{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c489c669-e66b-4c56-a3f3-87395da2240f",
          "code": "141112-29-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=141112-29-0",
          "code_system": "CAS",
          "references": [
            "e69a5350-c648-4898-a257-caa724269d9d",
            "8de15c9f-5221-4d9e-ad81-57dedbed9818"
          ]
        },
        {
          "uuid": "94a5ed31-ac97-428c-a3e6-d57309b71c21",
          "code": "C415327",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67415327",
          "code_system": "MESH",
          "references": [
            "e69a5350-c648-4898-a257-caa724269d9d"
          ]
        },
        {
          "uuid": "724ca105-00a5-41e7-9824-044feb69b88b",
          "code": "123000",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2849",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e69a5350-c648-4898-a257-caa724269d9d"
          ]
        },
        {
          "uuid": "4f50681a-a184-4c99-8a17-2ac215308c65",
          "code": "ANNEX I INDEX 606-054-00-7",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e69a5350-c648-4898-a257-caa724269d9d"
          ]
        },
        {
          "uuid": "4f18954b-071c-462a-a7f6-0af5231c1e7c",
          "code": "1371313",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1371313/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e69a5350-c648-4898-a257-caa724269d9d"
          ]
        },
        {
          "uuid": "f921ccc7-69d8-4777-8ed4-b587d33e1b71",
          "code": "m6553",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6553?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e69a5350-c648-4898-a257-caa724269d9d"
          ]
        },
        {
          "uuid": "539dc6e5-7f73-479a-930f-13e33c4bf25f",
          "code": "84098",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84098",
          "code_system": "PUBCHEM",
          "references": [
            "e69a5350-c648-4898-a257-caa724269d9d"
          ]
        },
        {
          "uuid": "5fe53b76-7a94-8f55-d7fa-276a8eb96fad",
          "code": "7275",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7275",
          "code_system": "HSDB",
          "references": [
            "62be4e13-7818-dee8-8409-a676e120da60"
          ]
        },
        {
          "uuid": "542fd2b9-716d-9fc0-5fb0-842a3c95a98a",
          "code": "DTXSID5034723",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5034723",
          "code_system": "EPA CompTox",
          "references": [
            "eddf3238-dddf-a3e7-db2e-c2da947fb578"
          ]
        },
        {
          "uuid": "932a66b2-119c-afd0-8028-a51bb95ea763",
          "code": "DB12938",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12938",
          "code_system": "DRUG BANK",
          "references": [
            "2cea928c-4ee7-0b07-dc6e-ccbef3c00264"
          ]
        },
        {
          "uuid": "4ecc3c85-f6db-4ac2-b1d2-8a59169398da",
          "code": "0T9R0O0EYT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e6f6d500-2f6f-d5bc-84dd-b760a1ddb84f",
          "code": "3612",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3612",
          "code_system": "CHEBI",
          "references": [
            "2cea928c-4ee7-0b07-dc6e-ccbef3c00264"
          ]
        },
        {
          "uuid": "2712124a-cc46-8bb2-7994-710927d63062",
          "code": "141213",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:141213",
          "code_system": "CHEBI",
          "references": [
            "2cea928c-4ee7-0b07-dc6e-ccbef3c00264"
          ]
        },
        {
          "uuid": "9aee5efe-6892-1036-eafd-c3a3dc738a36",
          "code": "isoxaflutole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/isoxaflutole.html",
          "code_system": "ALANWOOD",
          "references": [
            "b53051ea-f465-85cf-e4c0-8086006f96a2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0ccbc1ec-6c6e-45fa-8461-6242e7ba14e6",
          "name": "(5-CYCLOPROPYL-1,2-OXAZOL-4-YL)(.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-2-MESYL-P-TOLYL)METHANONE",
          "stdName": "(5-CYCLOPROPYL-1,2-OXAZOL-4-YL)(.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-2-MESYL-P-TOLYL)METHANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7320a9ac-b019-42e2-9173-d16d1e0dd38b",
            "4f5348ea-61c2-4c9a-ab66-05931ad5d54b"
          ],
          "display_name": false
        },
        {
          "uuid": "93f7b417-b9e9-415e-bddf-d260019aa8e3",
          "name": "(5-CYCLOPROPYL-4-ISOXAZOLYL)(2-(METHYLSULFONYL)-4-(TRIFLUOROMETHYL)PHENYL)METHANONE",
          "stdName": "(5-CYCLOPROPYL-4-ISOXAZOLYL)(2-(METHYLSULFONYL)-4-(TRIFLUOROMETHYL)PHENYL)METHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc1c8628-7d22-47e2-8693-c42bf57e99a5",
            "4f5348ea-61c2-4c9a-ab66-05931ad5d54b"
          ],
          "display_name": false
        },
        {
          "uuid": "a91deceb-0599-4ba0-a7df-9d99681efa1f",
          "name": "264-EUP-99",
          "stdName": "264-EUP-99",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "f07bb995-f206-444b-8f57-dc9d3bee659f"
          ],
          "display_name": false
        },
        {
          "uuid": "81631a4b-2bc8-4a38-b8b1-f5416009dac7",
          "name": "5-CYCLOPROPYL-4-(2-METHANESULFONYL-4-TRIFLUOROMETHYLBENZOYL)ISOXAZOLE",
          "stdName": "5-CYCLOPROPYL-4-(2-METHANESULFONYL-4-TRIFLUOROMETHYLBENZOYL)ISOXAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "f07bb995-f206-444b-8f57-dc9d3bee659f"
          ],
          "display_name": false
        },
        {
          "uuid": "e233e431-b8f9-4a90-9eab-4fb427c42ad7",
          "name": "5-CYCLOPROPYLISOXAZOL-4-YL 2-MESYL-4-TRIFLUOROMETHYLPHENYL KETONE",
          "stdName": "5-CYCLOPROPYLISOXAZOL-4-YL 2-MESYL-4-TRIFLUOROMETHYLPHENYL KETONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "f07bb995-f206-444b-8f57-dc9d3bee659f"
          ],
          "display_name": false
        },
        {
          "uuid": "a1a71f5d-d425-4570-9350-2969deed51c0",
          "name": "BALANCE",
          "stdName": "BALANCE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "9577f6ce-d75e-4015-bcae-6370517a92a1"
          ],
          "display_name": false
        },
        {
          "uuid": "b402dad4-59be-478b-a0a5-5c057e7d8d70",
          "name": "ISOXAFLUTOLE",
          "stdName": "ISOXAFLUTOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "37ed240e-e650-4440-a1b3-401ea4d5f91d",
            "d424fcb5-55ee-4968-bccf-71eaa8324055",
            "6b4e79c9-01e2-4fe4-9dd4-b4621fc5f528",
            "b8264b5e-9f24-4395-875f-6e071d76da91",
            "41fc1824-e2ac-43fb-be0d-8ffda3b7871b",
            "fe364570-3ff5-495c-95ad-e2737bbe99bc",
            "bfa40ecb-6b3e-4c0a-bbf8-1bba0becb92f"
          ],
          "display_name": true
        },
        {
          "uuid": "816c599d-b9f0-4c8d-9d8c-226aed7b86bb",
          "name": "ISOXAFLUTOLE [HSDB]",
          "stdName": "ISOXAFLUTOLE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "d424fcb5-55ee-4968-bccf-71eaa8324055"
          ],
          "display_name": false
        },
        {
          "uuid": "3d18db23-1a36-49d2-86ce-bfef3ecd5ff1",
          "name": "ISOXAFLUTOLE [ISO]",
          "stdName": "ISOXAFLUTOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "bfa40ecb-6b3e-4c0a-bbf8-1bba0becb92f"
          ],
          "display_name": false
        },
        {
          "uuid": "74f2b7f5-bbe1-4037-ad96-7006ced11318",
          "name": "ISOXAFLUTOLE [MI]",
          "stdName": "ISOXAFLUTOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "b8264b5e-9f24-4395-875f-6e071d76da91"
          ],
          "display_name": false
        },
        {
          "uuid": "edbf15f4-2aba-4557-b8df-d12dc48c899a",
          "name": "MERLIN",
          "stdName": "MERLIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "9577f6ce-d75e-4015-bcae-6370517a92a1"
          ],
          "display_name": false
        },
        {
          "uuid": "80acf4f7-3659-405e-aa4a-6a2a7abe1ff0",
          "name": "RPA-201772",
          "stdName": "RPA-201772",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
            "f07bb995-f206-444b-8f57-dc9d3bee659f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6b4e79c9-01e2-4fe4-9dd4-b4621fc5f528",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4f5348ea-61c2-4c9a-ab66-05931ad5d54b",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7320a9ac-b019-42e2-9173-d16d1e0dd38b",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc1c8628-7d22-47e2-8693-c42bf57e99a5",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8264b5e-9f24-4395-875f-6e071d76da91",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18edce51-4322-4a1b-9d42-6a2e24ce9a98",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f07bb995-f206-444b-8f57-dc9d3bee659f",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9577f6ce-d75e-4015-bcae-6370517a92a1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d424fcb5-55ee-4968-bccf-71eaa8324055",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfa40ecb-6b3e-4c0a-bbf8-1bba0becb92f",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e69a5350-c648-4898-a257-caa724269d9d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "610f538a-8a5f-48a7-879a-74c53e371c46",
          "citation": "SRS import [0T9R0O0EYT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0T9R0O0EYT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58686e14-281d-4711-9232-b13c6ce7040f",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe364570-3ff5-495c-95ad-e2737bbe99bc",
          "citation": "ISOXAFLUTOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "41fc1824-e2ac-43fb-be0d-8ffda3b7871b",
          "citation": "ISOXAFLUTOLE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37ed240e-e650-4440-a1b3-401ea4d5f91d",
          "citation": "ISOXAFLUTOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eddf3238-dddf-a3e7-db2e-c2da947fb578",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=141112-29-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62be4e13-7818-dee8-8409-a676e120da60",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+141112-29-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b53051ea-f465-85cf-e4c0-8086006f96a2",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "2cea928c-4ee7-0b07-dc6e-ccbef3c00264",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8de15c9f-5221-4d9e-ad81-57dedbed9818",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "58d256ef-140a-1cf6-8b74-ad1601aee41c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3add066b-5791-4891-a801-3b7afe6f51e4",
          "id": "3add066b-5791-4891-a801-3b7afe6f51e4",
          "molfile": "\n  Marvin  01132103072D          \n\n 24 26  0  0  0  0            999 V2000\n    8.8131   -5.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9908   -5.2311    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8706   -4.4116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1138   -6.0525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1680   -5.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8684   -6.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0546   -6.2489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5354   -5.6033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8396   -4.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6549   -4.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9544   -3.9439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7724   -3.8219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4445   -3.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5770   -2.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8477   -2.1159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -2.6929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6302   -3.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2763   -4.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6076   -4.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3578   -5.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7516   -7.0163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4518   -7.7873    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5262   -7.3173    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9799   -6.7222    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 21  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 17 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
          "smiles": "CS(=O)(=O)c1cc(ccc1C(=O)c2cnoc2C3CC3)C(F)(F)F",
          "formula": "C15H12F3NO4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9f714633-f272-46cc-aba6-0c7d721e6f64"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "359.3219",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "411ac007-fbc4-49d9-a0ea-0975d4ef6007",
      "version": "10",
      "structure": {
        "id": "7887fc37-02f1-44de-9b62-7cad814b4e49",
        "molfile": "\n  Marvin  01132106162D          \n\n 24 26  0  0  0  0            999 V2000\n    5.6306   -3.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2627   -2.6931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8481   -2.1160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5774   -2.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4449   -3.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9548   -3.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6553   -4.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1685   -5.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8688   -6.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0550   -6.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7520   -7.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4521   -7.7878    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5266   -7.3178    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9802   -6.7226    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5358   -5.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8400   -4.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9913   -5.2314    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8137   -5.1104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8711   -4.4119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1143   -6.0529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7729   -3.8221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2766   -4.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6079   -4.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3581   -5.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 15 10  2  0  0  0  0\n 16 15  1  0  0  0  0\n  7 16  2  0  0  0  0\n  8 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 17 20  2  0  0  0  0\n  6 21  2  0  0  0  0\n  1  5  2  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
        "smiles": "CS(=O)(=O)c1cc(ccc1C(=O)c2cnoc2C3CC3)C(F)(F)F",
        "formula": "C15H12F3NO4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "359.3219",
        "optical_activity": "NONE",
        "references": [
          "58686e14-281d-4711-9232-b13c6ce7040f",
          "610f538a-8a5f-48a7-879a-74c53e371c46"
        ],
        "stereo_centers": 0
      },
      "unii": "0T9R0O0EYT"
    }
  ]
}