{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ce7f6ce5-11e6-446b-981e-be6a75c25b0d",
          "code": "32426-11-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32426-11-2",
          "code_system": "CAS",
          "references": [
            "89b732b3-80df-4d6e-bab7-e06bad71a817",
            "9c98eac9-2393-4139-b022-7603943ade6e"
          ]
        },
        {
          "uuid": "9122385a-f415-491b-9c44-cce7f15af66d",
          "code": "69165",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:213",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "89b732b3-80df-4d6e-bab7-e06bad71a817"
          ]
        },
        {
          "uuid": "a0ace3ea-9025-4aff-8466-69ecf2e4f1bc",
          "code": "1539969",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1539969/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "89b732b3-80df-4d6e-bab7-e06bad71a817"
          ]
        },
        {
          "uuid": "0f33dc36-e8ee-40d2-ab42-5d1637812b9b",
          "code": "251-035-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.380",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "89b732b3-80df-4d6e-bab7-e06bad71a817"
          ]
        },
        {
          "uuid": "cf8f5f38-73d0-46f0-b6e0-d0a3d7f76d62",
          "code": "61906",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61906",
          "code_system": "PUBCHEM",
          "references": [
            "89b732b3-80df-4d6e-bab7-e06bad71a817"
          ]
        },
        {
          "uuid": "61912fee-de92-3f11-e7d7-e94f30508a21",
          "code": "DTXSID9035549",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9035549",
          "code_system": "EPA CompTox",
          "references": [
            "9fde8711-8525-164d-52a2-528f767600b7"
          ]
        },
        {
          "uuid": "a976378a-f6be-d182-9a1a-34ff214bfe05",
          "code": "DB13969",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13969",
          "code_system": "DRUG BANK",
          "references": [
            "8c8f3812-31e0-b4e1-45d4-6efb4c45371c"
          ]
        },
        {
          "uuid": "b3acb6f3-16e8-489b-a3b3-708ef66757b6",
          "code": "0T2NG1539G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bf4e0c22-49c8-9ee4-297d-1de80c4a54e9",
          "code": "0T2NG1539G",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0T2NG1539G",
          "code_system": "DAILYMED",
          "references": [
            "29ada1f8-769d-f33a-6d8f-090d6b0d02a6"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8107e5be-1525-4173-a73f-fbdedfc48487",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8dae87c8-d1fb-42b2-82f4-878142e75359",
            "refuuid": "cf570c69-6099-4fed-9582-5fbe24cf766d",
            "name": "QUATERNIUM-24 CATION",
            "unii": "KLP7T780EN",
            "linking_id": "KLP7T780EN",
            "ref_pname": "QUATERNIUM-24 CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "444c47b9-83e0-45b9-b1c0-cc26869da1e9",
          "name": "1-DECANAMINIUM, N,N-DIMETHYL-N-OCTYL-, CHLORIDE",
          "stdName": "1-DECANAMINIUM, N,N-DIMETHYL-N-OCTYL-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "199ded36-9898-4d08-91ae-492d0407fab0"
          ],
          "display_name": false
        },
        {
          "uuid": "b34f802f-475a-4edd-a835-03ca7bb88e07",
          "name": "1-DECANAMINIUM, N,N-DIMETHYL-N-OCTYL-, CHLORIDE (1:1)",
          "stdName": "1-DECANAMINIUM, N,N-DIMETHYL-N-OCTYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "199ded36-9898-4d08-91ae-492d0407fab0"
          ],
          "display_name": false
        },
        {
          "uuid": "0f78211c-12da-47ce-9326-b0c2d6953d0a",
          "name": "AEC QUATERNIUM-24",
          "stdName": "AEC QUATERNIUM-24",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "5baf0bf8-a3aa-4e87-b3c7-7831377c1507"
          ],
          "display_name": false
        },
        {
          "uuid": "88b26c7f-3cb3-42c7-854a-f8bf60ab88ae",
          "name": "AMMONIUM, DECYLDIMETHYLOCTYL, CHLORIDE",
          "stdName": "AMMONIUM, DECYLDIMETHYLOCTYL, CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "5baf0bf8-a3aa-4e87-b3c7-7831377c1507"
          ],
          "display_name": false
        },
        {
          "uuid": "0f8905dd-1d05-4870-baeb-344afd5e8c7e",
          "name": "BARDAC 2050",
          "stdName": "BARDAC 2050",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "5baf0bf8-a3aa-4e87-b3c7-7831377c1507"
          ],
          "display_name": false
        },
        {
          "uuid": "48ddf04d-6b6c-4438-affb-ccc0a2624df1",
          "name": "DECYLDIMETHYLOCTYLAMMONIUM CHLORIDE",
          "stdName": "DECYLDIMETHYLOCTYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "199ded36-9898-4d08-91ae-492d0407fab0"
          ],
          "display_name": false
        },
        {
          "uuid": "a9e109df-24a0-4c6a-a49b-c93d9c0e758b",
          "name": "DECYLOCTYLDIMETHYLAMMONIUM CHLORIDE",
          "stdName": "DECYLOCTYLDIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "199ded36-9898-4d08-91ae-492d0407fab0"
          ],
          "display_name": false
        },
        {
          "uuid": "99d6d4ef-5cf5-461b-aaed-ed50fd40f530",
          "name": "DECYLOCTYLDIMONIUM CHLORIDE",
          "stdName": "DECYLOCTYLDIMONIUM CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "eebc5fda-204e-46f3-bc9e-2ea5a242dad1"
          ],
          "display_name": false
        },
        {
          "uuid": "8bc1c38c-30cf-4360-9a39-000ba2186a83",
          "name": "DIMETHYL-N-OCTYL-1-DECANAMINIUM CHLORIDE, N,N-",
          "stdName": "DIMETHYL-N-OCTYL-1-DECANAMINIUM CHLORIDE, N,N-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "642778a4-5160-4355-9eca-965819b1e257"
          ],
          "display_name": false
        },
        {
          "uuid": "cb6ee667-74b4-4284-98c5-4f496d812ab2",
          "name": "MAQUAT 4050",
          "stdName": "MAQUAT 4050",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "5baf0bf8-a3aa-4e87-b3c7-7831377c1507"
          ],
          "display_name": false
        },
        {
          "uuid": "fae0f6e4-ad5f-4bcf-9413-1a9e56352626",
          "name": "OCTYL DECYL DIMETHYL AMMONIUM CHLORIDE",
          "stdName": "OCTYL DECYL DIMETHYL AMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "74ce6615-b2f5-4968-b84d-01cc7497b9b5"
          ],
          "display_name": false
        },
        {
          "uuid": "6eebf862-ed4e-441a-92b9-ef4ad07dd354",
          "name": "QUATERMIUM-24",
          "stdName": "QUATERMIUM-24",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "e9e34ce0-2c3c-4390-bcd7-565b0e9ee762"
          ],
          "display_name": false
        },
        {
          "uuid": "7e65ad89-52c3-4f3e-9751-c2a5835126df",
          "name": "QUATERNIUM-24",
          "stdName": "QUATERNIUM-24",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae62179-5556-421e-af7f-252ebbeacf3b",
            "5230f766-d7c4-452d-ad83-8c8e1221617f",
            "5baf0bf8-a3aa-4e87-b3c7-7831377c1507"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6518d664-31c4-4ba0-b39c-e6bfc9dba4e3",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "642778a4-5160-4355-9eca-965819b1e257",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5baf0bf8-a3aa-4e87-b3c7-7831377c1507",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ae62179-5556-421e-af7f-252ebbeacf3b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "199ded36-9898-4d08-91ae-492d0407fab0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eebc5fda-204e-46f3-bc9e-2ea5a242dad1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74ce6615-b2f5-4968-b84d-01cc7497b9b5",
          "citation": "HEALTH CANADA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9e34ce0-2c3c-4390-bcd7-565b0e9ee762",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89b732b3-80df-4d6e-bab7-e06bad71a817",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3489276f-8f59-4352-a9f4-8175e5d37a42",
          "citation": "SRS import [0T2NG1539G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0T2NG1539G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bff68aa-2709-4e68-b75e-6d58cf1bcb73",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5230f766-d7c4-452d-ad83-8c8e1221617f",
          "citation": "QUATERNIUM-24 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9fde8711-8525-164d-52a2-528f767600b7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=32426-11-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8c8f3812-31e0-b4e1-45d4-6efb4c45371c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9c98eac9-2393-4139-b022-7603943ade6e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "29ada1f8-769d-f33a-6d8f-090d6b0d02a6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "25038c2a-d09e-4b78-9c44-6fa70a44db2e",
          "id": "25038c2a-d09e-4b78-9c44-6fa70a44db2e",
          "molfile": "\n  Marvin  01132102032D          \n\n  1  0  0  0  0  0            999 V2000\n   12.1577   -5.1731    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f6c87ed6-850a-4080-bb8b-130fa25b6f3a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "bdb419b1-51b2-4e4a-9c09-e936fb33f120",
          "id": "bdb419b1-51b2-4e4a-9c09-e936fb33f120",
          "molfile": "\n  Marvin  01132109492D          \n\n 21 20  0  0  0  0            999 V2000\n    3.6510   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3654   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0799   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7943   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5087   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2232   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9376   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6521   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3665   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0809   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0809   -5.6750    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   10.7954   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6643   -5.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3665   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6521   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9376   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2232   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5087   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7943   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0799   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3654   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  CHG  1  11   1\nM  END",
          "smiles": "CCCCCCCCCC[N+](C)(C)CCCCCCCC",
          "formula": "C20H44N",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ed39ef9b-998a-4cb6-a76c-cc7f93ab7fb7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "298.5708",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b06afc24-c030-4613-81d4-00b77bee3f36",
      "version": "6",
      "structure": {
        "id": "71a3b0c0-4880-4ea7-8146-2e08ec3bfd84",
        "molfile": "\n  Marvin  01132105532D          \n\n 22 20  0  0  0  0            999 V2000\n    4.3654   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0799   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7943   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5087   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2232   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9376   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6521   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3665   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0809   -5.6750    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.7954   -6.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0809   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3665   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6521   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9376   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2232   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5087   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7943   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0799   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6643   -5.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1577   -5.1731    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n    4.3654   -4.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6510   -4.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n  9 19  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  CHG  2   9   1  20  -1\nM  END",
        "smiles": "CCCCCCCCCC[N+](C)(C)CCCCCCCC.[Cl-]",
        "formula": "C20H44N.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "334.0238",
        "optical_activity": "NONE",
        "references": [
          "3489276f-8f59-4352-a9f4-8175e5d37a42",
          "6bff68aa-2709-4e68-b75e-6d58cf1bcb73"
        ],
        "stereo_centers": 0
      },
      "unii": "0T2NG1539G"
    }
  ]
}