{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c8c8aeae-487a-4c87-be12-742be8129acb",
          "code": "115-39-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=115-39-9",
          "code_system": "CAS",
          "references": [
            "ca02e424-1c60-48e4-8a73-8b8f3ecb0f06",
            "fb2a2281-f480-45b5-b9a8-4f9bb3134e5f"
          ]
        },
        {
          "uuid": "2ed7611d-5c1f-4fd4-a1b1-30c71eb3aa48",
          "code": "BROMOPHENOL BLUE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bromophenol_blue",
          "code_system": "WIKIPEDIA",
          "references": [
            "ca02e424-1c60-48e4-8a73-8b8f3ecb0f06"
          ]
        },
        {
          "uuid": "911a6ca4-70e9-411e-be12-e5d331a8616f",
          "code": "m2724",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2724?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ca02e424-1c60-48e4-8a73-8b8f3ecb0f06"
          ]
        },
        {
          "uuid": "9a42470f-70b5-41aa-9571-d20b47c48fc9",
          "code": "CHEMBL2103765",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2103765",
          "code_system": "ChEMBL",
          "references": [
            "ca02e424-1c60-48e4-8a73-8b8f3ecb0f06"
          ]
        },
        {
          "uuid": "455719b9-8b43-4041-b5bc-c32d47997931",
          "code": "204-086-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.715",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ca02e424-1c60-48e4-8a73-8b8f3ecb0f06"
          ]
        },
        {
          "uuid": "cc2302d0-c6c4-44c7-aa2a-ef58579b0fd4",
          "code": "8272",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8272",
          "code_system": "PUBCHEM",
          "references": [
            "ca02e424-1c60-48e4-8a73-8b8f3ecb0f06"
          ]
        },
        {
          "uuid": "6277f1f7-36c4-8336-d316-71674f5d9680",
          "code": "7728",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7728",
          "code_system": "HSDB",
          "references": [
            "a323c06a-79ce-6c88-c9f1-22ce750c3c39"
          ]
        },
        {
          "uuid": "1a139221-a400-51c4-d74f-73ec389c1634",
          "code": "DTXSID6041682",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6041682",
          "code_system": "EPA CompTox",
          "references": [
            "3efbce80-e1c6-4198-0b99-d262d297a1bc"
          ]
        },
        {
          "uuid": "2354bab4-1a42-4b6c-a34a-f378c2bf0175",
          "code": "0R2969YC90",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ea4e2453-7ac4-ee97-24ba-923589bf0c0d",
          "code": "7818",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7818",
          "code_system": "NSC",
          "references": [
            "ebb65c5a-34a3-f567-e7b4-377b5e686c19"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df73ffb8-057f-4475-bb0f-50b7348e6fae",
          "name": "3,3',5,5'-TETRABROMOPHENOLSULFONPHTHALEIN",
          "stdName": "3,3',5,5'-TETRABROMOPHENOLSULFONPHTHALEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9b1ad7c-366e-43b0-861f-ada99fe47598",
            "9bf89ce3-6e79-4c22-a99c-2218da0795ac"
          ],
          "display_name": false
        },
        {
          "uuid": "ebbccd4b-7d98-45d6-87ae-171da547d550",
          "name": "4,4'-(1,1-DIOXIDO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMOPHENOL)",
          "stdName": "4,4'-(1,1-DIOXIDO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMOPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9b1ad7c-366e-43b0-861f-ada99fe47598",
            "9bf89ce3-6e79-4c22-a99c-2218da0795ac"
          ],
          "display_name": false
        },
        {
          "uuid": "a64e821e-f603-4966-a34e-75699aaef53d",
          "name": "ALBUTEST",
          "stdName": "ALBUTEST",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9b1ad7c-366e-43b0-861f-ada99fe47598",
            "9bf89ce3-6e79-4c22-a99c-2218da0795ac"
          ],
          "display_name": false
        },
        {
          "uuid": "052974ef-897f-43ed-a590-2bf309ce5bbf",
          "name": "BROMOPHENOL BLUE",
          "stdName": "BROMOPHENOL BLUE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89e80cd7-c64e-4d23-97d3-3a884c9587fe",
            "e9b1ad7c-366e-43b0-861f-ada99fe47598",
            "9bf89ce3-6e79-4c22-a99c-2218da0795ac",
            "460d12bb-adec-4759-ab54-fd5a96d502a2"
          ],
          "display_name": true
        },
        {
          "uuid": "fccbc134-4168-4260-a626-cf1193035e54",
          "name": "BROMOPHENOL BLUE [HSDB]",
          "stdName": "BROMOPHENOL BLUE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89e80cd7-c64e-4d23-97d3-3a884c9587fe",
            "9bf89ce3-6e79-4c22-a99c-2218da0795ac"
          ],
          "display_name": false
        },
        {
          "uuid": "75071b5e-f8fd-44ca-b4b4-d6b2ac990f11",
          "name": "BROMPHENOL BLUE",
          "stdName": "BROMPHENOL BLUE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "8c1741b6-cecc-4ef1-9e33-4d5077094ce9",
            "e249de12-a1f5-4159-ab58-836c96ee2e24",
            "9a6e03c2-e36d-426b-a135-16a40479b3e1",
            "e9b1ad7c-366e-43b0-861f-ada99fe47598",
            "9bf89ce3-6e79-4c22-a99c-2218da0795ac",
            "6d248ae1-6fb7-4c37-a30f-1c6d6a97c1f2"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7946aaa6-9d84-4949-9a36-f92bcd889b5a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "84ed490b-3af6-4cfc-bcfc-35828dbc32ad",
          "name": "BROMPHENOL BLUE [MI]",
          "stdName": "BROMPHENOL BLUE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a6e03c2-e36d-426b-a135-16a40479b3e1",
            "9bf89ce3-6e79-4c22-a99c-2218da0795ac"
          ],
          "display_name": false
        },
        {
          "uuid": "58217a26-2aeb-4504-a29f-beedc249f878",
          "name": "NSC-7818",
          "stdName": "NSC-7818",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39ba2dbe-61d4-4904-9593-c466f9ea1e0f",
            "9bf89ce3-6e79-4c22-a99c-2218da0795ac"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e9b1ad7c-366e-43b0-861f-ada99fe47598",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9bf89ce3-6e79-4c22-a99c-2218da0795ac",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a6e03c2-e36d-426b-a135-16a40479b3e1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e249de12-a1f5-4159-ab58-836c96ee2e24",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89e80cd7-c64e-4d23-97d3-3a884c9587fe",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39ba2dbe-61d4-4904-9593-c466f9ea1e0f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca02e424-1c60-48e4-8a73-8b8f3ecb0f06",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390966000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e8200a2-4777-486d-bf61-35ade1eb8bc0",
          "citation": "SRS import [0R2969YC90]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0R2969YC90",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390966000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c1741b6-cecc-4ef1-9e33-4d5077094ce9",
          "citation": "BROMPHENOL BLUE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6d248ae1-6fb7-4c37-a30f-1c6d6a97c1f2",
          "citation": "BROMPHENOL BLUE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "460d12bb-adec-4759-ab54-fd5a96d502a2",
          "citation": "BROMOPHENOL BLUE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a323c06a-79ce-6c88-c9f1-22ce750c3c39",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+115-39-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3efbce80-e1c6-4198-0b99-d262d297a1bc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=115-39-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fb2a2281-f480-45b5-b9a8-4f9bb3134e5f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ebb65c5a-34a3-f567-e7b4-377b5e686c19",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2abaf6d8-11df-42ce-ae11-b18b9d06e80b",
          "id": "2abaf6d8-11df-42ce-ae11-b18b9d06e80b",
          "molfile": "\n  Marvin  01132102192D          \n\n 29 32  0  0  0  0            999 V2000\n    2.5239   -5.7073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8501   -4.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3281   -4.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5313   -4.3883    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.6591   -3.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4559   -3.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9779   -4.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6470   -4.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1738   -5.4603    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7589   -2.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2530   -1.9695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7589   -1.3077    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3928   -0.7578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5958   -0.4828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9899   -1.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2723   -1.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5591   -1.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5591   -2.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2723   -2.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9899   -2.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4720   -3.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1896   -2.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9028   -3.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6204   -2.6313    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9028   -3.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6204   -4.2811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1896   -4.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1896   -5.1060    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4720   -3.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  8  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n 10  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 20  1  0  0  0  0\n 10 21  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 29  2  0  0  0  0\n 23 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 23  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 27  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(c3cc(c(c(c3)Br)O)Br)(c4cc(c(c(c4)Br)O)Br)OS2(=O)=O",
          "formula": "C19H10Br4O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d1c32229-e11a-4222-86d5-862a6d30dec2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "669.9606",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "48e864b1-1274-48b2-a67b-74eff17590d6",
      "version": "7",
      "structure": {
        "id": "c25d1909-2516-4914-a8df-e9527d6861c1",
        "molfile": "\n  Marvin  01132110032D          \n\n 29 32  0  0  0  0            999 V2000\n    2.5239   -5.7073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8501   -4.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6470   -4.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9779   -4.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4559   -3.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6591   -3.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3281   -4.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5313   -4.3883    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7589   -2.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2530   -1.9695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7589   -1.3077    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3928   -0.7578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5958   -0.4828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9899   -1.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9899   -2.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2723   -2.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5591   -2.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5591   -1.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2723   -1.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4720   -3.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1896   -2.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9028   -3.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6204   -2.6313    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9028   -3.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6204   -4.2811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1896   -4.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1896   -5.1060    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4720   -3.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1738   -5.4603    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 14 19  2  0  0  0  0\n  9 15  1  0  0  0  0\n  9 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  1  0  0  0  0\n 20 28  2  0  0  0  0\n  3 29  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(c3cc(c(c(c3)Br)O)Br)(c4cc(c(c(c4)Br)O)Br)OS2(=O)=O",
        "formula": "C19H10Br4O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "669.9606",
        "optical_activity": "NONE",
        "references": [
          "e9b1ad7c-366e-43b0-861f-ada99fe47598",
          "9e8200a2-4777-486d-bf61-35ade1eb8bc0"
        ],
        "stereo_centers": 0
      },
      "unii": "0R2969YC90"
    }
  ]
}