{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a0b6b932-8306-4075-b464-218a1cf82b4d",
          "code": "142-59-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=142-59-6",
          "code_system": "CAS",
          "references": [
            "cd697f93-45da-4767-9997-c49f63944b14",
            "03a0d0c4-4f27-4db0-82a2-52c7604a6ab6"
          ]
        },
        {
          "uuid": "b02b81e7-7845-4f6c-9b2e-ff52fb6bfa8f",
          "code": "C005270",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005270",
          "code_system": "MESH",
          "references": [
            "cd697f93-45da-4767-9997-c49f63944b14"
          ]
        },
        {
          "uuid": "d2cd6d6a-e707-4986-bdec-540e4abce14b",
          "code": "22124-95-4",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22124-95-4",
          "code_system": "CAS",
          "references": [
            "cd697f93-45da-4767-9997-c49f63944b14",
            "55cff94c-e6b1-40e3-b84c-25ef2b9c0280"
          ]
        },
        {
          "uuid": "7c27ae52-b7e5-4a52-be4d-93cae0835f95",
          "code": "14503",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3012",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "cd697f93-45da-4767-9997-c49f63944b14"
          ]
        },
        {
          "uuid": "93ad95f6-91a9-4958-8835-96bbf74c65e2",
          "code": "m7696",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7696?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cd697f93-45da-4767-9997-c49f63944b14"
          ]
        },
        {
          "uuid": "f7f538d7-a604-4878-a518-dc31675ffdbc",
          "code": "205-547-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.043",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cd697f93-45da-4767-9997-c49f63944b14"
          ]
        },
        {
          "uuid": "524a3bca-5d2d-b9e8-f48c-75672b199608",
          "code": "1170",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1170",
          "code_system": "HSDB",
          "references": [
            "161b83d3-cf20-616c-7023-ade37cd10598"
          ]
        },
        {
          "uuid": "d551848c-7e14-a63f-c936-8b222f531b14",
          "code": "DTXSID5020603",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5020603",
          "code_system": "EPA CompTox",
          "references": [
            "c3d12e73-eb7e-9a34-99ff-a55b05d41cfc"
          ]
        },
        {
          "uuid": "2cdef0ac-e15d-5cc2-451b-3fc6b33892db",
          "code": "21 CFR 176.300",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.300",
          "code_system": "CFR",
          "references": [
            "8b7f0de4-22a4-9480-18e6-644097f4528c"
          ]
        },
        {
          "uuid": "453e4052-1fae-de91-d4d7-f4a77a06bc6f",
          "code": "3032297",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3032297",
          "code_system": "PUBCHEM",
          "references": [
            "46085304-eb12-e641-c1e3-ed78f7f72a9d"
          ]
        },
        {
          "uuid": "10f304e5-1a10-4e7a-a60d-b4e52f311958",
          "code": "0L6N5662WT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "edbfc87f-20b2-eea1-3a24-002d1667fc8e",
          "code": "81934",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81934",
          "code_system": "CHEBI",
          "references": [
            "8b7f0de4-22a4-9480-18e6-644097f4528c"
          ]
        },
        {
          "uuid": "1cd8866e-eded-b954-542c-fca8a16f9c36",
          "code": "49511",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=49511",
          "code_system": "NSC",
          "references": [
            "fe6205d9-73cc-525e-a808-bef7eb17758b"
          ]
        },
        {
          "uuid": "6d163d6a-22b9-db68-868c-2219ca8e0836",
          "code": "147803",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=147803",
          "code_system": "NSC",
          "references": [
            "fe6205d9-73cc-525e-a808-bef7eb17758b"
          ]
        },
        {
          "uuid": "9b5cdadd-6ff9-06aa-e561-bba32e44e597",
          "code": "nabam",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/nabam.html",
          "code_system": "ALANWOOD",
          "references": [
            "e16f25ad-2ec3-2c2d-7f36-eee582a5822f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "98eb5c88-e674-4e31-85be-2b707238f268",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "0d6b94d0-9e55-4a89-a167-653992212fb5",
            "refuuid": "c01ce385-4f1a-408c-80b1-76f6930fc7a0",
            "name": "ETHYLENEBISDITHIOCARBAMIC ACID",
            "unii": "IO46B19O1Q",
            "linking_id": "IO46B19O1Q",
            "ref_pname": "ETHYLENEBISDITHIOCARBAMIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "449271d6-c090-4524-ae34-53db5082743e",
          "name": "CARBAMIC ACID, ETHYLENEBIS(DITHIO-, DISODIUM SALT",
          "stdName": "CARBAMIC ACID, ETHYLENEBIS(DITHIO-, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4345987c-bb08-47fe-ae08-05a6b16d50f6",
            "5f48dc7a-879b-4395-86d8-4d4760046aeb"
          ],
          "display_name": false
        },
        {
          "uuid": "75d613b1-b5c6-4b80-abc2-a93f66b66741",
          "name": "CARBAMODITHIOIC ACID, 1,2-ETHANEDIYLBIS-, DISODIUM SALT",
          "stdName": "CARBAMODITHIOIC ACID, 1,2-ETHANEDIYLBIS-, DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4345987c-bb08-47fe-ae08-05a6b16d50f6",
            "5f48dc7a-879b-4395-86d8-4d4760046aeb"
          ],
          "display_name": false
        },
        {
          "uuid": "e5c33aa1-d8c8-4065-9627-51782ab6f079",
          "name": "DISODIUM ETHYLENEBIS(DITHIOCARBAMATE)",
          "stdName": "DISODIUM ETHYLENEBIS(DITHIOCARBAMATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60625df2-6293-406c-bb52-20b1b4a9adb6",
            "06be7b87-887a-460d-958d-eb333787ce2f"
          ],
          "display_name": false
        },
        {
          "uuid": "5a0e02d5-1bd7-46d8-9642-e098f15c5e67",
          "name": "DISODIUM N,N'-1,2-ETHANEDIYLBIS(CARBAMODITHIOATE)",
          "stdName": "DISODIUM N,N'-1,2-ETHANEDIYLBIS(CARBAMODITHIOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60625df2-6293-406c-bb52-20b1b4a9adb6",
            "52d2ff1a-1c7e-48e5-bdf7-5663da414a7f"
          ],
          "display_name": false
        },
        {
          "uuid": "8735b416-eca3-4a98-a450-03f3e5937663",
          "name": "ETHYLENEBIS(DITHIOCARBAMATE) SODIUM",
          "stdName": "ETHYLENEBIS(DITHIOCARBAMATE) SODIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4345987c-bb08-47fe-ae08-05a6b16d50f6",
            "5f48dc7a-879b-4395-86d8-4d4760046aeb"
          ],
          "display_name": false
        },
        {
          "uuid": "b4b818a4-c017-4335-a8d9-a0b94e75b45a",
          "name": "NABAM",
          "stdName": "NABAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a674c3a0-2da9-4344-8f4d-a0db6a6e601c",
            "f7eb695f-9703-4b6d-a04e-9d4d76c8dcd7",
            "7b0e2365-4478-45d0-b527-20a33376878b",
            "1159ed25-0baf-4aeb-a745-3e8b5bf57ce3",
            "99569a26-f12c-4da5-8de1-c1c3f36c0b97",
            "4345987c-bb08-47fe-ae08-05a6b16d50f6",
            "6fd70491-60cb-4027-a392-9b608d2f37de",
            "5f48dc7a-879b-4395-86d8-4d4760046aeb",
            "ff299c73-8af7-449a-9a13-8a98fa335c57"
          ],
          "display_name": true
        },
        {
          "uuid": "22c3aad6-fc54-441e-9f39-b52f674fc41d",
          "name": "NABAM [HSDB]",
          "stdName": "NABAM [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99569a26-f12c-4da5-8de1-c1c3f36c0b97",
            "5f48dc7a-879b-4395-86d8-4d4760046aeb"
          ],
          "display_name": false
        },
        {
          "uuid": "e47e76a9-6ea6-4212-bec5-94e496bbf738",
          "name": "NABAM [ISO]",
          "stdName": "NABAM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f48dc7a-879b-4395-86d8-4d4760046aeb",
            "7b0e2365-4478-45d0-b527-20a33376878b"
          ],
          "display_name": false
        },
        {
          "uuid": "42e0b5dc-e8e0-48b6-b8b3-607ca49d1ffd",
          "name": "NABAM [MI]",
          "stdName": "NABAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f48dc7a-879b-4395-86d8-4d4760046aeb",
            "1159ed25-0baf-4aeb-a745-3e8b5bf57ce3"
          ],
          "display_name": false
        },
        {
          "uuid": "0c3db605-73fd-465c-bac8-841333ee09fb",
          "name": "NABAM-SODIUM",
          "stdName": "NABAM-SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f48dc7a-879b-4395-86d8-4d4760046aeb",
            "d3c293b1-930c-4601-b277-8273ba0491d1"
          ],
          "display_name": false
        },
        {
          "uuid": "fa275f31-b320-45cb-9dcc-925ef6d6ceac",
          "name": "NSC-147803",
          "stdName": "NSC-147803",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f48dc7a-879b-4395-86d8-4d4760046aeb",
            "c88c7c10-8fb7-45f0-afce-f49da80967ea"
          ],
          "display_name": false
        },
        {
          "uuid": "bd1cbb53-4ed6-4894-bfca-182ef82d7d24",
          "name": "NSC-49511",
          "stdName": "NSC-49511",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f48dc7a-879b-4395-86d8-4d4760046aeb",
            "c88c7c10-8fb7-45f0-afce-f49da80967ea"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4345987c-bb08-47fe-ae08-05a6b16d50f6",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a674c3a0-2da9-4344-8f4d-a0db6a6e601c",
          "citation": "MERCK",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f48dc7a-879b-4395-86d8-4d4760046aeb",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60625df2-6293-406c-bb52-20b1b4a9adb6",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06be7b87-887a-460d-958d-eb333787ce2f",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52d2ff1a-1c7e-48e5-bdf7-5663da414a7f",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1159ed25-0baf-4aeb-a745-3e8b5bf57ce3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99569a26-f12c-4da5-8de1-c1c3f36c0b97",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c88c7c10-8fb7-45f0-afce-f49da80967ea",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b0e2365-4478-45d0-b527-20a33376878b",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3c293b1-930c-4601-b277-8273ba0491d1",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd697f93-45da-4767-9997-c49f63944b14",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389645000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee7d1cc5-7971-4a48-a0c0-85a1adb9b2ff",
          "citation": "SRS import [0L6N5662WT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0L6N5662WT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389645000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7eb695f-9703-4b6d-a04e-9d4d76c8dcd7",
          "citation": "NABAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6fd70491-60cb-4027-a392-9b608d2f37de",
          "citation": "NABAM [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff299c73-8af7-449a-9a13-8a98fa335c57",
          "citation": "NABAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "161b83d3-cf20-616c-7023-ade37cd10598",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+142-59-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c3d12e73-eb7e-9a34-99ff-a55b05d41cfc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=142-59-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "46085304-eb12-e641-c1e3-ed78f7f72a9d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "03a0d0c4-4f27-4db0-82a2-52c7604a6ab6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "55cff94c-e6b1-40e3-b84c-25ef2b9c0280",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8b7f0de4-22a4-9480-18e6-644097f4528c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e16f25ad-2ec3-2c2d-7f36-eee582a5822f",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "fe6205d9-73cc-525e-a808-bef7eb17758b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "884cac03-6e2a-4de3-9c98-a3a6a1133761",
          "id": "884cac03-6e2a-4de3-9c98-a3a6a1133761",
          "molfile": "\n  Marvin  01132107042D          \n\n  1  0  0  0  0  0            999 V2000\n    1.0932   -3.5817    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "0f2681fc-76e1-4b80-9027-ce5690263968"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "3684f038-ae73-4f9e-ae27-8b47f12596e1",
          "id": "3684f038-ae73-4f9e-ae27-8b47f12596e1",
          "molfile": "\n  Marvin  01132102542D          \n\n 10  9  0  0  0  0            999 V2000\n    3.8905   -3.7800    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5906   -3.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5906   -2.5108    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3231   -3.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0558   -3.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7603   -3.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4883   -3.3507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2256   -3.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9255   -3.3507    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2256   -4.5919    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "C(CNC(=S)S)NC(=S)S",
          "formula": "C4H8N2S4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9815fe6e-fcd2-4051-8f4f-6a1c48033bbc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "212.3842",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5755f712-d892-496e-bb98-a82af9a0b2df",
      "version": "10",
      "structure": {
        "id": "0b095922-8fe6-4603-804c-3cce84f8fbad",
        "molfile": "\n  Marvin  01132100492D          \n\n 12  9  0  0  0  0            999 V2000\n    4.5906   -3.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8905   -3.7800    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    4.5906   -2.5108    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3231   -3.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0558   -3.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7603   -3.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4883   -3.3507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2256   -3.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9255   -3.3507    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    8.2256   -4.5919    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0932   -3.5817    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    1.0932   -3.5817    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n  2  1  1  0  0  0  0\nM  CHG  4   2  -1   9  -1  11   1  12   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  11  12\nM  SPA   1  1  11\nM  SDI   1  4    0.6732   -4.0017    0.6732   -3.1617\nM  SDI   1  4    1.5132   -3.1617    1.5132   -4.0017\nM  SMT   1 2\nM  END",
        "smiles": "C(CNC(=S)[S-])NC(=S)[S-].[Na+].[Na+]",
        "formula": "C4H6N2S4.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "256.3479",
        "optical_activity": "NONE",
        "references": [
          "4345987c-bb08-47fe-ae08-05a6b16d50f6",
          "ee7d1cc5-7971-4a48-a0c0-85a1adb9b2ff"
        ],
        "stereo_centers": 0
      },
      "unii": "0L6N5662WT"
    }
  ]
}