{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d1cc98ac-85f3-451b-8e4b-a00e694efd0d",
          "code": "141-63-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=141-63-9",
          "code_system": "CAS",
          "references": [
            "38c3170e-d5f5-409e-83e5-d79da2b53e1b",
            "7c6c7e78-de25-4b6b-824c-72a2c48e5a6b"
          ]
        },
        {
          "uuid": "0917d949-d02d-4ccc-8e65-10a39042c143",
          "code": "205-492-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.994",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "38c3170e-d5f5-409e-83e5-d79da2b53e1b"
          ]
        },
        {
          "uuid": "f7f3d07e-2194-4ad2-af32-6fef5a59d35f",
          "code": "1371445",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1371445/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "38c3170e-d5f5-409e-83e5-d79da2b53e1b"
          ]
        },
        {
          "uuid": "e7896c24-e9f8-474e-aa76-14b548ce61bb",
          "code": "m4720",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4720?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "38c3170e-d5f5-409e-83e5-d79da2b53e1b"
          ]
        },
        {
          "uuid": "920b2b8c-aa99-409c-a559-a94abf22060e",
          "code": "8853",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8853",
          "code_system": "PUBCHEM",
          "references": [
            "38c3170e-d5f5-409e-83e5-d79da2b53e1b"
          ]
        },
        {
          "uuid": "87d0e2a8-36cf-b39f-641b-06f557734c76",
          "code": "DTXSID1044803",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1044803",
          "code_system": "EPA CompTox",
          "references": [
            "1c34c179-c5d5-d580-f935-7a2f73da1b5c"
          ]
        },
        {
          "uuid": "fc2e20c2-5fb0-4288-84c7-fd9b3f4048fb",
          "code": "0QDQ2VQ5YJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bcee0fbf-3fb7-abef-8650-86bf8b07bdf2",
          "code": "84272",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:84272",
          "code_system": "CHEBI",
          "references": [
            "4695f62f-771c-5d1c-6aa4-499bcb3ee23c"
          ]
        },
        {
          "uuid": "e581e492-be97-85d3-6e3c-3744da7b2436",
          "code": "0QDQ2VQ5YJ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0QDQ2VQ5YJ",
          "code_system": "DAILYMED",
          "references": [
            "633adced-582f-b618-edac-4e962818c0af"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "54750168-79be-4bec-83e5-fe30ff2c2c2c",
          "name": "1,1,1,3,3,5,5,7,7,9,9,9-DODECAMETHYLPENTASILOXANE",
          "stdName": "1,1,1,3,3,5,5,7,7,9,9,9-DODECAMETHYLPENTASILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "330a2fe0-e97a-4c11-abc9-af72eeb40418",
            "6d25e77a-1a12-42ba-b0ed-32d5f9062cb5"
          ],
          "display_name": false
        },
        {
          "uuid": "3ec4092b-6b81-4145-894a-cc9cab9e7f72",
          "name": "DODECAMETHYLPENTASILOXANE",
          "stdName": "DODECAMETHYLPENTASILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c3469bd-e0f2-4a4b-bfcb-6c1f73612425",
            "67b267c5-4018-4d1f-afa0-987e26afa6e6",
            "42209222-77e6-44f1-ae4e-1506d733ecdc",
            "6d25e77a-1a12-42ba-b0ed-32d5f9062cb5"
          ],
          "display_name": true
        },
        {
          "uuid": "92db81ce-27ef-48db-aef5-98a75a04f749",
          "name": "DODECAMETHYLPENTASILOXANE [MI]",
          "stdName": "DODECAMETHYLPENTASILOXANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c3469bd-e0f2-4a4b-bfcb-6c1f73612425",
            "6d25e77a-1a12-42ba-b0ed-32d5f9062cb5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "67b267c5-4018-4d1f-afa0-987e26afa6e6",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5c3469bd-e0f2-4a4b-bfcb-6c1f73612425",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d25e77a-1a12-42ba-b0ed-32d5f9062cb5",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "330a2fe0-e97a-4c11-abc9-af72eeb40418",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38c3170e-d5f5-409e-83e5-d79da2b53e1b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391117000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26f71c46-50d7-48b9-998b-d26261971899",
          "citation": "SRS import [0QDQ2VQ5YJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0QDQ2VQ5YJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391117000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3e6a0b8-54c4-4a7e-99ce-9691ad2f4283",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42209222-77e6-44f1-ae4e-1506d733ecdc",
          "citation": "DODECAMETHYLPENTASILOXANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c34c179-c5d5-d580-f935-7a2f73da1b5c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=141-63-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7c6c7e78-de25-4b6b-824c-72a2c48e5a6b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4695f62f-771c-5d1c-6aa4-499bcb3ee23c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "633adced-582f-b618-edac-4e962818c0af",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "268b7244-b36f-4286-b0a9-9936413bc589",
          "id": "268b7244-b36f-4286-b0a9-9936413bc589",
          "molfile": "\n  Marvin  01132102082D          \n\n 21 20  0  0  0  0            999 V2000\n   10.2752   -4.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3333   -4.1194    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6049   -3.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8603   -3.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8711   -4.8451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4012   -5.5984    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.0795   -5.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7696   -5.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0034   -6.2793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2107   -6.2793    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2107   -7.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2107   -5.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4600   -6.2793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9628   -5.6183    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.3092   -6.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6589   -5.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4733   -4.9595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9463   -4.2363    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2478   -4.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7143   -3.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4689   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 10  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\nM  END",
          "smiles": "C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C",
          "formula": "C12H36O4Si5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "29459e5f-0a57-4817-b282-5bffe489569a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "384.8392",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0a973371-a394-4310-9f24-97323ed191ab",
      "version": "6",
      "structure": {
        "id": "43f67c9d-3e8f-4a64-bc44-f4c8d015a638",
        "molfile": "\n  Marvin  01132103352D          \n\n 21 20  0  0  0  0            999 V2000\n    6.4600   -6.2793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2107   -6.2793    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.0034   -6.2793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4012   -5.5984    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.8711   -4.8451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3333   -4.1194    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   10.2752   -4.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6049   -3.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8603   -3.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0795   -5.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7696   -5.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2107   -7.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2107   -5.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9628   -5.6183    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4733   -4.9595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9463   -4.2363    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2478   -4.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7143   -3.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4689   -3.5776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3092   -6.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6589   -5.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 14 20  1  0  0  0  0\n 14 21  1  0  0  0  0\nM  END",
        "smiles": "C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C",
        "formula": "C12H36O4Si5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "384.8392",
        "optical_activity": "NONE",
        "references": [
          "26f71c46-50d7-48b9-998b-d26261971899",
          "f3e6a0b8-54c4-4a7e-99ce-9691ad2f4283"
        ],
        "stereo_centers": 0
      },
      "unii": "0QDQ2VQ5YJ"
    }
  ]
}