{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a9121c76-5f68-40d8-8a86-7ee6b5eb457e",
          "code": "107667-60-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=107667-60-7",
          "code_system": "CAS",
          "references": [
            "bc3f9657-6ec3-48b1-a575-91a0d0179e30",
            "1efcf42a-e98c-48d6-a382-41bd9e094a51"
          ]
        },
        {
          "uuid": "a75fac76-9400-488b-8e70-ee6fc5bfd286",
          "code": "C061957",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67061957",
          "code_system": "MESH",
          "references": [
            "bc3f9657-6ec3-48b1-a575-91a0d0179e30"
          ]
        },
        {
          "uuid": "35e5d535-702e-4f9b-bffe-f0f480c4e4ce",
          "code": "6917",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6917",
          "code_system": "INN",
          "references": [
            "bc3f9657-6ec3-48b1-a575-91a0d0179e30"
          ]
        },
        {
          "uuid": "c5be07d2-84cc-459b-a297-6082ffb485ff",
          "code": "C118371",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C118371",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bc3f9657-6ec3-48b1-a575-91a0d0179e30"
          ]
        },
        {
          "uuid": "4b720ca0-ee07-4d4f-8abe-4a4c99a9df91",
          "code": "m8939",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8939?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bc3f9657-6ec3-48b1-a575-91a0d0179e30"
          ]
        },
        {
          "uuid": "6d2e78da-e156-4331-b374-a10610348b33",
          "code": "DB09221",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09221",
          "code_system": "DRUG BANK",
          "references": [
            "bc3f9657-6ec3-48b1-a575-91a0d0179e30"
          ]
        },
        {
          "uuid": "c06c64cd-5dcf-416f-995f-8cb7c96321e4",
          "code": "SUB09963MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bc3f9657-6ec3-48b1-a575-91a0d0179e30"
          ]
        },
        {
          "uuid": "b12ba5c7-c066-b935-bb85-25b2e83aef40",
          "code": "DTXSID7048615",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7048615",
          "code_system": "EPA CompTox",
          "references": [
            "fc75af34-1dd1-c467-82fc-fe661977f8c6"
          ]
        },
        {
          "uuid": "9aadd8e6-f035-ffdb-61f0-62b2919fd610",
          "code": "C26170",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C26170",
          "code_system": "NCI_THESAURUS",
          "references": [
            "08a9ba80-8f0b-b4d3-9983-fb05b119ea27"
          ]
        },
        {
          "uuid": "768d8f9f-c88e-72ac-6a19-030975816433",
          "code": "C29701",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Anti-ulcer Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29701",
          "code_system": "NCI_THESAURUS",
          "references": [
            "08a9ba80-8f0b-b4d3-9983-fb05b119ea27"
          ]
        },
        {
          "uuid": "2e50ec34-3682-42af-69b7-a8e2db80ed31",
          "code": "2179843",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2179843/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "807eeade-25f2-9af9-1481-b7fd3d0db796"
          ]
        },
        {
          "uuid": "25d30dc3-f758-4faf-b186-24bf0b25a55c",
          "code": "0WA1B15A1Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0f404ce8-cff9-fb61-c699-b17c88273c97",
          "code": "137 (Number of products:9660)",
          "comments": "Dietary Supplement Label Database|Mineral|Zinc",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=137&item=Zinc",
          "code_system": "DSLD",
          "references": [
            "08a9ba80-8f0b-b4d3-9983-fb05b119ea27"
          ]
        },
        {
          "uuid": "3ad4ca32-f277-63fc-9276-bb63487b9f08",
          "code": "9817450",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9817450",
          "code_system": "PUBCHEM",
          "references": [
            "1a8f996d-6b98-de23-951c-c4d29c026762"
          ]
        },
        {
          "uuid": "81d53480-bf65-7377-86ae-6797c1c996e2",
          "code": "4756",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4756",
          "code_system": "DRUG CENTRAL",
          "references": [
            "08a9ba80-8f0b-b4d3-9983-fb05b119ea27"
          ]
        },
        {
          "uuid": "f80ac9fe-9663-7fee-07df-d90bf7936cce",
          "code": "4102 (Number of products:4)",
          "comments": "Dietary Supplement Label Database|chemical|Zinc L-Carnosine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4102&item=Zinc L-Carnosine",
          "code_system": "DSLD",
          "references": [
            "08a9ba80-8f0b-b4d3-9983-fb05b119ea27"
          ]
        },
        {
          "uuid": "cf5befa3-f26d-b55f-ffeb-86cca594cc7a",
          "code": "0WA1B15A1Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0WA1B15A1Z",
          "code_system": "DAILYMED",
          "references": [
            "c69ac96f-4ce5-ebff-9e3d-b12d90e7c0cb"
          ]
        },
        {
          "uuid": "1c0dad95-b892-c0b7-92ee-c07ede93df4d",
          "code": "100000081935",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f9d7428e-6ea9-9e9e-1372-1705724e1bc8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "28a99c6b-e3d8-47c9-9cc8-b40fe31d900d",
          "name": ".BETA.-ALANYL-L-HISTIDINATO ZINC",
          "stdName": ".BETA.-ALANYL-L-HISTIDINATO ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "716dbd43-f6d4-4f70-8804-91a3a9aa147b"
          ],
          "display_name": false
        },
        {
          "uuid": "1222c9d1-5523-463c-933a-90d1db219029",
          "name": "L-HISTIDINE, N-.BETA.-ALANYL-, ZINC COMPLEX",
          "stdName": "L-HISTIDINE, N-.BETA.-ALANYL-, ZINC COMPLEX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "716dbd43-f6d4-4f70-8804-91a3a9aa147b"
          ],
          "display_name": false
        },
        {
          "uuid": "00ce4744-4a7a-4340-afba-2d48452ee465",
          "name": "POLAPREZINC",
          "stdName": "POLAPREZINC",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6db94f79-ad9a-49b0-8afa-38b8bd2a6372",
            "f6190b3e-63ba-4f64-bff2-d93f7f65ade3",
            "826d4d46-2005-4e50-871b-c641bb37e15f",
            "415764f0-f372-4394-8a85-437bfe893144",
            "db636e9b-9f6d-41a0-82ba-ba50154fdfdf",
            "32c31f2e-f34b-4e51-8b84-9a6cce18d64c",
            "09ce7d64-457a-4efc-bc33-10f424430417",
            "4bce030f-c0a0-4a48-b118-77523797f82d",
            "fc4da75d-259a-4119-a7ce-15fbd562df65",
            "e4ff62c0-422d-4293-9a5d-f8ed7ae87976",
            "74287b4a-0931-455e-8307-a2bb48b3e213"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "00a2f987-01ec-4fd1-b2b7-bda204494b24",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e7d9b963-9b48-4482-8a7b-59b117f93617",
          "name": "POLAPREZINC [JAN]",
          "stdName": "POLAPREZINC [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "826d4d46-2005-4e50-871b-c641bb37e15f",
            "415764f0-f372-4394-8a85-437bfe893144"
          ],
          "display_name": false
        },
        {
          "uuid": "2db10309-b287-48be-a64f-bc902bfa9241",
          "name": "POLAPREZINC [MART.]",
          "stdName": "POLAPREZINC [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "fc4da75d-259a-4119-a7ce-15fbd562df65"
          ],
          "display_name": false
        },
        {
          "uuid": "22160a99-1d7d-4170-a433-4e710d232d1b",
          "name": "POLAPREZINC [MI]",
          "stdName": "POLAPREZINC [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6db94f79-ad9a-49b0-8afa-38b8bd2a6372",
            "415764f0-f372-4394-8a85-437bfe893144"
          ],
          "display_name": false
        },
        {
          "uuid": "ae475a4e-356a-41dc-b046-cf61cd8f355b",
          "name": "PROMAC",
          "stdName": "PROMAC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "716dbd43-f6d4-4f70-8804-91a3a9aa147b"
          ],
          "display_name": false
        },
        {
          "uuid": "cfcaf90a-2641-f5c9-db3d-21d8128d5280",
          "name": "Polaprezinc [WHO-DD]",
          "stdName": "POLAPREZINC [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b948f51-3c41-a95e-6d7b-012617a31864"
          ],
          "display_name": false
        },
        {
          "uuid": "4dad7800-88e5-49d6-a0c2-4ec045f0d320",
          "name": "Z 103",
          "stdName": "Z 103",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "716dbd43-f6d4-4f70-8804-91a3a9aa147b"
          ],
          "display_name": false
        },
        {
          "uuid": "0c16b67f-36f6-40ef-91d3-4f8041d593c0",
          "name": "Z-103",
          "stdName": "Z-103",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ab95124-9bcf-4ed9-8ba4-d4295c7a43de",
            "415764f0-f372-4394-8a85-437bfe893144"
          ],
          "display_name": false
        },
        {
          "uuid": "b8571905-3a92-470a-8d20-041e1bd2fdeb",
          "name": "ZINC CARNOSINE",
          "stdName": "ZINC CARNOSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "420c38d4-12f8-4757-9e47-bbcf6d2df228"
          ],
          "display_name": false
        },
        {
          "uuid": "8d3f9a2b-2ce7-495f-968c-9cf78eec81af",
          "name": "ZINC L-CARNOSINE",
          "stdName": "ZINC L-CARNOSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "716dbd43-f6d4-4f70-8804-91a3a9aa147b"
          ],
          "display_name": false
        },
        {
          "uuid": "ab068f62-c9c8-4e49-87bc-238aff28d363",
          "name": "ZINC, (.BETA.-ALANYL-.KAPPA.N-L-HISTIDINATO(2-)-.KAPPA.N,.KAPPA.O)-",
          "stdName": "ZINC, (.BETA.-ALANYL-.KAPPA.N-L-HISTIDINATO(2-)-.KAPPA.N,.KAPPA.O)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "716dbd43-f6d4-4f70-8804-91a3a9aa147b"
          ],
          "display_name": false
        },
        {
          "uuid": "fbcd7ace-dbd8-45d4-b1db-89080a01ba0c",
          "name": "ZINC, (N-.BETA.-ALANYL-L-HISTIDINATO(2-)-N,NN,O.ALPHA.)-",
          "stdName": "ZINC, (N-.BETA.-ALANYL-L-HISTIDINATO(2-)-N,NN,O.ALPHA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "415764f0-f372-4394-8a85-437bfe893144",
            "716dbd43-f6d4-4f70-8804-91a3a9aa147b"
          ],
          "display_name": false
        },
        {
          "uuid": "9860b4c0-df2c-42e6-8104-fcb0655834be",
          "name": "polaprezinc [INN]",
          "stdName": "POLAPREZINC [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6190b3e-63ba-4f64-bff2-d93f7f65ade3",
            "415764f0-f372-4394-8a85-437bfe893144",
            "294c7e6c-6efb-49f1-a485-25a2c90a5091"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "826d4d46-2005-4e50-871b-c641bb37e15f",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "415764f0-f372-4394-8a85-437bfe893144",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "716dbd43-f6d4-4f70-8804-91a3a9aa147b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ab95124-9bcf-4ed9-8ba4-d4295c7a43de",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc4da75d-259a-4119-a7ce-15fbd562df65",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bce030f-c0a0-4a48-b118-77523797f82d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6190b3e-63ba-4f64-bff2-d93f7f65ade3",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6db94f79-ad9a-49b0-8afa-38b8bd2a6372",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "420c38d4-12f8-4757-9e47-bbcf6d2df228",
          "citation": "NCT00149149",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc3f9657-6ec3-48b1-a575-91a0d0179e30",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391867000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "876d1196-6051-4e36-8e65-718bc41ca062",
          "citation": "SRS import [0WA1B15A1Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0WA1B15A1Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391867000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09ce7d64-457a-4efc-bc33-10f424430417",
          "citation": "POLAPREZINC [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "32c31f2e-f34b-4e51-8b84-9a6cce18d64c",
          "citation": "POLAPREZINC [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db636e9b-9f6d-41a0-82ba-ba50154fdfdf",
          "citation": "POLAPREZINC [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e4ff62c0-422d-4293-9a5d-f8ed7ae87976",
          "citation": "POLAPREZINC [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74287b4a-0931-455e-8307-a2bb48b3e213",
          "citation": "POLAPREZINC [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fc75af34-1dd1-c467-82fc-fe661977f8c6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=107667-60-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f9d7428e-6ea9-9e9e-1372-1705724e1bc8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "08a9ba80-8f0b-b4d3-9983-fb05b119ea27",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1efcf42a-e98c-48d6-a382-41bd9e094a51",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "807eeade-25f2-9af9-1481-b7fd3d0db796",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "1a8f996d-6b98-de23-951c-c4d29c026762",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "294c7e6c-6efb-49f1-a485-25a2c90a5091",
          "citation": "INN Proposed List 66",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL66.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b948f51-3c41-a95e-6d7b-012617a31864",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c69ac96f-4ce5-ebff-9e3d-b12d90e7c0cb",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cd9a1f02-5bba-451b-a294-02366b15474c",
          "id": "cd9a1f02-5bba-451b-a294-02366b15474c",
          "molfile": "\n  Marvin  01132110372D          \n\n  1  0  0  0  1  0            999 V2000\n    6.0501   -6.0241    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d7dfb68a-c6e2-40d3-b70b-020d097b3638"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "660e08e9-fba0-4f26-ac74-d91b70b2c759",
          "id": "660e08e9-fba0-4f26-ac74-d91b70b2c759",
          "molfile": "\n  Marvin  01132105192D          \n\n 16 16  0  0  1  0            999 V2000\n    7.5708   -4.5156    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.5708   -3.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8492   -3.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1051   -3.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5549   -3.0137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -2.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7726   -2.4725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8627   -4.9259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1456   -4.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1456   -3.9473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4421   -4.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7296   -4.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0508   -5.1763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2923   -4.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1718   -4.5494    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.3150   -5.9317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  8  1  1  0  0  0\n 14  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  7  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\nM  CHG  1  15  -1\nM  END",
          "smiles": "C(CN)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)[O-]",
          "formula": "C9H13N4O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ec92e14f-043e-4f1a-98ca-96cb9c1c062a"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "225.2249",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3ffd49ee-c5be-4b1c-acaa-610d0420112c",
      "version": "17",
      "structure": {
        "id": "55b7b492-01a8-4b24-9e4d-39dfebb49fea",
        "molfile": "\n  Marvin  01132104272D          \n\n 17 16  0  0  1  0            999 V2000\n    5.5549   -3.0137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9608   -2.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7726   -2.4725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8492   -3.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1051   -3.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5708   -3.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5708   -4.5156    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2923   -4.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1718   -4.5494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3150   -5.9317    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.8627   -4.9259    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n    6.1456   -4.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4421   -4.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7296   -4.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0508   -5.1763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1456   -3.9473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0501   -6.0241    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  1  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 12  2  0  0  0  0\nM  CHG  3  10  -1  11  -1  17   2\nM  END",
        "smiles": "C(CN)C(=O)[N-][C@@H](Cc1cnc[nH]1)C(=O)[O-].[Zn+2]",
        "formula": "C9H12N4O3.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "289.6125",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "716dbd43-f6d4-4f70-8804-91a3a9aa147b",
          "876d1196-6051-4e36-8e65-718bc41ca062",
          "294c7e6c-6efb-49f1-a485-25a2c90a5091"
        ],
        "stereo_centers": 1
      },
      "unii": "0WA1B15A1Z"
    }
  ]
}