{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2067233a-3e11-47df-8bf6-94a05ddff4fc",
          "code": "C04AX24",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|PERIPHERAL VASODILATORS|PERIPHERAL VASODILATORS|Other peripheral vasodilators|visnadine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C04AX24&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "9f73d48f-755a-4707-9735-5e5c31e425a0",
          "code": "QC04AX24",
          "comments": "VATC|PERIPHERAL VASODILATORS|PERIPHERAL VASODILATORS|Other peripheral vasodilators|visnadine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC04AX24&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "e8b8d982-61d4-4754-8600-9e9dc5b7ee08",
          "code": "477-32-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=477-32-7",
          "code_system": "CAS",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0",
            "e358ed1a-89a9-4088-9bbb-10d5254932b7"
          ]
        },
        {
          "uuid": "47209d1d-6b6e-4eb6-abd0-b66ce9d14423",
          "code": "C87287",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87287",
          "code_system": "NCI_THESAURUS",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "3a40892b-254a-44df-adb6-734a9221661c",
          "code": "C067604",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67067604",
          "code_system": "MESH",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "4aedcf47-7f9b-4f6b-a89c-659b48b9dcae",
          "code": "VISNADINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Visnadine",
          "code_system": "WIKIPEDIA",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "636f9ef4-8e24-450e-9151-ecab9ad06165",
          "code": "SUB00083MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "9960b772-7a44-4755-ab9c-70541aafde14",
          "code": "1832",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1832",
          "code_system": "INN",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "17560d7e-534b-43d2-aa35-2bbd2a9bca94",
          "code": "207-515-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.833",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "903059c5-267a-45fc-8331-6a8ef3e46762",
          "code": "m11478",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11478?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "31ddbcfc-8c4a-427e-a41f-28dd27667153",
          "code": "CHEMBL2104448",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104448",
          "code_system": "ChEMBL",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "8a1006c2-f262-4be5-8029-5fae33593426",
          "code": "442151",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/442151",
          "code_system": "PUBCHEM",
          "references": [
            "aa82b084-c73b-42fa-a25e-1d037e10d4c0"
          ]
        },
        {
          "uuid": "bbe648ce-97f6-c7d5-9b14-c154e1b6c02f",
          "code": "C29707",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Vasodilating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f5c1e592-61c3-acb8-a6ad-02a76a75cb8e"
          ]
        },
        {
          "uuid": "dad763ab-e202-421e-a27d-008735e27b4e",
          "code": "0RL4V0K263",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "039c59cb-d054-7d1c-c13d-e556abc250e6",
          "code": "3649",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3649",
          "code_system": "DRUG CENTRAL",
          "references": [
            "f5c1e592-61c3-acb8-a6ad-02a76a75cb8e"
          ]
        },
        {
          "uuid": "f2bb83c6-fbb3-bfd6-91bd-8d5afb56c939",
          "code": "DB13355",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13355",
          "code_system": "DRUG BANK",
          "references": [
            "f5c1e592-61c3-acb8-a6ad-02a76a75cb8e"
          ]
        },
        {
          "uuid": "2698fe16-ed4e-15d9-9555-e60965507cd5",
          "code": "100000079325",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "58dc998f-6e0f-9e16-37bf-97e0ce633486"
          ]
        },
        {
          "uuid": "41a67c27-faeb-72fd-746d-3f8ecbcd9dff",
          "code": "DTXSID301023583",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301023583",
          "code_system": "EPA CompTox",
          "references": [
            "f5c1e592-61c3-acb8-a6ad-02a76a75cb8e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9af9b83c-f89d-4ab1-b62c-52b881de2077",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ad6fef6c-b62b-4217-a464-e91d16d33228",
            "refuuid": "58626506-e0d3-46c2-a97a-d2565dc526cf",
            "name": "VISNADINE",
            "unii": "0RL4V0K263",
            "linking_id": "0RL4V0K263",
            "ref_pname": "VISNADINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4d1c5235-fda9-4e31-883d-f1189bb9b626",
          "name": "3,4,5-TRIHYDROXY-2,2-DIMETHYL-6-CHROMANACRYLIC ACID D-LACTONE 4-ACETATE 3-(2-METHYLBUTYRATE).",
          "stdName": "3,4,5-TRIHYDROXY-2,2-DIMETHYL-6-CHROMANACRYLIC ACID D-LACTONE 4-ACETATE 3-(2-METHYLBUTYRATE).",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0aa091dc-77de-49e5-b317-e63168e6517b"
          ],
          "display_name": false
        },
        {
          "uuid": "0627b9ce-9de5-bf97-4612-b4f69cce8868",
          "name": "VISNADIN",
          "stdName": "VISNADIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c17d349-982c-ae89-d40a-8b59ceb9ce19"
          ],
          "display_name": false
        },
        {
          "uuid": "5e14e2e3-a440-47d4-9040-dca30b2e9dc1",
          "name": "VISNADINE",
          "stdName": "VISNADINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f2a460d-6e6f-4702-a391-6beba6743c3d",
            "04fa565c-5696-4654-9753-aefad08909f3",
            "3dc91395-b14f-4f22-8876-66cce90be9f5",
            "02004c2c-c574-4d62-8ed6-624fdf425d68",
            "05d50bae-6a11-4a4b-915d-9ee4561f131f",
            "3faab682-a464-4630-b03e-6cbcf13e81ea",
            "d26709c6-8e15-44ea-bd78-5db13cbcb917",
            "099b0c92-c23a-462d-98e2-3ee357af8338",
            "0aa091dc-77de-49e5-b317-e63168e6517b",
            "ee4d2ec6-65f1-43c3-ad65-6e127be37d85",
            "c78f8054-4e61-4c97-9e18-ecd79fd84109"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3030a20f-6c85-4069-9170-8a8bcbc18932",
              "name_org": "INN"
            },
            {
              "uuid": "7468f69e-93f7-49ca-885e-ddd07212350d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4327cd15-5b06-40f8-a810-be3537a1a1b1",
          "name": "VISNADINE [MART.]",
          "stdName": "VISNADINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05d50bae-6a11-4a4b-915d-9ee4561f131f"
          ],
          "display_name": false
        },
        {
          "uuid": "9a661234-c549-4fbe-9949-0f72bae8b215",
          "name": "VISNADINE [MI]",
          "stdName": "VISNADINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f2a460d-6e6f-4702-a391-6beba6743c3d"
          ],
          "display_name": false
        },
        {
          "uuid": "a2cc045d-9114-fd5e-a09b-1ee6277dbeaa",
          "name": "Visnadine [WHO-DD]",
          "stdName": "VISNADINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e850ffa-9b29-afab-d183-6de5e40fea6e"
          ],
          "display_name": false
        },
        {
          "uuid": "aa5ad83f-0415-4cea-8a26-5fe6edee45fd",
          "name": "visnadine [INN]",
          "stdName": "VISNADINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04fa565c-5696-4654-9753-aefad08909f3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0aa091dc-77de-49e5-b317-e63168e6517b",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "04fa565c-5696-4654-9753-aefad08909f3",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "05d50bae-6a11-4a4b-915d-9ee4561f131f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f2a460d-6e6f-4702-a391-6beba6743c3d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee4d2ec6-65f1-43c3-ad65-6e127be37d85",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d26709c6-8e15-44ea-bd78-5db13cbcb917",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa82b084-c73b-42fa-a25e-1d037e10d4c0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390306000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e641df5-5d28-43c9-97ff-22d5b6e6e1c1",
          "citation": "SRS import [0RL4V0K263]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0RL4V0K263",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390306000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "099b0c92-c23a-462d-98e2-3ee357af8338",
          "citation": "VISNADINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3dc91395-b14f-4f22-8876-66cce90be9f5",
          "citation": "VISNADINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "02004c2c-c574-4d62-8ed6-624fdf425d68",
          "citation": "VISNADINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3faab682-a464-4630-b03e-6cbcf13e81ea",
          "citation": "VISNADINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c78f8054-4e61-4c97-9e18-ecd79fd84109",
          "citation": "VISNADINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "58dc998f-6e0f-9e16-37bf-97e0ce633486",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6c17d349-982c-ae89-d40a-8b59ceb9ce19",
          "citation": "https://www.sigmaaldrich.com/catalog/product/sigma/smb00087?lang=en&region=US",
          "doc_type": "SIGMA-ALDRICH",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "f5c1e592-61c3-acb8-a6ad-02a76a75cb8e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e358ed1a-89a9-4088-9bbb-10d5254932b7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2e850ffa-9b29-afab-d183-6de5e40fea6e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5d7dd8d1-81b2-49cd-8a9a-21cf728e6ea9",
          "id": "5d7dd8d1-81b2-49cd-8a9a-21cf728e6ea9",
          "molfile": "\n  Marvin  01132104502D          \n\n 28 30  0  0  1  0            999 V2000\n    2.7291   -2.0542    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.7291   -1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9679   -2.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2446   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5059   -2.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5059   -3.1425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2167   -2.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2766   -2.4411    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.9968   -2.0386    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.9968   -1.4284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2671   -1.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6382   -1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2671   -0.3999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7075   -2.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7075   -3.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9968   -3.6645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2766   -3.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7765   -3.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7136   -2.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4278   -3.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1479   -3.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1479   -2.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8808   -2.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8808   -1.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1229   -0.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1229   -0.2112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4278   -1.2115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4278   -2.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  6  0  0  0\n  8  9  1  0  0  0  0\n  8 17  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 14 28  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 28 22  2  0  0  0  0\n 23 24  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n 27 25  1  0  0  0  0\n 28 27  1  0  0  0  0\nM  END",
          "smiles": "CC[C@@H](C)C(=O)O[C@@H]1[C@@H](c2c(ccc3ccc(=O)oc32)OC1(C)C)OC(=O)C",
          "formula": "C21H24O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "40f72a62-f820-40a7-af16-f35f5767bb0c"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "388.4119",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "58626506-e0d3-46c2-a97a-d2565dc526cf",
      "version": "14",
      "structure": {
        "id": "9b34b0ad-779a-49f7-bfc3-c4707529e778",
        "molfile": "\n  Marvin  01132108042D          \n\n 28 30  0  0  1  0            999 V2000\n    6.7075   -2.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9968   -2.0386    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.4278   -2.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7075   -3.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2766   -2.4411    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9968   -1.4284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1479   -2.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4278   -1.2115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9968   -3.6645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4278   -3.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2766   -3.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2167   -2.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2671   -1.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1479   -3.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8808   -2.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1229   -0.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7765   -3.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7136   -2.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5059   -2.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6382   -1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2671   -0.3999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8808   -1.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1229   -0.2112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7291   -2.0542    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5059   -3.1425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9679   -2.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7291   -1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2446   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  6  0  0  0\n  3  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  5 12  1  6  0  0  0\n  6 13  1  0  0  0  0\n  7 14  1  0  0  0  0\n  7 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n 11 17  1  0  0  0  0\n 11 18  1  0  0  0  0\n 12 19  1  0  0  0  0\n 13 20  1  0  0  0  0\n 13 21  2  0  0  0  0\n 15 22  2  0  0  0  0\n 16 23  2  0  0  0  0\n 19 24  1  0  0  0  0\n 19 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  1  0  0  0\n 26 28  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 14  2  0  0  0  0\n 16 22  1  0  0  0  0\nM  END",
        "smiles": "CC[C@@H](C)C(=O)O[C@@H]1[C@@H](c2c(ccc3ccc(=O)oc32)OC1(C)C)OC(=O)C",
        "formula": "C21H24O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "388.4119",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8e641df5-5d28-43c9-97ff-22d5b6e6e1c1",
          "0aa091dc-77de-49e5-b317-e63168e6517b",
          "04fa565c-5696-4654-9753-aefad08909f3"
        ],
        "stereo_centers": 3
      },
      "unii": "0RL4V0K263"
    }
  ]
}