{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "30cb8f8b-c7aa-4cb8-824b-7ae77b9f5cb4",
          "code": "68854-18-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68854-18-2",
          "code_system": "CAS",
          "references": [
            "be0bbfc2-34d9-4968-9e8f-afc9a90b4a52",
            "15ddadaa-9db4-4e32-9e3e-3e32b823b728"
          ]
        },
        {
          "uuid": "baa62cb6-9dea-419b-9b81-c9b297ed01fe",
          "code": "313701",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/313701",
          "code_system": "PUBCHEM",
          "references": [
            "be0bbfc2-34d9-4968-9e8f-afc9a90b4a52"
          ]
        },
        {
          "uuid": "c0598d76-657c-654d-f8d7-018a4e2e9f97",
          "code": "DTXSID80218949",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80218949",
          "code_system": "EPA CompTox",
          "references": [
            "e081205e-0271-7df2-a498-e3b006430c38"
          ]
        },
        {
          "uuid": "5e43ef11-4575-4494-9b2e-74a91002ae06",
          "code": "0V98KE489V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e1d1d013-9c11-7b9e-24ab-4e90ea5fcb87",
          "code": "74759",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=74759",
          "code_system": "NSC",
          "references": [
            "47f509e6-d66a-fe9f-6c2f-961c77cbd875"
          ]
        },
        {
          "uuid": "44651a58-2f43-c3e0-6f21-a066fbeb3e96",
          "code": "229347",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=229347",
          "code_system": "NSC",
          "references": [
            "47f509e6-d66a-fe9f-6c2f-961c77cbd875"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e5e16121-e600-441c-bdf0-62baa98be29d",
          "name": "DIETHYL 2,4,6-TRIOXOHEPTANEDIOATE",
          "stdName": "DIETHYL 2,4,6-TRIOXOHEPTANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c5857b-3be3-483e-84a1-7fed1b42f38d",
            "d9ed3af8-2212-4f2c-9d02-d9ef75267118"
          ],
          "display_name": false
        },
        {
          "uuid": "9bbbba2d-ffd0-4996-8b74-cfaa82bab7fa",
          "name": "DIETHYL TRIOXOPIMELATE",
          "stdName": "DIETHYL TRIOXOPIMELATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c5857b-3be3-483e-84a1-7fed1b42f38d",
            "45e72f86-4183-4bc7-b1a3-3b3f7e60419c",
            "dadbfdb9-2230-460a-b79f-d3102d859e63"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d945e0ac-c7b0-437b-919f-3a770c0a9ceb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4d183196-2fb0-4622-9b1e-ba335d2679cf",
          "name": "HEPTANEDIOIC ACID, 2,4,6-TRIOXO-, 1,7-DIETHYL ESTER",
          "stdName": "HEPTANEDIOIC ACID, 2,4,6-TRIOXO-, 1,7-DIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c5857b-3be3-483e-84a1-7fed1b42f38d",
            "d9ed3af8-2212-4f2c-9d02-d9ef75267118"
          ],
          "display_name": false
        },
        {
          "uuid": "97d5eccb-185e-4029-943b-454f3a01a70e",
          "name": "HEPTANEDIOIC ACID, 2,4,6-TRIOXO-, DIETHYL ESTER",
          "stdName": "HEPTANEDIOIC ACID, 2,4,6-TRIOXO-, DIETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c5857b-3be3-483e-84a1-7fed1b42f38d",
            "d9ed3af8-2212-4f2c-9d02-d9ef75267118"
          ],
          "display_name": false
        },
        {
          "uuid": "6249831a-8cbe-48fb-8e8a-e040c2912aa9",
          "name": "NSC-229347",
          "stdName": "NSC-229347",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c5857b-3be3-483e-84a1-7fed1b42f38d",
            "d9ed3af8-2212-4f2c-9d02-d9ef75267118"
          ],
          "display_name": false
        },
        {
          "uuid": "884d6eec-dbd8-463f-a139-2baaa6053ea9",
          "name": "NSC-74759",
          "stdName": "NSC-74759",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c5857b-3be3-483e-84a1-7fed1b42f38d",
            "d9ed3af8-2212-4f2c-9d02-d9ef75267118"
          ],
          "display_name": false
        },
        {
          "uuid": "f7bd3503-3685-4a11-a29e-b2f85527bb91",
          "name": "T.P.E.",
          "stdName": "T.P.E.",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c5857b-3be3-483e-84a1-7fed1b42f38d",
            "dadbfdb9-2230-460a-b79f-d3102d859e63"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dadbfdb9-2230-460a-b79f-d3102d859e63",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a8c5857b-3be3-483e-84a1-7fed1b42f38d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9ed3af8-2212-4f2c-9d02-d9ef75267118",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be0bbfc2-34d9-4968-9e8f-afc9a90b4a52",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391492000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21570fcc-a2c4-495e-909c-68bd17caf584",
          "citation": "SRS import [0V98KE489V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0V98KE489V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391492000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45e72f86-4183-4bc7-b1a3-3b3f7e60419c",
          "citation": "DIETHYL TRIOXOPIMELATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e081205e-0271-7df2-a498-e3b006430c38",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68854-18-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "15ddadaa-9db4-4e32-9e3e-3e32b823b728",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "47f509e6-d66a-fe9f-6c2f-961c77cbd875",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "19fff048-33e3-481d-a4a3-dbbd777f1bcb",
          "id": "19fff048-33e3-481d-a4a3-dbbd777f1bcb",
          "molfile": "\n  Marvin  01132101322D          \n\n 18 17  0  0  0  0            999 V2000\n    4.6666   -4.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3764   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3764   -5.4676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0891   -5.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7988   -5.4676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0891   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3764   -7.1135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7988   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5114   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5114   -5.8607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2213   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9481   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9481   -5.8607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6607   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6607   -7.9251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3705   -6.6978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0832   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7930   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C(=O)CC(=O)CC(=O)C(=O)OCC",
          "formula": "C11H14O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b2793db6-5f0e-4c46-9824-7ee8b726f2ac"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "258.2251",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "42bb6b45-2fbf-45b5-9912-5bffbfc32452",
      "version": "6",
      "structure": {
        "id": "3e141638-b224-441c-a33f-71691f9a5567",
        "molfile": "\n  Marvin  01132103172D          \n\n 18 17  0  0  0  0            999 V2000\n    4.6666   -4.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3764   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7988   -5.4676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3764   -5.4676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3764   -7.1135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0891   -5.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0891   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7930   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5114   -5.8607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7988   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0832   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5114   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6607   -7.9251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3705   -6.6978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9481   -5.8607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2213   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6607   -7.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9481   -6.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  6  3  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  9  2  0  0  0  0\n 12 10  1  0  0  0  0\n 14 11  1  0  0  0  0\n 16 12  1  0  0  0  0\n 17 13  2  0  0  0  0\n 17 14  1  0  0  0  0\n 18 15  2  0  0  0  0\n 18 16  1  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C(=O)CC(=O)CC(=O)C(=O)OCC",
        "formula": "C11H14O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "258.2251",
        "optical_activity": "NONE",
        "references": [
          "d9ed3af8-2212-4f2c-9d02-d9ef75267118",
          "21570fcc-a2c4-495e-909c-68bd17caf584"
        ],
        "stereo_centers": 0
      },
      "unii": "0V98KE489V"
    }
  ]
}