{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "18a500b8-90cb-44cf-b5f1-3adb064f92c0", "code": "1806-54-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1806-54-8", "code_system": "CAS", "references": [ "9b08ab22-5d5f-e794-6dd0-e360d7dc66a5" ] }, { "uuid": "eecebe36-c076-41a6-a6bb-d4ba7deebbbd", "code": "15733", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15733", "code_system": "PUBCHEM", "references": [ "9b08ab22-5d5f-e794-6dd0-e360d7dc66a5" ] }, { "uuid": "8fad8124-5f0b-4c8f-b1aa-86db617513dd", "code": "0LV8VW3YJZ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "efdc55b0-bc26-2eb1-fc07-d483ba14c389", "code": "DTXSID6026246", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6026246", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "5a2aacee-e140-4328-8914-f8b4aea9847a", "type": "LABELED->NON-LABELED", "references": [ "9b08ab22-5d5f-e794-6dd0-e360d7dc66a5" ], "related_substance": { "uuid": "ec2d3598-3a78-4a3b-b9a2-e0040d83b910", "refuuid": "22ef5576-fe96-49bd-ad02-b7b7039153ed", "name": "TRI-N-OCTYL PHOSPHATE P-32", "unii": "MY79VAJ12R", "linking_id": "MY79VAJ12R", "ref_pname": "TRI-N-OCTYL PHOSPHATE P-32", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "1cceaeae-b265-0c10-d8d8-f282e6eb7e4f", "name": "PHOSPHORIC ACID, TRIOCTYL ESTER", "stdName": "PHOSPHORIC ACID, TRIOCTYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b08ab22-5d5f-e794-6dd0-e360d7dc66a5" ], "display_name": false }, { "uuid": "f12b1371-bc16-54eb-d4dc-05fff927dedc", "name": "TRI-N-OCTYL PHOSPHATE", "stdName": "TRI-N-OCTYL PHOSPHATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9b08ab22-5d5f-e794-6dd0-e360d7dc66a5" ], "display_name": true } ], "references": [ { "uuid": "9b08ab22-5d5f-e794-6dd0-e360d7dc66a5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3d75c5ce-94d3-5101-3d9f-fd521c83abc3", "id": "3d75c5ce-94d3-5101-3d9f-fd521c83abc3", "molfile": "\n Marvin 01132103152D \n\n 29 28 0 0 0 0 999 V2000\n 8.8323 -2.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5467 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2613 -2.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9757 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6901 -2.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4046 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -2.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8336 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -2.2286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -2.6411 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6751 -1.9266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8501 -3.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0875 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5001 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3251 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7375 -5.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5625 -5.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9751 -6.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8001 -6.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9770 -3.0536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6914 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4059 -3.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1204 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8349 -3.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5493 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2639 -3.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9783 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6927 -3.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 10 1 0 0 0 0\n 21 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\nM END", "smiles": "CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC", "formula": "C24H51O4P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "65aa1913-dd56-48ce-8168-328f62f5d3bf" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "434.634", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "896b3e65-931e-4a97-9b67-9f78fdfc6c38", "version": "7", "structure": { "id": "26a0fdd6-e2d7-e518-cdbe-950bb4fe345c", "molfile": "\n Marvin 01132102082D \n\n 29 28 0 0 0 0 999 V2000\n 15.2625 -2.6411 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6751 -1.9266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -2.2286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8336 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -2.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4046 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6901 -2.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9757 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2613 -2.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5467 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8323 -2.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8501 -3.3555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0875 -4.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5001 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3251 -4.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7375 -5.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5625 -5.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9751 -6.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8001 -6.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9770 -3.0536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6914 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4059 -3.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1204 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8349 -3.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5493 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2639 -3.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9783 -2.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6927 -3.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 1 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 1 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\nM END", "smiles": "CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC", "formula": "C24H51O4P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "434.634", "optical_activity": "NONE", "references": [ "9b08ab22-5d5f-e794-6dd0-e360d7dc66a5" ], "stereo_centers": 0 }, "unii": "0LV8VW3YJZ" } ] }