{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ed3e7be5-7ae5-4ceb-a741-1c884ed089f5",
          "code": "G03BB01",
          "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|ANDROGENS|5-androstanon (3) derivatives|mesterolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=G03BB01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "6318291f-92ca-411f-94e5-7e2e449a5b34",
          "code": "QG03BB01",
          "comments": "VATC|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|ANDROGENS|5-androstanon (3) derivatives|mesterolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QG03BB01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "47159c8d-4ddd-4ff9-8896-2b31e990a8e1",
          "code": "1424-00-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1424-00-6",
          "code_system": "CAS",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f",
            "5c2f366f-55a7-4205-917b-4331a041bcf6"
          ]
        },
        {
          "uuid": "33af6fd3-8fd5-4083-98ab-a48b2a4383ce",
          "code": "C87227",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87227",
          "code_system": "NCI_THESAURUS",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "c74f82cf-ded1-4a6f-9123-dcd5fc923f32",
          "code": "D008655",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008655",
          "code_system": "MESH",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "d3d8b10f-a611-4b9a-bab0-6defd85dafde",
          "code": "MESTEROLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mesterolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "d156d003-01c8-49c0-b289-4f7ad2c9f299",
          "code": "SUB08790MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "d50249f0-60d8-423a-b5f1-429de0fb7cc6",
          "code": "1965",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1965",
          "code_system": "INN",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "442e8774-a5dc-4c62-9990-8a7fba5dfcd8",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "3801aa05-c1a4-4e73-9add-87cfe9cb6f6e",
          "code": "215-836-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.014.397",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "42ca3ae1-b234-4ec5-b7dd-14e990089641",
          "code": "6781",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6781/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "fbccf36a-9577-4f0c-8b57-b537cd14a424",
          "code": "m7256",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7256?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "dc1f0fa6-9635-4c44-8bf5-17e926425eed",
          "code": "CHEMBL258918",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL258918",
          "code_system": "ChEMBL",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "90b40187-6f77-477e-b24a-e89a057f8e56",
          "code": "15020",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15020",
          "code_system": "PUBCHEM",
          "references": [
            "be1b0200-d642-47ba-8a69-08814501502f"
          ]
        },
        {
          "uuid": "e118b03c-490a-8129-a6a2-a72ac37bba06",
          "code": "C243",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Therapeutic Androgen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C243",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bb0baf03-1133-e010-3cad-736568654fea"
          ]
        },
        {
          "uuid": "b09dc031-c7ae-4dab-bce9-3719e12c3154",
          "code": "0SRQ75X9I9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "12e68846-6b99-f7cf-8382-0cc2e53a52e7",
          "code": "3342",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3342",
          "code_system": "DRUG CENTRAL",
          "references": [
            "bb0baf03-1133-e010-3cad-736568654fea"
          ]
        },
        {
          "uuid": "e79085d7-39a1-d52f-9868-ba851b12f1b5",
          "code": "DB13587",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13587",
          "code_system": "DRUG BANK",
          "references": [
            "bb0baf03-1133-e010-3cad-736568654fea"
          ]
        },
        {
          "uuid": "4558d1e7-e046-c907-f1bf-0869f88341dd",
          "code": "Designer-drugs-Mesterolone",
          "comments": "Wikipedia|List of designer drugs|Androgens|DHT based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "bb0baf03-1133-e010-3cad-736568654fea"
          ]
        },
        {
          "uuid": "007b2e2f-110b-e1ac-04a3-c74cdc001968",
          "code": "75054",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=75054",
          "code_system": "NSC",
          "references": [
            "9bd7a01c-cee5-14bc-ea8d-30c21bae4c86"
          ]
        },
        {
          "uuid": "3c47251c-73b7-c077-7e41-4196d8dc96ab",
          "code": "100000091044",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0280a632-7e7a-5dd5-ca07-6cf510ac818e"
          ]
        },
        {
          "uuid": "7675628e-0238-3b7c-e36e-912d2fa0d0e2",
          "code": "DTXSID90878533",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90878533",
          "code_system": "EPA CompTox",
          "references": [
            "bb0baf03-1133-e010-3cad-736568654fea"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c66c7683-6693-4d20-8820-4fb8577acf45",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7204c8fc-0296-4a35-be9d-629ab20bed34",
            "refuuid": "57af56c5-2f3b-4f76-a8a6-b7b59d8a5666",
            "name": "MESTEROLONE",
            "unii": "0SRQ75X9I9",
            "linking_id": "0SRQ75X9I9",
            "ref_pname": "MESTEROLONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c2881f52-c7f9-46be-b6c7-556de668606e",
          "amount": {
            "uuid": "c4173af8-9f7e-4388-b6c6-336f6792ea2f",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "6abb9792-cf0c-49e5-8b96-91df4cf0ee65"
          ],
          "related_substance": {
            "uuid": "e5834c44-30fd-417e-9297-b9f0052aabf0",
            "refuuid": "76e3cb7a-8513-40f3-89de-9351381277a7",
            "name": "1.ALPHA.-METHYLTESTOSTERONE",
            "unii": "04HE5JTH63",
            "linking_id": "04HE5JTH63",
            "ref_pname": "1.ALPHA.-METHYLTESTOSTERONE"
          }
        },
        {
          "uuid": "fb89f26d-4ef2-4e4a-9f47-a36afef0c243",
          "amount": {
            "uuid": "15e162c9-4454-4778-a00a-c77698c2d685",
            "units": "%",
            "high_limit": 0.5
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "a342c52d-1653-4c0a-8702-3e470af2f92d"
          ],
          "related_substance": {
            "uuid": "b8b38ca0-bbb1-4c73-bf5f-fe0cc3e246d0",
            "refuuid": "5bcb32b4-1b14-4143-b7d7-5ca9cead4c40",
            "name": "(1.ALPHA.,3.BETA.,5.ALPHA.,17.BETA.)-1-METHYLANDROSTANE-3,17-DIOL",
            "unii": "3E7IW352LX",
            "linking_id": "3E7IW352LX",
            "ref_pname": "(1.ALPHA.,3.BETA.,5.ALPHA.,17.BETA.)-1-METHYLANDROSTANE-3,17-DIOL"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8c07ccc4-7d27-4f9c-a4ce-1f1d39b2f770",
          "name": "17β-Hydroxy-1α-methyl-5α-androstan-3-one",
          "stdName": "17.BETA.-HYDROXY-1.ALPHA.-METHYL-5.ALPHA.-ANDROSTAN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2d0827c-0cf4-4197-8c8b-09341f667d95"
          ],
          "display_name": false
        },
        {
          "uuid": "5ff6c033-171b-4f89-85c3-fad42fe83edc",
          "name": "ANDROSTAN-3-ONE, 17-HYDROXY-1-METHYL-, (1.ALPHA.,5.ALPHA.,17.BETA.)-",
          "stdName": "ANDROSTAN-3-ONE, 17-HYDROXY-1-METHYL-, (1.ALPHA.,5.ALPHA.,17.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2d0827c-0cf4-4197-8c8b-09341f667d95"
          ],
          "display_name": false
        },
        {
          "uuid": "306567d4-e041-4e40-9c77-efe7b5768ec8",
          "name": "ANDROVIRON",
          "stdName": "ANDROVIRON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6cacae6-57e3-4cb1-82a0-5644d7a1bc97"
          ],
          "display_name": false
        },
        {
          "uuid": "5d65ef45-3812-425b-9392-0e81778e3667",
          "name": "MESTEROLONE",
          "stdName": "MESTEROLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02ca5b73-230d-4e07-83c2-ce0a83a24581",
            "65d61bc3-8699-45ab-8173-26252ad4e605",
            "7e37fe1f-f95e-4c0e-8c5d-5f3da6852528",
            "9aaa549d-b1f2-444b-a412-f7e5f2b6770c",
            "cc668627-25ac-41f1-8196-ede6c3fded91",
            "74abd535-6a8d-4bf0-a010-947471aa7364",
            "480675f7-53fe-4617-8dc3-db7cb387c8bb",
            "fa026189-ee61-4e17-aa78-4751d6cbe0ea",
            "ac638bf1-c9d0-41db-a703-f55f101f36b9",
            "f53bb2ac-161e-452a-8830-52d429a8092e",
            "a2c1b41f-44dd-4427-8ad2-0b4363579867",
            "7f791cd5-1b90-4c32-b49b-3602bdd98c42",
            "1feac1b4-1058-4ce1-9669-6967ff722a85"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "fe18ed27-6a25-4eac-ada7-f62a76f6ceb3",
              "name_org": "INN"
            },
            {
              "uuid": "7b75c0a0-86b7-45dd-8a70-ef7b398fa43a",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "719fd001-a78e-7a89-551f-8bcae2482017",
          "name": "MESTEROLONE [EP IMPURITY]",
          "stdName": "MESTEROLONE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac638bf1-c9d0-41db-a703-f55f101f36b9"
          ],
          "display_name": false
        },
        {
          "uuid": "cc4b140b-13c1-62b2-650e-d884a7266a07",
          "name": "MESTEROLONE [EP MONOGRAPH]",
          "stdName": "MESTEROLONE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac3a670-1380-183d-5441-931b0fe4b2a4"
          ],
          "display_name": false
        },
        {
          "uuid": "607335b6-eeef-4f64-8692-4712f7113fe0",
          "name": "MESTEROLONE [MART.]",
          "stdName": "MESTEROLONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "480675f7-53fe-4617-8dc3-db7cb387c8bb"
          ],
          "display_name": false
        },
        {
          "uuid": "59780eac-19bc-40d2-bdef-d0d3540862b1",
          "name": "MESTEROLONE [MI]",
          "stdName": "MESTEROLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e37fe1f-f95e-4c0e-8c5d-5f3da6852528"
          ],
          "display_name": false
        },
        {
          "uuid": "eafeaeff-7637-47a7-8fe0-0cda87b2dcde",
          "name": "MESTEROLONE [USAN]",
          "stdName": "MESTEROLONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1feac1b4-1058-4ce1-9669-6967ff722a85"
          ],
          "display_name": false
        },
        {
          "uuid": "8041d291-42ae-72ae-7d97-e450f4d1427e",
          "name": "Mesterolone [WHO-DD]",
          "stdName": "MESTEROLONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b97863fa-b109-9c63-7c26-70949f86ec71"
          ],
          "display_name": false
        },
        {
          "uuid": "3b3110ee-b3c9-419b-8bbf-810f1e5ef3ce",
          "name": "NSC-75054",
          "stdName": "NSC-75054",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2d0827c-0cf4-4197-8c8b-09341f667d95"
          ],
          "display_name": false
        },
        {
          "uuid": "76c38846-cbd6-41e9-8ce7-d25b7ac61e1b",
          "name": "PROVIRON",
          "stdName": "PROVIRON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6cacae6-57e3-4cb1-82a0-5644d7a1bc97"
          ],
          "display_name": false
        },
        {
          "uuid": "657d0b8b-1772-456f-bfac-0609e024aafc",
          "name": "SH 723",
          "stdName": "SH 723",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2d0827c-0cf4-4197-8c8b-09341f667d95"
          ],
          "display_name": false
        },
        {
          "uuid": "72912ac0-46f0-4124-b87e-c5add6378390",
          "name": "SH-723",
          "stdName": "SH-723",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8375d488-ce38-4c99-bf4d-e01a34dc5cf2"
          ],
          "display_name": false
        },
        {
          "uuid": "2269a135-6894-4423-a1a8-958079a85c93",
          "name": "TESTIWOP",
          "stdName": "TESTIWOP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6cacae6-57e3-4cb1-82a0-5644d7a1bc97"
          ],
          "display_name": false
        },
        {
          "uuid": "e7b4bd82-fe00-4026-afdb-454a80b9faa1",
          "name": "mesterolone [INN]",
          "stdName": "MESTEROLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f53bb2ac-161e-452a-8830-52d429a8092e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a342c52d-1653-4c0a-8702-3e470af2f92d",
          "citation": "European Pharmacopoeia Online 9.8, Mesterolone Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6abb9792-cf0c-49e5-8b96-91df4cf0ee65",
          "citation": "European Pharmacopoeia Online 9.8, Mesterolone Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7f791cd5-1b90-4c32-b49b-3602bdd98c42",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b2d0827c-0cf4-4197-8c8b-09341f667d95",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8375d488-ce38-4c99-bf4d-e01a34dc5cf2",
          "citation": "USP dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f53bb2ac-161e-452a-8830-52d429a8092e",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1feac1b4-1058-4ce1-9669-6967ff722a85",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac638bf1-c9d0-41db-a703-f55f101f36b9",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "480675f7-53fe-4617-8dc3-db7cb387c8bb",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e37fe1f-f95e-4c0e-8c5d-5f3da6852528",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65d61bc3-8699-45ab-8173-26252ad4e605",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6cacae6-57e3-4cb1-82a0-5644d7a1bc97",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be1b0200-d642-47ba-8a69-08814501502f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389659000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a1b3e01-c1c0-460f-b5b4-e8355558ea6c",
          "citation": "SRS import [0SRQ75X9I9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0SRQ75X9I9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389659000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc668627-25ac-41f1-8196-ede6c3fded91",
          "citation": "MESTEROLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74abd535-6a8d-4bf0-a010-947471aa7364",
          "citation": "MESTEROLONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a2c1b41f-44dd-4427-8ad2-0b4363579867",
          "citation": "MESTEROLONE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9aaa549d-b1f2-444b-a412-f7e5f2b6770c",
          "citation": "MESTEROLONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "02ca5b73-230d-4e07-83c2-ce0a83a24581",
          "citation": "MESTEROLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fa026189-ee61-4e17-aa78-4751d6cbe0ea",
          "citation": "MESTEROLONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0280a632-7e7a-5dd5-ca07-6cf510ac818e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "bb0baf03-1133-e010-3cad-736568654fea",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5c2f366f-55a7-4205-917b-4331a041bcf6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7ac3a670-1380-183d-5441-931b0fe4b2a4",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "b97863fa-b109-9c63-7c26-70949f86ec71",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9bd7a01c-cee5-14bc-ea8d-30c21bae4c86",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "185846ac-3933-47e2-ab87-a73839f135f5",
          "id": "185846ac-3933-47e2-ab87-a73839f135f5",
          "molfile": "\n  Marvin  01132101272D          \n\n 22 25  0  0  1  0            999 V2000\n   10.8023   -3.6898    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.8023   -2.8648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2817   -4.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8023   -5.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0140   -4.7593    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.2995   -5.1788    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.2995   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5942   -6.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8797   -6.0040    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1605   -6.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4461   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7314   -6.4142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4461   -5.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1605   -4.7593    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.1605   -3.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8797   -5.1788    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.8797   -4.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5942   -4.7593    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.5942   -3.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2995   -3.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0140   -3.9433    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.0140   -3.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 21  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 21  1  0  0  0  0\n  6  7  1  6  0  0  0\n 18  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 16  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1CC(=O)C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@@]4(C)CC[C@@H]3[C@@]12C)O",
          "formula": "C20H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5fcfe873-f823-4932-afcd-a2a808a1e6a9"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "304.4676",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "57af56c5-2f3b-4f76-a8a6-b7b59d8a5666",
      "version": "22",
      "structure": {
        "id": "3ce559ca-33b0-4e23-9af6-0a446db38f69",
        "molfile": "\n  Marvin  01132103142D          \n\n 26 29  0  0  1  0            999 V2000\n    7.8797   -5.1788    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5942   -4.7593    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2995   -5.1788    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.0140   -4.7593    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.8023   -5.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2817   -4.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8023   -3.6898    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.0140   -3.9433    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2995   -3.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5942   -3.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0140   -3.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8023   -2.8648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0140   -5.5753    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2995   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5942   -6.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8797   -6.0040    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1605   -6.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4461   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4461   -5.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1605   -4.7593    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1605   -3.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7314   -6.4142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8797   -6.8291    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2995   -4.3582    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5942   -5.5753    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8797   -4.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  2  1  0  0  0  0\n  8 11  1  1  0  0  0\n  8  4  1  0  0  0  0\n  7 12  1  1  0  0  0\n  4 13  1  6  0  0  0\n 14  3  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  1  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20  1  1  0  0  0  0\n 20 21  1  6  0  0  0\n 22 18  2  0  0  0  0\n 16 23  1  6  0  0  0\n  3 24  1  1  0  0  0\n  2 25  1  6  0  0  0\n  1 26  1  1  0  0  0\nM  END",
        "smiles": "C[C@H]1CC(=O)C[C@]2([H])CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@]3([H])[C@@]12C)O",
        "formula": "C20H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "304.4676",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b2d0827c-0cf4-4197-8c8b-09341f667d95",
          "4a1b3e01-c1c0-460f-b5b4-e8355558ea6c",
          "f53bb2ac-161e-452a-8830-52d429a8092e"
        ],
        "stereo_centers": 8
      },
      "unii": "0SRQ75X9I9"
    }
  ]
}