{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "586efb5b-a499-479f-9583-d776addecb44",
          "code": "541-02-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=541-02-6",
          "code_system": "CAS",
          "references": [
            "bf2cc798-275b-4d51-85b3-53d4369e4187",
            "3940b4c6-ccf1-497e-8475-1fc281d12099"
          ]
        },
        {
          "uuid": "df65cfe6-5d5a-4211-a859-e342b3a685c8",
          "code": "C114768",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67114768",
          "code_system": "MESH",
          "references": [
            "bf2cc798-275b-4d51-85b3-53d4369e4187"
          ]
        },
        {
          "uuid": "605b250d-df9d-4133-b773-74bdd226a158",
          "code": "DECAMETHYLCYCLOPENTASILOXANE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Decamethylcyclopentasiloxane",
          "code_system": "WIKIPEDIA",
          "references": [
            "bf2cc798-275b-4d51-85b3-53d4369e4187"
          ]
        },
        {
          "uuid": "afa8c7f3-93cd-4258-aa16-ef91ef9a70ad",
          "code": "208-764-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.969",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bf2cc798-275b-4d51-85b3-53d4369e4187"
          ]
        },
        {
          "uuid": "48634852-3154-47c8-9a40-83167cdf6f52",
          "code": "1305744",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1305744/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bf2cc798-275b-4d51-85b3-53d4369e4187"
          ]
        },
        {
          "uuid": "1a8c55de-381b-44d8-8358-2add03e02995",
          "code": "m4122",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4122?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bf2cc798-275b-4d51-85b3-53d4369e4187"
          ]
        },
        {
          "uuid": "21fc2e5a-d5d9-4859-835b-7c8944baa5f1",
          "code": "SUB21629",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bf2cc798-275b-4d51-85b3-53d4369e4187"
          ]
        },
        {
          "uuid": "e209dbdd-a779-4d60-8a74-678e3cb0e0a8",
          "code": "10913",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10913",
          "code_system": "PUBCHEM",
          "references": [
            "bf2cc798-275b-4d51-85b3-53d4369e4187"
          ]
        },
        {
          "uuid": "1155f660-cb92-9cb8-f523-eca469feddc9",
          "code": "5683",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5683",
          "code_system": "HSDB",
          "references": [
            "06642ada-1c40-7f8e-d1f2-c4e5c3e3e000"
          ]
        },
        {
          "uuid": "1013ba5c-01b1-8f34-686b-450464b9c743",
          "code": "DTXSID1027184",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1027184",
          "code_system": "EPA CompTox",
          "references": [
            "6db32325-7453-1ced-f306-0982eb9518a7"
          ]
        },
        {
          "uuid": "7e7a5cbf-ceb1-d0cf-7d8e-64ad580d9e05",
          "code": "DB11244",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11244",
          "code_system": "DRUG BANK",
          "references": [
            "37e40b6e-73b7-8712-8da5-f9f26fb8702d"
          ]
        },
        {
          "uuid": "3f337723-d2b7-4ac0-9b5f-b0301cc25c54",
          "code": "0THT5PCI0R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8f79802c-d5ee-017e-8e1a-33fa30105bb4",
          "code": "1154809",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1154809",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "37e40b6e-73b7-8712-8da5-f9f26fb8702d"
          ]
        },
        {
          "uuid": "99c14e8b-2b3d-6c9e-2b0d-16d096dc1a7e",
          "code": "100000088318",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "fdd24470-d482-43ca-8125-09eb10e86e05"
          ]
        },
        {
          "uuid": "cd044bf8-5bad-0ff4-0407-e9eac3909cae",
          "code": "0THT5PCI0R",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0THT5PCI0R",
          "code_system": "DAILYMED",
          "references": [
            "75ef9c04-b120-a2fd-9ce6-0d91baf999df"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7bec960c-5e25-4a81-aa52-c94377d7fa95",
          "amount": {
            "uuid": "01713611-4697-44b2-92a1-e00da5ebd4c6"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5ab59428-85a9-42b2-bd64-741dec1b39d1",
            "refuuid": "1755a4ce-1669-426e-94b9-1788c4adc7d5",
            "name": "CYCLOMETHICONE 5",
            "unii": "0THT5PCI0R",
            "linking_id": "0THT5PCI0R",
            "ref_pname": "CYCLOMETHICONE 5",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "56a4a9d5-13ba-4621-9730-9b4b7e10510d",
          "name": "2,2,4,4,6,6,8,8,10,10-DECAMETHYL-1,3,5,7,9,2,4,6,8,10-PENTOXAPENTASILECANE",
          "stdName": "2,2,4,4,6,6,8,8,10,10-DECAMETHYL-1,3,5,7,9,2,4,6,8,10-PENTOXAPENTASILECANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89bdb0a4-a664-4a0c-9223-511a1456c0e3",
            "4a40d85e-616a-4afa-8b54-6221fce5ab2a"
          ],
          "display_name": false
        },
        {
          "uuid": "9f280d8b-ad21-4df7-811b-db3954a810d8",
          "name": "CICLOPENTASILOXANE",
          "stdName": "CICLOPENTASILOXANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "462f7c14-61b3-4920-adc4-867f904485bf"
          ],
          "display_name": false
        },
        {
          "uuid": "234e252b-4802-4a8b-89ac-6c5dc85294a9",
          "name": "CYCLOMETHICONE 5",
          "stdName": "CYCLOMETHICONE 5",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3402f7e-1776-4f67-85de-493c090331ce",
            "3c4ebea0-04f3-44ff-8999-649c7481715c",
            "1f7aa401-4182-4af5-8f4b-491f10f55d02"
          ],
          "display_name": true
        },
        {
          "uuid": "28c5e60d-13b5-18ed-5929-e5bd805aa1da",
          "name": "CYCLOMETHICONE 5 [USP-RS]",
          "stdName": "CYCLOMETHICONE 5 [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e17965d-f9e7-3b2c-4d2f-13d628559262"
          ],
          "display_name": false
        },
        {
          "uuid": "d3efa45b-0c01-4a26-9146-5e20271ce341",
          "name": "CYCLOMETHICONE D5",
          "stdName": "CYCLOMETHICONE D5",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b40c3738-7d65-4712-9953-e47ef9d99aa4"
          ],
          "display_name": false
        },
        {
          "uuid": "7f1d0e16-2fb2-4349-8d85-c7c48e5b1351",
          "name": "CYCLOPENTASILOXANE",
          "stdName": "CYCLOPENTASILOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "6a2ebc6f-cdb9-4730-b530-9e6c8bb107bc",
            "18f0c4b3-d379-4db0-8a29-e77e68fd4754",
            "8ece0971-f089-4812-a4f1-3ddc29fc3b8b",
            "39351df1-48d1-4733-9898-1f953622235e"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ca8ab564-f420-4ad6-a8cb-bd7a87138007",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "13044e5b-4252-4ed5-88b5-4ee9d5aa9001",
          "name": "CYCLOPENTASILOXANE (D5)",
          "stdName": "CYCLOPENTASILOXANE (D5)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6fade056-9d14-4bf0-af99-4da94b0f2f0c"
          ],
          "display_name": false
        },
        {
          "uuid": "12998839-053d-4c90-b572-92062934cccd",
          "name": "CYCLOPENTASILOXANE, DECAMETHYL-",
          "stdName": "CYCLOPENTASILOXANE, DECAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfc8b492-1369-4689-8962-9ac58944e41a",
            "4a40d85e-616a-4afa-8b54-6221fce5ab2a"
          ],
          "display_name": false
        },
        {
          "uuid": "a2bb5ff0-dbd9-7dc0-c7df-d0fa25db9ea3",
          "name": "Cyclomethicone 5 [WHO-DD]",
          "stdName": "CYCLOMETHICONE 5 [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fe84af9-109b-2904-dc4c-b4bcb46c9a6e"
          ],
          "display_name": false
        },
        {
          "uuid": "aa9be07d-cf61-46a5-b50f-e0cab1f220b9",
          "name": "D5",
          "stdName": "D5",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b9c80ee-7e09-4b43-a3d6-22ecc60dff5c"
          ],
          "display_name": false
        },
        {
          "uuid": "140f3971-fcc2-497c-b462-fb8736e83e6e",
          "name": "DECAMETHYLCYCLOPENTASILOXANE",
          "stdName": "DECAMETHYLCYCLOPENTASILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9da7423a-f38f-4cbc-ae49-7daad5dd1032",
            "ab0ab0e9-dcd5-411b-b35d-cc71a323fd9d",
            "7b9c80ee-7e09-4b43-a3d6-22ecc60dff5c",
            "14a9599a-24d4-46ef-ba7e-9ae62cf0d01c",
            "711353ff-6f2e-4a1a-a05d-52e6c41c9ddb"
          ],
          "display_name": false
        },
        {
          "uuid": "c335d444-bac3-44ee-90fd-0067c99e3dfa",
          "name": "DECAMETHYLCYCLOPENTASILOXANE [HSDB]",
          "stdName": "DECAMETHYLCYCLOPENTASILOXANE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9da7423a-f38f-4cbc-ae49-7daad5dd1032"
          ],
          "display_name": false
        },
        {
          "uuid": "47f4d5f6-a584-4b60-a2c5-22fc6031687b",
          "name": "DECAMETHYLCYCLOPENTASILOXANE [MI]",
          "stdName": "DECAMETHYLCYCLOPENTASILOXANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "711353ff-6f2e-4a1a-a05d-52e6c41c9ddb"
          ],
          "display_name": false
        },
        {
          "uuid": "4af8625f-0fd0-4a50-a0ac-e69a1816d5f0",
          "name": "DOW CORNING ST CYCLOMETHICONE 5",
          "stdName": "DOW CORNING ST CYCLOMETHICONE 5",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ca764b1-dd4f-477a-be41-8cd5b588d7d3"
          ],
          "display_name": false
        },
        {
          "uuid": "6c140bad-0c6f-4e9c-a53a-2375a3b2730c",
          "name": "DOW CORNING UP-1002 ULTRA PURE FLUID",
          "stdName": "DOW CORNING UP-1002 ULTRA PURE FLUID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ece0971-f089-4812-a4f1-3ddc29fc3b8b"
          ],
          "display_name": false
        },
        {
          "uuid": "6a8748e7-e4f4-40e9-88e6-ed9ad20f2efe",
          "name": "JEESILC CPS-211",
          "stdName": "JEESILC CPS-211",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3598dcba-1b69-4e8f-a722-5e5f395516c4"
          ],
          "display_name": false
        },
        {
          "uuid": "e28e771c-d8f2-4c71-9708-262ab0a51fd3",
          "name": "KF-995",
          "stdName": "KF-995",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0ceb131-34ea-4175-beda-ba55415f561a"
          ],
          "display_name": false
        },
        {
          "uuid": "47edb44f-1480-4c45-97df-69e206a928f2",
          "name": "KP-545 COMPONENT CYCLOMETHICONE 5",
          "stdName": "KP-545 COMPONENT CYCLOMETHICONE 5",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c463a2e-173a-4039-92e4-fde3d3fa8031"
          ],
          "display_name": false
        },
        {
          "uuid": "0f29ed3b-fb26-42dc-878e-f78351c2a000",
          "name": "OCTAMETHYLCYCLOTETRASILOXANE (D5)",
          "stdName": "OCTAMETHYLCYCLOTETRASILOXANE (D5)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9fd10b77-600e-4c95-a0b6-888dc887220a"
          ],
          "display_name": false
        },
        {
          "uuid": "54b8ca6c-cfad-4469-8121-d5cb6a6af1e5",
          "name": "XIAMETER PMX-0245",
          "stdName": "XIAMETER PMX-0245",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05592eb8-5d34-4896-87fb-3fa1523d02c4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4a40d85e-616a-4afa-8b54-6221fce5ab2a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bfc8b492-1369-4689-8962-9ac58944e41a",
          "citation": "STN(DMF 17213)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89bdb0a4-a664-4a0c-9223-511a1456c0e3",
          "citation": "ACD 8.0(DMF 17213)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b9c80ee-7e09-4b43-a3d6-22ecc60dff5c",
          "citation": "http://www.siltechpersonalcare.com/pdfs/brochures/Fact_Sheet_D5.pdf",
          "url": "http://www.siltechpersonalcare.com/pdfs/brochures/Fact_Sheet_D5.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ece0971-f089-4812-a4f1-3ddc29fc3b8b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a2ebc6f-cdb9-4730-b530-9e6c8bb107bc",
          "citation": "DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c4ebea0-04f3-44ff-8999-649c7481715c",
          "citation": "NF 27",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05592eb8-5d34-4896-87fb-3fa1523d02c4",
          "citation": "https://www.xiameter.com/en/Products/Pages/ProductDetail.aspx?pid=01645196&R=X273EN&C=US",
          "url": "https://www.xiameter.com/en/Products/Pages/ProductDetail.aspx?pid=01645196&R=X273EN&C=US",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fade056-9d14-4bf0-af99-4da94b0f2f0c",
          "citation": "DOW CORNING SPECICATION SHHEET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "711353ff-6f2e-4a1a-a05d-52e6c41c9ddb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "462f7c14-61b3-4920-adc4-867f904485bf",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18f0c4b3-d379-4db0-8a29-e77e68fd4754",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9da7423a-f38f-4cbc-ae49-7daad5dd1032",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3598dcba-1b69-4e8f-a722-5e5f395516c4",
          "citation": "http://www.jeen.com/technical/JEESILC%20CPS-211.pdf",
          "url": "http://www.jeen.com/technical/JEESILC%20CPS-211.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0ceb131-34ea-4175-beda-ba55415f561a",
          "citation": "http://www.silicone.jp/e/catalog/pdf/pc_us.pdf",
          "url": "http://www.silicone.jp/e/catalog/pdf/pc_us.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f7aa401-4182-4af5-8f4b-491f10f55d02",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9fd10b77-600e-4c95-a0b6-888dc887220a",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ca764b1-dd4f-477a-be41-8cd5b588d7d3",
          "citation": "DOW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b40c3738-7d65-4712-9953-e47ef9d99aa4",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf2cc798-275b-4d51-85b3-53d4369e4187",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a22a0a94-ce50-455b-8193-1add58b45a81",
          "citation": "SRS import [0THT5PCI0R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0THT5PCI0R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab0ab0e9-dcd5-411b-b35d-cc71a323fd9d",
          "citation": "DECAMETHYLCYCLOPENTASILOXANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39351df1-48d1-4733-9898-1f953622235e",
          "citation": "CYCLOPENTASILOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14a9599a-24d4-46ef-ba7e-9ae62cf0d01c",
          "citation": "DECAMETHYLCYCLOPENTASILOXANE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a3402f7e-1776-4f67-85de-493c090331ce",
          "citation": "CYCLOMETHICONE 5 [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "06642ada-1c40-7f8e-d1f2-c4e5c3e3e000",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+541-02-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6db32325-7453-1ced-f306-0982eb9518a7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=541-02-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fdd24470-d482-43ca-8125-09eb10e86e05",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "37e40b6e-73b7-8712-8da5-f9f26fb8702d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3940b4c6-ccf1-497e-8475-1fc281d12099",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8e17965d-f9e7-3b2c-4d2f-13d628559262",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "0c463a2e-173a-4039-92e4-fde3d3fa8031",
          "citation": "Shin-Etsu  ",
          "url": "https://www.shinetsuamerica.com/files/literature/Shin-Etsu%20Unique%20Materials%202010%2011_2.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "75ef9c04-b120-a2fd-9ce6-0d91baf999df",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7fe84af9-109b-2904-dc4c-b4bcb46c9a6e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7f184f94-311b-4b4e-bead-0b3125549250",
          "id": "7f184f94-311b-4b4e-bead-0b3125549250",
          "molfile": "\n  Marvin  01132106362D          \n\n 20 20  0  0  0  0            999 V2000\n   10.4674   -5.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2124   -6.1686    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5450   -5.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5450   -6.6536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2901   -7.4383    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6226   -6.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6226   -7.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5450   -8.2228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2124   -8.7078    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5450   -9.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4675   -9.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0374   -8.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7050   -8.2228    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   11.9599   -9.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5300   -8.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9599   -7.4382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7050   -6.6536    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   12.5300   -6.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9599   -5.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0374   -6.1686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2 20  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 20 17  1  0  0  0  0\nM  END",
          "smiles": "C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1",
          "formula": "C10H30O5Si5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ef606fa5-cfcf-4772-802d-935c38c6d07b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "370.7695",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1755a4ce-1669-426e-94b9-1788c4adc7d5",
      "version": "16",
      "structure": {
        "id": "64f17f7a-11bb-407a-91a8-fb0ce6fe40b3",
        "molfile": "\n  Marvin  01132105152D          \n\n 20 20  0  0  0  0            999 V2000\n   10.4674   -5.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5450   -6.6536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2124   -6.1686    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   11.0374   -6.1686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7050   -6.6536    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   11.9599   -7.4382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7050   -8.2228    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   11.0374   -8.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2124   -8.7078    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5450   -8.2228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2901   -7.4383    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5450   -5.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6226   -6.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6226   -7.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5450   -9.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4675   -9.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9599   -9.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5300   -8.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5300   -6.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9599   -5.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 11  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  3  1  1  0  0  0  0\n  3 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n  9 16  1  0  0  0  0\n  7 17  1  0  0  0  0\n  7 18  1  0  0  0  0\n  5 19  1  0  0  0  0\n  5 20  1  0  0  0  0\nM  END",
        "smiles": "C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1",
        "formula": "C10H30O5Si5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "370.7695",
        "optical_activity": "NONE",
        "references": [
          "3c4ebea0-04f3-44ff-8999-649c7481715c",
          "a22a0a94-ce50-455b-8193-1add58b45a81"
        ],
        "stereo_centers": 0
      },
      "unii": "0THT5PCI0R"
    }
  ]
}