{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "25064331-0e18-4340-9e31-26242e6e5577",
          "code": "17590-01-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17590-01-1",
          "code_system": "CAS",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0",
            "d0795a1e-4dc5-427c-bb11-ec020898b6bb"
          ]
        },
        {
          "uuid": "adbb7ad1-d8e5-4199-a33b-155896f55dcf",
          "code": "C74237",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74237",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "76066239-6e7e-4902-b7b9-dd0789755d22",
          "code": "AMPHETAMINIL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Amphetaminil",
          "code_system": "WIKIPEDIA",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "918b4277-79de-4dbc-804a-dbd0154a1f13",
          "code": "SUB05419MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "b4ee3935-0d46-4768-acdd-65ec88a8df16",
          "code": "4471",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4471",
          "code_system": "INN",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "19519e7e-6435-478a-bbf1-6e0cc1b62258",
          "code": "241-560-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.767",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "3c273286-aaf0-4713-bcdf-afe898c33971",
          "code": "17813",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/17813/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "193d49ea-3580-4811-bbed-951c16428abe",
          "code": "m1850",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1850?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "c178d314-5a16-4bda-954a-07388fd3ae61",
          "code": "CHEMBL2104064",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104064",
          "code_system": "ChEMBL",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "4f096961-7a16-45da-994e-eac603798a98",
          "code": "28615",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28615",
          "code_system": "PUBCHEM",
          "references": [
            "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0"
          ]
        },
        {
          "uuid": "75a796ea-c66a-543c-57a3-82a0f50662f1",
          "code": "C47795",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|CNS Stimulant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cf2358cd-e22d-f5f7-f7b2-536b5f7649fc"
          ]
        },
        {
          "uuid": "eb0c395a-d8ad-4832-94ce-a5c7bbdf839e",
          "code": "0XU0V77JVE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e8f91a6a-b353-9681-274f-2ee135304210",
          "code": "196",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/196",
          "code_system": "DRUG CENTRAL",
          "references": [
            "cf2358cd-e22d-f5f7-f7b2-536b5f7649fc"
          ]
        },
        {
          "uuid": "e228a32d-0e36-fe1e-4ca5-812e6ff2e5b6",
          "code": "DTXSID80864783",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80864783",
          "code_system": "EPA CompTox",
          "references": [
            "cf2358cd-e22d-f5f7-f7b2-536b5f7649fc"
          ]
        },
        {
          "uuid": "48e566a9-c864-b7f7-59ae-6231657f2112",
          "code": "67172",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=67172",
          "code_system": "NSC",
          "references": [
            "94c3d808-9abd-bcee-7ee7-06956cfd0470"
          ]
        },
        {
          "uuid": "1e523571-4ce5-bb6d-c852-e49196c65407",
          "code": "100000087198",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a2feb3e3-47ba-585e-704d-7a5cc1842e26"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b4ad7f17-c6e7-4d37-81a7-55ddf3879ea8",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8f4a5290-cc63-41ab-a66a-0fce3a9b0649",
            "refuuid": "85d1fd3a-d0dc-4e54-ae41-7c7119a7a521",
            "name": "AMFETAMINIL",
            "unii": "0XU0V77JVE",
            "linking_id": "0XU0V77JVE",
            "ref_pname": "AMFETAMINIL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9648f042-66e1-46ed-8e2f-055c36963699",
          "name": "AMFETAMINIL",
          "stdName": "AMFETAMINIL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23baf304-111a-4c6b-8426-2b44999d0bfd",
            "8c0f9439-2e15-444e-bf29-a4f1a5b449c0",
            "68583217-1104-46f7-91af-5f526e8f8bba",
            "c6a194cf-3da2-4041-9ad3-50ed7db1e29d",
            "9ec94ee9-3015-400e-a5b0-5b76fe119ace",
            "71c234e1-acae-45e9-baea-21153bc41abb",
            "88a47e2f-76b2-40c0-b79e-fb66938b7d93",
            "ddcd4a4e-3d85-4560-b5c1-d00617249886"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ade6d174-edf5-4611-bb8f-470fbdfbca44",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3600ffe4-690a-4664-b143-3d947e974c3b",
          "name": "AMFETAMINIL [MART.]",
          "stdName": "AMFETAMINIL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88a47e2f-76b2-40c0-b79e-fb66938b7d93"
          ],
          "display_name": false
        },
        {
          "uuid": "3898a0aa-08be-4619-b675-0a4d8fcb5025",
          "name": "AMPHETAMINIL",
          "stdName": "AMPHETAMINIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "296e9bb8-f54f-46b4-8081-23ee749437ba",
            "cf33c53f-068c-40a9-916b-5084773520d7",
            "71c234e1-acae-45e9-baea-21153bc41abb",
            "2f740f24-1bae-4515-b0b8-2895250ddd4d"
          ],
          "display_name": false
        },
        {
          "uuid": "49041fbe-6968-41f0-b24a-18f330c4f4c9",
          "name": "AMPHETAMINIL [MI]",
          "stdName": "AMPHETAMINIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71c234e1-acae-45e9-baea-21153bc41abb",
            "2f740f24-1bae-4515-b0b8-2895250ddd4d"
          ],
          "display_name": false
        },
        {
          "uuid": "87af2406-cc5a-44b4-a27d-c4afd9847e22",
          "name": "AN 1",
          "stdName": "AN 1",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "030c1fea-30c4-45d5-9559-b71fd67f980f",
            "a274a142-6d88-4760-8822-f93bf2238267"
          ],
          "display_name": false
        },
        {
          "uuid": "5742d7b3-9b36-72db-f99e-5ec8657882a1",
          "name": "Amfetaminil [WHO-DD]",
          "stdName": "AMFETAMINIL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97ca2779-4c75-8ecc-d476-3ff697c49c72"
          ],
          "display_name": false
        },
        {
          "uuid": "efc4c84a-23e1-40ae-9676-581e9abcd76d",
          "name": "NSC-67172",
          "stdName": "NSC-67172",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64951af4-f320-4888-bf42-5c1bb7b78211",
            "71c234e1-acae-45e9-baea-21153bc41abb"
          ],
          "display_name": false
        },
        {
          "uuid": "1f656255-12c9-42b7-b15d-1276f2e089d9",
          "name": "amfetaminil [INN]",
          "stdName": "AMFETAMINIL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6a194cf-3da2-4041-9ad3-50ed7db1e29d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "23baf304-111a-4c6b-8426-2b44999d0bfd",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c6a194cf-3da2-4041-9ad3-50ed7db1e29d",
          "citation": "INN Proposed List 40",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL40.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "88a47e2f-76b2-40c0-b79e-fb66938b7d93",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f740f24-1bae-4515-b0b8-2895250ddd4d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71c234e1-acae-45e9-baea-21153bc41abb",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "030c1fea-30c4-45d5-9559-b71fd67f980f",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a274a142-6d88-4760-8822-f93bf2238267",
          "citation": "D07446",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf33c53f-068c-40a9-916b-5084773520d7",
          "citation": "rxnorm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c0f9439-2e15-444e-bf29-a4f1a5b449c0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64951af4-f320-4888-bf42-5c1bb7b78211",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4448a0d4-d0b0-4fd8-ae86-67ec324b2be0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9082a4a3-03e3-45e9-b56a-37051f29fb56",
          "citation": "SRS import [0XU0V77JVE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0XU0V77JVE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390758000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b3d6ba7-6750-44f1-9eeb-788ddf2e99d5",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddcd4a4e-3d85-4560-b5c1-d00617249886",
          "citation": "AMFETAMINIL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ec94ee9-3015-400e-a5b0-5b76fe119ace",
          "citation": "AMFETAMINIL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "296e9bb8-f54f-46b4-8081-23ee749437ba",
          "citation": "AMPHETAMINIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "68583217-1104-46f7-91af-5f526e8f8bba",
          "citation": "AMFETAMINIL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a2feb3e3-47ba-585e-704d-7a5cc1842e26",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "cf2358cd-e22d-f5f7-f7b2-536b5f7649fc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d0795a1e-4dc5-427c-bb11-ec020898b6bb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "94c3d808-9abd-bcee-7ee7-06956cfd0470",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "97ca2779-4c75-8ecc-d476-3ff697c49c72",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "143e2b95-dc78-407f-9e4a-d2cb380af31c",
          "id": "143e2b95-dc78-407f-9e4a-d2cb380af31c",
          "molfile": "\n  Marvin  01132101152D          \n\n 19 20  0  0  0  0            999 V2000\n    3.0026    0.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0285   -0.5060    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.7543   -0.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4618   -0.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4775    0.2899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1811    0.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8821    0.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8825   -0.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1789   -0.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3254   -0.9194    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6126   -0.5094    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.8958   -0.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1789   -1.3319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6278    0.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3333    0.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3352    1.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6210    1.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9155    1.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9128    0.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 11  1  0  0  0  0\n 12 13  3  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1ccccc1)NC(C#N)c2ccccc2",
          "formula": "C17H18N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4b2d523a-451e-4fa4-86c0-8d2fe6d7cef2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "250.3389",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "85d1fd3a-d0dc-4e54-ae41-7c7119a7a521",
      "version": "12",
      "structure": {
        "id": "000549c4-7e79-45f4-aea7-1a5bf27b2e6e",
        "molfile": "\n  Marvin  01132100192D          \n\n 19 20  0  0  0  0            999 V2000\n    1.6278    0.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6126   -0.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3333    0.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9128    0.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3254   -0.9194    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8958   -0.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3352    1.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9155    1.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0285   -0.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1789   -1.3319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6210    1.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7543   -0.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0026    0.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4618   -0.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4775    0.2899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1789   -0.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1811    0.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8825   -0.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8821    0.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  3  0  0  0  0\n  7 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 15 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n  8 11  1  0  0  0  0\n 18 19  2  0  0  0  0\nM  END",
        "smiles": "CC(Cc1ccccc1)NC(C#N)c2ccccc2",
        "formula": "C17H18N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "UNKNOWN",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "250.3389",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8b3d6ba7-6750-44f1-9eeb-788ddf2e99d5",
          "9082a4a3-03e3-45e9-b56a-37051f29fb56",
          "c6a194cf-3da2-4041-9ad3-50ed7db1e29d"
        ],
        "stereo_centers": 2
      },
      "unii": "0XU0V77JVE"
    }
  ]
}