{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a9645212-ec7e-4e90-a785-9b6d443c5103",
          "code": "1000284-53-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1000284-53-6",
          "code_system": "CAS",
          "references": [
            "1ba30db0-dd3a-4aa8-9f3d-5fdca1f8e7f6",
            "9fb15beb-d87b-4847-9ff2-b4f11f52d216"
          ]
        },
        {
          "uuid": "bae17418-1227-4845-b84b-6e8aef091cb9",
          "code": "71587902",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587902",
          "code_system": "PUBCHEM",
          "references": [
            "1ba30db0-dd3a-4aa8-9f3d-5fdca1f8e7f6"
          ]
        },
        {
          "uuid": "e486ac79-a8bb-7f6c-8cbe-8256e492e6cf",
          "code": "DTXSID40142877",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40142877",
          "code_system": "EPA CompTox",
          "references": [
            "efc3a0f3-2a62-4efc-21a1-4c9b165c9409"
          ]
        },
        {
          "uuid": "f3efac80-63f2-4764-a432-1d0a9cdebbc2",
          "code": "0QC141I50V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1fbcae20-0603-4ef6-bf14-6144f5693d85",
          "name": "DI-HEXYLOXY CYCLOHEXANE",
          "stdName": "DI-HEXYLOXY CYCLOHEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb96a6f2-ba86-4a00-ac90-0f4f796e6480",
            "c00118d2-8fc9-45ec-a894-07832002754e"
          ],
          "display_name": false
        },
        {
          "uuid": "1dcc1142-aa1f-4676-9646-390a1ac866be",
          "name": "DIHEXYLOXY CYCLOHEXANE",
          "stdName": "DIHEXYLOXY CYCLOHEXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb96a6f2-ba86-4a00-ac90-0f4f796e6480",
            "baa4cefe-a60e-4a2d-b341-e05969208ed3",
            "c00118d2-8fc9-45ec-a894-07832002754e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c33efd4f-d680-419a-b7e7-e52d19be7ca2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "87d3af81-d4b2-4e93-b730-bd58d96a2c5f",
          "name": "DIHEXYLOXYCYCLOHEXANE",
          "stdName": "DIHEXYLOXYCYCLOHEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fab9a2cb-f978-409b-9f33-64d00a5fc846",
            "c00118d2-8fc9-45ec-a894-07832002754e"
          ],
          "display_name": false
        },
        {
          "uuid": "52e34d38-4365-41dc-9f30-013e51a67728",
          "name": "MELATEIN X-5",
          "stdName": "MELATEIN X-5",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb96a6f2-ba86-4a00-ac90-0f4f796e6480",
            "c00118d2-8fc9-45ec-a894-07832002754e"
          ],
          "display_name": false
        },
        {
          "uuid": "177e8b0e-07d9-4f0c-a1e4-f16604549b3d",
          "name": "TRANS-1,2-BIS-HEXYLOXY-CYCLOHEXANE",
          "stdName": "TRANS-1,2-BIS-HEXYLOXY-CYCLOHEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb96a6f2-ba86-4a00-ac90-0f4f796e6480",
            "c00118d2-8fc9-45ec-a894-07832002754e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fb96a6f2-ba86-4a00-ac90-0f4f796e6480",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c00118d2-8fc9-45ec-a894-07832002754e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fab9a2cb-f978-409b-9f33-64d00a5fc846",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ba30db0-dd3a-4aa8-9f3d-5fdca1f8e7f6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f51430b8-3046-4d6e-b183-e6873f71e5fa",
          "citation": "SRS import [0QC141I50V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0QC141I50V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08062ef9-1390-4e68-a76e-cb96edbe942c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "baa4cefe-a60e-4a2d-b341-e05969208ed3",
          "citation": "DIHEXYLOXY CYCLOHEXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "efc3a0f3-2a62-4efc-21a1-4c9b165c9409",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1000284-53-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9fb15beb-d87b-4847-9ff2-b4f11f52d216",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b8716ae8-01e2-423c-8ec9-9c8dfbb5989a",
          "id": "b8716ae8-01e2-423c-8ec9-9c8dfbb5989a",
          "molfile": "\n  Marvin  01132109322D          \n\n 20 20  0  0  0  0            999 V2000\n    6.6656   -4.9278    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.9511   -4.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2367   -4.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2367   -5.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9511   -6.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6656   -5.7528    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.3801   -6.1653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3801   -6.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -7.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -8.2278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8091   -8.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8091   -9.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5235   -9.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3801   -4.5153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -4.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8091   -4.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5235   -4.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2380   -4.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9525   -4.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6670   -4.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  1 14  1  1  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  6  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCO[C@@H]1CCCC[C@H]1OCCCCCC",
          "formula": "C18H36O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "57415ea6-2cc4-4e71-87f9-b0ef69c11e6f"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "284.4779",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2fc1c372-b197-42c3-8066-0d786a22cb71",
      "version": "5",
      "structure": {
        "id": "8fecc7e6-fbdb-4e3a-8c94-68ad36a9cd8f",
        "molfile": "\n  Marvin  01132107282D          \n\n 20 20  0  0  0  0            999 V2000\n    5.2367   -4.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9511   -4.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6656   -4.9278    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3801   -4.5153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -4.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8091   -4.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5235   -4.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2380   -4.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9525   -4.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6670   -4.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6656   -5.7528    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3801   -6.1653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3801   -6.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -7.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0946   -8.2278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8091   -8.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8091   -9.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5235   -9.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9511   -6.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2367   -5.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  3  1  0  0  0  0\n 11 12  1  6  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 11  1  0  0  0  0\n 20 19  1  0  0  0  0\n  1 20  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCO[C@@H]1CCCC[C@H]1OCCCCCC",
        "formula": "C18H36O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "284.4779",
        "optical_activity": "( + / - )",
        "references": [
          "f51430b8-3046-4d6e-b183-e6873f71e5fa",
          "08062ef9-1390-4e68-a76e-cb96edbe942c"
        ],
        "stereo_centers": 2
      },
      "unii": "0QC141I50V"
    }
  ]
}