{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9f086cce-d550-45f2-9686-15c529b9ecc7",
          "code": "60045-26-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60045-26-3",
          "code_system": "CAS",
          "references": [
            "d69e280b-e99b-4d8e-aa76-51dddcec3c0a",
            "65826dd9-99b9-4d9e-827f-5783da69dc5b"
          ]
        },
        {
          "uuid": "2e426a43-b3ff-4763-b8e2-ae3a405e0464",
          "code": "346273",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/346273",
          "code_system": "PUBCHEM",
          "references": [
            "d69e280b-e99b-4d8e-aa76-51dddcec3c0a"
          ]
        },
        {
          "uuid": "98a107b8-aea7-cf9a-a15d-60b3670d6fff",
          "code": "DTXSID60323626",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60323626",
          "code_system": "EPA CompTox",
          "references": [
            "2147d2ef-f196-ba0b-69b7-584e42a9d782"
          ]
        },
        {
          "uuid": "daa2c1f9-c28f-4f11-9a79-91d65fe1603f",
          "code": "0NAP1ZH91D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1a5e10a1-584d-03ad-70c6-1c2b9312d81a",
          "code": "404465",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=404465",
          "code_system": "NSC",
          "references": [
            "08a38a90-870a-08d9-a0f6-beb8070d3b26"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "25c7fb39-03ed-4830-9a10-1ba1c003db41",
          "name": "1-PROPANOL, 3-PHENYL-, BENZOATE",
          "stdName": "1-PROPANOL, 3-PHENYL-, BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a211bcd6-1ba8-4191-966f-f1e98d73ac2f",
            "88d6d95c-3a42-49c6-9fbd-ae2618c1fa33"
          ],
          "display_name": false
        },
        {
          "uuid": "a2276645-ad25-4754-b8eb-58b2b8370c95",
          "name": "3-PHENYL-1-PROPANOL BENZOATE",
          "stdName": "3-PHENYL-1-PROPANOL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a211bcd6-1ba8-4191-966f-f1e98d73ac2f",
            "88d6d95c-3a42-49c6-9fbd-ae2618c1fa33"
          ],
          "display_name": false
        },
        {
          "uuid": "2017bf7b-618d-4635-9181-0a61e1ef9bfd",
          "name": "3-PHENYLPROPYL BENZOATE",
          "stdName": "3-PHENYLPROPYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15ed98cd-0172-4f37-8604-d72bcdefee9c",
            "88d6d95c-3a42-49c6-9fbd-ae2618c1fa33"
          ],
          "display_name": true
        },
        {
          "uuid": "7b837a3d-0b7a-4733-93be-d1a1be51c8ea",
          "name": "BENZENEPROPANOL, 1-BENZOATE",
          "stdName": "BENZENEPROPANOL, 1-BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a211bcd6-1ba8-4191-966f-f1e98d73ac2f",
            "88d6d95c-3a42-49c6-9fbd-ae2618c1fa33"
          ],
          "display_name": false
        },
        {
          "uuid": "994b5dce-00e5-4260-8256-1da02325633f",
          "name": "BENZENEPROPANOL, BENZOATE",
          "stdName": "BENZENEPROPANOL, BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a211bcd6-1ba8-4191-966f-f1e98d73ac2f",
            "88d6d95c-3a42-49c6-9fbd-ae2618c1fa33"
          ],
          "display_name": false
        },
        {
          "uuid": "7a183e21-3397-b590-77f2-197c5069ea48",
          "name": "NSC-404465",
          "stdName": "NSC-404465",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08a38a90-870a-08d9-a0f6-beb8070d3b26"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "15ed98cd-0172-4f37-8604-d72bcdefee9c",
          "citation": "EC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "88d6d95c-3a42-49c6-9fbd-ae2618c1fa33",
          "citation": "EC FLAVOURING SUBSTANCES",
          "doc_type": "EC FLAVOURING SUBSTANCES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a211bcd6-1ba8-4191-966f-f1e98d73ac2f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d69e280b-e99b-4d8e-aa76-51dddcec3c0a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392733000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09bc4d78-86e9-4976-9cd4-13006bf88117",
          "citation": "SRS import [0NAP1ZH91D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0NAP1ZH91D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392733000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2147d2ef-f196-ba0b-69b7-584e42a9d782",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=60045-26-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "08a38a90-870a-08d9-a0f6-beb8070d3b26",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "65826dd9-99b9-4d9e-827f-5783da69dc5b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fd498edc-99b9-42c5-a7d7-2b201952d8a8",
          "id": "fd498edc-99b9-42c5-a7d7-2b201952d8a8",
          "molfile": "\n  Marvin  01132113072D          \n\n 18 19  0  0  0  0            999 V2000\n    9.6360   -4.2279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9270   -3.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2083   -4.2236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2083   -5.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4945   -5.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4945   -6.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7781   -6.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0643   -6.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3504   -6.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3504   -7.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0643   -7.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7781   -7.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9270   -2.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6408   -2.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6408   -1.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9246   -1.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2107   -1.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2107   -2.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)CCCOC(=O)c2ccccc2",
          "formula": "C16H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "784ed731-9ca3-464d-96c3-bf10526293aa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "240.2976",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "44620544-7149-47e8-aac3-33e18e820c69",
      "version": "5",
      "structure": {
        "id": "016bf5a7-d3a0-4325-8717-f6c1b4c7eb47",
        "molfile": "\n  Marvin  01132100242D          \n\n 18 19  0  0  0  0            999 V2000\n    9.6360   -4.2279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2083   -4.2236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9270   -3.8143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6408   -2.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6408   -1.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9246   -1.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2107   -1.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2107   -2.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9270   -2.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4945   -6.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4945   -5.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2083   -5.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0643   -6.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3504   -6.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3504   -7.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0643   -7.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7781   -7.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7781   -6.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 12  2  1  0  0  0  0\n  3  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n  9  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 18 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 18 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)CCCOC(=O)c2ccccc2",
        "formula": "C16H16O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "240.2976",
        "optical_activity": "NONE",
        "references": [
          "a211bcd6-1ba8-4191-966f-f1e98d73ac2f",
          "09bc4d78-86e9-4976-9cd4-13006bf88117"
        ],
        "stereo_centers": 0
      },
      "unii": "0NAP1ZH91D"
    }
  ]
}