{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f820f960-87a2-4bad-b90a-0edcf90ef13d",
          "code": "82199-12-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=82199-12-0",
          "code_system": "CAS",
          "references": [
            "3360e9e8-6fc6-47e9-a8e1-689f82e443b1",
            "a9616e8d-54a1-4c75-93d5-2492d7beea7c"
          ]
        },
        {
          "uuid": "dfac15fa-e1d0-4ef8-a5e2-1a3b8cba04f3",
          "code": "279-914-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.072.628",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3360e9e8-6fc6-47e9-a8e1-689f82e443b1"
          ]
        },
        {
          "uuid": "7a8c0cd4-c69d-49ee-a68f-957762e7db23",
          "code": "174265",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/174265",
          "code_system": "PUBCHEM",
          "references": [
            "3360e9e8-6fc6-47e9-a8e1-689f82e443b1"
          ]
        },
        {
          "uuid": "429c7591-842e-4569-9c4c-07b51223bdee",
          "code": "0XY8B09591",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4201df0f-38c0-0d37-aca3-c1fe254bd45e",
          "code": "DTXSID90868651",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90868651",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "49c26add-a991-4ae0-886b-c1f0c0515d9c",
          "name": "BUTANAMIDE, N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-2-(2-(2-METHOXYPHENYL)DIAZENYL)-3-OXO-",
          "stdName": "BUTANAMIDE, N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-2-(2-(2-METHOXYPHENYL)DIAZENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c861c70-2a9b-4aae-ab64-c8c3a4d0e14d",
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b"
          ],
          "display_name": false
        },
        {
          "uuid": "a0492832-b0eb-4dac-96b1-ef32338dafa4",
          "name": "C.I. 11785",
          "stdName": "C.I. 11785",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c861c70-2a9b-4aae-ab64-c8c3a4d0e14d",
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b"
          ],
          "display_name": false
        },
        {
          "uuid": "cd5fa918-b004-4dc0-b6e6-38275a418be9",
          "name": "C.I. PIGMENT YELLOW 194",
          "stdName": "C.I. PIGMENT YELLOW 194",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c861c70-2a9b-4aae-ab64-c8c3a4d0e14d",
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b"
          ],
          "display_name": false
        },
        {
          "uuid": "693e7968-1499-4062-a044-66316f28bcf5",
          "name": "CI 11785",
          "stdName": "CI 11785",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c861c70-2a9b-4aae-ab64-c8c3a4d0e14d",
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b"
          ],
          "display_name": false
        },
        {
          "uuid": "491f4cc4-20fc-4294-b5c5-a5fbfc95d180",
          "name": "CI PIGMENT YELLOW 194",
          "stdName": "CI PIGMENT YELLOW 194",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c861c70-2a9b-4aae-ab64-c8c3a4d0e14d",
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b"
          ],
          "display_name": false
        },
        {
          "uuid": "346394aa-e32d-4cef-aeda-ea9f59734297",
          "name": "CI PIGMENT YELLOW 194, (±)-",
          "stdName": "CI PIGMENT YELLOW 194, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b",
            "52885482-a0b1-413d-b665-ca58686d2c76"
          ],
          "display_name": false
        },
        {
          "uuid": "061cc31b-e4cf-4c3a-939e-723c82a1c4fd",
          "name": "N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-2-(2-(2-METHOXYPHENYL)DIAZENYL)-3-OXOBUTANAMIDE",
          "stdName": "N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-2-(2-(2-METHOXYPHENYL)DIAZENYL)-3-OXOBUTANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c861c70-2a9b-4aae-ab64-c8c3a4d0e14d",
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b"
          ],
          "display_name": false
        },
        {
          "uuid": "0c0c0eed-8601-41cd-b1ee-85cf63d28a75",
          "name": "NOVOPERM YELLOW F 2G",
          "stdName": "NOVOPERM YELLOW F 2G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c861c70-2a9b-4aae-ab64-c8c3a4d0e14d",
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b"
          ],
          "display_name": false
        },
        {
          "uuid": "84e5e8bc-a994-4451-832a-ffd003cb5d98",
          "name": "PIGMENT YELLOW 194",
          "stdName": "PIGMENT YELLOW 194",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a1f179f-14f7-4d42-9a1a-adf6383ef80b",
            "1c60427a-e7e4-4ddb-894d-c4668f956c48"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "3c861c70-2a9b-4aae-ab64-c8c3a4d0e14d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3a1f179f-14f7-4d42-9a1a-adf6383ef80b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52885482-a0b1-413d-b665-ca58686d2c76",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c60427a-e7e4-4ddb-894d-c4668f956c48",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3360e9e8-6fc6-47e9-a8e1-689f82e443b1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392079000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01a854b7-9921-4c51-bfb0-a033318885e6",
          "citation": "SRS import [0XY8B09591]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0XY8B09591",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392079000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9616e8d-54a1-4c75-93d5-2492d7beea7c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "60da33bb-2a0d-4429-aea1-fd97c628a4b4",
          "id": "60da33bb-2a0d-4429-aea1-fd97c628a4b4",
          "molfile": "\n  Marvin  01132105012D          \n\n 27 29  0  0  0  0            999 V2000\n    2.8940   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4829   -3.5763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6525   -3.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2414   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4111   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4111   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2414   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6525   -2.1458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4829   -2.1458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8940   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.4829   -0.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6525   -0.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8940    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7161   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1354   -0.7153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1354   -2.1458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -2.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3686   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1990   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6101   -2.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4158   -2.3185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5062   -3.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2215   -3.5517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7498   -3.4777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1990   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3686   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 15 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 27 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 26 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)C(C(=O)Nc1ccc2c(c1)[nH]c(=O)[nH]2)/N=N/c3ccccc3OC",
          "formula": "C18H17N5O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dc50202c-b344-481d-8988-3d0189101a31"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "367.3594",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cfca9e48-b847-4272-ab68-b2eb3692e5e2",
      "version": "3",
      "structure": {
        "id": "b0a8f791-7270-4dcb-9b06-aed303e26c47",
        "molfile": "\n  Marvin  01132109092D          \n\n 27 29  0  0  0  0            999 V2000\n    3.7161   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8940   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4829   -0.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6525   -0.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1354   -0.7153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1354   -2.1458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8940    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4829   -2.1458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6525   -2.1458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2414   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6525   -3.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2414   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4111   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4111   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4829   -3.5763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8940   -4.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5062   -3.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7498   -3.4777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1990   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6101   -2.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4158   -2.3185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3686   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9575   -2.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3686   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1990   -1.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2215   -3.5517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  7  2  0  0  0  0\n  6 24  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 12  2  0  0  0  0\n 11 16  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 22  1  0  0  0  0\n 18 27  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 23  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)C(C(=O)Nc1ccc2c(c1)[nH]c(=O)[nH]2)/N=N/c3ccccc3OC",
        "formula": "C18H17N5O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "367.3594",
        "optical_activity": "( + / - )",
        "references": [
          "01a854b7-9921-4c51-bfb0-a033318885e6",
          "1c60427a-e7e4-4ddb-894d-c4668f956c48"
        ],
        "stereo_centers": 1
      },
      "unii": "0XY8B09591"
    }
  ]
}