{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3213c17c-ebdc-488d-b576-99c8cfe6a099",
          "code": "865661-00-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=865661-00-3",
          "code_system": "CAS",
          "references": [
            "b880e0a1-ac57-424d-a309-dd7f41e387bf",
            "0719bb42-5379-4f6a-a17e-349c86bfdc8c"
          ]
        },
        {
          "uuid": "e7084bf3-2af1-4647-936d-6b7a719eeeb6",
          "code": "11292282",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11292282",
          "code_system": "PUBCHEM",
          "references": [
            "b880e0a1-ac57-424d-a309-dd7f41e387bf"
          ]
        },
        {
          "uuid": "5ac2b509-6bb1-41f6-8849-4a483c8cb522",
          "code": "0L6TPF5UXK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "68af653a-c1b0-7a55-a1cd-5fa21b5fd30a",
          "code": "DTXSID501006929",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501006929",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "45d98fb4-71ff-4013-9924-f646c05a01f9",
          "name": "(±)-LA PLUS MALEATE",
          "stdName": "(+/-)-LA PLUS MALEATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fdf2cac-ab12-4da9-b7ee-b2bc859fb3cd",
            "3d7e5d1d-240f-4ee6-9953-b5dfb20a3103"
          ],
          "display_name": false
        },
        {
          "uuid": "94f292e6-849e-438b-881b-9ddfb72cd207",
          "name": "(±)-THIOCTAMIDOETHYL DIMETHYLAMINE MALEATE",
          "stdName": "(+/-)-THIOCTAMIDOETHYL DIMETHYLAMINE MALEATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d7e5d1d-240f-4ee6-9953-b5dfb20a3103",
            "ee828553-864a-49c9-a3b5-869c130d22c6"
          ],
          "display_name": false
        },
        {
          "uuid": "e49d829b-cb1f-4e2c-bc86-59535f20397c",
          "name": "1,2-DITHIOLANE-3-PENTANAMIDE, N-(2-(DIMETHYLAMINO)ETHYL)-, (2Z)-2-BUTENEDIOATE (1:1)",
          "stdName": "1,2-DITHIOLANE-3-PENTANAMIDE, N-(2-(DIMETHYLAMINO)ETHYL)-, (2Z)-2-BUTENEDIOATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d7e5d1d-240f-4ee6-9953-b5dfb20a3103",
            "175389f5-db22-420a-8ff7-bb51898d7bed"
          ],
          "display_name": false
        },
        {
          "uuid": "0e6e3fa6-66f1-4285-aa92-a8532f49ba06",
          "name": "LIPOSOL MALEATE, (±)-",
          "stdName": "LIPOSOL MALEATE, (+/-)-",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fdf2cac-ab12-4da9-b7ee-b2bc859fb3cd",
            "3d7e5d1d-240f-4ee6-9953-b5dfb20a3103"
          ],
          "display_name": false
        },
        {
          "uuid": "5e8533af-1ea7-40e4-8e92-ca4443450d83",
          "name": "THIOCTAMIDOETHYL DIMETHYLAMINE MALEATE, (±)-",
          "stdName": "THIOCTAMIDOETHYL DIMETHYLAMINE MALEATE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fdf2cac-ab12-4da9-b7ee-b2bc859fb3cd",
            "3d7e5d1d-240f-4ee6-9953-b5dfb20a3103"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "0fdf2cac-ab12-4da9-b7ee-b2bc859fb3cd",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3d7e5d1d-240f-4ee6-9953-b5dfb20a3103",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee828553-864a-49c9-a3b5-869c130d22c6",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "175389f5-db22-420a-8ff7-bb51898d7bed",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b880e0a1-ac57-424d-a309-dd7f41e387bf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391623000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c99ff43-dd36-452a-b63e-fe01ccefa863",
          "citation": "SRS import [0L6TPF5UXK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0L6TPF5UXK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391623000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0719bb42-5379-4f6a-a17e-349c86bfdc8c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c9ff59a3-e843-434d-9912-e24e0968682b",
          "id": "c9ff59a3-e843-434d-9912-e24e0968682b",
          "molfile": "\n  Marvin  01132110262D          \n\n  8  7  0  0  0  0            999 V2000\n   11.3114  -10.1705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7239  -10.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5489  -10.8850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3114  -11.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7239  -12.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5489  -12.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9614  -13.0284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9614  -11.5994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\nM  END",
          "smiles": "C(=C/C(=O)O)/C(=O)O",
          "formula": "C4H4O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "45c9fa2e-fe2a-41fd-a3ca-7fda252bfd28"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "116.0723",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a95d3ecf-1dd9-4573-b3d7-0143dc42066e",
          "id": "a95d3ecf-1dd9-4573-b3d7-0143dc42066e",
          "molfile": "\n  Marvin  01132108472D          \n\n 17 17  0  0  0  0            999 V2000\n   15.1581   -7.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4437   -6.6042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4437   -5.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7292   -7.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0147   -6.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3003   -7.0168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5858   -6.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5858   -5.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8713   -7.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8713   -7.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1568   -8.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1568   -9.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4424   -9.4917    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.3562  -10.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5492  -10.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1367   -9.7692    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6887   -9.1562    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 17 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CN(C)CCNC(=O)CCCCC1CCSS1",
          "formula": "C12H24N2OS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4b67cb2e-3b6e-49ae-87d2-3e290af5690f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "276.4644",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5d931948-f98c-43ef-8508-fc79d07145b6",
      "version": "3",
      "structure": {
        "id": "a8194078-4f61-4127-b1ec-6f38ee153af5",
        "molfile": "\n  Marvin  01132108442D          \n\n 25 24  0  0  0  0            999 V2000\n   11.7239  -10.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3114  -10.1705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5489  -10.8850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3114  -11.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7239  -12.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5489  -12.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9614  -13.0284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9614  -11.5994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5858   -6.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8713   -7.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8713   -7.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1568   -8.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1568   -9.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4424   -9.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6887   -9.1562    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1367   -9.7692    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5492  -10.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3562  -10.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3003   -7.0168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0147   -6.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7292   -7.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4437   -6.6042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1581   -7.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4437   -5.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5858   -5.7792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 18 17  1  0  0  0  0\n  9 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n  9 25  2  0  0  0  0\nM  END",
        "smiles": "CN(C)CCNC(=O)CCCCC1CCSS1.C(=C/C(=O)O)/C(=O)O",
        "formula": "C12H24N2OS2.C4H4O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "392.5367",
        "optical_activity": "( + / - )",
        "references": [
          "175389f5-db22-420a-8ff7-bb51898d7bed",
          "5c99ff43-dd36-452a-b63e-fe01ccefa863"
        ],
        "stereo_centers": 1
      },
      "unii": "0L6TPF5UXK"
    }
  ]
}