{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a6224d51-1f75-46b0-8cb1-5a9cfe432ba4",
          "code": "584-79-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=584-79-2",
          "code_system": "CAS",
          "references": [
            "7cf60572-2ac1-49d6-9663-9c5fe1fc5722",
            "52183e55-be61-4908-b809-b8d49aff7266"
          ]
        },
        {
          "uuid": "a93afcd2-d3d4-4bac-81f1-f0dab3edf632",
          "code": "D000487",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68000487",
          "code_system": "MESH",
          "references": [
            "7cf60572-2ac1-49d6-9663-9c5fe1fc5722"
          ]
        },
        {
          "uuid": "9d9d10a1-13c8-443a-a814-c628c92025c3",
          "code": "209-542-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.677",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7cf60572-2ac1-49d6-9663-9c5fe1fc5722"
          ]
        },
        {
          "uuid": "3a1773dc-9978-4c8f-ba72-3ef1dbc1aea0",
          "code": "513",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/513/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7cf60572-2ac1-49d6-9663-9c5fe1fc5722"
          ]
        },
        {
          "uuid": "3d0e2393-046c-4953-a4ea-6c1d88a5756c",
          "code": "m1522",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1522?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7cf60572-2ac1-49d6-9663-9c5fe1fc5722"
          ]
        },
        {
          "uuid": "2020fbca-e934-4d5c-aa4d-465a36092540",
          "code": "SUB12789MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7cf60572-2ac1-49d6-9663-9c5fe1fc5722"
          ]
        },
        {
          "uuid": "642791f7-b940-afa0-9966-545a34651505",
          "code": "11442",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11442",
          "code_system": "PUBCHEM",
          "references": [
            "8ae346a4-9795-6a7b-ceec-c14b844ad44a"
          ]
        },
        {
          "uuid": "03b933dc-e1d0-b1f6-a4d2-ffebb30afc64",
          "code": "34572",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34572",
          "code_system": "CHEBI",
          "references": [
            "d78728ea-1b1a-0b68-dcef-69be96d85d5a"
          ]
        },
        {
          "uuid": "186bacb7-6b78-1179-aef2-73988b5ae049",
          "code": "39118",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39118",
          "code_system": "CHEBI",
          "references": [
            "d78728ea-1b1a-0b68-dcef-69be96d85d5a"
          ]
        },
        {
          "uuid": "674dc829-4511-4e5d-827f-93bcb33c931d",
          "code": "0X03II877M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0322a796-7217-702b-93d1-0f95689fde3b",
          "code": "100000077999",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c0fb3161-006a-e7d7-683e-2a38034b9bd5"
          ]
        },
        {
          "uuid": "cfb33c0c-9b1d-e74c-a660-8a3a646dad33",
          "code": "allethrin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/allethrin.html",
          "code_system": "ALANWOOD",
          "references": [
            "1136c322-78f1-22b5-3128-778c8ff5822e"
          ]
        },
        {
          "uuid": "3cbcef82-bd42-02d7-a2fb-1d4e9df4e1cf",
          "code": "DTXSID8035180",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8035180",
          "code_system": "EPA CompTox",
          "references": [
            "370d82aa-b5a9-28eb-b9ed-ed046e9dc5f8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c3a9e780-fa08-4ac7-b3a5-b24dc1c407cc",
          "name": "2,2-DIMETHYL-3-(2-METHYL-1-PROPENYL)CYCLOPROPANECARBOXYLIC ACID 2-METHYL-4-OXO-3-(2-PROPENYL)-2-CYCLOPENTEN-1-YL ESTER",
          "stdName": "2,2-DIMETHYL-3-(2-METHYL-1-PROPENYL)CYCLOPROPANECARBOXYLIC ACID 2-METHYL-4-OXO-3-(2-PROPENYL)-2-CYCLOPENTEN-1-YL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb56eab5-420e-4b7c-b457-baf7ba87ab67",
            "2a1ab2e5-19cf-43a5-9586-20bd0050d3bb"
          ],
          "display_name": false
        },
        {
          "uuid": "def4a873-8a37-4cd5-8c93-d693d9b470a2",
          "name": "ALLETHRIN",
          "stdName": "ALLETHRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab66c412-e089-4ff6-bca3-8b0351c4c527",
            "aa019198-5c54-42da-ba36-af9f3705ca0e",
            "768ca0b6-ea1c-4bc7-bd04-2908ee68ab61",
            "bb56eab5-420e-4b7c-b457-baf7ba87ab67",
            "0362a25e-6df8-4cec-8243-9dac73cd1a99"
          ],
          "display_name": true
        },
        {
          "uuid": "8bc399ff-48df-46aa-8553-dfd6c1b7eb6f",
          "name": "ALLETHRIN I",
          "stdName": "ALLETHRIN I",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb56eab5-420e-4b7c-b457-baf7ba87ab67",
            "be508fd5-5669-4ed8-9f46-ab8d9650305e",
            "2a1ab2e5-19cf-43a5-9586-20bd0050d3bb"
          ],
          "display_name": false
        },
        {
          "uuid": "ecd04c10-aa8a-4855-8902-19c673edba70",
          "name": "ALLETHRIN I [MI]",
          "stdName": "ALLETHRIN I [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb56eab5-420e-4b7c-b457-baf7ba87ab67",
            "2a1ab2e5-19cf-43a5-9586-20bd0050d3bb"
          ],
          "display_name": false
        },
        {
          "uuid": "6f15e4a8-79fc-4e60-a128-6bfae49ab869",
          "name": "ALLETHRIN [HSDB]",
          "stdName": "ALLETHRIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab66c412-e089-4ff6-bca3-8b0351c4c527",
            "bb56eab5-420e-4b7c-b457-baf7ba87ab67"
          ],
          "display_name": false
        },
        {
          "uuid": "2d28635d-4148-43ea-809d-8eed5cd01ee1",
          "name": "ALLETHROLONE ESTER OF CHRYSANTHEMUMMONOCARBOXYLIC ACID",
          "stdName": "ALLETHROLONE ESTER OF CHRYSANTHEMUMMONOCARBOXYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb56eab5-420e-4b7c-b457-baf7ba87ab67",
            "2a1ab2e5-19cf-43a5-9586-20bd0050d3bb"
          ],
          "display_name": false
        },
        {
          "uuid": "41c455bd-1f05-4e44-9323-dfc24ba97b42",
          "name": "CYCLOPROPANECARBOXYLIC ACID, 2,2-DIMETHYL-3-(2-METHYLPROPENYL)-, ESTER WITH 2-ALLYL-4-HYDROXY-3-METHYL-2-CYCLOPENTEN-1-ONE",
          "stdName": "CYCLOPROPANECARBOXYLIC ACID, 2,2-DIMETHYL-3-(2-METHYLPROPENYL)-, ESTER WITH 2-ALLYL-4-HYDROXY-3-METHYL-2-CYCLOPENTEN-1-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "345970a5-8048-457e-be22-40b3fe94e3b1",
            "bb56eab5-420e-4b7c-b457-baf7ba87ab67"
          ],
          "display_name": false
        },
        {
          "uuid": "8c72857d-d3cb-47ad-a021-95d8bae0db02",
          "name": "PYNAMIN",
          "stdName": "PYNAMIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb56eab5-420e-4b7c-b457-baf7ba87ab67",
            "2a1ab2e5-19cf-43a5-9586-20bd0050d3bb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "768ca0b6-ea1c-4bc7-bd04-2908ee68ab61",
          "citation": "ALANWOOD 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0362a25e-6df8-4cec-8243-9dac73cd1a99",
          "citation": "ALANWOOD.net",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "345970a5-8048-457e-be22-40b3fe94e3b1",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb56eab5-420e-4b7c-b457-baf7ba87ab67",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a1ab2e5-19cf-43a5-9586-20bd0050d3bb",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab66c412-e089-4ff6-bca3-8b0351c4c527",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cf60572-2ac1-49d6-9663-9c5fe1fc5722",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390968000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08b34819-33a6-4bc8-a608-cea2e7baa713",
          "citation": "SRS import [0X03II877M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0X03II877M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390968000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa019198-5c54-42da-ba36-af9f3705ca0e",
          "citation": "ALLETHRIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "be508fd5-5669-4ed8-9f46-ab8d9650305e",
          "citation": "ALLETHRIN I [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0fb3161-006a-e7d7-683e-2a38034b9bd5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8ae346a4-9795-6a7b-ceec-c14b844ad44a",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "52183e55-be61-4908-b809-b8d49aff7266",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1136c322-78f1-22b5-3128-778c8ff5822e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d78728ea-1b1a-0b68-dcef-69be96d85d5a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "370d82aa-b5a9-28eb-b9ed-ed046e9dc5f8",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ef999bad-f605-4946-b34b-2712e907e225",
          "id": "ef999bad-f605-4946-b34b-2712e907e225",
          "molfile": "\n  Marvin  01132112252D          \n\n 22 23  0  0  0  0            999 V2000\n    7.3537   -4.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -3.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1162   -3.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3537   -2.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -1.9382    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.2267   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.4018   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9893   -0.8113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9893   -2.2402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1642   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.6793   -1.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8947   -1.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2272   -1.3428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8947   -2.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2272   -3.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4736   -2.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8062   -3.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6793   -2.9076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9342   -3.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -1.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7536   -0.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6591   -0.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 20  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 20  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 18 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 18 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 19 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\nM  END",
          "smiles": "C=CCC1=C(C)C(CC1=O)OC(=O)C2C(C=C(C)C)C2(C)C",
          "formula": "C19H26O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "68f6f66b-e6d1-4425-b26f-2a3f8194b605"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "302.4087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c7aa8b48-02b9-4ce6-9748-efd616b52c8c",
      "version": "9",
      "structure": {
        "id": "edbada73-8f1b-4d8d-b816-67ee7b303887",
        "molfile": "\n  Marvin  01132112182D          \n\n 22 23  0  0  0  0            999 V2000\n    0.8062   -3.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4736   -2.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2272   -3.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8947   -2.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6793   -2.9076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1642   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6793   -1.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8947   -1.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2272   -1.3428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9893   -2.2402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4018   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2267   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -1.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -1.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3537   -2.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -3.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3537   -4.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1162   -3.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7536   -0.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6591   -0.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9893   -0.8113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9342   -3.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  6 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20 13  1  0  0  0  0\n 11 21  2  0  0  0  0\n 22  5  1  0  0  0  0\nM  END",
        "smiles": "C=CCC1=C(C)C(CC1=O)OC(=O)C2C(C=C(C)C)C2(C)C",
        "formula": "C19H26O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "302.4087",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "768ca0b6-ea1c-4bc7-bd04-2908ee68ab61",
          "08b34819-33a6-4bc8-a608-cea2e7baa713"
        ],
        "stereo_centers": 3
      },
      "unii": "0X03II877M"
    }
  ]
}