{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8ca68514-74db-4306-9251-86e94d144fe4", "code": "1309389-73-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1309389-73-8", "code_system": "CAS", "references": [ "ad7d81bc-bb53-ca1b-6e19-17bda2fd4b52", "c3cce4ce-5ead-e153-140a-dc45c2d485ca" ] }, { "uuid": "08df0e99-8a19-421c-9abb-5e34210dad26", "code": "68085257", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68085257", "code_system": "PUBCHEM", "references": [ "c3cce4ce-5ead-e153-140a-dc45c2d485ca", "ad7d81bc-bb53-ca1b-6e19-17bda2fd4b52" ] }, { "uuid": "39a323c8-0b52-4014-ae89-1418c3256895", "code": "0TA0227SQW", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8bd93b59-fc09-e28b-4695-b9466679b4c2", "code": "DTXSID601019527", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601019527", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "2e37e7f7-7134-3a31-2b2b-05adfb8f9e8f", "name": "3-(1,3-BENZODIOXOL-5-YL)-N,N-DIPHENYLPROP-2-ENAMIDE, (2E)-", "stdName": "3-(1,3-BENZODIOXOL-5-YL)-N,N-DIPHENYLPROP-2-ENAMIDE, (2E)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ad7d81bc-bb53-ca1b-6e19-17bda2fd4b52", "c3cce4ce-5ead-e153-140a-dc45c2d485ca" ], "display_name": true }, { "uuid": "6c0fe225-c247-0e18-24ca-f6d4252a4bf3", "name": "3-BENZO(1,3)DIOXOL-5-YL-N,N-DIPHENYL-2-PROPENAMIDE, (E)-", "stdName": "3-BENZO(1,3)DIOXOL-5-YL-N,N-DIPHENYL-2-PROPENAMIDE, (E)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c3cce4ce-5ead-e153-140a-dc45c2d485ca", "ad7d81bc-bb53-ca1b-6e19-17bda2fd4b52" ], "display_name": false }, { "uuid": "dd3f251f-de09-75dc-c48a-c26799790b2a", "name": "FEMA NO. 4788", "stdName": "FEMA NO. 4788", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "c3cce4ce-5ead-e153-140a-dc45c2d485ca", "ad7d81bc-bb53-ca1b-6e19-17bda2fd4b52" ], "display_name": false } ], "references": [ { "uuid": "ad7d81bc-bb53-ca1b-6e19-17bda2fd4b52", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c3cce4ce-5ead-e153-140a-dc45c2d485ca", "citation": "FHFI", "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "885dcf56-c203-25bf-b917-b721407b45a6", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7a7b3069-db18-4dfe-83b7-a84900fcb403", "id": "7a7b3069-db18-4dfe-83b7-a84900fcb403", "molfile": "\n Marvin 01132106222D \n\n 26 29 0 0 0 0 999 V2000\n 14.2705 -2.4199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2705 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9850 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6994 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4140 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4140 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1284 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8428 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6275 -4.7374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1124 -4.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6275 -3.4025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8428 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1284 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5560 -3.6575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8416 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8416 -2.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1271 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4126 -2.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4126 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1271 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5560 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8416 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8416 -5.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5560 -6.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2705 -5.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2705 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 2 3 1 0 0 0 0\n 14 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 13 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 12 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 21 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 20 2 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 26 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)N(c2ccccc2)C(=O)/C=C/c3ccc4c(c3)OCO4", "formula": "C22H17NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "295228da-1b85-446e-869a-f42341120bd6" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "343.3761", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "66151c2a-c12f-4f6f-8f08-d7efac2a0d43", "version": "7", "structure": { "id": "3f61abe6-b4ad-592a-bf3c-7718cad4f66c", "molfile": "2-Propenamide, 3-(1,3-benzodioxol-5-yl)-N,N-diphenyl-, (2E)-\n Marvin 01132103212D \n\n 26 29 0 0 0 0 999 V2000\n 13.5560 -3.6575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2705 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9850 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6994 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4140 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1284 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8428 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8428 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1284 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4140 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6275 -4.7374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1124 -4.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6275 -3.4025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2705 -2.4199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8416 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8416 -2.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1271 -2.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4126 -2.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4126 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1271 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5560 -4.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8416 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8416 -5.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5560 -6.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2705 -5.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2705 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 5 10 2 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 7 13 1 0 0 0 0\n 2 14 2 0 0 0 0\n 1 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 2 0 0 0 0\n 15 20 1 0 0 0 0\n 1 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 21 26 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)N(c2ccccc2)C(=O)/C=C/c3ccc4c(c3)OCO4", "formula": "C22H17NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "343.3761", "optical_activity": "NONE", "references": [ "ad7d81bc-bb53-ca1b-6e19-17bda2fd4b52", "c3cce4ce-5ead-e153-140a-dc45c2d485ca" ], "stereo_centers": 0 }, "unii": "0TA0227SQW" } ] }