{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b0e7b10e-45d8-465c-8f6d-3dcb116d9153",
          "code": "541-20-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=541-20-8",
          "code_system": "CAS",
          "references": [
            "beccad86-c89d-4b17-b0de-408f1891935c",
            "9ad5c448-4ff4-4bfa-9ece-f5abd187ebb1"
          ]
        },
        {
          "uuid": "2ff833f8-f4ad-47a1-9e6b-855a35390711",
          "code": "C80532",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80532",
          "code_system": "NCI_THESAURUS",
          "references": [
            "beccad86-c89d-4b17-b0de-408f1891935c"
          ]
        },
        {
          "uuid": "b05321bc-cb56-4a34-b2ec-aa18d75c8318",
          "code": "SUB09681MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "beccad86-c89d-4b17-b0de-408f1891935c"
          ]
        },
        {
          "uuid": "09a0d360-68d9-4e1f-a8f1-8b1e088074b8",
          "code": "4166",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4166",
          "code_system": "INN",
          "references": [
            "beccad86-c89d-4b17-b0de-408f1891935c"
          ]
        },
        {
          "uuid": "bde07406-de01-46de-9989-4b01a615fd91",
          "code": "208-771-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.975",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "beccad86-c89d-4b17-b0de-408f1891935c"
          ]
        },
        {
          "uuid": "ee8a47f7-557a-4dbc-b225-0594891e70c7",
          "code": "m872",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m872?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "beccad86-c89d-4b17-b0de-408f1891935c"
          ]
        },
        {
          "uuid": "07e8a269-23df-4800-a5fe-76677c5caab2",
          "code": "CHEMBL2110996",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110996",
          "code_system": "ChEMBL",
          "references": [
            "beccad86-c89d-4b17-b0de-408f1891935c"
          ]
        },
        {
          "uuid": "90aa946f-3782-480a-be14-31c1281a1da7",
          "code": "10919",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10919",
          "code_system": "PUBCHEM",
          "references": [
            "beccad86-c89d-4b17-b0de-408f1891935c"
          ]
        },
        {
          "uuid": "8f785492-eb22-b6ae-9187-1e3c10ae21b6",
          "code": "C66886",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent[C66880]|Nicotinic Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66886",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c67e77d6-8262-3591-c0e7-7cfdcaa62625"
          ]
        },
        {
          "uuid": "cc16c026-d6cf-4b01-a1de-6565192fef55",
          "code": "0UX03A6JJC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "828d6f70-a2b0-87cb-c5ba-6a7af3f7e6b6",
          "code": "3808",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3808",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c67e77d6-8262-3591-c0e7-7cfdcaa62625"
          ]
        },
        {
          "uuid": "a9f29b73-6be2-e49c-f327-22c574b21feb",
          "code": "134839",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:134839",
          "code_system": "CHEBI",
          "references": [
            "c67e77d6-8262-3591-c0e7-7cfdcaa62625"
          ]
        },
        {
          "uuid": "9e949bd2-3c26-45a1-6b9b-d363bfa20cd4",
          "code": "148343",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=148343",
          "code_system": "NSC",
          "references": [
            "dcbf22d8-2140-c945-0ac6-36416c45876e"
          ]
        },
        {
          "uuid": "eb0726e8-a1c0-a158-35d8-a55324a044df",
          "code": "100000082507",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ab82d3f1-a5e3-6597-08de-266a894f76fc"
          ]
        },
        {
          "uuid": "2b05c03d-81d8-973d-7e60-694e3b1af1be",
          "code": "DTXSID001351676",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001351676",
          "code_system": "EPA CompTox",
          "references": [
            "b1737949-7de7-8bb4-81f2-978d5bd0de0f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "13441bec-086d-4553-bf2a-19707cab581f",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "ded2a49d-b662-4793-b76b-d3b58c71241b",
            "refuuid": "7e5b67be-8c54-461e-b880-6bdef3364479",
            "name": "PENTAMETHONIUM",
            "unii": "521DS2D2HB",
            "linking_id": "521DS2D2HB",
            "ref_pname": "PENTAMETHONIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "61ea765b-1289-46b5-ae8d-e30243ae00b6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5bbdc650-41a4-4f70-a67c-9cda6161c84d",
            "refuuid": "7e5b67be-8c54-461e-b880-6bdef3364479",
            "name": "PENTAMETHONIUM",
            "unii": "521DS2D2HB",
            "linking_id": "521DS2D2HB",
            "ref_pname": "PENTAMETHONIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e660f031-7f72-4b54-921e-f303f9e75d9d",
          "name": "1,5-PENTANEDIAMINIUM, N1,N1,N1,N5,N5,N5-HEXAMETHYL-, BROMIDE (1:2)",
          "stdName": "1,5-PENTANEDIAMINIUM, N1,N1,N1,N5,N5,N5-HEXAMETHYL-, BROMIDE (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d96e363-40df-40ac-86a9-43082a9e8bf8",
            "e676475e-801b-4c66-971b-a2441afed03b"
          ],
          "display_name": false
        },
        {
          "uuid": "f83a6b3a-a334-47bc-9cde-01e401e6b3c9",
          "name": "LYTENSIUM",
          "stdName": "LYTENSIUM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d96e363-40df-40ac-86a9-43082a9e8bf8",
            "e676475e-801b-4c66-971b-a2441afed03b"
          ],
          "display_name": false
        },
        {
          "uuid": "9fda6beb-3e83-4ce7-a0f4-5abe0326c188",
          "name": "NSC-148343",
          "stdName": "NSC-148343",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38ca46e7-2239-41d4-a789-ef6fa280d622",
            "6d96e363-40df-40ac-86a9-43082a9e8bf8"
          ],
          "display_name": false
        },
        {
          "uuid": "40ce8621-e34b-4ddf-9910-e03058d02921",
          "name": "PENTAMETHONIUM BROMIDE",
          "stdName": "PENTAMETHONIUM BROMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7412fbf1-48a0-4214-bff9-f057c1a3428f",
            "871019ac-75f7-40cb-9dd5-f7499a5cdb6a",
            "233075d2-8898-4523-af9f-b86c727e4f47",
            "325d4d75-cd3a-4240-b291-6332df8643e7",
            "b814462e-9f59-4cb3-bb84-e4c3801eb76a",
            "6d96e363-40df-40ac-86a9-43082a9e8bf8",
            "5fede3dc-537a-4182-a12e-22d66b7584ca",
            "d46966a7-e0b8-4170-8453-29d3eb8edf51",
            "cb69103a-f59b-4264-8b22-215934b2475c",
            "49733d96-f16a-4003-96c5-820f30c4875c"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "3b7e5faf-3308-4fed-951e-44e43401ef4e",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "92275b7e-aae5-4ccc-a31e-620b5ccfdf6d",
          "name": "PENTAMETHONIUM BROMIDE [MART.]",
          "stdName": "PENTAMETHONIUM BROMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb69103a-f59b-4264-8b22-215934b2475c"
          ],
          "display_name": false
        },
        {
          "uuid": "c4211bf1-5f4e-4f77-a2b3-ee66c7764336",
          "name": "PENTAMETHONIUM BROMIDE [MI]",
          "stdName": "PENTAMETHONIUM BROMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b814462e-9f59-4cb3-bb84-e4c3801eb76a",
            "6d96e363-40df-40ac-86a9-43082a9e8bf8"
          ],
          "display_name": false
        },
        {
          "uuid": "4f77f321-566f-43f0-a3f8-e195e6ea133f",
          "name": "PENTAMETHONIUM DIBROMIDE",
          "stdName": "PENTAMETHONIUM DIBROMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d96e363-40df-40ac-86a9-43082a9e8bf8",
            "e676475e-801b-4c66-971b-a2441afed03b"
          ],
          "display_name": false
        },
        {
          "uuid": "f18bbaa4-8ea5-46b4-ba43-302530bf2aba",
          "name": "PENTAMETHYLENEBIS(TRIMETHYLAMMONIUM BROMIDE)",
          "stdName": "PENTAMETHYLENEBIS(TRIMETHYLAMMONIUM BROMIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d96e363-40df-40ac-86a9-43082a9e8bf8",
            "0eeaa179-15a1-40de-90af-a218bc3de4be"
          ],
          "display_name": false
        },
        {
          "uuid": "9b478f75-b1da-f4db-f2d0-0b66c616ba9c",
          "name": "Pentamethonium bromide [WHO-DD]",
          "stdName": "PENTAMETHONIUM BROMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b225d92-53ba-a88e-bc70-2720c79130f1"
          ],
          "display_name": false
        },
        {
          "uuid": "fe3a9214-4981-4e1d-9433-9f0fb6019df2",
          "name": "pentamethonium bromide [INN]",
          "stdName": "PENTAMETHONIUM BROMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7412fbf1-48a0-4214-bff9-f057c1a3428f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "49733d96-f16a-4003-96c5-820f30c4875c",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7412fbf1-48a0-4214-bff9-f057c1a3428f",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cb69103a-f59b-4264-8b22-215934b2475c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "325d4d75-cd3a-4240-b291-6332df8643e7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d96e363-40df-40ac-86a9-43082a9e8bf8",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0eeaa179-15a1-40de-90af-a218bc3de4be",
          "citation": "USP DICTIONARY 2013",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e676475e-801b-4c66-971b-a2441afed03b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b814462e-9f59-4cb3-bb84-e4c3801eb76a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38ca46e7-2239-41d4-a789-ef6fa280d622",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "beccad86-c89d-4b17-b0de-408f1891935c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33017359-e878-4155-9410-5cc24d9e980e",
          "citation": "SRS import [0UX03A6JJC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0UX03A6JJC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "871019ac-75f7-40cb-9dd5-f7499a5cdb6a",
          "citation": "PENTAMETHONIUM BROMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d46966a7-e0b8-4170-8453-29d3eb8edf51",
          "citation": "PENTAMETHONIUM BROMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "233075d2-8898-4523-af9f-b86c727e4f47",
          "citation": "PENTAMETHONIUM BROMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5fede3dc-537a-4182-a12e-22d66b7584ca",
          "citation": "PENTAMETHONIUM BROMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab82d3f1-a5e3-6597-08de-266a894f76fc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c67e77d6-8262-3591-c0e7-7cfdcaa62625",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9ad5c448-4ff4-4bfa-9ece-f5abd187ebb1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dcbf22d8-2140-c945-0ac6-36416c45876e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0b225d92-53ba-a88e-bc70-2720c79130f1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b1737949-7de7-8bb4-81f2-978d5bd0de0f",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bdf85573-0bef-411d-b326-1437862f66cf",
          "id": "bdf85573-0bef-411d-b326-1437862f66cf",
          "molfile": "\n  Marvin  01132109492D          \n\n  1  0  0  0  0  0            999 V2000\n    9.6930   -3.3312    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Br",
          "formula": "BrH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "da3c89cd-9b20-4012-98d3-c345f73f3a56"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "80.9115",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a26819b1-d5bf-45c1-ae00-2f38a98c013c",
          "id": "a26819b1-d5bf-45c1-ae00-2f38a98c013c",
          "molfile": "\n  Marvin  01132108262D          \n\n 13 12  0  0  0  0            999 V2000\n    2.4512   -2.3012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8370   -3.0357    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    2.0892   -3.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2337   -3.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5792   -2.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2715   -3.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0173   -2.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7200   -3.1476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4535   -2.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1435   -3.2031    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    7.8502   -3.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7011   -3.9027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6022   -2.4915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\nM  CHG  2   2   1  10   1\nM  END",
          "smiles": "C[N+](C)(C)CCCCC[N+](C)(C)C",
          "formula": "C11H28N2",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fad84777-5ba6-49a7-92b5-db49e0ed0f2d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "188.3538",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2edcf9bc-3f94-44af-9489-6734e353a596",
      "version": "13",
      "structure": {
        "id": "1464f3b4-5fc5-4800-9c6c-f787212d7ebc",
        "molfile": "\n  Marvin  01132101162D          \n\n 15 12  0  0  0  0            999 V2000\n    3.5789   -2.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8367   -3.0354    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.2711   -3.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4510   -2.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0890   -3.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2334   -3.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0168   -2.7152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7195   -3.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4529   -2.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1428   -3.2028    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.8495   -3.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7005   -3.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6015   -2.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6966   -3.3324    0.0000 Br  0  5  0  0  0  0  0  0  0  0  0  0\n    9.6966   -3.3324    0.0000 Br  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\nM  CHG  4   2   1  10   1  14  -1  15  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  14  15\nM  SPA   1  1  14\nM  SDI   1  4    9.2766   -3.7524    9.2766   -2.9124\nM  SDI   1  4   10.1166   -2.9124   10.1166   -3.7524\nM  SMT   1 2\nM  END",
        "smiles": "C[N+](C)(C)CCCCC[N+](C)(C)C.[Br-].[Br-]",
        "formula": "C11H28N2.2Br",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "348.1609",
        "optical_activity": "NONE",
        "references": [
          "33017359-e878-4155-9410-5cc24d9e980e",
          "49733d96-f16a-4003-96c5-820f30c4875c",
          "7412fbf1-48a0-4214-bff9-f057c1a3428f"
        ],
        "stereo_centers": 0
      },
      "unii": "0UX03A6JJC"
    }
  ]
}