide [USAN]",
          "stdName": "BUMETANIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d341e57-63d2-42d2-9541-afae59fa82f0"
          ],
          "display_name": false
        },
        {
          "uuid": "fc2922d6-5f87-7ebf-fdc0-ba256852853a",
          "name": "Bumetanide [USP MONOGRAPH]",
          "stdName": "BUMETANIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "926300ae-5237-dca6-32f9-d226d42d20f6"
          ],
          "display_name": false
        },
        {
          "uuid": "567d061f-d848-4f31-9de7-45674f37217b",
          "name": "Bumetanide [USP-RS]",
          "stdName": "BUMETANIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "869201df-16d0-44ed-a601-afed7abcfea8"
          ],
          "display_name": false
        },
        {
          "uuid": "40d05761-455a-4a0a-b096-10f19c7b5e42",
          "name": "Bumetanide [VANDF]",
          "stdName": "BUMETANIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cb9d4b1-d9e4-457b-b487-5422ba0d702f"
          ],
          "display_name": false
        },
        {
          "uuid": "95c8b8e7-e755-bea0-dbce-1f900987da55",
          "name": "Bumetanide [WHO-DD]",
          "stdName": "BUMETANIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "826a3dad-e5b0-67bc-f8cc-464ae02630b3"
          ],
          "display_name": false
        },
        {
          "uuid": "8de527a2-81ae-4fc3-854e-7942de32a418",
          "name": "Bumex",
          "stdName": "BUMEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a98ee26c-96d1-42ec-bbd6-3019c7373d37"
          ],
          "display_name": false
        },
        {
          "uuid": "857298ee-7dee-42e5-883b-70f82de4c4c0",
          "name": "PF-1593",
          "stdName": "PF-1593",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28a67bd9-71a6-421e-ae23-016e11a098b9"
          ],
          "display_name": false
        },
        {
          "uuid": "ce5a193d-05cc-4751-827d-98b359df2eb1",
          "name": "PF1593",
          "stdName": "PF1593",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76bc6d8a-722b-4dd8-a78a-56edd56c90e2"
          ],
          "display_name": false
        },
        {
          "uuid": "497c2696-b027-4bed-b465-d0b27eb5c90a",
          "name": "RO-10-6338",
          "stdName": "RO-10-6338",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8ab34f2-260b-4df7-8dc4-139ab6450756"
          ],
          "display_name": false
        },
        {
          "uuid": "865fafc8-64bb-482b-b8c1-5656951db537",
          "name": "RO-106338",
          "stdName": "RO-106338",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50bd1165-6cda-416d-bc10-38da911541f0"
          ],
          "display_name": false
        },
        {
          "uuid": "3e749e4c-0a97-4c64-adf3-0a19337c3092",
          "name": "RO10-6338",
          "stdName": "RO10-6338",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a98ee26c-96d1-42ec-bbd6-3019c7373d37"
          ],
          "display_name": false
        },
        {
          "uuid": "548fa748-79c9-66a0-3bde-5e65400e7f71",
          "name": "S-95008.",
          "stdName": "S-95008.",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db060293-cfdb-6f9c-acba-d172c568ce2c"
          ],
          "display_name": false
        },
        {
          "uuid": "7a22278f-3c92-8d9d-ce23-82d67aacdb53",
          "name": "S95008.",
          "stdName": "S95008.",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db060293-cfdb-6f9c-acba-d172c568ce2c"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "e82d1678-e2c6-4a7c-9efe-590ea4c4a015",
          "name": "Biological Half-life",
          "value": {
            "uuid": "e257d881-c041-4920-96ca-92b2a61a89ea",
            "high": 1.5,
            "low": 1,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "25c6b903-9aeb-c98a-0787-0713533c0bf8"
          ]
        }
      ]
    }
  ]
}