{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5b7f86a2-96b8-4706-8ed3-50ed07f8c543", "code": "80844-07-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=80844-07-1", "code_system": "CAS", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645", "92357fbd-1e34-44f5-9039-08ccc32e651e" ] }, { "uuid": "8f2a230e-c339-4ff2-8e29-5746c55b741c", "code": "C65587", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65587", "code_system": "NCI_THESAURUS", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "62e5e88c-c0a3-4339-b8c7-1f0c047f5ac0", "code": "C076840", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67076840", "code_system": "MESH", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "4678e4c7-989f-45ff-8123-be4cef696c6e", "code": "ETOFENPROX", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Etofenprox", "code_system": "WIKIPEDIA", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "335f9d5e-7033-40a8-82bd-a52a85dd8068", "code": "SUB07320MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "07334de4-37f9-43d1-b5d5-2e5d417dbde0", "code": "128965", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2299", "code_system": "EPA PESTICIDE CODE", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "68692f98-c4ff-4879-94d0-fef541c8c846", "code": "6109", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6109", "code_system": "INN", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "92ca78ee-900f-4170-b5b6-347a435fedcb", "code": "m5192", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m5192?q=authorize", "code_system": "MERCK INDEX", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "9eb80134-6501-403f-b173-5e1f29c7b10d", "code": "CHEMBL2105573", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2105573", "code_system": "ChEMBL", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "5744aff1-22fd-453a-9255-55a63644b59b", "code": "71245", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71245", "code_system": "PUBCHEM", "references": [ "e3509a9f-aa31-4d3d-919f-7f1427c36645" ] }, { "uuid": "e06ddba1-52d8-73ce-921d-e19eb2aba8cb", "code": "DTXSID9032610", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9032610", "code_system": "EPA CompTox", "references": [ "29c31477-d88a-ae05-2556-bfe63a9c56f4" ] }, { "uuid": "eae5c188-cb30-7ab3-eaeb-2be41f5db189", "code": "C737", "comments": "Industrial Aid[C45678]|Pesticide", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737", "code_system": "NCI_THESAURUS", "references": [ "591083a6-6e47-69ea-cd3b-8609f381a8b8" ] }, { "uuid": "73da2032-32b8-4676-857f-b4fe04056c10", "code": "0LD7P9153C", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c78b0d30-bc9b-d886-43c5-f046c2875342", "code": "39348", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39348", "code_system": "CHEBI", "references": [ "591083a6-6e47-69ea-cd3b-8609f381a8b8" ] }, { "uuid": "df12defd-4731-66b8-96b2-159799b53301", "code": "100000082083", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "b9e8355e-c601-1058-48eb-fe2d3182a3b0" ] }, { "uuid": "de103558-aa35-8e7e-a2eb-c239a9171f26", "code": "etofenprox", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/etofenprox.html", "code_system": "ALANWOOD", "references": [ "13085ce1-3d10-9251-3219-ac6bb84a915d" ] } ], "relationships": [ { "uuid": "893bdb0d-5430-4820-96d1-69bb28390c28", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "7d97eb86-f2ff-480a-b45b-4789cf198e21", "refuuid": "be583690-f10d-400c-b99f-84e6b7870b51", "name": "ETOFENPROX", "unii": "0LD7P9153C", "linking_id": "0LD7P9153C", "ref_pname": "ETOFENPROX", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "54ecd8f6-5855-429a-bad8-8d7a0b18466d", "name": ".ALPHA.-((P-ETHOXY-B,B-DIMETHYLPHENETHYL)OXY)-M-PHENOXYTOLUENE", "stdName": ".ALPHA.-((P-ETHOXY-B,B-DIMETHYLPHENETHYL)OXY)-M-PHENOXYTOLUENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "31765445-0de3-4fe6-b73b-77ad5e19cee3" ], "display_name": false }, { "uuid": "1eea91ef-4527-42ab-ab50-a9f515b694ef", "name": "1-((2-(4-ETHOXYPHENYL)-2-METHYLPROPOXY)METHYL)-3-PHENOXYBENZENE", "stdName": "1-((2-(4-ETHOXYPHENYL)-2-METHYLPROPOXY)METHYL)-3-PHENOXYBENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9a287afd-a17c-4cec-bc50-e8a7b2f537fc", "32e595d9-e651-419c-bd9c-5caaa3d274ff" ], "display_name": false }, { "uuid": "820f0f33-6d4b-4cd8-befd-46c792bace16", "name": "2-(4-ETHOXYPHENYL)-2-METHYLPROPYL 3-PHENOXYBENZYL ETHER", "stdName": "2-(4-ETHOXYPHENYL)-2-METHYLPROPYL 3-PHENOXYBENZYL ETHER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "59c06078-9bc0-471f-aed6-16e8e6bcd327", "32e595d9-e651-419c-bd9c-5caaa3d274ff" ], "display_name": false }, { "uuid": "af7dd2e4-31c7-4102-9bea-f7a4f5cc2095", "name": "ETOFENPROX", "stdName": "ETOFENPROX", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "31765445-0de3-4fe6-b73b-77ad5e19cee3", "443c583f-65e2-4f1f-a75d-dc4d92641fbe", "c2799938-b88e-4e97-85ba-348e83adb907", "8b01566b-524d-4d94-b89f-1a822e1a4f95", "5dd6d574-96ec-425b-b4a7-d0df9e3b5223", "2d76e012-ade5-4a6b-bafb-71e336f9430b", "dc0c2fc4-1ff5-4946-8b1d-7697c2bf12d8", "e8e71e01-138c-4db5-a899-942ff37fb88e" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "a5e2a565-fa5e-451b-a287-cca4a06d0c00", "name_org": "INN" } ] }, { "uuid": "16671a67-0c5f-6e3f-66a6-458bac396c83", "name": "ETOFENPROX [JAN]", "stdName": "ETOFENPROX [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0d2048b8-e375-e66f-c5cd-20b4bf1073f7" ], "display_name": false }, { "uuid": "33b40b25-b4c1-4ca0-92d0-b99a513f2a20", "name": "ETOFENPROX [MART.]", "stdName": "ETOFENPROX [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e8e71e01-138c-4db5-a899-942ff37fb88e" ], "display_name": false }, { "uuid": "4b4d34e3-5398-453e-a27f-9aec88aca56a", "name": "ETOFENPROX [MI]", "stdName": "ETOFENPROX [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5dd6d574-96ec-425b-b4a7-d0df9e3b5223", "dc0c2fc4-1ff5-4946-8b1d-7697c2bf12d8" ], "display_name": false }, { "uuid": "1d692ac0-0d02-4396-a6b4-4af6e1227976", "name": "etofenprox [INN]", "stdName": "ETOFENPROX [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "443c583f-65e2-4f1f-a75d-dc4d92641fbe" ], "display_name": false } ], "references": [ { "uuid": "31765445-0de3-4fe6-b73b-77ad5e19cee3", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "32e595d9-e651-419c-bd9c-5caaa3d274ff", "citation": "ALANWOOD.NET", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "59c06078-9bc0-471f-aed6-16e8e6bcd327", "citation": "ALANWOOD IUPAC", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9a287afd-a17c-4cec-bc50-e8a7b2f537fc", "citation": "ALANWOOD CAS", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "443c583f-65e2-4f1f-a75d-dc4d92641fbe", "citation": "INN Proposed List 57", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL57.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e8e71e01-138c-4db5-a899-942ff37fb88e", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dc0c2fc4-1ff5-4946-8b1d-7697c2bf12d8", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5dd6d574-96ec-425b-b4a7-d0df9e3b5223", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e3509a9f-aa31-4d3d-919f-7f1427c36645", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390688000, "tags": [ "NOMEN" ] }, { "uuid": "3cd62328-2c30-4861-ab8c-714d1601e159", "citation": "SRS import [0LD7P9153C]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0LD7P9153C", "doc_type": "SRS", "public_domain": true, "document_date": 1493390688000, "tags": [ "NOMEN" ] }, { "uuid": "1072b227-fee4-43ea-a2ec-50183e5179c9", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8b01566b-524d-4d94-b89f-1a822e1a4f95", "citation": "ETOFENPROX [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c2799938-b88e-4e97-85ba-348e83adb907", "citation": "ETOFENPROX [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2d76e012-ade5-4a6b-bafb-71e336f9430b", "citation": "ETOFENPROX [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "29c31477-d88a-ae05-2556-bfe63a9c56f4", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80844-07-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b9e8355e-c601-1058-48eb-fe2d3182a3b0", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "591083a6-6e47-69ea-cd3b-8609f381a8b8", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "0d2048b8-e375-e66f-c5cd-20b4bf1073f7", "citation": "JAN", "doc_type": "JAN", "public_domain": true }, { "uuid": "92357fbd-1e34-44f5-9039-08ccc32e651e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "13085ce1-3d10-9251-3219-ac6bb84a915d", "citation": "AW", "doc_type": "ALANWOOD", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "065447f3-5221-401d-a76e-bfe0ecb3ea80", "id": "065447f3-5221-401d-a76e-bfe0ecb3ea80", "molfile": "\n Marvin 01132100372D \n\n 28 30 0 0 0 0 999 V2000\n -3.4792 -1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7625 -1.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0458 -1.8083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3276 -1.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3264 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6146 -0.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1008 -0.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1037 -1.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6128 -1.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8125 -0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3958 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2208 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5250 -0.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2375 -0.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9500 -0.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6599 -0.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6611 0.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3729 1.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0883 0.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0912 -0.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8000 -0.5625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7958 -1.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0770 -1.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0725 -2.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7854 -3.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5043 -2.6224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5053 -1.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3747 -0.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 9 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 10 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 16 28 2 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 2 0 0 0 0\n 20 21 1 0 0 0 0\n 28 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 27 22 2 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "CCOc1ccc(cc1)C(C)(C)COCc2cccc(c2)Oc3ccccc3", "formula": "C25H28O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b4ba57d0-cf23-4481-89e7-b746212d7ffd" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "376.489", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "be583690-f10d-400c-b99f-84e6b7870b51", "version": "9", "structure": { "id": "0b89d5cc-7e85-4324-87bd-01b763a5455e", "molfile": "\n Marvin 01132100512D \n\n 28 30 0 0 0 0 999 V2000\n 3.6611 0.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6599 -0.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3747 -0.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0912 -0.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0883 0.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3729 1.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3264 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3276 -1.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6128 -1.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1037 -1.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1008 -0.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6146 -0.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0458 -1.8083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7625 -1.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4792 -1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8125 -0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5250 -0.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2375 -0.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9500 -0.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3958 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2208 0.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8000 -0.5625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7958 -1.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0770 -1.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0725 -2.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7854 -3.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5043 -2.6224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5053 -1.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13 14 1 0 0 0 0\n 3 4 2 0 0 0 0\n 14 15 1 0 0 0 0\n 7 8 2 0 0 0 0\n 11 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 8 9 1 0 0 0 0\n 17 18 1 0 0 0 0\n 4 5 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 2 1 0 0 0 0\n 9 10 2 0 0 0 0\n 16 20 1 0 0 0 0\n 2 3 1 0 0 0 0\n 16 21 1 0 0 0 0\n 10 11 1 0 0 0 0\n 4 22 1 0 0 0 0\n 5 6 2 0 0 0 0\n 22 23 1 0 0 0 0\n 11 12 2 0 0 0 0\n 23 24 2 0 0 0 0\n 12 7 1 0 0 0 0\n 24 25 1 0 0 0 0\n 6 1 1 0 0 0 0\n 25 26 2 0 0 0 0\n 8 13 1 0 0 0 0\n 26 27 1 0 0 0 0\n 1 2 2 0 0 0 0\n 27 28 2 0 0 0 0\n 28 23 1 0 0 0 0\nM END", "smiles": "CCOc1ccc(cc1)C(C)(C)COCc2cccc(c2)Oc3ccccc3", "formula": "C25H28O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "376.489", "optical_activity": "NONE", "references": [ "1072b227-fee4-43ea-a2ec-50183e5179c9", "3cd62328-2c30-4861-ab8c-714d1601e159", "443c583f-65e2-4f1f-a75d-dc4d92641fbe" ], "stereo_centers": 0 }, "unii": "0LD7P9153C" } ] }